Trabectedin
(PKVRCIRHQMSYJX-AIFWHQITSA-N)
Structure
- SMILES
- COc1cc2c(cc1O)CCN[C@@]12CS[C@@H]2c3c(OC(=O)C)c(C)c4c(c3[C@H](COC1=O)N1[C@@H]2[C@@H]2N([C@H]([C@@H]1O)Cc1c2c(O)c(c(c1)C)OC)C)OCO4
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01CX01
- Molecular Formula:
- C39H43N3O11S
- Molecular Weight:
- 761.837
- Log P:
- 3.6178
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 4
- TPSA:
- 194.02
- CAS Number(s):
- 114899-77-3
Synonym(s)
1.
Trabectedin
2.
ET 743
3.
ET-743
4.
Ecteinascidin 743
5.
NSC 684766
6.
Yondelis
7.
ET743
External Link(s)
| MeSH | D000077606 |
| PubChem Compound | 108150 |
| ChEBI | 84050 |
| CHEMBL | CHEMBL450449 |
| DrugBank | DB05109 |
| DrugCentral | 4633 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 2774 |
| Therapeutic Target Database | D03RTK |
| ZINC | 150338708 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Rhabdomyolysis | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 2 | Neutropenia | FAERS: 21 Canada Vigilance: 1 | 20406837 | CTD SIDER Canada Vigilance US FAERS |
| 3 | Nausea | FAERS: 17 | SIDER US FAERS | |
| 4 | Pancytopenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Fatigue | FAERS: 13 | SIDER US FAERS | |
| 6 | Vomiting | FAERS: 13 | SIDER US FAERS | |
| 7 | Drug dose omission | FAERS: 12 | US FAERS | |
| 8 | Sepsis | FAERS: 11 | SIDER US FAERS | |
| 9 | Acute kidney injury | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Extravasation | FAERS: 10 | SIDER US FAERS | |
| 11 | Thrombocytopenia | FAERS: 10 | SIDER US FAERS | |
| 12 | Blood creatine phosphokinase increased | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 13 | Adverse event | FAERS: 8 | US FAERS | |
| 14 | Alanine Aminotransferase Increased | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 15 | Catheter site related reaction | FAERS: 8 | US FAERS | |
| 16 | Pneumonia | FAERS: 8 | US FAERS | |
| 17 | Aspartate Aminotransferase Increased | FAERS: 7 | SIDER US FAERS | |
| 18 | Catheter site erythema | FAERS: 7 | US FAERS | |
| 19 | Hepatotoxicity | FAERS: 7 | SIDER US FAERS | |
| 20 | Leukopenia | FAERS: 7 | SIDER US FAERS | |
| 21 | Asthenia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 22 | Device malfunction | FAERS: 6 | US FAERS | |
| 23 | Medical device site fibrosis | FAERS: 6 | US FAERS | |
| 24 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 25 | Constipation | FAERS: 5 | SIDER US FAERS | |
| 26 | Device infusion issue | FAERS: 5 | US FAERS | |
| 27 | Febrile Neutropenia | FAERS: 5 | SIDER US FAERS | |
| 28 | Infusion Site Extravasation | FAERS: 5 | US FAERS | |
| 29 | Catheter site pain | FAERS: 4 | US FAERS | |
| 30 | Dehydration | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 31 | Drug ineffective | FAERS: 4 | US FAERS | |
| 32 | Erythema | FAERS: 4 | US FAERS | |
| 33 | Haematotoxicity | FAERS: 4 | US FAERS | |
| 34 | Injection site erythema | FAERS: 4 | US FAERS | |
| 35 | Myalgia | FAERS: 4 | SIDER US FAERS | |
| 36 | Neutrophil count decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 37 | Pain | FAERS: 4 | US FAERS | |
| 38 | Transaminases increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 40 | Blood alkaline phosphatase increased | FAERS: 3 | SIDER US FAERS | |
| 41 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 42 | Device occlusion | FAERS: 3 | US FAERS | |
| 43 | Device related infection | FAERS: 3 | US FAERS | |
| 44 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 45 | Gamma-Glutamyltransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 46 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 47 | Pneumonitis | FAERS: 3 | US FAERS | |
| 48 | Product use issue | FAERS: 3 | US FAERS | |
| 49 | Somnolence | FAERS: 3 | US FAERS | |
| 50 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 51 | Abdominal Pain | FAERS: 2 | SIDER US FAERS | |
| 52 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 53 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 54 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 55 | Agitation | FAERS: 2 | US FAERS | |
| 56 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 57 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 58 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 59 | Catheter site swelling | FAERS: 2 | US FAERS | |
