Adderall
(PYHRZPFZZDCOPH-QXGOIDDHSA-N)
Structure
- SMILES
- OS(=O)(=O)O.C[C@@H](Cc1ccccc1)N.C[C@@H](Cc1ccccc1)N
- Molecular Formula:
- C18H28N2O4S
- Molecular Weight:
- 368.491
- Log P:
- 4.9812
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 135.02
- CAS Number(s):
- 51-63-8
Synonym(s)
1.
Adderall
2.
Obetrol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 328 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Product quality issue | FAERS: 91 | US FAERS | |
| 4 | Headache | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 59 | US FAERS | |
| 6 | Feeling abnormal | FAERS: 40 | US FAERS | |
| 7 | Somnolence | FAERS: 40 | US FAERS | |
| 8 | Nausea | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Anxiety | FAERS: 32 | US FAERS | |
| 10 | Dizziness | FAERS: 29 | US FAERS | |
| 11 | Malaise | FAERS: 27 | US FAERS | |
| 12 | Agitation | FAERS: 18 | US FAERS | |
| 13 | Product taste abnormal | FAERS: 16 | US FAERS | |
| 14 | Palpitations | FAERS: 15 | US FAERS | |
| 15 | Drug dispensing error | FAERS: 14 | US FAERS | |
| 16 | Product physical issue | FAERS: 14 | US FAERS | |
| 17 | Tremor | FAERS: 13 | US FAERS | |
| 18 | Vomiting | FAERS: 13 | US FAERS | |
| 19 | Asthenia | FAERS: 12 | US FAERS | |
| 20 | Drug effect incomplete | FAERS: 12 | US FAERS | |
| 21 | Anger | FAERS: 11 | US FAERS | |
| 22 | Lethargy | FAERS: 10 | US FAERS | |
| 23 | Pain | FAERS: 10 | US FAERS | |
| 24 | Weight decreased | FAERS: 10 | US FAERS | |
| 25 | Constipation | FAERS: 9 | US FAERS | |
| 26 | Crying | FAERS: 9 | US FAERS | |
| 27 | Product formulation issue | FAERS: 9 | US FAERS | |
| 28 | Impaired work ability | FAERS: 8 | US FAERS | |
| 29 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 30 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 31 | Drug effect variable | FAERS: 7 | US FAERS | |
| 32 | Dyspepsia | FAERS: 7 | US FAERS | |
| 33 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 34 | Adverse event | FAERS: 6 | US FAERS | |
| 35 | Depressed mood | FAERS: 6 | US FAERS | |
| 36 | Dysgeusia | FAERS: 6 | US FAERS | |
| 37 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 39 | Pruritus | FAERS: 6 | US FAERS | |
| 40 | Alopecia | FAERS: 5 | US FAERS | |
| 41 | Chest Pain | FAERS: 5 | US FAERS | |
| 42 | Chest discomfort | FAERS: 5 | US FAERS | |
| 43 | Feeling jittery | FAERS: 5 | US FAERS | |
| 44 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 45 | Mood swings | FAERS: 5 | US FAERS | |
| 46 | Myalgia | FAERS: 5 | US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 48 | Suspected counterfeit product | FAERS: 5 | US FAERS | |
| 49 | Therapeutic response changed | FAERS: 5 | US FAERS | |
| 50 | Therapeutic response unexpected with drug substitution | FAERS: 5 | US FAERS | |
| 51 | Urticaria | FAERS: 5 | US FAERS | |
| 52 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 53 | Bruxism | FAERS: 4 | US FAERS | |
| 54 | Disorientation | FAERS: 4 | US FAERS | |
| 55 | Drug Dependence | FAERS: 4 | US FAERS | |
| 56 | Flatulence | FAERS: 4 | US FAERS | |
| 57 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 58 | Panic Disorder | FAERS: 4 | US FAERS | |
| 59 | Paranoia | FAERS: 4 | US FAERS | |
| 60 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 61 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 62 | Product availability issue | FAERS: 4 | US FAERS | |
| 63 | Product counterfeit | FAERS: 4 | US FAERS | |
| 64 | Product measured potency issue | FAERS: 4 | US FAERS | |
| 65 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 66 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 67 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 68 | Therapy change | FAERS: 4 | US FAERS | |
| 69 | Vertigo | FAERS: 4 | US FAERS | |
| 70 | treatment failure | FAERS: 4 | US FAERS | |
| 71 | Apathy | FAERS: 3 | US FAERS | |
| 72 | Chills | FAERS: 3 | US FAERS | |
| 73 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 74 | Discomfort | FAERS: 3 | US FAERS | |
| 75 | Economic problem | FAERS: 3 | US FAERS | |
| 76 | Educational problem | FAERS: 3 | US FAERS | |
| 77 | Flushing | FAERS: 3 | US FAERS | |
| 78 | Hypersomnia | FAERS: 3 | US FAERS | |
| 79 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 80 | Influenza | FAERS: 3 | US FAERS | |
| 81 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 82 | Medication Error | FAERS: 3 | US FAERS | |
| 83 | Personality Change | FAERS: 3 | US FAERS | |
| 84 | Product contamination | FAERS: 3 | US FAERS | |
| 85 | Product dispensing error | FAERS: 3 | US FAERS | |
| 86 | Product tampering | FAERS: 3 | US FAERS | |
| 87 | Product use issue | FAERS: 3 | US FAERS | |
| 88 | Tachycardia | FAERS: 3 | US FAERS | |
| 89 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 90 | Throat irritation | FAERS: 3 | US FAERS | |
