tesamorelin
(QBEPNUQJQWDYKU-BMGKTWPMSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N)CC(C)C)CCCNC(=N)N)C)CCCNC(=N)N)C)CCCNC(=N)N)CCC(=O)O)CCC(=O)N)CC(=O)N)CO)CCC(=O)O)CCC(=O)N)CCC(=O)N)CCCNC(=N)N)CO)CCSC)[C@H](CC)C)CC(=O)O)CCC(=O)N)CC(C)C)CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)C/C=C/CC)C)CC(=O)O)C)Cc1ccccc1)CC(=O)N)CO)Cc1ccc(cc1)O)CCCNC(=N)N)CCCCN)CC(C)C)CCC(=O)N)CC(C)C)CO)C)CCCNC(=N)N
- Molecular Formula:
- C221H366N72O67S
- Molecular Weight:
- 5135.780
- Log P:
- 4.3171
- Hydrogen Bond Acceptor:
- 140
- Hydrogen Bond Donor:
- 83
- TPSA:
- 2364.67
- CAS Number(s):
- 804475-66-9
Synonym(s)
1.
tesamorelin
2.
TH-9507
3.
TH9507
4.
egrifta
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 91 | US FAERS | |
| 2 | Injection site pain | FAERS: 75 | US FAERS | |
| 3 | Headache | FAERS: 42 | US FAERS | |
| 4 | Nausea | FAERS: 41 | US FAERS | |
| 5 | Drug ineffective | FAERS: 39 | US FAERS | |
| 6 | Blood glucose increased | FAERS: 37 | US FAERS | |
| 7 | Myalgia | FAERS: 37 | US FAERS | |
| 8 | Injection site bruising | FAERS: 35 | US FAERS | |
| 9 | Injection site pruritus | FAERS: 31 | US FAERS | |
| 10 | Fatigue | FAERS: 30 | US FAERS | |
| 11 | Peripheral swelling | FAERS: 30 | US FAERS | |
| 12 | Dizziness | FAERS: 26 | US FAERS | |
| 13 | Pruritus | FAERS: 24 | US FAERS | |
| 14 | Malaise | FAERS: 23 | US FAERS | |
| 15 | Joint swelling | FAERS: 21 | US FAERS | |
| 16 | Diabetes Mellitus | FAERS: 19 | US FAERS | |
| 17 | Injection site erythema | FAERS: 19 | US FAERS | |
| 18 | Vomiting | FAERS: 19 | US FAERS | |
| 19 | Pain | FAERS: 17 | US FAERS | |
| 20 | Carpal Tunnel Syndrome | FAERS: 14 | US FAERS | |
| 21 | Myocardial Infarction | FAERS: 14 | US FAERS | |
| 22 | Palpitations | FAERS: 13 | US FAERS | |
| 23 | Swelling | FAERS: 13 | US FAERS | |
| 24 | Unevaluable event | FAERS: 13 | US FAERS | |
| 25 | Weight decreased | FAERS: 13 | US FAERS | |
| 26 | Anxiety | FAERS: 12 | US FAERS | |
| 27 | Back Pain | FAERS: 12 | US FAERS | |
| 28 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 29 | Injection Site Reaction | FAERS: 11 | US FAERS | |
| 30 | Injection site mass | FAERS: 11 | US FAERS | |
| 31 | Arthritis | FAERS: 10 | US FAERS | |
| 32 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 33 | Musculoskeletal Pain | FAERS: 10 | US FAERS | |
| 34 | Night sweats | FAERS: 10 | US FAERS | |
| 35 | Urticaria | FAERS: 10 | US FAERS | |
| 36 | Injection site nodule | FAERS: 9 | US FAERS | |
| 37 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 38 | Asthenia | FAERS: 8 | US FAERS | |
| 39 | Drug dose omission | FAERS: 8 | US FAERS | |
| 40 | Influenza | FAERS: 8 | US FAERS | |
| 41 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 42 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 43 | Drug administration error | FAERS: 7 | US FAERS | |
| 44 | Flushing | FAERS: 7 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 46 | Injection site irritation | FAERS: 7 | US FAERS | |
| 47 | Product dose omission | FAERS: 7 | US FAERS | |
| 48 | Sinusitis | FAERS: 7 | US FAERS | |
| 49 | Tremor | FAERS: 7 | US FAERS | |
| 50 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 51 | Joint stiffness | FAERS: 6 | US FAERS | |
| 52 | Lipoatrophy | FAERS: 6 | US FAERS | |
| 53 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 54 | Pneumonia | FAERS: 6 | US FAERS | |
| 55 | Thirst | FAERS: 6 | US FAERS | |
| 56 | Waist circumference increased | FAERS: 6 | US FAERS | |
| 57 | Arthropathy | FAERS: 5 | US FAERS | |
| 58 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 59 | Bronchitis | FAERS: 5 | US FAERS | |
| 60 | Chest Pain | FAERS: 5 | US FAERS | |
| 61 | Chest discomfort | FAERS: 5 | US FAERS | |
