eribulin
(UFNVPOGXISZXJD-JBQZKEIOSA-N)
Structure
- SMILES
- NC[C@H](C[C@H]1O[C@@H]2[C@@H]([C@H]1OC)CC(=O)C[C@H]1CC[C@H]3[C@H](O1)[C@@H]1O[C@]4(CC[C@@H]5O[C@@H](CC[C@@H]6O[C@H](C2)C(=C)[C@@H](C6)C)C(=C)C5)O[C@@H]2[C@H](O3)[C@H]1O[C@@H]2C4)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX41
- Molecular Formula:
- C40H59NO11
- Molecular Weight:
- 729.897
- Log P:
- 4.1383
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 2
- TPSA:
- 146.39
- CAS Number(s):
- 253128-41-5
Synonym(s)
1.
eribulin
2.
B 1793
3.
B 1939
4.
B-1793
5.
B-1939
6.
E 7389
7.
E-7389
8.
ER 086526
9.
ER-086526
10.
ER-86526
11.
ER086526
12.
Halaven
13.
NSC 707389
14.
NSC-707389
15.
NSC707389
16.
eribulin (as mesylate)
17.
eribulin mesilate
18.
eribulin mesylate
19.
eribulin monomethanesulfonate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 25 | SIDER US FAERS | |
| 2 | Febrile Neutropenia | FAERS: 18 | SIDER US FAERS | |
| 3 | Malignant neoplasm progression | FAERS: 10 | US FAERS | |
| 4 | Pulmonary Embolism | FAERS: 6 | SIDER US FAERS | |
| 5 | Thrombocytopenia | FAERS: 6 | SIDER US FAERS | |
| 6 | Fatigue | FAERS: 5 | SIDER US FAERS | |
| 7 | Dizziness | FAERS: 4 | SIDER US FAERS | |
| 8 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 9 | Stomatitis | FAERS: 4 | SIDER US FAERS | |
| 10 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 11 | Asthenia | FAERS: 3 | SIDER US FAERS | |
| 12 | Bone pain | FAERS: 3 | SIDER US FAERS | |
| 13 | Cystitis | FAERS: 3 | US FAERS | |
| 14 | Embolism | FAERS: 3 | US FAERS | |
| 15 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 16 | Leukopenia | FAERS: 3 | SIDER US FAERS | |
| 17 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 18 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 19 | Abdominal Pain | FAERS: 2 | SIDER US FAERS | |
| 20 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 21 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 23 | Constipation | FAERS: 2 | SIDER US FAERS | |
| 24 | Dehydration | FAERS: 2 | SIDER US FAERS | |
| 25 | Disease Progression | FAERS: 2 | US FAERS | |
| 26 | Dysuria | FAERS: 2 | SIDER US FAERS | |
| 27 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 28 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 29 | Headache | FAERS: 2 | SIDER US FAERS | |
| 30 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 31 | Infusion Site Extravasation | FAERS: 2 | US FAERS | |
| 32 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 33 | Oral candidiasis | FAERS: 2 | SIDER US FAERS | |
| 34 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 35 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 36 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 37 | Radiation proctitis | FAERS: 2 | US FAERS | |
| 38 | Sepsis | FAERS: 2 | SIDER US FAERS | |
| 39 | Syncope | FAERS: 2 | US FAERS | |
| 40 | Tachycardia | FAERS: 2 | SIDER US FAERS | |
| 41 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 42 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 43 | Agitation | FAERS: 1 | US FAERS | |
| 44 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 45 | Alopecia | FAERS: 1 | SIDER US FAERS | |
| 46 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 47 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 48 | Back Pain | FAERS: 1 | SIDER US FAERS | |
| 49 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 50 | Cellulitis | FAERS: 1 | US FAERS | |
| 51 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 52 | Chest discomfort | FAERS: 1 | US FAERS | |
| 53 | Corynebacterium test positive | FAERS: 1 | US FAERS | |
| 54 | Culture urine positive | FAERS: 1 | US FAERS | |
| 55 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 56 | Deep Vein Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 57 | Device related infection | FAERS: 1 | US FAERS | |
