insulin aspart, insulin aspart protamine drug combination 30:70
(WEDIKSVWBUKTRA-WTKGVUNUSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H]2CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H]([C@H](CC)C)NC(=O)CN)CCC(=O)O)CCC(=O)N)C(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C(C)C)CC(C)C)Cc1ccc(cc1)O)CC(C)C)C)CCC(=O)O)C(C)C)CC(C)C)Cc1c[nH]cn1)CO)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1ccccc1)N)CC(=O)N)CCC(=O)N)Cc1c[nH]cn1)CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2)[C@H](CC)C)CO)[C@H](O)C)C(=O)N[C@H](C(=O)O)CC(=O)N)CCC(=O)O)CCCNC(=N)N)Cc1ccccc1)Cc1ccc(cc1)O)CC(=O)O
- Molecular Formula:
- C256H381N65O79S6
- Molecular Weight:
- 5825.540
- Log P:
- 4.6293
- Hydrogen Bond Acceptor:
- 148
- Hydrogen Bond Donor:
- 80
- TPSA:
- 2496.96
- CAS Number(s):
- 116094-23-6
Synonym(s)
1.
insulin aspart, insulin aspart protamine drug combination 30:70
2.
BIAsp 30
3.
BIAsp30
4.
NovoLog Mix 70:30
5.
NovoMix 30
6.
biphasic insulin aspart 30
7.
biphasic insulin aspart 30:70
8.
insulin aspart - insulin aspart protamine (30:70)
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 120 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 2 | Wrong technique in product usage process | FAERS: 99 | US FAERS | |
| 3 | Drug ineffective | FAERS: 43 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Product quality issue | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Infusion site pain | FAERS: 29 | US FAERS | |
| 6 | Blood glucose decreased | FAERS: 19 | US FAERS | |
| 7 | Liquid product physical issue | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Injection site pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Device malfunction | FAERS: 11 | US FAERS | |
| 10 | Circumstance or information capable of leading to medication error | FAERS: 10 | US FAERS | |
| 11 | Headache | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Blood glucose abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Diabetes mellitus inadequate control | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Diabetic Ketoacidosis | FAERS: 8 | US FAERS | |
| 15 | Infusion site erythema | FAERS: 8 | US FAERS | |
| 16 | Malaise | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Dizziness | FAERS: 7 | US FAERS | |
| 18 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 19 | Infusion site irritation | FAERS: 7 | US FAERS | |
| 20 | Product use issue | FAERS: 7 | US FAERS | |
| 21 | Blood glucose fluctuation | FAERS: 6 | US FAERS | |
| 22 | Fatigue | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Infusion site mass | FAERS: 6 | US FAERS | |
| 24 | Nausea | FAERS: 6 | US FAERS | |
| 25 | Device breakage | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 27 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 28 | Suicide attempt | FAERS: 5 | US FAERS | |
| 29 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Hypoaesthesia facial | FAERS: 4 | US FAERS | |
| 31 | Injection site erythema | FAERS: 4 | US FAERS | |
| 32 | Insulin Resistance | FAERS: 4 | US FAERS | |
| 33 | Palpitations | FAERS: 4 | US FAERS | |
| 34 | Urticaria | FAERS: 4 | US FAERS | |
| 35 | Drug effect variable | FAERS: 3 | US FAERS | |
| 36 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 37 | Formication | FAERS: 3 | US FAERS | |
| 38 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 39 | Incorrect dose administered by device | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Infusion site bruising | FAERS: 3 | US FAERS | |
| 41 | Infusion site swelling | FAERS: 3 | US FAERS | |
| 42 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 43 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 44 | Injection site mass | FAERS: 3 | US FAERS | |
| 45 | Ketoacidosis | FAERS: 3 | US FAERS | |
| 46 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 47 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 48 | Pneumonia | FAERS: 3 | US FAERS | |
| 49 | Skin reaction | FAERS: 3 | US FAERS | |
| 50 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 51 | Angioedema | FAERS: 2 | US FAERS | |
| 52 | Asthenia | FAERS: 2 | US FAERS | |
| 53 | Back Pain | FAERS: 2 | US FAERS | |
| 54 | Blindness | FAERS: 2 | US FAERS | |
| 55 | Burning sensation | FAERS: 2 | US FAERS | |
| 56 | Cataract | FAERS: 2 | US FAERS | |
| 57 | Catheter site abscess | FAERS: 2 | US FAERS | |
| 58 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 59 | Drug administration error | FAERS: 2 | US FAERS | |
| 60 | Epistaxis | FAERS: 2 | US FAERS | |
| 61 | Erythema | FAERS: 2 | US FAERS | |
| 62 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 63 | Flushing | FAERS: 2 | US FAERS | |
| 64 | Increased insulin requirement | FAERS: 2 | US FAERS | |
| 65 | Infusion site inflammation | FAERS: 2 | US FAERS | |
| 66 | Injection site bruising | FAERS: 2 | US FAERS | |
| 67 | Injection site infection | FAERS: 2 | US FAERS | |
| 68 | Injection site inflammation | FAERS: 2 | US FAERS | |
| 69 | Insulin autoimmune syndrome | FAERS: 2 | US FAERS | |
| 70 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 71 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 72 | Malabsorption from application site | FAERS: 2 | US FAERS | |
| 73 | Multiple use of single-use product | FAERS: 2 | US FAERS | |
| 74 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 75 | Pain | FAERS: 2 | US FAERS | |
| 76 | Product communication issue | FAERS: 2 | US FAERS | |
| 77 | Product storage error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Sepsis | FAERS: 2 | US FAERS | |
| 79 | Sinusitis | FAERS: 2 | US FAERS | |
