silodosin
(PNCPYILNMDWPEY-QGZVFWFLSA-N)
Structure
- SMILES
- OCCCN1CCc2c1c(cc(c2)C[C@H](NCCOc1ccccc1OCC(F)(F)F)C)C(=O)N
- Type(s)
- Approved
- ATC code(s)
- G04CA04
- Molecular Formula:
- C25H32F3N3O4
- Molecular Weight:
- 495.534
- Log P:
- 4.2273
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 97.05
- CAS Number(s):
- 160970-54-7; 160970-64-9
Synonym(s)
1.
silodosin
2.
1-(3-hydroxypropyl)-5-(2-(2-(2-(2,2,2-trifluoroethoxy)phenoxy)ethylamino)propyl)indoline-7-carboxamide
3.
KMD 3213
4.
KMD-3213
5.
rapaflo
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 82 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Retrograde ejaculation | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 4 | Headache | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Syncope | FAERS: 17 | SIDER US FAERS | |
| 6 | Constipation | FAERS: 10 | US FAERS | |
| 7 | Dysuria | FAERS: 10 | OFFSIDES US FAERS | |
| 8 | Fatigue | FAERS: 10 | US FAERS | |
| 9 | Myalgia | FAERS: 9 | US FAERS | |
| 10 | Nausea | FAERS: 9 | SIDER US FAERS | |
| 11 | Urinary Retention | FAERS: 9 | US FAERS | |
| 12 | Malaise | FAERS: 7 | US FAERS | |
| 13 | Pruritus | FAERS: 7 | SIDER US FAERS | |
| 14 | Asthenia | FAERS: 6 | SIDER US FAERS | |
| 15 | Back Pain | FAERS: 6 | US FAERS | |
| 16 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 17 | Erectile dysfunction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Hypotension | FAERS: 6 | SIDER US FAERS | |
| 19 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 5 | SIDER US FAERS | |
| 21 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 22 | Lip swelling | FAERS: 5 | US FAERS | |
| 23 | Pain | FAERS: 5 | US FAERS | |
| 24 | Palpitations | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 25 | Chest Pain | FAERS: 4 | US FAERS | |
| 26 | Drug dose omission | FAERS: 4 | US FAERS | |
| 27 | Erythema | FAERS: 4 | US FAERS | |
| 28 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 29 | Flatulence | FAERS: 4 | US FAERS | |
| 30 | Nocturia | FAERS: 4 | US FAERS | |
| 31 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 32 | Urticaria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 34 | Blood urine present | FAERS: 3 | US FAERS | |
| 35 | Burning sensation | FAERS: 3 | US FAERS | |
| 36 | Disorientation | FAERS: 3 | US FAERS | |
| 37 | Expired product administered | FAERS: 3 | US FAERS | |
| 38 | Flushing | FAERS: 3 | US FAERS | |
| 39 | Pneumonia | FAERS: 3 | US FAERS | |
| 40 | Somnolence | FAERS: 3 | US FAERS | |
| 41 | Urine flow decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Adverse event | FAERS: 2 | US FAERS | |
| 43 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 44 | Angioedema | FAERS: 2 | US FAERS | |
| 45 | Bladder pain | FAERS: 2 | US FAERS | |
| 46 | Chills | FAERS: 2 | US FAERS | |
| 47 | Chromaturia | FAERS: 2 | US FAERS | |
| 48 | Cold sweat | FAERS: 2 | US FAERS | |
| 49 | Dehydration | FAERS: 2 | US FAERS | |
| 50 | Epistaxis | FAERS: 2 | US FAERS | |
| 51 | Feeling jittery | FAERS: 2 | US FAERS | |
| 52 | Head discomfort | FAERS: 2 | US FAERS | |
| 53 | Impaired work ability | FAERS: 2 | US FAERS | |
| 54 | Lethargy | FAERS: 2 | US FAERS | |
| 55 | Myoglobinuria | FAERS: 2 | US FAERS | |
| 56 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 57 | Nervousness | FAERS: 2 | US FAERS | |
| 58 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 59 | Paraplegia | FAERS: 2 | US FAERS | |
| 60 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 61 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 62 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 63 | Rash erythematous | FAERS: 2 | US FAERS | |
| 64 | Renal pain | FAERS: 2 | US FAERS | |
| 65 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 66 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 67 | Skin irritation | FAERS: 2 | US FAERS | |
| 68 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 69 | Tremor | FAERS: 2 | US FAERS | |
| 70 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 71 | Urinary Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Vomiting | FAERS: 2 | US FAERS | |
