benazepril
(VPSRQEHTHIMDQM-FKLPMGAJSA-N)
Structure
- SMILES
- CCOC(=O)[C@@H](N[C@H]1CCc2c(N(C1=O)CC(=O)O)cccc2)CCc1ccccc1.Cl
- Molecular Formula:
- C24H29ClN2O5
- Molecular Weight:
- 460.950
- Log P:
- 3.8310
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 95.94
- CAS Number(s):
- 86541-74-4
Synonym(s)
1.
benazepril
2.
Briem
3.
CGS-14824-A
4.
CGS-14824A
5.
Cibacen
6.
Cibacène
7.
Labopal
8.
Lotensin
9.
benazapril
10.
benazepril hydrochloride
11.
benzazepril
External Link(s)
| MeSH | C044946 |
| PubChem Compound | 67107870 5362123 |
| ChEBI | 3012 |
| CHEMBL | CHEMBL1694 |
| KEGG | cpd:C07701 dr:D00620 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Angioedema | FAERS: 25 | US FAERS | |
| 3 | Dizziness | FAERS: 23 | US FAERS | |
| 4 | Pharmaceutical product complaint | FAERS: 21 | US FAERS | |
| 5 | Palpitations | FAERS: 18 | US FAERS | |
| 6 | Headache | FAERS: 16 | US FAERS | |
| 7 | Product substitution issue | FAERS: 12 | US FAERS | |
| 8 | Pruritus | FAERS: 12 | US FAERS | |
| 9 | Fatigue | FAERS: 11 | US FAERS | |
| 10 | Hypotension | FAERS: 11 | US FAERS | |
| 11 | Nausea | FAERS: 11 | US FAERS | |
| 12 | Blood pressure inadequately controlled | FAERS: 10 | US FAERS | |
| 13 | Vomiting | FAERS: 8 | US FAERS | |
| 14 | Chest discomfort | FAERS: 7 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 16 | Malaise | FAERS: 7 | US FAERS | |
| 17 | Product quality issue | FAERS: 7 | US FAERS | |
| 18 | Urticaria | FAERS: 7 | US FAERS | |
| 19 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 21 | Chest Pain | FAERS: 6 | US FAERS | |
| 22 | Lip swelling | FAERS: 6 | US FAERS | |
| 23 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 24 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 25 | Constipation | FAERS: 5 | US FAERS | |
| 26 | Flatulence | FAERS: 5 | US FAERS | |
| 27 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 28 | Swelling | FAERS: 5 | US FAERS | |
| 29 | Anxiety | FAERS: 4 | US FAERS | |
| 30 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 31 | Burning sensation | FAERS: 4 | US FAERS | |
| 32 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 33 | Syncope | FAERS: 4 | US FAERS | |
| 34 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 35 | Asthenia | FAERS: 3 | US FAERS | |
| 36 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 37 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 38 | Bronchitis | FAERS: 3 | US FAERS | |
| 39 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 40 | Cold sweat | FAERS: 3 | US FAERS | |
| 41 | Erythema | FAERS: 3 | US FAERS | |
| 42 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 43 | Hepatitis | FAERS: 3 | US FAERS | |
| 44 | Inflammation | FAERS: 3 | US FAERS | |
| 45 | Pain | FAERS: 3 | US FAERS | |
| 46 | Presyncope | FAERS: 3 | US FAERS | |
| 47 | Productive Cough | FAERS: 3 | US FAERS | |
| 48 | Small bowel angioedema | FAERS: 3 | US FAERS | |
| 49 | Wheezing | FAERS: 3 | US FAERS | |
| 50 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 51 | Amputation | FAERS: 2 | US FAERS | |
| 52 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 53 | Anorexia | FAERS: 2 | US FAERS | |
| 54 | Aphasia | FAERS: 2 | US FAERS | |
| 55 | Arthralgia | FAERS: 2 | US FAERS | |
| 56 | Asthma | FAERS: 2 | US FAERS | |
| 57 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 58 | Back Pain | FAERS: 2 | US FAERS | |
| 59 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 60 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 61 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 62 | Cataract operation | FAERS: 2 | US FAERS | |
| 63 | Cataract | FAERS: 2 | US FAERS | |
| 64 | Cyanosis | FAERS: 2 | US FAERS | |
| 65 | Dysphonia | FAERS: 2 | US FAERS | |
| 66 | Flushing | FAERS: 2 | US FAERS | |
| 67 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 68 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 69 | Leukopenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 71 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 72 | Neonatal anuria | FAERS: 2 | US FAERS | |
| 73 | Neonatal respiratory failure | FAERS: 2 | US FAERS | |
| 74 | Nervousness | FAERS: 2 | US FAERS | |
| 75 | Oliguria | FAERS: 2 | US FAERS | |
| 76 | Pancreatitis | FAERS: 2 | US FAERS | |
| 77 | Performance status decreased | FAERS: 2 | US FAERS | |
| 78 | Renal pain | FAERS: 2 | US FAERS | |
| 79 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 80 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 81 | Skin lesion | FAERS: 2 | US FAERS | |
| 82 | Tachycardia | FAERS: 2 | US FAERS | |
| 83 | Throat irritation | FAERS: 2 | US FAERS | |
| 84 | Unevaluable event | FAERS: 2 | US FAERS | |
| 85 | Visual Impairment | FAERS: 2 | US FAERS | |
| 86 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 87 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 88 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 89 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 90 | Agitation | FAERS: 1 | US FAERS | |
| 91 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 92 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 93 | Arthritis | FAERS: 1 | US FAERS | |
| 94 | Asphyxia | FAERS: 1 | US FAERS | |
| 95 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 96 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 97 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 98 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 99 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 100 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 101 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 102 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 103 | Blood urea increased | FAERS: 1 | US FAERS | |
