Cefuroxime
(URDOHUPGIOGTKV-JTBFTWTJSA-M)
Structure
- SMILES
- CO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)[O-])COC(=O)N)/c1ccco1.[Na+]
- Molecular Formula:
- C16H15N4NaO8S
- Molecular Weight:
- 446.367
- Log P:
- -0.8416
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 2
- TPSA:
- 201.89
- CAS Number(s):
- 56238-63-2; 90013-55-1
Synonym(s)
1.
Cefuroxime
2.
Cephuroxime
3.
Ketocef
4.
Zinacef
External Link(s)
| MeSH | D002444 |
| PubChem Compound | 23670318 101675044 |
| ChEBI | 3517 |
| CHEMBL | CHEMBL2146124 |
| KEGG | cpd:C08108 dr:D00915 |
| Therapeutic Target Database | D0Y2IE |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anaphylactic shock | FAERS: 55 | US FAERS | |
| 2 | Hypersensitivity | FAERS: 35 | US FAERS | |
| 3 | Cardiac Arrest | FAERS: 25 | US FAERS | |
| 4 | Pharmaceutical product complaint | FAERS: 25 | US FAERS | |
| 5 | Corneal Opacity | FAERS: 23 | US FAERS | |
| 6 | Chills | FAERS: 22 | US FAERS | |
| 7 | Chest discomfort | FAERS: 20 | US FAERS | |
| 8 | Vomiting | FAERS: 20 | US FAERS | |
| 9 | Pruritus | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Hypotension | FAERS: 17 | US FAERS | |
| 11 | Bronchospasm | FAERS: 14 | US FAERS | |
| 12 | Syncope | FAERS: 14 | US FAERS | |
| 13 | Urticaria | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Product quality issue | FAERS: 13 | US FAERS | |
| 15 | Anaphylactoid Reaction | FAERS: 12 | US FAERS | |
| 16 | Erythema | FAERS: 12 | US FAERS | |
| 17 | Incorrect route of drug administration | FAERS: 12 | US FAERS | |
| 18 | Dizziness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Visual disturbance | FAERS: 11 | US FAERS | |
| 20 | Nausea | FAERS: 10 | US FAERS | |
| 21 | Pallor | FAERS: 10 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Cyanosis | FAERS: 8 | US FAERS | |
| 24 | Flushing | FAERS: 8 | US FAERS | |
| 25 | Asthenia | FAERS: 7 | US FAERS | |
| 26 | Tachycardia | FAERS: 7 | US FAERS | |
| 27 | Tremor | FAERS: 7 | US FAERS | |
| 28 | Accidental overdose | FAERS: 6 | US FAERS | |
| 29 | Brain Hypoxia | FAERS: 6 | US FAERS | |
| 30 | Chest Pain | FAERS: 6 | US FAERS | |
| 31 | Eye inflammation | FAERS: 6 | US FAERS | |
| 32 | Headache | FAERS: 6 | US FAERS | |
| 33 | Kounis Syndrome | FAERS: 6 | US FAERS | |
| 34 | Rash erythematous | FAERS: 6 | US FAERS | |
| 35 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 36 | Retinal Detachment | FAERS: 6 | US FAERS | |
| 37 | Throat irritation | FAERS: 6 | US FAERS | |
| 38 | Visual Impairment | FAERS: 6 | US FAERS | |
| 39 | Anxiety | FAERS: 5 | US FAERS | |
| 40 | Back Pain | FAERS: 5 | US FAERS | |
| 41 | Chromaturia | FAERS: 5 | US FAERS | |
| 42 | Fatigue | FAERS: 5 | US FAERS | |
| 43 | Influenza | FAERS: 5 | US FAERS | |
| 44 | Oropharyngeal discomfort | FAERS: 5 | US FAERS | |
| 45 | Stevens-Johnson Syndrome | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 47 | Aphasia | FAERS: 4 | US FAERS | |
| 48 | Arthralgia | FAERS: 4 | US FAERS | |
| 49 | Choking | FAERS: 4 | US FAERS | |
| 50 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 51 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 52 | Maternal exposure timing unspecified | FAERS: 4 | US FAERS | |
| 53 | Myalgia | FAERS: 4 | US FAERS | |
| 54 | Shock | FAERS: 4 | US FAERS | |
| 55 | Amaurosis | FAERS: 3 | US FAERS | |
| 56 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 57 | Device related infection | FAERS: 3 | US FAERS | |
| 58 | Disorientation | FAERS: 3 | US FAERS | |
| 59 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 60 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 61 | Leukocytosis | FAERS: 3 | US FAERS | |
| 62 | Medication Error | FAERS: 3 | US FAERS | |
| 63 | Optic Atrophy | FAERS: 3 | US FAERS | |
