Buprenorphine, Naloxone Drug Combination
(SFNLWIKOKQVFPB-KZCPYJDTSA-N)
Structure
- SMILES
- CO[C@]12CC[C@]3(C[C@@H]1[C@@](C(C)(C)C)(O)C)[C@@]14[C@H]2Oc2c4c(C[C@H]3N(CC1)CC1CC1)ccc2O.C=CCN1CC[C@@]23[C@@]4([C@H]1Cc1c3c(O[C@H]2C(=O)CC4)c(cc1)O)O
- Molecular Formula:
- C48H62N2O8
- Molecular Weight:
- 795.014
- Log P:
- 5.5910
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 132.16
- CAS Number(s):
- 352020-56-5
Synonym(s)
1.
Buprenorphine, Naloxone Drug Combination
2.
Buprenorphine Naloxone
3.
Buprenorphine Naloxone Drug Combination
4.
Buprenorphine-Naloxone
5.
Buprenorphine-Naloxone Combination
6.
Buprenorphine-Naloxone Drug Combination
7.
Suboxone
8.
Buprenorphine Naloxone Combination
9.
Combination, Buprenorphine-Naloxone
10.
Combination, Buprenorphine-Naloxone Drug
11.
Drug Combination, Buprenorphine-Naloxone
12.
Naloxone, Buprenorphine
External Link(s)
| MeSH | D000069479 |
| PubChem Compound | 11274356 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 90 | US FAERS | |
| 2 | Drug ineffective | FAERS: 67 | US FAERS | |
| 3 | Vomiting | FAERS: 60 | US FAERS | |
| 4 | Headache | FAERS: 56 | US FAERS | |
| 5 | Drug withdrawal syndrome | FAERS: 43 | US FAERS | |
| 6 | Product substitution issue | FAERS: 43 | US FAERS | |
| 7 | Malaise | FAERS: 36 | US FAERS | |
| 8 | Product adhesion issue | FAERS: 33 | US FAERS | |
| 9 | Wrong technique in product usage process | FAERS: 29 | US FAERS | |
| 10 | Drug Dependence | FAERS: 27 | US FAERS | |
| 11 | Product solubility abnormal | FAERS: 26 | US FAERS | |
| 12 | Oral administration complication | FAERS: 22 | US FAERS | |
| 13 | Pain | FAERS: 21 | US FAERS | |
| 14 | Drug effect incomplete | FAERS: 20 | US FAERS | |
| 15 | Product physical consistency issue | FAERS: 20 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 19 | US FAERS | |
| 17 | Tremor | FAERS: 18 | US FAERS | |
| 18 | Anxiety | FAERS: 17 | US FAERS | |
| 19 | Dizziness | FAERS: 17 | US FAERS | |
| 20 | Product quality issue | FAERS: 17 | US FAERS | |
| 21 | Asthenia | FAERS: 16 | US FAERS | |
| 22 | Constipation | FAERS: 13 | US FAERS | |
| 23 | Fatigue | FAERS: 13 | US FAERS | |
| 24 | Stomatitis | FAERS: 13 | US FAERS | |
| 25 | Accidental exposure to product by child | FAERS: 10 | US FAERS | |
| 26 | Intentional product use issue | FAERS: 10 | US FAERS | |
| 27 | Product distribution issue | FAERS: 10 | US FAERS | |
| 28 | Urticaria | FAERS: 10 | US FAERS | |
| 29 | Lethargy | FAERS: 9 | US FAERS | |
| 30 | Therapy change | FAERS: 9 | US FAERS | |
| 31 | Chills | FAERS: 8 | US FAERS | |
| 32 | Endocarditis | FAERS: 8 | US FAERS | |
| 33 | Overdose | FAERS: 8 | US FAERS | |
| 34 | Pruritus | FAERS: 8 | US FAERS | |
| 35 | Somnolence | FAERS: 8 | US FAERS | |
| 36 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 37 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 38 | Myalgia | FAERS: 7 | US FAERS | |
| 39 | Palpitations | FAERS: 7 | US FAERS | |
| 40 | Restlessness | FAERS: 7 | US FAERS | |
| 41 | Drug administration error | FAERS: 6 | US FAERS | |
| 42 | Drug diversion | FAERS: 6 | US FAERS | |
| 43 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 44 | Drug abuse | FAERS: 5 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 46 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 47 | Limb discomfort | FAERS: 5 | US FAERS | |
| 48 | Medication Error | FAERS: 5 | US FAERS | |
| 49 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 50 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 51 | Accidental overdose | FAERS: 4 | US FAERS | |
| 52 | Amnesia | FAERS: 4 | US FAERS | |
| 53 | Anger | FAERS: 4 | US FAERS | |
| 54 | Cold sweat | FAERS: 4 | US FAERS | |
| 55 | Crying | FAERS: 4 | US FAERS | |
| 56 | Dependence | FAERS: 4 | US FAERS | |
| 57 | Dysuria | FAERS: 4 | US FAERS | |
| 58 | Nervousness | FAERS: 4 | US FAERS | |
| 59 | Product dosage form issue | FAERS: 4 | US FAERS | |