| 62 | Constipation | FAERS: 5 | US FAERS | |
| 63 | Dysuria | FAERS: 5 | US FAERS | |
| 64 | Insulin-like growth factor increased | FAERS: 5 | US FAERS | |
| 65 | Muscle tightness | FAERS: 5 | US FAERS | |
| 66 | Bone pain | FAERS: 4 | US FAERS | |
| 67 | Burning sensation | FAERS: 4 | US FAERS | |
| 68 | Dysgeusia | FAERS: 4 | US FAERS | |
| 69 | Emergency Care | FAERS: 4 | US FAERS | |
| 70 | Erythema | FAERS: 4 | US FAERS | |
| 71 | Flatulence | FAERS: 4 | US FAERS | |
| 72 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 73 | Injection site warmth | FAERS: 4 | US FAERS | |
| 74 | Neck Pain | FAERS: 4 | US FAERS | |
| 75 | No adverse event | FAERS: 4 | US FAERS | |
| 76 | Sepsis | FAERS: 4 | US FAERS | |
| 77 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 78 | Anger | FAERS: 3 | US FAERS | |
| 79 | Anogenital dysplasia | FAERS: 3 | US FAERS | |
| 80 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 81 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 82 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 83 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 84 | Cellulitis | FAERS: 3 | US FAERS | |
| 85 | Chills | FAERS: 3 | US FAERS | |
| 86 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 87 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 88 | Injection site inflammation | FAERS: 3 | US FAERS | |
| 89 | Injection site urticaria | FAERS: 3 | US FAERS | |
| 90 | Lethargy | FAERS: 3 | US FAERS | |
| 91 | Limb discomfort | FAERS: 3 | US FAERS | |
| 92 | Lipohypertrophy | FAERS: 3 | US FAERS | |
| 93 | Mood swings | FAERS: 3 | US FAERS | |
| 94 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 95 | Neurodermatitis | FAERS: 3 | US FAERS | |
| 96 | Pancreatitis | FAERS: 3 | US FAERS | |
| 97 | Somnolence | FAERS: 3 | US FAERS | |
| 98 | Thrombosis | FAERS: 3 | US FAERS | |
| 99 | Vertigo | FAERS: 3 | US FAERS | |
| 100 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 101 | Acne | FAERS: 2 | US FAERS | |
| 102 | Adverse event | FAERS: 2 | US FAERS | |
| 103 | Alopecia | FAERS: 2 | US FAERS | |
| 104 | Blindness | FAERS: 2 | US FAERS | |
| 105 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 106 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 107 | Colon adenoma | FAERS: 2 | US FAERS | |
| 108 | Crying | FAERS: 2 | US FAERS | |
| 109 | Dehydration | FAERS: 2 | US FAERS | |
| 110 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 111 | Facial wasting | FAERS: 2 | US FAERS | |
| 112 | Gait inability | FAERS: 2 | US FAERS | |
| 113 | Hypersomnia | FAERS: 2 | US FAERS | |
| 114 | Hypotension | FAERS: 2 | US FAERS | |
| 115 | Incision site pain | FAERS: 2 | US FAERS | |
| 116 | Infection | FAERS: 2 | US FAERS | |
| 117 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 118 | Injection site scar | FAERS: 2 | US FAERS | |
| 119 | Laceration | FAERS: 2 | US FAERS | |
| 120 | Lipodystrophy acquired | FAERS: 2 | US FAERS | |
| 121 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 122 | Memory impairment | FAERS: 2 | US FAERS | |
| 123 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 124 | Neuralgia | FAERS: 2 | US FAERS | |
| 125 | Nodule | FAERS: 2 | US FAERS | |
| 126 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 127 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 128 | Overdose | FAERS: 2 | US FAERS | |
| 129 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 130 | Polydipsia | FAERS: 2 | US FAERS | |
| 131 | Product leakage | FAERS: 2 | US FAERS | |
| 132 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 133 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 134 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 135 | Syncope | FAERS: 2 | US FAERS | |