| 73 | Abasia | FAERS: 1 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 75 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 76 | Acute myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 77 | Alopecia | FAERS: 1 | US FAERS | |
| 78 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 79 | Anger | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Anxiety | FAERS: 1 | US FAERS | |
| 81 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 82 | Arthralgia | FAERS: 1 | US FAERS | |
| 83 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 84 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 85 | Azoospermia | FAERS: 1 | US FAERS | |
| 86 | Back disorder | FAERS: 1 | US FAERS | |
| 87 | Blindness | FAERS: 1 | US FAERS | |
| 88 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 89 | Blood iron increased | FAERS: 1 | US FAERS | |
| 90 | Bradycardia | FAERS: 1 | US FAERS | |
| 91 | Breast tenderness | FAERS: 1 | US FAERS | |
| 92 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 93 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 94 | Chest discomfort | FAERS: 1 | US FAERS | |
| 95 | Choking sensation | FAERS: 1 | US FAERS | |
| 96 | Choking | FAERS: 1 | US FAERS | |
| 97 | Cystitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 99 | Dementia | FAERS: 1 | US FAERS | |
| 100 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 101 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 102 | Dose calculation error | FAERS: 1 | US FAERS | |
| 103 | Drug abuse | FAERS: 1 | US FAERS | |
| 104 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 105 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 106 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 107 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 108 | Dyspareunia | FAERS: 1 | US FAERS | |
| 109 | Dysphonia | FAERS: 1 | US FAERS | |
| 110 | Dystonia | FAERS: 1 | US FAERS | |
| 111 | Ear congestion | FAERS: 1 | US FAERS | |
| 112 | Ear discomfort | FAERS: 1 | US FAERS | |
| 113 | Economic problem | FAERS: 1 | US FAERS | |
| 114 | Eczema | FAERS: 1 | US FAERS | |
| 115 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 116 | Epilepsy | FAERS: 1 | US FAERS | |
| 117 | Erection increased | FAERS: 1 | US FAERS | |
| 118 | Eructation | FAERS: 1 | US FAERS | |
| 119 | Erythema Multiforme | FAERS: 1 | OFFSIDES US FAERS | |
| 120 | Eye irritation | FAERS: 1 | US FAERS | |
| 121 | Eye pain | FAERS: 1 | US FAERS | |
| 122 | Feeling Cold | FAERS: 1 | US FAERS | |
| 123 | Fixed eruption | FAERS: 1 | US FAERS | |
| 124 | Gout | FAERS: 1 | US FAERS | |
| 125 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 126 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 127 | Incoherent | FAERS: 1 | US FAERS | |
| 128 | Incontinence | FAERS: 1 | US FAERS | |
| 129 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 130 | Initial insomnia | FAERS: 1 | US FAERS | |
| 131 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 132 | Ketosis | FAERS: 1 | US FAERS | |
| 133 | Liver induration | FAERS: 1 | US FAERS | |
| 134 | Mental impairment | FAERS: 1 | US FAERS | |
| 135 | Mental status changes | FAERS: 1 | US FAERS | |
| 136 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 137 | Middle insomnia | FAERS: 1 | US FAERS | |
| 138 | Mouth swelling | FAERS: 1 | US FAERS | |
| 139 | Muscle tightness | FAERS: 1 | US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 141 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 142 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 143 | Overdose | FAERS: 1 | US FAERS | |
| 144 | Pancytopenia | FAERS: 1 | US FAERS | |
| 145 | Papule | FAERS: 1 | US FAERS | |
| 146 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 147 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 148 | Penile blister | FAERS: 1 | US FAERS | |
| 149 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 150 | Perineal induration | FAERS: 1 | US FAERS | |
| 151 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 152 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 153 | Product dose omission | FAERS: 1 | US FAERS | |