| 60 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 61 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 62 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 63 | Unevaluable event | FAERS: 4 | US FAERS | |
| 64 | Apathy | FAERS: 3 | US FAERS | |
| 65 | Back Pain | FAERS: 3 | US FAERS | |
| 66 | Cellulitis | FAERS: 3 | US FAERS | |
| 67 | Chest Pain | FAERS: 3 | US FAERS | |
| 68 | Discomfort | FAERS: 3 | US FAERS | |
| 69 | Drug dose omission | FAERS: 3 | US FAERS | |
| 70 | Drug effect variable | FAERS: 3 | US FAERS | |
| 71 | Hypersomnia | FAERS: 3 | US FAERS | |
| 72 | Night sweats | FAERS: 3 | US FAERS | |
| 73 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 74 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 75 | Product packaging issue | FAERS: 3 | US FAERS | |
| 76 | Product use issue | FAERS: 3 | US FAERS | |
| 77 | Retching | FAERS: 3 | US FAERS | |
| 78 | Swelling | FAERS: 3 | US FAERS | |
| 79 | Syncope | FAERS: 3 | US FAERS | |
| 80 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 81 | treatment failure | FAERS: 3 | US FAERS | |
| 82 | Abscess | FAERS: 2 | US FAERS | |
| 83 | Adverse event | FAERS: 2 | US FAERS | |
| 84 | Arthralgia | FAERS: 2 | US FAERS | |
| 85 | Burning sensation | FAERS: 2 | US FAERS | |
| 86 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 87 | Dental caries | FAERS: 2 | US FAERS | |
| 88 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 89 | Disease recurrence | FAERS: 2 | US FAERS | |
| 90 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 91 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 92 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 93 | Drug screen positive | FAERS: 2 | US FAERS | |
| 94 | Dysarthria | FAERS: 2 | US FAERS | |
| 95 | Dysgeusia | FAERS: 2 | US FAERS | |
| 96 | Dyspepsia | FAERS: 2 | US FAERS | |
| 97 | Economic problem | FAERS: 2 | US FAERS | |
| 98 | Eye pain | FAERS: 2 | US FAERS | |
| 99 | Feeling jittery | FAERS: 2 | US FAERS | |
| 100 | Glossitis | FAERS: 2 | US FAERS | |
| 101 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 102 | Influenza | FAERS: 2 | US FAERS | |
| 103 | Insurance issue | FAERS: 2 | US FAERS | |
| 104 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 105 | Photophobia | FAERS: 2 | US FAERS | |
| 106 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 107 | Product barcode issue | FAERS: 2 | US FAERS | |
| 108 | Product formulation issue | FAERS: 2 | US FAERS | |
| 109 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 110 | Pulmonary sepsis | FAERS: 2 | US FAERS | |
| 111 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 112 | Septic embolus | FAERS: 2 | US FAERS | |
| 113 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 114 | Sneezing | FAERS: 2 | US FAERS | |
| 115 | Tongue blistering | FAERS: 2 | US FAERS | |
| 116 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 117 | Urinary Retention | FAERS: 2 | US FAERS | |
| 118 | Visual Impairment | FAERS: 2 | US FAERS | |
| 119 | Weight decreased | FAERS: 2 | US FAERS | |
| 120 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 121 | Acne | FAERS: 1 | US FAERS | |
| 122 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 123 | Ageusia | FAERS: 1 | US FAERS | |
| 124 | Agitation | FAERS: 1 | US FAERS | |
| 125 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 126 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 127 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 128 | Aphagia | FAERS: 1 | US FAERS | |
| 129 | Bedridden | FAERS: 1 | US FAERS | |
| 130 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 131 | Bone pain | FAERS: 1 | US FAERS | |
| 132 | Chest discomfort | FAERS: 1 | US FAERS | |
| 133 | Cluster Headache | FAERS: 1 | US FAERS | |
| 134 | Completed Suicide | FAERS: 1 | US FAERS | |
| 135 | Depressed mood | FAERS: 1 | US FAERS | |