| 64 | Retinal infarction | FAERS: 3 | US FAERS | |
| 65 | Skin lesion | FAERS: 3 | US FAERS | |
| 66 | Accidental exposure | FAERS: 2 | US FAERS | |
| 67 | Agitation | FAERS: 2 | US FAERS | |
| 68 | Alcohol Intolerance | FAERS: 2 | US FAERS | |
| 69 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 70 | Cold sweat | FAERS: 2 | US FAERS | |
| 71 | Endophthalmitis | FAERS: 2 | US FAERS | |
| 72 | Extravasation | FAERS: 2 | US FAERS | |
| 73 | Eye Infection | FAERS: 2 | US FAERS | |
| 74 | Laryngospasm | FAERS: 2 | US FAERS | |
| 75 | Laryngotracheitis | FAERS: 2 | US FAERS | |
| 76 | Meningitis | FAERS: 2 | US FAERS | |
| 77 | Neutropenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Overdose | FAERS: 2 | US FAERS | |
| 79 | Pneumonitis | FAERS: 2 | US FAERS | |
| 80 | Poisoning | FAERS: 2 | US FAERS | |
| 81 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 82 | Restlessness | FAERS: 2 | US FAERS | |
| 83 | Retinal toxicity | FAERS: 2 | US FAERS | |
| 84 | Stridor | FAERS: 2 | US FAERS | |
| 85 | Sudden death | FAERS: 2 | US FAERS | |
| 86 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 87 | Urinary sediment present | FAERS: 2 | US FAERS | |
| 88 | Vertigo | FAERS: 2 | US FAERS | |
| 89 | Vitritis | FAERS: 2 | US FAERS | |
| 90 | Wheezing | FAERS: 2 | US FAERS | |
| 91 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 92 | nervous system disorder | FAERS: 2 | US FAERS | |
| 93 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 94 | Acanthosis | FAERS: 1 | US FAERS | |
| 95 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 96 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 97 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 98 | Airway peak pressure increased | FAERS: 1 | US FAERS | |
| 99 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 100 | Angioedema | FAERS: 1 | US FAERS | |
| 101 | Anuria | FAERS: 1 | US FAERS | |
| 102 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 103 | Asthma | FAERS: 1 | US FAERS | |
| 104 | Blindness | FAERS: 1 | US FAERS | |
| 105 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 106 | Blood urine present | FAERS: 1 | US FAERS | |
| 107 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 108 | Bradycardia | FAERS: 1 | US FAERS | |
| 109 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 110 | Burning sensation | FAERS: 1 | US FAERS | |
| 111 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 112 | Cataract | FAERS: 1 | US FAERS | |
| 113 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 114 | Cholangitis | FAERS: 1 | US FAERS | |
| 115 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 116 | Cholestasis | FAERS: 1 | US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 118 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 119 | Colitis | FAERS: 1 | US FAERS | |
| 120 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 121 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 122 | Corneal defect | FAERS: 1 | US FAERS | |
| 123 | Deafness | FAERS: 1 | US FAERS | |
| 124 | Discomfort | FAERS: 1 | US FAERS | |
| 125 | Drug ineffective | FAERS: 1 | US FAERS | |
| 126 | Dysgeusia | FAERS: 1 | US FAERS | |
| 127 | Dysphonia | FAERS: 1 | US FAERS | |
| 128 | Endocarditis | FAERS: 1 | US FAERS | |
| 129 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 130 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 131 | Eosinophilia | FAERS: 1 | US FAERS | |
| 132 | Epistaxis | FAERS: 1 | US FAERS | |
| 133 | Feeling Cold | FAERS: 1 | US FAERS | |
| 134 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 135 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 136 | Gaze palsy | FAERS: 1 | US FAERS | |
| 137 | Granuloma | FAERS: 1 | US FAERS | |