| 80 | Sneezing | FAERS: 2 | US FAERS | |
| 81 | Swelling | FAERS: 2 | US FAERS | |
| 82 | Visual Impairment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 84 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 85 | Accidental overdose | FAERS: 1 | US FAERS | |
| 86 | Agitation | FAERS: 1 | US FAERS | |
| 87 | Alopecia | FAERS: 1 | US FAERS | |
| 88 | Anxiety | FAERS: 1 | US FAERS | |
| 89 | Aphasia | FAERS: 1 | US FAERS | |
| 90 | Apparent death | FAERS: 1 | US FAERS | |
| 91 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 92 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 93 | Blood ketone body | FAERS: 1 | US FAERS | |
| 94 | Blood ketone body increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 96 | Butterfly rash | FAERS: 1 | US FAERS | |
| 97 | Cataract operation | FAERS: 1 | US FAERS | |
| 98 | Catheter site pain | FAERS: 1 | US FAERS | |
| 99 | Chest discomfort | FAERS: 1 | US FAERS | |
| 100 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 101 | Cold sweat | FAERS: 1 | US FAERS | |
| 102 | Dawn phenomenon | FAERS: 1 | US FAERS | |
| 103 | Device Failure | FAERS: 1 | US FAERS | |
| 104 | Device defective | FAERS: 1 | US FAERS | |
| 105 | Device occlusion | FAERS: 1 | US FAERS | |
| 106 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 107 | Disability | FAERS: 1 | US FAERS | |
| 108 | Disease complication | FAERS: 1 | US FAERS | |
| 109 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 110 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 111 | Drug titration error | FAERS: 1 | US FAERS | |
| 112 | Dysarthria | FAERS: 1 | US FAERS | |
| 113 | Expired drug administered | FAERS: 1 | US FAERS | |
| 114 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 115 | Failure to suspend medication | FAERS: 1 | US FAERS | |
| 116 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 117 | Hernia | FAERS: 1 | US FAERS | |
| 118 | Hypersomnia | FAERS: 1 | US FAERS | |
| 119 | Hypophagia | FAERS: 1 | US FAERS | |
| 120 | Hypotension | FAERS: 1 | US FAERS | |
| 121 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 122 | Infection | FAERS: 1 | US FAERS | |
| 123 | Infusion site discomfort | FAERS: 1 | US FAERS | |
| 124 | Infusion site induration | FAERS: 1 | US FAERS | |
| 125 | Infusion site infection | FAERS: 1 | US FAERS | |
| 126 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 127 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 128 | Infusion site scar | FAERS: 1 | US FAERS | |
| 129 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 130 | Injection site irritation | FAERS: 1 | US FAERS | |
| 131 | Injection site nodule | FAERS: 1 | US FAERS | |
| 132 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 133 | Injury associated with device | FAERS: 1 | US FAERS | |
| 134 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 135 | Intentional product use issue | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 136 | Laceration | FAERS: 1 | US FAERS | |
| 137 | Lethargy | FAERS: 1 | US FAERS | |
| 138 | Local reaction | FAERS: 1 | US FAERS | |
| 139 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 140 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 141 | Memory impairment | FAERS: 1 | US FAERS | |
| 142 | Muscle strain | FAERS: 1 | US FAERS | |
| 143 | Muscle tightness | FAERS: 1 | US FAERS | |
| 144 | Neonatal respiratory distress | FAERS: 1 | US FAERS | |
| 145 | Nerve injury | FAERS: 1 | US FAERS | |
| 146 | Overdose | FAERS: 1 | US FAERS | |
| 147 | Pancreatitis | FAERS: 1 | US FAERS | |
| 148 | Periarthritis | FAERS: 1 | US FAERS | |
| 149 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 150 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 151 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 152 | Presyncope | FAERS: 1 | US FAERS | |
| 153 | Product contamination physical | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Product dose omission | FAERS: 1 | US FAERS | |
| 155 | Product label issue | FAERS: 1 | US FAERS | |
| 156 | Product preparation error | FAERS: 1 | US FAERS | |
| 157 | Product prescribing error | FAERS: 1 | US FAERS | |
| 158 | Pruritus | FAERS: 1 | US FAERS | |
| 159 | Psoriasis | FAERS: 1 | US FAERS | |
| 160 | Renal cyst | FAERS: 1 | US FAERS | |
| 161 | Skin irritation | FAERS: 1 | US FAERS | |
| 162 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 163 | Staring | FAERS: 1 | US FAERS | |
| 164 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 165 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 166 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 167 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 168 | Thrombosis | FAERS: 1 | US FAERS | |
| 169 | Tooth repair | FAERS: 1 | US FAERS | |
| 170 | Unevaluable event | FAERS: 1 | US FAERS | |
| 171 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 172 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 173 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 174 | Vertigo | FAERS: 1 | US FAERS | |
| 175 | Victim of homicide | FAERS: 1 | US FAERS | |
| 176 | furuncle | FAERS: 1 | US FAERS | |
| 177 | Angioplasty | Canada Vigilance: 1 | Canada Vigilance | |
| 178 | Chest Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 179 | Depressed Level of Consciousness | Canada Vigilance: 1 | Canada Vigilance | |
| 180 | Device leakage | Canada Vigilance: 1 | Canada Vigilance | |
| 181 | Therapeutic product effect decreased | Canada Vigilance: 4 | Canada Vigilance | |
| 182 | Tremor | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.