Kombiglyze XR
(QUKZWYNGKYRRKE-RIKNOMPASA-N)
Structure
- SMILES
- CN(C(=N)N=C(N)N)C.N#C[C@H]1CC2[C@H](N1C(=O)[C@@H](C13CC4CC(C1)CC(C3)(C4)O)N)C2
- Molecular Formula:
- C22H36N8O2
- Molecular Weight:
- 444.574
- Log P:
- 2.0527
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 5
- TPSA:
- 181.84
- CAS Number(s):
- 1198772-17-6
Synonym(s)
1.
Kombiglyze XR
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 38 | US FAERS | |
| 2 | Drug ineffective | FAERS: 35 | US FAERS | |
| 3 | Nausea | FAERS: 35 | US FAERS | |
| 4 | Pancreatitis | FAERS: 30 | US FAERS | |
| 5 | Vomiting | FAERS: 26 | US FAERS | |
| 6 | Dizziness | FAERS: 25 | US FAERS | |
| 7 | Medication residue present | FAERS: 25 | US FAERS | |
| 8 | Drug dose omission | FAERS: 22 | US FAERS | |
| 9 | Abdominal discomfort | FAERS: 19 | US FAERS | |
| 10 | Headache | FAERS: 17 | US FAERS | |
| 11 | Malaise | FAERS: 14 | US FAERS | |
| 12 | Pruritus | FAERS: 14 | US FAERS | |
| 13 | Weight decreased | FAERS: 13 | US FAERS | |
| 14 | Abdominal Pain | FAERS: 12 | US FAERS | |
| 15 | Myalgia | FAERS: 12 | US FAERS | |
| 16 | Chest Pain | FAERS: 11 | US FAERS | |
| 17 | Medication residue | FAERS: 11 | US FAERS | |
| 18 | Urticaria | FAERS: 11 | US FAERS | |
| 19 | Constipation | FAERS: 10 | US FAERS | |
| 20 | Fatigue | FAERS: 9 | US FAERS | |
| 21 | Palpitations | FAERS: 8 | US FAERS | |
| 22 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 24 | Dyspepsia | FAERS: 6 | US FAERS | |
| 25 | Medication Error | FAERS: 6 | US FAERS | |
| 26 | Adverse event | FAERS: 5 | US FAERS | |
| 27 | Arthralgia | FAERS: 5 | US FAERS | |
| 28 | Asthenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 30 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 31 | Pain | FAERS: 5 | US FAERS | |
| 32 | Somnolence | FAERS: 5 | US FAERS | |
| 33 | Back Pain | FAERS: 4 | US FAERS | |
| 34 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 35 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 36 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 37 | Dehydration | FAERS: 4 | US FAERS | |
| 38 | Dysuria | FAERS: 4 | US FAERS | |
| 39 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 40 | Tremor | FAERS: 4 | US FAERS | |
| 41 | Visual Impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Alopecia | FAERS: 3 | US FAERS | |
| 43 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 44 | Creatinine renal clearance increased | FAERS: 3 | US FAERS | |
| 45 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 46 | Drug administration error | FAERS: 3 | US FAERS | |
| 47 | Flatulence | FAERS: 3 | US FAERS | |
| 48 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 49 | Neck Pain | FAERS: 3 | US FAERS | |
| 50 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 51 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 52 | Pneumonia | FAERS: 3 | US FAERS | |
| 53 | Product quality issue | FAERS: 3 | US FAERS | |
| 54 | Acidosis | FAERS: 2 | US FAERS | |
| 55 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 56 | Angioedema | FAERS: 2 | US FAERS | |
| 57 | Arthritis | FAERS: 2 | US FAERS | |
| 58 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 59 | Bone pain | FAERS: 2 | US FAERS | |
| 60 | Chest discomfort | FAERS: 2 | US FAERS | |
| 61 | Cystitis | FAERS: 2 | US FAERS | |
| 62 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 63 | Dysgeusia | FAERS: 2 | US FAERS | |
| 64 | Erythema | FAERS: 2 | US FAERS | |
| 65 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 66 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 67 | Inability to afford medication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 69 | Lipase increased | FAERS: 2 | US FAERS | |
| 70 | Memory impairment | FAERS: 2 | US FAERS | |
| 71 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 72 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 73 | Retching | FAERS: 2 | US FAERS | |
| 74 | Syncope | FAERS: 2 | US FAERS | |