| 136 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 137 | Viral load increased | FAERS: 2 | US FAERS | |
| 138 | Visual Impairment | FAERS: 2 | US FAERS | |
| 139 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 140 | furuncle | FAERS: 2 | US FAERS | |
| 141 | Abasia | FAERS: 1 | US FAERS | |
| 142 | Abdominal mass | FAERS: 1 | US FAERS | |
| 143 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 144 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 145 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 146 | Administration site bruise | FAERS: 1 | US FAERS | |
| 147 | Amylase increased | FAERS: 1 | US FAERS | |
| 148 | Arterial restenosis | FAERS: 1 | US FAERS | |
| 149 | Ascites | FAERS: 1 | US FAERS | |
| 150 | Asphyxia | FAERS: 1 | US FAERS | |
| 151 | Asthma | FAERS: 1 | US FAERS | |
| 152 | Back disorder | FAERS: 1 | US FAERS | |
| 153 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 154 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 155 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 156 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 157 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 158 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 159 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 160 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 161 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 162 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 163 | Blood urea increased | FAERS: 1 | US FAERS | |
| 164 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 165 | Breast tenderness | FAERS: 1 | US FAERS | |
| 166 | CD4 lymphocytes increased | FAERS: 1 | US FAERS | |
| 167 | Cachexia | FAERS: 1 | US FAERS | |
| 168 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 169 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 170 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 171 | Chromaturia | FAERS: 1 | US FAERS | |
| 172 | Cold sweat | FAERS: 1 | US FAERS | |
| 173 | Completed Suicide | FAERS: 1 | US FAERS | |
| 174 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 175 | Cyst | FAERS: 1 | US FAERS | |
| 176 | Dental Plaque | FAERS: 1 | US FAERS | |
| 177 | Depressed mood | FAERS: 1 | US FAERS | |
| 178 | Dermal absorption impaired | FAERS: 1 | US FAERS | |
| 179 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 180 | Diverticulitis | FAERS: 1 | US FAERS | |
| 181 | Drug label confusion | FAERS: 1 | US FAERS | |
| 182 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 183 | Dysmorphism | FAERS: 1 | US FAERS | |
| 184 | Dyspepsia | FAERS: 1 | US FAERS | |
| 185 | Dysphonia | FAERS: 1 | US FAERS | |
| 186 | Ecchymosis | FAERS: 1 | US FAERS | |
| 187 | Embolism | FAERS: 1 | US FAERS | |
| 188 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 189 | Euphoric mood | FAERS: 1 | US FAERS | |
| 190 | Expired drug administered | FAERS: 1 | US FAERS | |
| 191 | Facial Pain | FAERS: 1 | US FAERS | |
| 192 | Feeling Cold | FAERS: 1 | US FAERS | |
| 193 | Folliculitis | FAERS: 1 | US FAERS | |
| 194 | Food Poisoning | FAERS: 1 | US FAERS | |
| 195 | Full blood count increased | FAERS: 1 | US FAERS | |
| 196 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 197 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 198 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 199 | Genital rash | FAERS: 1 | US FAERS | |
| 200 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 201 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 202 | Hernia | FAERS: 1 | US FAERS | |
| 203 | Hip surgery | FAERS: 1 | US FAERS | |
| 204 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 205 | Hospice Care | FAERS: 1 | US FAERS | |
| 206 | Hostility | FAERS: 1 | US FAERS | |
| 207 | Hypervigilance | FAERS: 1 | US FAERS | |
