Epirubicin
(MWWSFMDVAYGXBV-FGBSZODSSA-N)
Structure
- SMILES
- OCC(=O)[C@@]1(O)C[C@H](O[C@H]2C[C@H](N)[C@H]([C@@H](O2)C)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC.Cl
- Molecular Formula:
- C27H30ClNO11
- Molecular Weight:
- 579.980
- Log P:
- 1.5036
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 7
- TPSA:
- 206.07
- CAS Number(s):
- 25316-40-9; 56390-09-1
Synonym(s)
1.
Epirubicin
2.
4'-Epiadriamycin
3.
4'-Epidoxorubicin
4.
4'-Epi-Adriamycin
5.
4'-Epi-DXR
6.
4'-Epi-Doxorubicin
7.
EPI-cell
8.
Ellence
9.
Epilem
10.
Epirubicin Hydrochloride
11.
Farmorubicin
12.
Farmorubicina
13.
Farmorubicine
14.
IMI-28
15.
NSC-256942
16.
Pharmorubicin
17.
4' Epi Adriamycin
18.
4' Epi DXR
19.
4' Epi Doxorubicin
20.
4' Epiadriamycin
21.
4' Epidoxorubicin
22.
EPI cell
23.
EPIcell
24.
Hydrochloride, Epirubicin
25.
IMI 28
26.
IMI28
27.
NSC 256942
28.
NSC256942
External Link(s)
| MeSH | D015251 |
| PubChem Compound | 65348 53630345 |
| CHEMBL | CHEMBL1200981 |
| KEGG | dr:D02214 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Extravasation | FAERS: 15 | US FAERS | |
| 3 | Vomiting | FAERS: 14 | US FAERS | |
| 4 | Nausea | FAERS: 12 | US FAERS | |
| 5 | Erythema | FAERS: 11 | US FAERS | |
| 6 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 7 | Disease Progression | FAERS: 9 | US FAERS | |
| 8 | Cellulitis | FAERS: 8 | US FAERS | |
| 9 | Drug exposure during pregnancy | FAERS: 8 | US FAERS | |
| 10 | Pneumonia | FAERS: 8 | US FAERS | |
| 11 | Febrile Neutropenia | FAERS: 7 | US FAERS | |
| 12 | Hypotension | FAERS: 7 | US FAERS | |
| 13 | Infection | FAERS: 7 | US FAERS | |
| 14 | White blood cell count decreased | FAERS: 7 | US FAERS | |
| 15 | Fatigue | FAERS: 6 | US FAERS | |
| 16 | Headache | FAERS: 6 | US FAERS | |
| 17 | Inflammation | FAERS: 6 | US FAERS | |
| 18 | Leukopenia | FAERS: 6 | US FAERS | |
| 19 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 20 | Ventricular hypokinesia | FAERS: 6 | US FAERS | |
| 21 | Asthenia | FAERS: 5 | US FAERS | |
| 22 | Malaise | FAERS: 5 | US FAERS | |
| 23 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 24 | Abdominal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Atrial thrombosis | FAERS: 4 | US FAERS | |
| 26 | Back Pain | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 27 | Bronchopneumonia | FAERS: 4 | US FAERS | |
| 28 | Chest Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Chills | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Constipation | FAERS: 4 | US FAERS | |
| 31 | Fibrosis | FAERS: 4 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 33 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 34 | Liver Abscess | FAERS: 4 | US FAERS | |
| 35 | Occupational exposure to product | FAERS: 4 | US FAERS | |
| 36 | Respiratory distress | FAERS: 4 | US FAERS | |
| 37 | Septic Shock | FAERS: 4 | US FAERS | |
| 38 | Thrombocytopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 40 | Bronchitis | FAERS: 3 | US FAERS | |
| 41 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 42 | Chest discomfort | FAERS: 3 | US FAERS | |
| 43 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 44 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 45 | Hypertransaminasaemia | FAERS: 3 | US FAERS | |
| 46 | Infusion Site Extravasation | FAERS: 3 | US FAERS | |
| 47 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 48 | Maternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 49 | Necrosis | FAERS: 3 | US FAERS | |
| 50 | Palpitations | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Pruritus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Soft tissue necrosis | FAERS: 3 | US FAERS | |
| 53 | Syncope | FAERS: 3 | US FAERS | |
| 54 | Throat irritation | FAERS: 3 | US FAERS | |
| 55 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 56 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 57 | Weight decreased | FAERS: 3 | US FAERS | |
| 58 | Accidental exposure | FAERS: 2 | US FAERS | |
| 59 | Acinetobacter test positive | FAERS: 2 | US FAERS | |
| 60 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 61 | Alopecia | FAERS: 2 | US FAERS | |
| 62 | Anal sphincter atony | FAERS: 2 | US FAERS | |
| 63 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 64 | Anxiety | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Bladder necrosis | FAERS: 2 | US FAERS | |
| 66 | Bronchospasm | FAERS: 2 | US FAERS | |
| 67 | Cardiac Arrest | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 69 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 70 | Contralateral breast cancer | FAERS: 2 | US FAERS | |
| 71 | Dizziness | FAERS: 2 | US FAERS | |
| 72 | Dysuria | FAERS: 2 | US FAERS | |
| 73 | Extravasation of urine | FAERS: 2 | US FAERS | |
| 74 | Eye irritation | FAERS: 2 | US FAERS | |
| 75 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 76 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 77 | Flushing | FAERS: 2 | US FAERS | |
| 78 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 79 | Hepatitis B | FAERS: 2 | US FAERS | |
| 80 | Hyperlipasaemia | FAERS: 2 | US FAERS | |
