icatibant
(QURWXBZNHXJZBE-SKXRKSCCSA-N)
Structure
- SMILES
- OC[C@@H](C(=O)N1Cc2ccccc2C[C@@H]1C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)N[C@H](C(=O)O)CCCN=C(N)N)NC(=O)[C@H](Cc1cccs1)NC(=O)CNC(=O)[C@@H]1C[C@H](CN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](CCCN=C(N)N)N)CCCN=C(N)N)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- B06AC02
- Molecular Formula:
- C59H89N19O13S
- Molecular Weight:
- 1304.520
- Log P:
- 1.5852
- Hydrogen Bond Acceptor:
- 33
- Hydrogen Bond Donor:
- 15
- TPSA:
- 551.96
- CAS Number(s):
- 130308-48-4; 138614-30-9
Synonym(s)
1.
icatibant
2.
D-Arg(Hyp(3)-Thi(5)-D-Tic(7)-Oic(8))BK
3.
HOE 140
4.
HOE-140
5.
HOE140
6.
Hoechst 140
7.
Hoechst-140
8.
JE 049
9.
JE-049
10.
WIN 65365
11.
WIN-65365
12.
icatibant acetate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 80 | US FAERS | |
| 2 | Injection site pain | FAERS: 73 | US FAERS | |
| 3 | No adverse event | FAERS: 32 | US FAERS | |
| 4 | Injection site erythema | FAERS: 28 | US FAERS | |
| 5 | Product use issue | FAERS: 27 | US FAERS | |
| 6 | Malaise | FAERS: 26 | US FAERS | |
| 7 | Dizziness | FAERS: 25 | US FAERS | |
| 8 | Headache | FAERS: 21 | US FAERS | |
| 9 | Nausea | FAERS: 21 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 11 | Fatigue | FAERS: 17 | US FAERS | |
| 12 | Adverse event | FAERS: 15 | US FAERS | |
| 13 | Swelling | FAERS: 14 | US FAERS | |
| 14 | Injection Site Reaction | FAERS: 13 | US FAERS | |
| 15 | Vomiting | FAERS: 13 | US FAERS | |
| 16 | Maternal exposure during pregnancy | FAERS: 12 | US FAERS | |
| 17 | Pain | FAERS: 12 | 16099101 21484880 | CTD US FAERS |
| 18 | Urticaria | FAERS: 12 | US FAERS | |
| 19 | Inappropriate schedule of drug administration | FAERS: 10 | US FAERS | |
| 20 | Nasopharyngitis | FAERS: 10 | US FAERS | |
| 21 | Pneumonia | FAERS: 10 | US FAERS | |
| 22 | Somnolence | FAERS: 9 | US FAERS | |
| 23 | Chest Pain | FAERS: 7 | US FAERS | |
| 24 | Injection site pruritus | FAERS: 7 | US FAERS | |
| 25 | Injection site urticaria | FAERS: 7 | US FAERS | |
| 26 | Weight decreased | FAERS: 7 | US FAERS | |
| 27 | Dehydration | FAERS: 6 | US FAERS | |
| 28 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 29 | Drug dose omission | FAERS: 6 | US FAERS | |
| 30 | Drug effect delayed | FAERS: 6 | US FAERS | |
| 31 | Dysphonia | FAERS: 6 | US FAERS | |
| 32 | Expired product administered | FAERS: 6 | US FAERS | |
| 33 | Influenza | FAERS: 6 | US FAERS | |
| 34 | Injection site bruising | FAERS: 6 | US FAERS | |
| 35 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 36 | Pruritus | FAERS: 6 | US FAERS | |
| 37 | Thrombosis | FAERS: 6 | 16514058 | CTD US FAERS |
| 38 | Angioedema | FAERS: 5 | US FAERS | |
| 39 | Asthenia | FAERS: 5 | US FAERS | |
| 40 | Lip swelling | FAERS: 5 | US FAERS | |
| 41 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 42 | Syncope | FAERS: 5 | US FAERS | |
| 43 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 44 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 45 | Device related infection | FAERS: 4 | US FAERS | |
| 46 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 47 | Injection site warmth | FAERS: 4 | US FAERS | |
| 48 | Product quality issue | FAERS: 4 | US FAERS | |
| 49 | Arthritis | FAERS: 3 | US FAERS | |
| 50 | Asthma | FAERS: 3 | US FAERS | |
| 51 | Back Pain | FAERS: 3 | US FAERS | |
| 52 | Burning sensation | FAERS: 3 | US FAERS | |
| 53 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 54 | Inflammation | FAERS: 3 | US FAERS | |
| 55 | Injection site mass | FAERS: 3 | US FAERS | |
| 56 | Limb discomfort | FAERS: 3 | US FAERS | |
| 57 | Pancreatitis | FAERS: 3 | US FAERS | |
| 58 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 59 | Rebound effect | FAERS: 3 | US FAERS | |
| 60 | Sepsis | FAERS: 3 | US FAERS | |
| 61 | Sinusitis | FAERS: 3 | US FAERS | |
| 62 | Stress | FAERS: 3 | US FAERS | |
| 63 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 64 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 65 | Abscess | FAERS: 2 | US FAERS | |
| 66 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 67 | Arthropathy | FAERS: 2 | US FAERS | |