| 91 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 92 | Urinary hesitation | FAERS: 3 | US FAERS | |
| 93 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 94 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 95 | Acne | FAERS: 2 | US FAERS | |
| 96 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 97 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 98 | Anorexia | FAERS: 2 | US FAERS | |
| 99 | Asphyxia | FAERS: 2 | US FAERS | |
| 100 | Asthenopia | FAERS: 2 | US FAERS | |
| 101 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 102 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 103 | Change in sustained attention | FAERS: 2 | US FAERS | |
| 104 | Completed Suicide | FAERS: 2 | US FAERS | |
| 105 | Disease recurrence | FAERS: 2 | US FAERS | |
| 106 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 107 | Drug abuse | FAERS: 2 | US FAERS | |
| 108 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 109 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 110 | Drug screen negative | FAERS: 2 | US FAERS | |
| 111 | Drug screen positive | FAERS: 2 | US FAERS | |
| 112 | Dry skin | FAERS: 2 | US FAERS | |
| 113 | Dystonia | FAERS: 2 | US FAERS | |
| 114 | Emotional disorder | FAERS: 2 | US FAERS | |
| 115 | Emotional poverty | FAERS: 2 | US FAERS | |
| 116 | Erythema | FAERS: 2 | US FAERS | |
| 117 | Formication | FAERS: 2 | US FAERS | |
| 118 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 119 | Hostility | FAERS: 2 | US FAERS | |
| 120 | Hunger | FAERS: 2 | US FAERS | |
| 121 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 122 | Joint swelling | FAERS: 2 | US FAERS | |
| 123 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 124 | Memory impairment | FAERS: 2 | US FAERS | |
| 125 | Muscle tightness | FAERS: 2 | US FAERS | |
| 126 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 127 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 128 | Neck Pain | FAERS: 2 | US FAERS | |
| 129 | Overdose | FAERS: 2 | US FAERS | |
| 130 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 131 | Product commingling | FAERS: 2 | US FAERS | |
| 132 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 133 | Product shape issue | FAERS: 2 | US FAERS | |
| 134 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 135 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 136 | Restlessness | FAERS: 2 | US FAERS | |
| 137 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 138 | Stomatitis | FAERS: 2 | US FAERS | |
| 139 | Stress | FAERS: 2 | US FAERS | |
| 140 | Syncope | FAERS: 2 | US FAERS | |
| 141 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 142 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 143 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 144 | Therapeutic product effect variable | FAERS: 2 | US FAERS | |
| 145 | Therapy cessation | FAERS: 2 | US FAERS | |
| 146 | Tinnitus | FAERS: 2 | US FAERS | |
| 147 | Unevaluable event | FAERS: 2 | US FAERS | |
| 148 | Visual Impairment | FAERS: 2 | US FAERS | |
| 149 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 150 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 151 | Accidental exposure | FAERS: 1 | US FAERS | |
| 152 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 153 | Ageusia | FAERS: 1 | US FAERS | |
| 154 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 155 | Amnesia | FAERS: 1 | US FAERS | |
| 156 | Anosmia | FAERS: 1 | US FAERS | |
| 157 | Aphagia | FAERS: 1 | US FAERS | |
| 158 | Arthralgia | FAERS: 1 | US FAERS | |
| 159 | Arthritis | FAERS: 1 | US FAERS | |
| 160 | Asthma | FAERS: 1 | US FAERS | |
| 161 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 162 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 163 | Back Pain | FAERS: 1 | US FAERS | |
| 164 | Bedridden | FAERS: 1 | US FAERS | |
| 165 | Bladder pain | FAERS: 1 | US FAERS | |
| 166 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 167 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 168 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 169 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 170 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 171 | Burning sensation | FAERS: 1 | US FAERS | |
| 172 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 173 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 174 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 175 | Choking | FAERS: 1 | US FAERS | |
| 176 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 177 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 178 | Dehydration | FAERS: 1 | US FAERS | |
| 179 | Delirium | FAERS: 1 | US FAERS | |
| 180 | Dental caries | FAERS: 1 | US FAERS | |
| 181 | Disease complication | FAERS: 1 | US FAERS | |
| 182 | Dissociation | FAERS: 1 | US FAERS | |