| 58 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 59 | Disorientation | FAERS: 1 | US FAERS | |
| 60 | Dysgeusia | FAERS: 1 | SIDER US FAERS | |
| 61 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 62 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 63 | Feeling Cold | FAERS: 1 | US FAERS | |
| 64 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 65 | Flank Pain | FAERS: 1 | US FAERS | |
| 66 | Gastritis | FAERS: 1 | US FAERS | |
| 67 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 68 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 69 | Hypotension | FAERS: 1 | US FAERS | |
| 70 | Hypoxia | FAERS: 1 | US FAERS | |
| 71 | Incision site complication | FAERS: 1 | US FAERS | |
| 72 | Incoherent | FAERS: 1 | US FAERS | |
| 73 | Infection | FAERS: 1 | SIDER US FAERS | |
| 74 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 75 | Laryngitis | FAERS: 1 | US FAERS | |
| 76 | Malaise | FAERS: 1 | US FAERS | |
| 77 | Mental status changes | FAERS: 1 | US FAERS | |
| 78 | Myalgia | FAERS: 1 | SIDER US FAERS | |
| 79 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 80 | Nausea | FAERS: 1 | SIDER US FAERS | |
| 81 | Neck Pain | FAERS: 1 | US FAERS | |
| 82 | Necrosis | FAERS: 1 | US FAERS | |
| 83 | Neuralgia | FAERS: 1 | US FAERS | |
| 84 | Neutropenic sepsis | FAERS: 1 | SIDER US FAERS | |
| 85 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 86 | Pain | FAERS: 1 | SIDER US FAERS | |
| 87 | Pathological fracture | FAERS: 1 | US FAERS | |
| 88 | Pelvic mass | FAERS: 1 | US FAERS | |
| 89 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 90 | Pneumonitis | FAERS: 1 | US FAERS | |
| 91 | Polyneuropathy | FAERS: 1 | SIDER US FAERS | |
| 92 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 93 | Presyncope | FAERS: 1 | US FAERS | |
| 94 | Pseudomeningocele | FAERS: 1 | US FAERS | |
| 95 | Purulence | FAERS: 1 | US FAERS | |
| 96 | Septic Shock | FAERS: 1 | US FAERS | |
| 97 | Skin toxicity | FAERS: 1 | US FAERS | |
| 98 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 99 | Superinfection | FAERS: 1 | US FAERS | |
| 100 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 101 | Thrombosis | FAERS: 1 | US FAERS | |
| 102 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 103 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 104 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 105 | Anorexia | SIDER | ||
| 106 | Aspartate Aminotransferase Increased | SIDER | ||
| 107 | Blood and lymphatic system disorders | SIDER | ||
| 108 | Chest Pain | SIDER | ||
| 109 | Chills | SIDER | ||
| 110 | Conjunctivitis | SIDER | ||
| 111 | Cytopenia | SIDER | ||
| 112 | Dermatitis | SIDER | ||
| 113 | Disseminated Intravascular Coagulation | SIDER | ||
| 114 | Dry skin | SIDER | ||
| 115 | Dyspepsia | SIDER | ||
| 116 | Ear and labyrinth disorders | SIDER | ||
| 117 | Epistaxis | SIDER | ||
| 118 | Erythema | SIDER | ||
| 119 | Hepatic cancer metastatic | SIDER | ||
| 120 | Hepatotoxicity | SIDER | ||
| 121 | Infestation | SIDER | ||
| 122 | Lethargy | SIDER | ||
| 123 | Lymphopenia | SIDER | ||
| 124 | Malnutrition | SIDER | ||
| 125 | Musculoskeletal Pain | SIDER | ||
| 126 | Musculoskeletal chest pain | SIDER | ||
| 127 | Musculoskeletal discomfort | SIDER | ||
| 128 | Nasopharyngitis | SIDER | ||
| 129 | Neuritis | SIDER | ||
| 130 | Night sweats | SIDER | ||
| 131 | Oropharyngeal pain | SIDER | ||
| 132 | Pancreatitis | SIDER | ||
| 133 | Peripheral motor neuropathy | SIDER | ||
| 134 | Protein urine present | SIDER | ||
| 135 | Proteinuria | SIDER | ||
| 136 | Pruritus | SIDER | ||
| 137 | Rhinitis | SIDER | ||
| 138 | Tinnitus | SIDER | ||
| 139 | Weight decreased | SIDER | ||
| 140 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.