| 68 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 69 | Dyspepsia | FAERS: 2 | US FAERS | |
| 70 | Epilepsy | FAERS: 2 | US FAERS | |
| 71 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 72 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 73 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 74 | Incontinence | FAERS: 2 | US FAERS | |
| 75 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 76 | Infection | FAERS: 2 | US FAERS | |
| 77 | Infusion site erythema | FAERS: 2 | US FAERS | |
| 78 | Infusion site pain | FAERS: 2 | US FAERS | |
| 79 | Infusion site urticaria | FAERS: 2 | US FAERS | |
| 80 | Injection site discomfort | FAERS: 2 | US FAERS | |
| 81 | Injection site irritation | FAERS: 2 | US FAERS | |
| 82 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 83 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 84 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 85 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 86 | Neuralgia | FAERS: 2 | US FAERS | |
| 87 | Palpitations | FAERS: 2 | US FAERS | |
| 88 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 89 | Presyncope | FAERS: 2 | US FAERS | |
| 90 | Procedural complication | FAERS: 2 | US FAERS | |
| 91 | Product administration error | FAERS: 2 | US FAERS | |
| 92 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 93 | Therapy cessation | FAERS: 2 | US FAERS | |
| 94 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 95 | Abdominal mass | FAERS: 1 | US FAERS | |
| 96 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 97 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 98 | Alopecia | FAERS: 1 | US FAERS | |
| 99 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 100 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 101 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 102 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 103 | Anoxia | FAERS: 1 | US FAERS | |
| 104 | Back disorder | FAERS: 1 | US FAERS | |
| 105 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 106 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 107 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 108 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 109 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 110 | Blood urine present | FAERS: 1 | US FAERS | |
| 111 | Bone pain | FAERS: 1 | US FAERS | |
| 112 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 113 | Bronchitis | FAERS: 1 | US FAERS | |
| 114 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 115 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 116 | Catheter site infection | FAERS: 1 | US FAERS | |
| 117 | Cellulitis | FAERS: 1 | US FAERS | |
| 118 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 119 | Chills | FAERS: 1 | US FAERS | |
| 120 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 121 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 122 | Cold sweat | FAERS: 1 | US FAERS | |
| 123 | Constipation | FAERS: 1 | US FAERS | |
| 124 | Conversion disorder | FAERS: 1 | US FAERS | |
| 125 | Crying | FAERS: 1 | US FAERS | |
| 126 | Cystitis | FAERS: 1 | US FAERS | |
| 127 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 128 | Depressed mood | FAERS: 1 | US FAERS | |
| 129 | Device Failure | FAERS: 1 | US FAERS | |
| 130 | Device defective | FAERS: 1 | US FAERS | |
| 131 | Device malfunction | FAERS: 1 | US FAERS | |
| 132 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 133 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 134 | Discomfort | FAERS: 1 | US FAERS | |
| 135 | Disease recurrence | FAERS: 1 | US FAERS | |
| 136 | Diverticulitis | FAERS: 1 | US FAERS | |
| 137 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 138 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 139 | Dysarthria | FAERS: 1 | US FAERS | |
| 140 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 141 | Erythema | FAERS: 1 | US FAERS | |
| 142 | Euphoric mood | FAERS: 1 | US FAERS | |
| 143 | Excessive skin | FAERS: 1 | US FAERS | |
| 144 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 145 | Extra dose administered | FAERS: 1 | US FAERS | |
| 146 | Eye pain | FAERS: 1 | US FAERS | |
