romidepsin
(OHRURASPPZQGQM-GCCNXGTGSA-N)
Structure
- SMILES
- C/C=C/1\NC(=O)[C@H]2CSSCC/C=C/[C@@H](OC(=O)[C@@H](NC1=O)C(C)C)CC(=O)N[C@@H](C(=O)N2)C(C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX39
- Molecular Formula:
- C24H36N4O6S2
- Molecular Weight:
- 540.696
- Log P:
- 2.7448
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 193.3
- CAS Number(s):
- 128517-07-7
Synonym(s)
1.
romidepsin
2.
FK228
3.
FR 901228
4.
FR-901228
5.
FR901228
6.
istodax
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 36 | SIDER US FAERS | |
| 2 | Thrombocytopenia | FAERS: 31 | SIDER US FAERS | |
| 3 | Vomiting | FAERS: 26 | SIDER US FAERS | |
| 4 | Fatigue | FAERS: 25 | SIDER US FAERS | |
| 5 | Disease Progression | FAERS: 18 | SIDER US FAERS | |
| 6 | Asthenia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Headache | FAERS: 10 | SIDER US FAERS | |
| 8 | Sepsis | FAERS: 10 | SIDER US FAERS | |
| 9 | Dysgeusia | FAERS: 9 | SIDER US FAERS | |
| 10 | Malaise | FAERS: 8 | US FAERS | |
| 11 | Neutrophil count decreased | FAERS: 8 | US FAERS | |
| 12 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 13 | Chills | FAERS: 7 | SIDER US FAERS | |
| 14 | T-Cell Lymphoma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Aspartate Aminotransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 16 | Cellulitis | FAERS: 6 | SIDER US FAERS | |
| 17 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 18 | Drug ineffective | FAERS: 6 | US FAERS | |
| 19 | Hypotension | FAERS: 6 | SIDER US FAERS | |
| 20 | Infusion Site Extravasation | FAERS: 6 | US FAERS | |
| 21 | Leukopenia | FAERS: 6 | SIDER US FAERS | |
| 22 | Lymphopenia | FAERS: 6 | SIDER US FAERS | |
| 23 | Neutropenia | FAERS: 5 | SIDER US FAERS | |
| 24 | Pneumonia | FAERS: 5 | SIDER US FAERS | |
| 25 | Weight decreased | FAERS: 5 | SIDER US FAERS | |
| 26 | Alanine Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 27 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 28 | Extravasation | FAERS: 4 | US FAERS | |
| 29 | Full blood count decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Infection | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 32 | Septic Shock | FAERS: 4 | SIDER US FAERS | |
| 33 | Abdominal Pain | FAERS: 3 | SIDER US FAERS | |
| 34 | Adverse event | FAERS: 3 | US FAERS | |
| 35 | Ageusia | FAERS: 3 | US FAERS | |
| 36 | Deep Vein Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 37 | Dizziness | FAERS: 3 | SIDER US FAERS | |
| 38 | Fracture | FAERS: 3 | US FAERS | |
| 39 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 40 | Injection site extravasation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Leukocytosis | FAERS: 3 | US FAERS | |
| 42 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 43 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 44 | Oropharyngeal candidiasis | FAERS: 3 | US FAERS | |
| 45 | Pain | FAERS: 3 | US FAERS | |
| 46 | Pancytopenia | FAERS: 3 | US FAERS | |
| 47 | Pharyngitis | FAERS: 3 | US FAERS | |
| 48 | Pulmonary Embolism | FAERS: 3 | SIDER US FAERS | |
| 49 | Splenomegaly | FAERS: 3 | US FAERS | |
| 50 | Syncope | FAERS: 3 | SIDER US FAERS | |
| 51 | Thrombosis | FAERS: 3 | US FAERS | |
| 52 | Troponin increased | FAERS: 3 | US FAERS | |
| 53 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 54 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 55 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 56 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 57 | Chest Pain | FAERS: 2 | SIDER US FAERS | |
| 58 | Dyspepsia | FAERS: 2 | US FAERS | |
| 59 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 60 | Facial paralysis | FAERS: 2 | US FAERS | |
| 61 | Febrile Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 62 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 63 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 64 | Haematotoxicity | FAERS: 2 | US FAERS | |
| 65 | Hepatitis B | FAERS: 2 | US FAERS | |
| 66 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 67 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 68 | Monoplegia | FAERS: 2 | US FAERS | |
| 69 | Mycosis Fungoides | FAERS: 2 | SIDER US FAERS | |
| 70 | Mycosis fungoides recurrent | FAERS: 2 | US FAERS | |
| 71 | Mycosis fungoides stage IV | FAERS: 2 | US FAERS | |
| 72 | Palpitations | FAERS: 2 | US FAERS | |
| 73 | Peripheral T-cell lymphoma unspecified refractory | FAERS: 2 | US FAERS | |
| 74 | Pneumonitis | FAERS: 2 | US FAERS | |
| 75 | Procedural complication | FAERS: 2 | US FAERS | |
| 76 | Product label confusion | FAERS: 2 | US FAERS | |
| 77 | Restlessness | FAERS: 2 | US FAERS | |
| 78 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 79 | Splenic Infarction | FAERS: 2 | US FAERS | |
| 80 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 81 | Sudden death | FAERS: 2 | US FAERS | |
| 82 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 83 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 84 | Acute graft versus host disease in skin | FAERS: 1 | US FAERS | |
| 85 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 86 | Alopecia | FAERS: 1 | US FAERS | |
| 87 | Anaplastic large cell lymphoma T- and null-cell types recurrent | FAERS: 1 | US FAERS | |
| 88 | Arthralgia | FAERS: 1 | US FAERS | |
| 89 | Arthropathy | FAERS: 1 | US FAERS | |
| 90 | Asphyxia | FAERS: 1 | US FAERS | |
| 91 | Back Pain | FAERS: 1 | US FAERS | |
| 92 | Bedridden | FAERS: 1 | US FAERS | |