| 81 | Hyperventilation | FAERS: 2 | US FAERS | |
| 82 | Klebsiella test positive | FAERS: 2 | US FAERS | |
| 83 | Leukocytosis | FAERS: 2 | US FAERS | |
| 84 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 85 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 87 | Reduced bladder capacity | FAERS: 2 | US FAERS | |
| 88 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 89 | Sepsis | FAERS: 2 | US FAERS | |
| 90 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 91 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 92 | Swelling | FAERS: 2 | US FAERS | |
| 93 | Tremor | FAERS: 2 | US FAERS | |
| 94 | jaundice | FAERS: 2 | US FAERS | |
| 95 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 96 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 97 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 98 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 99 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 100 | Arthralgia | FAERS: 1 | US FAERS | |
| 101 | Arthropathy | FAERS: 1 | US FAERS | |
| 102 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 103 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 104 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 105 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 106 | Bone pain | FAERS: 1 | US FAERS | |
| 107 | Bradycardia | FAERS: 1 | US FAERS | |
| 108 | Burning sensation | FAERS: 1 | US FAERS | |
| 109 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 110 | Chemical cystitis | FAERS: 1 | US FAERS | |
| 111 | Choking sensation | FAERS: 1 | US FAERS | |
| 112 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 113 | Contracted bladder | FAERS: 1 | US FAERS | |
| 114 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 115 | Deafness | FAERS: 1 | US FAERS | |
| 116 | Delirium | FAERS: 1 | US FAERS | |
| 117 | Dementia | FAERS: 1 | US FAERS | |
| 118 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 119 | Diplopia | FAERS: 1 | US FAERS | |
| 120 | Diverticulitis | FAERS: 1 | US FAERS | |
| 121 | Drug ineffective | FAERS: 1 | US FAERS | |
| 122 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 123 | Dysgeusia | FAERS: 1 | US FAERS | |
| 124 | Dysphonia | FAERS: 1 | US FAERS | |
| 125 | Eczema | FAERS: 1 | US FAERS | |
| 126 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 127 | Eosinophilia | FAERS: 1 | US FAERS | |
| 128 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 129 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 130 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 131 | Glaucoma | FAERS: 1 | US FAERS | |
| 132 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 133 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 134 | Ileus | FAERS: 1 | US FAERS | |
| 135 | Initial insomnia | FAERS: 1 | US FAERS | |
| 136 | Injection site erythema | FAERS: 1 | US FAERS | |
| 137 | Injection site pain | FAERS: 1 | US FAERS | |
| 138 | Joint Tuberculosis | FAERS: 1 | US FAERS | |
| 139 | Joint stiffness | FAERS: 1 | US FAERS | |
| 140 | Joint swelling | FAERS: 1 | US FAERS | |
| 141 | Limb injury | FAERS: 1 | US FAERS | |
| 142 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 143 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 144 | Medication Error | FAERS: 1 | US FAERS | |
| 145 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 146 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 147 | Multiple gated acquisition scan abnormal | FAERS: 1 | US FAERS | |
| 148 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 149 | Myalgia | FAERS: 1 | US FAERS | |
| 150 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 151 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 152 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 153 | Ototoxicity | FAERS: 1 | US FAERS | |
| 154 | Pain | FAERS: 1 | US FAERS | |
| 155 | Pancytopenia | FAERS: 1 | US FAERS | |
| 156 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 157 | Pemphigus | FAERS: 1 | US FAERS | |
| 158 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 159 | Pleurisy | FAERS: 1 | US FAERS | |
| 160 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 161 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 162 | Product use issue | FAERS: 1 | US FAERS | |
| 163 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 164 | Rash erythematous | FAERS: 1 | US FAERS | |
| 165 | Shock | FAERS: 1 | US FAERS | |
| 166 | Skin reaction | FAERS: 1 | US FAERS | |
| 167 | Sudden death | FAERS: 1 | US FAERS | |
| 168 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 169 | Thrombosis | FAERS: 1 | US FAERS | |
| 170 | Tuberculosis | FAERS: 1 | US FAERS | |
| 171 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 172 | Urinary Retention | FAERS: 1 | US FAERS | |
| 173 | Vein pain | FAERS: 1 | US FAERS | |
| 174 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 175 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 176 | Wound decomposition | FAERS: 1 | US FAERS | |
| 177 | Pharyngeal swelling | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.