| 208 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 209 | In-stent arterial restenosis | FAERS: 1 | US FAERS | |
| 210 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 211 | Inflammation | FAERS: 1 | US FAERS | |
| 212 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 213 | Injection site dryness | FAERS: 1 | US FAERS | |
| 214 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 215 | Injection site papule | FAERS: 1 | US FAERS | |
| 216 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 217 | Joint destruction | FAERS: 1 | US FAERS | |
| 218 | Joint injury | FAERS: 1 | US FAERS | |
| 219 | Laryngitis | FAERS: 1 | US FAERS | |
| 220 | Leukopenia | FAERS: 1 | US FAERS | |
| 221 | Limbal swelling | FAERS: 1 | US FAERS | |
| 222 | Lip swelling | FAERS: 1 | US FAERS | |
| 223 | Lipoma | FAERS: 1 | US FAERS | |
| 224 | Loose tooth | FAERS: 1 | US FAERS | |
| 225 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 226 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 227 | Lymphoma | FAERS: 1 | US FAERS | |
| 228 | Medication Error | FAERS: 1 | US FAERS | |
| 229 | Menopause | FAERS: 1 | US FAERS | |
| 230 | Menorrhagia | FAERS: 1 | US FAERS | |
| 231 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 232 | Muscle strain | FAERS: 1 | US FAERS | |
| 233 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 234 | Nerve injury | FAERS: 1 | US FAERS | |
| 235 | Nervousness | FAERS: 1 | US FAERS | |
| 236 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 237 | Pain of skin | FAERS: 1 | US FAERS | |
| 238 | Penetrating abdominal trauma | FAERS: 1 | US FAERS | |
| 239 | Pertussis | FAERS: 1 | US FAERS | |
| 240 | Polyuria | FAERS: 1 | US FAERS | |
| 241 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 242 | Presyncope | FAERS: 1 | US FAERS | |
| 243 | Product contamination physical | FAERS: 1 | US FAERS | |
| 244 | Product storage error | FAERS: 1 | US FAERS | |
| 245 | Product supply issue | FAERS: 1 | US FAERS | |
| 246 | Prostatectomy | FAERS: 1 | US FAERS | |
| 247 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 248 | Rash erythematous | FAERS: 1 | US FAERS | |
| 249 | Renal pain | FAERS: 1 | US FAERS | |
| 250 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 251 | Retching | FAERS: 1 | US FAERS | |
| 252 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 253 | Sciatica | FAERS: 1 | US FAERS | |
| 254 | Septic arthritis streptococcal | FAERS: 1 | US FAERS | |
| 255 | Skin cosmetic procedure | FAERS: 1 | US FAERS | |
| 256 | Skin tightness | FAERS: 1 | US FAERS | |
| 257 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 258 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 259 | Suicide attempt | FAERS: 1 | US FAERS | |
| 260 | T-lymphocyte count increased | FAERS: 1 | US FAERS | |
| 261 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 262 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 263 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 264 | Therapy cessation | FAERS: 1 | US FAERS | |
| 265 | Thermal burn | FAERS: 1 | US FAERS | |
| 266 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 267 | Tinnitus | FAERS: 1 | US FAERS | |
| 268 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 269 | Transaminases increased | FAERS: 1 | US FAERS | |
| 270 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 271 | Urine output increased | FAERS: 1 | US FAERS | |
| 272 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 273 | Wheezing | FAERS: 1 | US FAERS | |
| 274 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 275 | jaundice | FAERS: 1 | US FAERS | |
| 276 | liposarcoma | FAERS: 1 | US FAERS | |
| 277 | muscle injury | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.