| 138 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 139 | Hoarseness | FAERS: 1 | US FAERS | |
| 140 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 141 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 142 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 143 | Implant site infection | FAERS: 1 | US FAERS | |
| 144 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 145 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 146 | Infection | FAERS: 1 | US FAERS | |
| 147 | Infusion site pain | FAERS: 1 | US FAERS | |
| 148 | Leukopenia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Lip swelling | FAERS: 1 | US FAERS | |
| 150 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 151 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 152 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 153 | Malaise | FAERS: 1 | US FAERS | |
| 154 | Mastoiditis | FAERS: 1 | US FAERS | |
| 155 | Mental status changes | FAERS: 1 | US FAERS | |
| 156 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 157 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 158 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 159 | Pain | FAERS: 1 | US FAERS | |
| 160 | Palmar erythema | FAERS: 1 | US FAERS | |
| 161 | Palpitations | FAERS: 1 | US FAERS | |
| 162 | Pancreatitis | FAERS: 1 | US FAERS | |
| 163 | Pancytopenia | FAERS: 1 | US FAERS | |
| 164 | Pemphigus | FAERS: 1 | US FAERS | |
| 165 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 166 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 167 | Piloerection | FAERS: 1 | US FAERS | |
| 168 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 169 | Procedural complication | FAERS: 1 | US FAERS | |
| 170 | Product label issue | FAERS: 1 | US FAERS | |
| 171 | Productive Cough | FAERS: 1 | US FAERS | |
| 172 | Prolonged expiration | FAERS: 1 | US FAERS | |
| 173 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 174 | Psoriasis | FAERS: 1 | US FAERS | |
| 175 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 176 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 177 | Rales | FAERS: 1 | US FAERS | |
| 178 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 179 | Renal pain | FAERS: 1 | US FAERS | |
| 180 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 181 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 182 | Retinal Vasculitis | FAERS: 1 | US FAERS | |
| 183 | Retinal pigmentation | FAERS: 1 | US FAERS | |
| 184 | Sense of oppression | FAERS: 1 | US FAERS | |
| 185 | Skin Erosion | FAERS: 1 | US FAERS | |
| 186 | Skin irritation | FAERS: 1 | US FAERS | |
| 187 | Skin test positive | FAERS: 1 | US FAERS | |
| 188 | Sneezing | FAERS: 1 | US FAERS | |
| 189 | Somnolence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Splenomegaly | FAERS: 1 | US FAERS | |
| 191 | Staring | FAERS: 1 | US FAERS | |
| 192 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 193 | Transmission of an infectious agent via a medicinal product | FAERS: 1 | US FAERS | |
| 194 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 195 | Urinary Retention | FAERS: 1 | US FAERS | |
| 196 | Vasculitis | FAERS: 1 | US FAERS | |
| 197 | Vitreal cells | FAERS: 1 | US FAERS | |
| 198 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 199 | Weight decreased | FAERS: 1 | US FAERS | |
| 200 | Wheelchair user | FAERS: 1 | US FAERS | |
| 201 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 202 | pseudomembranous colitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Diplopia | Canada Vigilance: 1 | Canada Vigilance | |
| 204 | Erythema Multiforme | Canada Vigilance: 1 | Canada Vigilance | |
| 205 | Lymphadenopathy | Canada Vigilance: 1 | Canada Vigilance | |
| 206 | Thrombocytopenia | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.