| 147 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 148 | Flushing | FAERS: 1 | US FAERS | |
| 149 | Food Allergy | FAERS: 1 | US FAERS | |
| 150 | Gait inability | FAERS: 1 | US FAERS | |
| 151 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 152 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 153 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 154 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 155 | Gout | FAERS: 1 | US FAERS | |
| 156 | Hypersomnia | FAERS: 1 | US FAERS | |
| 157 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 158 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 159 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 160 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 161 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 162 | Injection related reaction | FAERS: 1 | US FAERS | |
| 163 | Injection site cyst | FAERS: 1 | US FAERS | |
| 164 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 165 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 166 | Injury associated with device | FAERS: 1 | US FAERS | |
| 167 | Instillation site pain | FAERS: 1 | US FAERS | |
| 168 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 169 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 170 | Joint swelling | FAERS: 1 | US FAERS | |
| 171 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 172 | Lethargy | FAERS: 1 | US FAERS | |
| 173 | Limb injury | FAERS: 1 | US FAERS | |
| 174 | Lupus hepatitis | FAERS: 1 | US FAERS | |
| 175 | Lymphoma | FAERS: 1 | US FAERS | |
| 176 | Macrocytosis | FAERS: 1 | US FAERS | |
| 177 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 178 | Memory impairment | FAERS: 1 | US FAERS | |
| 179 | Meniscus injury | FAERS: 1 | US FAERS | |
| 180 | Mental impairment | FAERS: 1 | US FAERS | |
| 181 | Mouth swelling | FAERS: 1 | US FAERS | |
| 182 | Mydriasis | FAERS: 1 | US FAERS | |
| 183 | Neck Pain | FAERS: 1 | US FAERS | |
| 184 | Needle issue | FAERS: 1 | US FAERS | |
| 185 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 186 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 187 | Overdose | FAERS: 1 | US FAERS | |
| 188 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 189 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 190 | Post procedural complication | FAERS: 1 | US FAERS | |
| 191 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 192 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 193 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 194 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 195 | Product barcode issue | FAERS: 1 | US FAERS | |
| 196 | Product leakage | FAERS: 1 | US FAERS | |
| 197 | Product packaging issue | FAERS: 1 | US FAERS | |
| 198 | Rash erythematous | FAERS: 1 | US FAERS | |
| 199 | Respiratory distress | FAERS: 1 | US FAERS | |
| 200 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 201 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 202 | Shock | FAERS: 1 | US FAERS | |
| 203 | Skin lesion | FAERS: 1 | US FAERS | |
| 204 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 205 | Syringe issue | FAERS: 1 | US FAERS | |
| 206 | Terminal state | FAERS: 1 | US FAERS | |
| 207 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 208 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 209 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 210 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 211 | Toothache | FAERS: 1 | US FAERS | |
| 212 | Tremor | FAERS: 1 | US FAERS | |
| 213 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 214 | Visual Impairment | FAERS: 1 | US FAERS | |
| 215 | Acute kidney injury | 24975837 | CTD | |
| 216 | Angioedemas, Hereditary | CTD | ||
| 217 | Chemical and Drug Induced Liver Injury | 30685357 | CTD | |
| 218 | Extravasation of Diagnostic and Therapeutic Materials | 9622145 | CTD | |
| 219 | Hyperalgesia | CTD | ||
| 220 | Hyperemia | 11837250 | CTD | |
| 221 | Hyperesthesia | 8190269 | CTD | |
| 222 | Hypotension | 14744816 16321614 21436127 | CTD | |
| 223 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 224 | Urinary Bladder Diseases | 8032584 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.