| 136 | Disorientation | FAERS: 1 | US FAERS | |
| 137 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 138 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 139 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 140 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 141 | Drug screen negative | FAERS: 1 | US FAERS | |
| 142 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 143 | Ear discomfort | FAERS: 1 | US FAERS | |
| 144 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 145 | Eczema | FAERS: 1 | US FAERS | |
| 146 | Emotional disorder | FAERS: 1 | US FAERS | |
| 147 | Encephalitis | FAERS: 1 | US FAERS | |
| 148 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 149 | Euphoric mood | FAERS: 1 | US FAERS | |
| 150 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 151 | Extra dose administered | FAERS: 1 | US FAERS | |
| 152 | Fasciotomy | FAERS: 1 | US FAERS | |
| 153 | Feeling Cold | FAERS: 1 | US FAERS | |
| 154 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 155 | Formication | FAERS: 1 | US FAERS | |
| 156 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 157 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 158 | Hyperacusis | FAERS: 1 | US FAERS | |
| 159 | Hypogonadism | FAERS: 1 | US FAERS | |
| 160 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 161 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 162 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 163 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 164 | Laziness | FAERS: 1 | US FAERS | |
| 165 | Lip swelling | FAERS: 1 | US FAERS | |
| 166 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 167 | Memory impairment | FAERS: 1 | US FAERS | |
| 168 | Mental impairment | FAERS: 1 | US FAERS | |
| 169 | Monoplegia | FAERS: 1 | US FAERS | |
| 170 | Mood swings | FAERS: 1 | US FAERS | |
| 171 | Mouth swelling | FAERS: 1 | US FAERS | |
| 172 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 173 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 174 | Neonatal complications of substance abuse | FAERS: 1 | US FAERS | |
| 175 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 176 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 177 | Penile curvature | FAERS: 1 | US FAERS | |
| 178 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 179 | Product container seal issue | FAERS: 1 | US FAERS | |
| 180 | Product dispensing error | FAERS: 1 | US FAERS | |
| 181 | Product dose omission | FAERS: 1 | US FAERS | |
| 182 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 183 | Product physical issue | FAERS: 1 | US FAERS | |
| 184 | Product preparation error | FAERS: 1 | US FAERS | |
| 185 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 186 | Rash erythematous | FAERS: 1 | US FAERS | |
| 187 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 188 | Seasonal Affective Disorder | FAERS: 1 | US FAERS | |
| 189 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 190 | Skin irritation | FAERS: 1 | US FAERS | |
| 191 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 192 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 193 | Tachycardia | FAERS: 1 | US FAERS | |
| 194 | Terminal dribbling | FAERS: 1 | US FAERS | |
| 195 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 196 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 197 | Therapy cessation | FAERS: 1 | US FAERS | |
| 198 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 199 | Tooth Loss | FAERS: 1 | US FAERS | |
| 200 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 201 | Wheezing | FAERS: 1 | US FAERS | |
| 202 | Heroin Dependence | 19948382 | CTD | |
| 203 | Morphine Dependence | 21270789 | CTD | |
| 204 | Opioid-Related Disorders | 17517480 17565668 | CTD | |
| 205 | Pain, Postoperative | 19448245 | CTD | |
| 206 | Substance Withdrawal Syndrome | 21270789 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.