| 154 | Product physical issue | FAERS: 1 | US FAERS | |
| 155 | Product quality issue | FAERS: 1 | US FAERS | |
| 156 | Product use issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Prostatic pain | FAERS: 1 | US FAERS | |
| 158 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 159 | Respiratory distress | FAERS: 1 | US FAERS | |
| 160 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 161 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 162 | Rhinalgia | FAERS: 1 | US FAERS | |
| 163 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 164 | Sinus headache | FAERS: 1 | US FAERS | |
| 165 | Skin lesion | FAERS: 1 | US FAERS | |
| 166 | Skin reaction | FAERS: 1 | US FAERS | |
| 167 | Sluggishness | FAERS: 1 | US FAERS | |
| 168 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 169 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 170 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 171 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 172 | Suture insertion | FAERS: 1 | US FAERS | |
| 173 | Swelling | FAERS: 1 | US FAERS | |
| 174 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 175 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 176 | Thirst | FAERS: 1 | US FAERS | |
| 177 | Throat irritation | FAERS: 1 | US FAERS | |
| 178 | Tinnitus | FAERS: 1 | US FAERS | |
| 179 | Tongue blistering | FAERS: 1 | US FAERS | |
| 180 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 181 | Urinary hesitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Urine output increased | FAERS: 1 | US FAERS | |
| 183 | Vertigo | FAERS: 1 | US FAERS | |
| 184 | Visual Impairment | FAERS: 1 | US FAERS | |
| 185 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 186 | Weight decreased | FAERS: 1 | US FAERS | |
| 187 | prostatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 188 | Adenocarcinoma | OFFSIDES | ||
| 189 | Alanine Aminotransferase Increased | OFFSIDES | ||
| 190 | Anal abscess | OFFSIDES | ||
| 191 | Anti-insulin antibody positive | OFFSIDES | ||
| 192 | Anticonvulsant drug level decreased | OFFSIDES | ||
| 193 | Blood Glucose | OFFSIDES | ||
| 194 | Blood albumin decreased | OFFSIDES | ||
| 195 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 196 | Blood amylase increased | OFFSIDES | ||
| 197 | Blood cholinesterase decreased | OFFSIDES | ||
| 198 | Blood creatinine increased | OFFSIDES | ||
| 199 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 200 | Blood potassium increased | OFFSIDES | ||
| 201 | Blood sodium | OFFSIDES | ||
| 202 | Blood urea increased | OFFSIDES | ||
| 203 | Blood uric acid decreased | OFFSIDES | ||
| 204 | Blood uric acid | OFFSIDES | ||
| 205 | Complicated fracture | OFFSIDES | ||
| 206 | Diet refusal | OFFSIDES | ||
| 207 | Disturbance in sexual arousal | SIDER | ||
| 208 | Floppy iris syndrome | SIDER | ||
| 209 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 210 | Gastroenteritis | OFFSIDES | ||
| 211 | Gastrointestinal Pain | SIDER | ||
| 212 | Granulocyte count decreased | OFFSIDES | ||
| 213 | Incorrect drug dosage form administered | OFFSIDES | ||
| 214 | Infusion site mobility decreased | OFFSIDES | ||
| 215 | Intraoperative floppy iris syndrome | SIDER | ||
| 216 | Large intestine perforation | OFFSIDES | ||
| 217 | Liver carcinoma ruptured | OFFSIDES | ||
| 218 | Lymphocyte count decreased | OFFSIDES | ||
| 219 | Malabsorption from injection site | OFFSIDES | ||
| 220 | Mechanical ventilation | OFFSIDES | ||
| 221 | Myelitis | OFFSIDES | ||
| 222 | Neutrophil count decreased | OFFSIDES | ||
| 223 | Oral pain | Canada Vigilance: 1 | Canada Vigilance | |
| 224 | Peritonitis | OFFSIDES | ||
| 225 | Priapism | SIDER | ||
| 226 | Procedural complication | SIDER | ||
| 227 | Protein total decreased | OFFSIDES | ||
| 228 | Pyelonephritis | OFFSIDES | ||
| 229 | Rhinorrhea | OFFSIDES | ||
| 230 | Shock | SIDER | ||
| 231 | Urologic Diseases | 20126606 | CTD | |
| 232 | Vascular purpura | SIDER | ||
| 233 | Wound dehiscence | OFFSIDES | ||
| 234 | jaundice | SIDER | ||
| 235 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.