| 75 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 76 | furuncle | FAERS: 2 | US FAERS | |
| 77 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 78 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 79 | Ageusia | FAERS: 1 | US FAERS | |
| 80 | Amylase increased | FAERS: 1 | US FAERS | |
| 81 | Anxiety | FAERS: 1 | US FAERS | |
| 82 | Bladder pain | FAERS: 1 | US FAERS | |
| 83 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 84 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 85 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 86 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 87 | Blood urea increased | FAERS: 1 | US FAERS | |
| 88 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 89 | Cataract | FAERS: 1 | US FAERS | |
| 90 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 91 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 92 | Chromaturia | FAERS: 1 | US FAERS | |
| 93 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 94 | Dementia | FAERS: 1 | US FAERS | |
| 95 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 96 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 97 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 98 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 99 | Ear discomfort | FAERS: 1 | US FAERS | |
| 100 | Emotional distress | FAERS: 1 | US FAERS | |
| 101 | Epistaxis | FAERS: 1 | US FAERS | |
| 102 | Extra dose administered | FAERS: 1 | US FAERS | |
| 103 | Feeling Cold | FAERS: 1 | US FAERS | |
| 104 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 105 | Flank Pain | FAERS: 1 | US FAERS | |
| 106 | Flushing | FAERS: 1 | US FAERS | |
| 107 | Gastritis | FAERS: 1 | US FAERS | |
| 108 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 109 | Genital swelling | FAERS: 1 | US FAERS | |
| 110 | Hepatitis | FAERS: 1 | US FAERS | |
| 111 | Hunger | FAERS: 1 | US FAERS | |
| 112 | Hypophagia | FAERS: 1 | US FAERS | |
| 113 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 114 | Insurance issue | FAERS: 1 | US FAERS | |
| 115 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 116 | Laryngitis | FAERS: 1 | US FAERS | |
| 117 | Limb discomfort | FAERS: 1 | US FAERS | |
| 118 | Limb injury | FAERS: 1 | US FAERS | |
| 119 | Lip swelling | FAERS: 1 | US FAERS | |
| 120 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 121 | Mood swings | FAERS: 1 | US FAERS | |
| 122 | Nerve injury | FAERS: 1 | US FAERS | |
| 123 | Nervousness | FAERS: 1 | US FAERS | |
| 124 | Night sweats | FAERS: 1 | US FAERS | |
| 125 | Nodule | FAERS: 1 | US FAERS | |
| 126 | Obesity | FAERS: 1 | US FAERS | |
| 127 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 128 | Overweight | FAERS: 1 | US FAERS | |
| 129 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 130 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 131 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 132 | Product dose omission | FAERS: 1 | US FAERS | |
| 133 | Product lot number issue | FAERS: 1 | US FAERS | |
| 134 | Product packaging issue | FAERS: 1 | US FAERS | |
| 135 | Product physical issue | FAERS: 1 | US FAERS | |
| 136 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 137 | Psoriasis | FAERS: 1 | US FAERS | |
| 138 | Pubic pain | FAERS: 1 | US FAERS | |
| 139 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 140 | Sepsis | FAERS: 1 | US FAERS | |
| 141 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 142 | Stress | FAERS: 1 | US FAERS | |
| 143 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 144 | Swelling | FAERS: 1 | US FAERS | |
| 145 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 146 | Therapy cessation | FAERS: 1 | US FAERS | |
| 147 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 148 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 149 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 150 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.