| 183 | Diverticulitis | FAERS: 1 | US FAERS | |
| 184 | Drug abuser | FAERS: 1 | US FAERS | |
| 185 | Drug administration error | FAERS: 1 | US FAERS | |
| 186 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 187 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 188 | Drug level changed | FAERS: 1 | US FAERS | |
| 189 | Drug name confusion | FAERS: 1 | US FAERS | |
| 190 | Drug titration error | FAERS: 1 | US FAERS | |
| 191 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 192 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 193 | Emotional distress | FAERS: 1 | US FAERS | |
| 194 | Epilepsy | FAERS: 1 | US FAERS | |
| 195 | Epistaxis | FAERS: 1 | US FAERS | |
| 196 | Expired drug administered | FAERS: 1 | US FAERS | |
| 197 | Expired product administered | FAERS: 1 | US FAERS | |
| 198 | Extra dose administered | FAERS: 1 | US FAERS | |
| 199 | Eye pain | FAERS: 1 | US FAERS | |
| 200 | Frustration | FAERS: 1 | US FAERS | |
| 201 | General symptom | FAERS: 1 | US FAERS | |
| 202 | Growth retardation | FAERS: 1 | US FAERS | |
| 203 | Hernia | FAERS: 1 | US FAERS | |
| 204 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 205 | Hypotension | FAERS: 1 | US FAERS | |
| 206 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 207 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 208 | Incontinence | FAERS: 1 | US FAERS | |
| 209 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 210 | Inflammation | FAERS: 1 | US FAERS | |
| 211 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 212 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 213 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 214 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 215 | Joint stiffness | FAERS: 1 | US FAERS | |
| 216 | Limb discomfort | FAERS: 1 | US FAERS | |
| 217 | Lip swelling | FAERS: 1 | US FAERS | |
| 218 | Live Birth | FAERS: 1 | US FAERS | |
| 219 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 220 | Malabsorption | FAERS: 1 | US FAERS | |
| 221 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 222 | Medication residue present | FAERS: 1 | US FAERS | |
| 223 | Mental impairment | FAERS: 1 | US FAERS | |
| 224 | Mental status changes | FAERS: 1 | US FAERS | |
| 225 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 226 | Narcolepsy | FAERS: 1 | US FAERS | |
| 227 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 228 | Nervousness | FAERS: 1 | US FAERS | |
| 229 | Neuralgia | FAERS: 1 | US FAERS | |
| 230 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 231 | No adverse event | FAERS: 1 | US FAERS | |
| 232 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 233 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 234 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 235 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 236 | Oral pain | FAERS: 1 | US FAERS | |
| 237 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 238 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 239 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 240 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 241 | Physical assault | FAERS: 1 | US FAERS | |
| 242 | Poisoning | FAERS: 1 | US FAERS | |
| 243 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 244 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 245 | Presyncope | FAERS: 1 | US FAERS | |
| 246 | Product coating issue | FAERS: 1 | US FAERS | |
| 247 | Product complaint | FAERS: 1 | US FAERS | |
| 248 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 249 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 250 | Product label confusion | FAERS: 1 | US FAERS | |
| 251 | Product lot number issue | FAERS: 1 | US FAERS | |
| 252 | Product size issue | FAERS: 1 | US FAERS | |
| 253 | Product storage error | FAERS: 1 | US FAERS | |
| 254 | Product use complaint | FAERS: 1 | US FAERS | |
| 255 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 256 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 257 | Retching | FAERS: 1 | US FAERS | |
| 258 | Rhinitis | FAERS: 1 | US FAERS | |
| 259 | Schizophrenia | FAERS: 1 | US FAERS | |
| 260 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 261 | Somnambulism | FAERS: 1 | US FAERS | |
| 262 | Staring | FAERS: 1 | US FAERS | |
| 263 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 264 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 265 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 266 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 267 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 268 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 269 | Yawning | FAERS: 1 | US FAERS | |
| 270 | furuncle | FAERS: 1 | US FAERS | |
| 271 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.