| 104 | Bone pain | FAERS: 1 | US FAERS | |
| 105 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 106 | Candidiasis | FAERS: 1 | US FAERS | |
| 107 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 108 | Choking | FAERS: 1 | US FAERS | |
| 109 | Cholangiolitis | FAERS: 1 | US FAERS | |
| 110 | Cholecystitis | FAERS: 1 | US FAERS | |
| 111 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 112 | Chromaturia | FAERS: 1 | US FAERS | |
| 113 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 114 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 115 | Crying | FAERS: 1 | US FAERS | |
| 116 | Deafness | FAERS: 1 | US FAERS | |
| 117 | Dehydration | FAERS: 1 | US FAERS | |
| 118 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 119 | Depressed mood | FAERS: 1 | US FAERS | |
| 120 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 121 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 122 | Discomfort | FAERS: 1 | US FAERS | |
| 123 | Disorientation | FAERS: 1 | US FAERS | |
| 124 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 125 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 126 | Drug resistance | FAERS: 1 | US FAERS | |
| 127 | Dry skin | FAERS: 1 | US FAERS | |
| 128 | Dysarthria | FAERS: 1 | US FAERS | |
| 129 | Dyspepsia | FAERS: 1 | US FAERS | |
| 130 | Dysuria | FAERS: 1 | US FAERS | |
| 131 | Economic problem | FAERS: 1 | US FAERS | |
| 132 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 133 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 134 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 135 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 136 | Fracture | FAERS: 1 | US FAERS | |
| 137 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 138 | Gastritis | FAERS: 1 | US FAERS | |
| 139 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 140 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 141 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 142 | Head discomfort | FAERS: 1 | US FAERS | |
| 143 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 144 | Hyperplasia | FAERS: 1 | US FAERS | |
| 145 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 146 | Hypotensive Transfusion Reaction | FAERS: 1 | US FAERS | |
| 147 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 148 | Impaired work ability | FAERS: 1 | US FAERS | |
| 149 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 150 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 151 | Intubation complication | FAERS: 1 | US FAERS | |
| 152 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 153 | Joint vibration | FAERS: 1 | US FAERS | |
| 154 | Jugular vein occlusion | FAERS: 1 | US FAERS | |
| 155 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 156 | Laryngitis | FAERS: 1 | US FAERS | |
| 157 | Laryngospasm | FAERS: 1 | US FAERS | |
| 158 | Lethargy | FAERS: 1 | US FAERS | |
| 159 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 160 | Medication Error | FAERS: 1 | US FAERS | |
| 161 | Medication residue | FAERS: 1 | US FAERS | |
| 162 | Memory impairment | FAERS: 1 | US FAERS | |
| 163 | Mental impairment | FAERS: 1 | US FAERS | |
| 164 | Middle insomnia | FAERS: 1 | US FAERS | |
| 165 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 166 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 167 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 168 | Neck Pain | FAERS: 1 | US FAERS | |
| 169 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 170 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 171 | No adverse event | FAERS: 1 | US FAERS | |
| 172 | Nocturia | FAERS: 1 | US FAERS | |
| 173 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 174 | Osteoporosis | FAERS: 1 | US FAERS | |
| 175 | Pallor | FAERS: 1 | US FAERS | |
| 176 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 177 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 178 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 179 | Pneumonia | FAERS: 1 | US FAERS | |
| 180 | Post procedural complication | FAERS: 1 | US FAERS | |
| 181 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 182 | Protein total decreased | FAERS: 1 | US FAERS | |
| 183 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 184 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 185 | Purpura | FAERS: 1 | US FAERS | |
| 186 | Rales | FAERS: 1 | US FAERS | |
| 187 | Rash erythematous | FAERS: 1 | US FAERS | |
| 188 | Regurgitation | FAERS: 1 | US FAERS | |
| 189 | Renal Colic | FAERS: 1 | US FAERS | |
| 190 | Retching | FAERS: 1 | US FAERS | |
| 191 | Rhinalgia | FAERS: 1 | US FAERS | |
| 192 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 193 | Rubella | FAERS: 1 | US FAERS | |
| 194 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 195 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 196 | Somnolence | FAERS: 1 | US FAERS | |
| 197 | Stridor | FAERS: 1 | US FAERS | |
| 198 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 199 | Thirst | FAERS: 1 | US FAERS | |
| 200 | Thrombosis | FAERS: 1 | US FAERS | |
| 201 | Tinnitus | FAERS: 1 | US FAERS | |
| 202 | Troponin increased | FAERS: 1 | US FAERS | |
| 203 | Upper airway resistance syndrome | FAERS: 1 | US FAERS | |
| 204 | Vertigo | FAERS: 1 | US FAERS | |
| 205 | Weight decreased | FAERS: 1 | US FAERS | |
| 206 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 207 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 208 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 209 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 210 | Amnesia | Canada Vigilance: 1 | Canada Vigilance | |
| 211 | Tremor | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.