| 93 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 94 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 95 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 96 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 97 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 98 | Blood urea increased | FAERS: 1 | US FAERS | |
| 99 | Bradycardia | FAERS: 1 | US FAERS | |
| 100 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 101 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 102 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 103 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 104 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 105 | Cytomegalovirus enterocolitis | FAERS: 1 | US FAERS | |
| 106 | Device occlusion | FAERS: 1 | US FAERS | |
| 107 | Discomfort | FAERS: 1 | US FAERS | |
| 108 | Dry skin | FAERS: 1 | US FAERS | |
| 109 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 110 | Enteritis | FAERS: 1 | US FAERS | |
| 111 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 1 | US FAERS | |
| 112 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 113 | Erythema | FAERS: 1 | US FAERS | |
| 114 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 115 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 116 | Flatulence | FAERS: 1 | US FAERS | |
| 117 | Gastritis | FAERS: 1 | US FAERS | |
| 118 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 119 | Hemicephalalgia | FAERS: 1 | US FAERS | |
| 120 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 121 | Hypophagia | FAERS: 1 | US FAERS | |
| 122 | Hypoxia | FAERS: 1 | US FAERS | |
| 123 | Immunosuppression | FAERS: 1 | US FAERS | |
| 124 | Inflammation | FAERS: 1 | US FAERS | |
| 125 | Influenza | FAERS: 1 | US FAERS | |
| 126 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 127 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 128 | Infusion site pain | FAERS: 1 | US FAERS | |
| 129 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 130 | Infusion site ulcer | FAERS: 1 | US FAERS | |
| 131 | Infusion site vesicles | FAERS: 1 | US FAERS | |
| 132 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 133 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 134 | Interleukin-2 receptor increased | FAERS: 1 | US FAERS | |
| 135 | Lip swelling | FAERS: 1 | US FAERS | |
| 136 | Lung Abscess | FAERS: 1 | US FAERS | |
| 137 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 138 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 139 | Lymphoma | FAERS: 1 | US FAERS | |
| 140 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 141 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 142 | Medication Error | FAERS: 1 | US FAERS | |
| 143 | Memory impairment | FAERS: 1 | US FAERS | |
| 144 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 145 | Myalgia | FAERS: 1 | US FAERS | |
| 146 | Mycosis fungoides refractory | FAERS: 1 | US FAERS | |
| 147 | Myocarditis | FAERS: 1 | US FAERS | |
| 148 | Nasopharyngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Nodule | FAERS: 1 | US FAERS | |
| 150 | Pancreatitis | FAERS: 1 | US FAERS | |
| 151 | Performance status decreased | FAERS: 1 | US FAERS | |
| 152 | Periarthritis | FAERS: 1 | US FAERS | |
| 153 | Peripheral T-cell lymphoma unspecified stage IV | FAERS: 1 | US FAERS | |
| 154 | Petechiae | FAERS: 1 | US FAERS | |
| 155 | Product label issue | FAERS: 1 | US FAERS | |
| 156 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 157 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 158 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 159 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 160 | Rash erythematous | FAERS: 1 | US FAERS | |
| 161 | Rectal polyp | FAERS: 1 | US FAERS | |
| 162 | Respiratory distress | FAERS: 1 | US FAERS | |
| 163 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 164 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 165 | Skin irritation | FAERS: 1 | US FAERS | |
| 166 | Skin lesion | FAERS: 1 | US FAERS | |
| 167 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 168 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 169 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 170 | Stridor | FAERS: 1 | US FAERS | |
| 171 | T-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 172 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 173 | Transaminases increased | FAERS: 1 | US FAERS | |
| 174 | Transplantation complication | FAERS: 1 | US FAERS | |
| 175 | Troponin I increased | FAERS: 1 | US FAERS | |
| 176 | Unevaluable event | FAERS: 1 | US FAERS | |
| 177 | Urticaria | FAERS: 1 | US FAERS | |
| 178 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 179 | Vascular device infection | FAERS: 1 | US FAERS | |
| 180 | Ventricular arrhythmia | FAERS: 1 | SIDER US FAERS | |
| 181 | Visual Impairment | FAERS: 1 | US FAERS | |
| 182 | Wound Infection | FAERS: 1 | US FAERS | |
| 183 | Anorexia | SIDER | ||
| 184 | Blood and lymphatic system disorders | SIDER | ||
| 185 | Candida sepsis | SIDER | ||
| 186 | Carcinoma, Transitional Cell | 17230511 | CTD | |
| 187 | Catheter related infection | SIDER | ||
| 188 | Central line infection | SIDER | ||
| 189 | Dehydration | SIDER | ||
| 190 | Dermatitis | SIDER | ||
| 191 | Device related infection | SIDER | ||
| 192 | Gastrointestinal Pain | SIDER | ||
| 193 | Hypersensitivity | SIDER | ||
| 194 | Long QT Syndrome | 21650221 | CTD | |
| 195 | Lymphoma, T-Cell, Cutaneous | 21417297 21634430 21936551 | CTD | |
| 196 | Malnutrition | SIDER | ||
| 197 | Shock | SIDER | ||
| 198 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.