| 60 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 61 | Disease Progression | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Infection | FAERS: 2 | SIDER US FAERS | |
| 63 | Infusion site irritation | FAERS: 2 | US FAERS | |
| 64 | Infusion site pain | FAERS: 2 | US FAERS | |
| 65 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 66 | Malaise | FAERS: 2 | US FAERS | |
| 67 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 68 | Medication Error | FAERS: 2 | US FAERS | |
| 69 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 70 | Myocarditis | FAERS: 2 | US FAERS | |
| 71 | Neutrophilic dermatosis | FAERS: 2 | US FAERS | |
| 72 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 73 | Product dose omission | FAERS: 2 | US FAERS | |
| 74 | Product packaging counterfeit | FAERS: 2 | US FAERS | |
| 75 | Product preparation error | FAERS: 2 | US FAERS | |
| 76 | Product substitution issue | FAERS: 2 | US FAERS | |
| 77 | Renal tubular necrosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 78 | Respiratory Failure | FAERS: 2 | OFFSIDES US FAERS | |
| 79 | Weight decreased | FAERS: 2 | SIDER US FAERS | |
| 80 | leiomyosarcoma | FAERS: 2 | US FAERS | |
| 81 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 82 | Application site induration | FAERS: 1 | US FAERS | |
| 83 | Arteritis | FAERS: 1 | US FAERS | |
| 84 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 85 | Back Pain | FAERS: 1 | SIDER US FAERS | |
| 86 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 87 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 88 | Blood creatinine increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 89 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 90 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 91 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 92 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 93 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 94 | Bone pain | FAERS: 1 | US FAERS | |
| 95 | Burning sensation | FAERS: 1 | US FAERS | |
| 96 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 97 | Catheter site inflammation | FAERS: 1 | US FAERS | |
| 98 | Catheter site pruritus | FAERS: 1 | US FAERS | |
| 99 | Cellulitis | FAERS: 1 | US FAERS | |
| 100 | Childhood | FAERS: 1 | US FAERS | |
| 101 | Cholestasis | FAERS: 1 | US FAERS | |
| 102 | Complication associated with device | FAERS: 1 | US FAERS | |
| 103 | Cytopenia | FAERS: 1 | US FAERS | |
| 104 | Device dislocation | FAERS: 1 | US FAERS | |
| 105 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 106 | Device use issue | FAERS: 1 | US FAERS | |
| 107 | Disseminated Intravascular Coagulation | FAERS: 1 | OFFSIDES US FAERS | |
| 108 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 109 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 110 | Drug administration error | FAERS: 1 | US FAERS | |
| 111 | Dysarthria | FAERS: 1 | US FAERS | |
| 112 | Embolism | FAERS: 1 | US FAERS | |
| 113 | Epilepsy | FAERS: 1 | US FAERS | |
| 114 | Expired product administered | FAERS: 1 | US FAERS | |
| 115 | Feeling Cold | FAERS: 1 | US FAERS | |
| 116 | Headache | FAERS: 1 | SIDER US FAERS | |
| 117 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 118 | Hydronephrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 119 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 120 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 121 | Hyperventilation | FAERS: 1 | US FAERS | |
| 122 | Hypokinesia | FAERS: 1 | US FAERS | |
| 123 | Hypotension | FAERS: 1 | SIDER US FAERS | |
| 124 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 125 | Implant site pustules | FAERS: 1 | US FAERS | |
| 126 | Implant site ulcer | FAERS: 1 | US FAERS | |
| 127 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 128 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 129 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 130 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 131 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 132 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 133 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 134 | Initial insomnia | FAERS: 1 | US FAERS | |
| 135 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 136 | Injection site pain | FAERS: 1 | US FAERS | |
| 137 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 138 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 139 | Joint swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 141 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 142 | Lymphopenia | FAERS: 1 | US FAERS | |
| 143 | Medical device site thrombosis | FAERS: 1 | US FAERS | |
| 144 | Memory impairment | FAERS: 1 | US FAERS | |
| 145 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 146 | Needle issue | FAERS: 1 | US FAERS | |
| 147 | Neutropenic sepsis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 148 | Night sweats | FAERS: 1 | US FAERS | |
| 149 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 150 | Oliguria | FAERS: 1 | US FAERS | |
| 151 | Phlebitis | FAERS: 1 | US FAERS | |
| 152 | Pneumothorax | FAERS: 1 | US FAERS | |
| 153 | Product counterfeit | FAERS: 1 | US FAERS | |
| 154 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 155 | Product label counterfeit | FAERS: 1 | US FAERS | |
| 156 | Product lot number issue | FAERS: 1 | US FAERS | |
| 157 | Product origin unknown | FAERS: 1 | US FAERS | |
| 158 | Product quality issue | FAERS: 1 | US FAERS | |
| 159 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 160 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 161 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 162 | Sarcoma | FAERS: 1 | 19238326 | CTD US FAERS |
| 163 | Septic Shock | FAERS: 1 | SIDER US FAERS | |
| 164 | Shock | FAERS: 1 | SIDER US FAERS | |
| 165 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 166 | Sinusitis | FAERS: 1 | US FAERS | |
| 167 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 168 | Subileus | FAERS: 1 | US FAERS | |
| 169 | Sudden death | FAERS: 1 | US FAERS | |
| 170 | Suicide attempt | FAERS: 1 | US FAERS | |
| 171 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 172 | Swelling | FAERS: 1 | US FAERS | |
| 173 | Syncope | FAERS: 1 | SIDER US FAERS | |
| 174 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 175 | Therapy change | FAERS: 1 | US FAERS | |
| 176 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 177 | Thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Tongue blistering | FAERS: 1 | US FAERS | |
| 179 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 180 | Unevaluable event | FAERS: 1 | US FAERS | |
| 181 | Urinary sediment abnormal | FAERS: 1 | US FAERS | |
| 182 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 183 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 184 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 185 | treatment failure | FAERS: 1 | US FAERS | |
| 186 | Agranulocytosis | SIDER | ||
| 187 | Alopecia | SIDER | ||
| 188 | Anemic | SIDER | ||
| 189 | Anorexia | SIDER | ||
| 190 | Arthralgia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 191 | Aura | OFFSIDES | ||
| 192 | Bilirubin conjugated increased | SIDER | ||
| 193 | Blood Glucose | OFFSIDES | ||
| 194 | Blood albumin decreased | SIDER | ||
| 195 | Blood and lymphatic system disorders | SIDER | ||
| 196 | Bradycardia | OFFSIDES | ||
| 197 | Catheter related infection | OFFSIDES | ||
| 198 | Chemical and Drug Induced Liver Injury | 12154027 19238326 | CTD | |
| 199 | Chronic left ventricular failure | OFFSIDES | ||
| 200 | Dermatitis | SIDER | ||
| 201 | Dizziness | SIDER | ||
| 202 | Dysgeusia | SIDER | ||
| 203 | Dyspepsia | SIDER | ||
| 204 | Electrocardiogram change | OFFSIDES | ||
| 205 | Electromechanical dissociation | OFFSIDES | ||
| 206 | Escherichia infection | OFFSIDES | ||
| 207 | Flushing | SIDER | ||
| 208 | Gastrointestinal Pain | SIDER | ||
| 209 | Hemorrhage | 12154027 | CTD | |
| 210 | Hepatomegaly | SIDER | ||
| 211 | Hyperbilirubinemia | 12154027 | CTD | |
| 212 | Hypersensitivity | SIDER | ||
| 213 | Hypoxia | OFFSIDES | ||
| 214 | Infestation | SIDER | ||
| 215 | Injection Site Reaction | SIDER | ||
| 216 | Intestinal Obstruction | OFFSIDES | ||
| 217 | Lethargy | OFFSIDES | ||
| 218 | Liver Cirrhosis, Experimental | 12154027 | CTD | |
| 219 | Malnutrition | SIDER | ||
| 220 | Metabolic acidosis | OFFSIDES | ||
| 221 | Metastatic Neoplasm | Canada Vigilance: 1 | Canada Vigilance | |
| 222 | Musculoskeletal discomfort | SIDER | ||
| 223 | Necrosis | 12154027 | CTD SIDER | |
| 224 | Neutropenic infection | SIDER | ||
| 225 | Pulmonary Embolism | SIDER | ||
| 226 | Traumatic liver injury | SIDER | ||
| 227 | jaundice | SIDER | ||
| 228 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.