Ondansetron
(MKBLHFILKIKSQM-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1C(CCc2c1c1ccccc1n2C)Cn1ccnc1C.Cl
- Molecular Formula:
- C18H20ClN3O
- Molecular Weight:
- 329.824
- Log P:
- 3.9305
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 39.82
- CAS Number(s):
- 99614-01-4; 110204-46-1
Synonym(s)
1.
Ondansetron
2.
GR-38032F
3.
GR38032F
4.
Ondansetron Hydrochloride
5.
Ondansetron Monohydrochloride
6.
Ondansetron Monohydrochloride Dihydrate
7.
Ondansetron, (+,-)-Isomer
8.
Ondansetron, (R)-Isomer
9.
Ondansetron, (S)-Isomer
10.
SN-307
11.
Zofran
12.
Dihydrate, Ondansetron Monohydrochloride
13.
GR 38032F
14.
Hydrochloride, Ondansetron
15.
Monohydrochloride Dihydrate, Ondansetron
16.
Monohydrochloride, Ondansetron
17.
SN 307
18.
SN307
External Link(s)
| MeSH | D017294 |
| PubChem Compound | 44661392 68647 66766733 |
| CHEMBL | CHEMBL1201111 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 15 | US FAERS | |
| 2 | Maternal exposure during pregnancy | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Depressed Level of Consciousness | FAERS: 11 | US FAERS | |
| 4 | Vomiting | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Sinus Tachycardia | FAERS: 9 | US FAERS | |
| 7 | Somnolence | FAERS: 9 | US FAERS | |
| 8 | Accidental overdose | FAERS: 8 | US FAERS | |
| 9 | Flushing | FAERS: 7 | US FAERS | |
| 10 | Overdose | FAERS: 6 | US FAERS | |
| 11 | Pruritus | FAERS: 6 | US FAERS | |
| 12 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 13 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 14 | Chest Pain | FAERS: 5 | US FAERS | |
| 15 | Constipation | FAERS: 5 | US FAERS | |
| 16 | Dizziness | FAERS: 5 | US FAERS | |
| 17 | Hypotension | FAERS: 5 | US FAERS | |
| 18 | Myoclonus | FAERS: 5 | US FAERS | |
| 19 | Nystagmus | FAERS: 5 | US FAERS | |
| 20 | Product use issue | FAERS: 5 | US FAERS | |
| 21 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 22 | Tremor | FAERS: 5 | US FAERS | |
| 23 | Anxiety | FAERS: 4 | US FAERS | |
| 24 | Chills | FAERS: 4 | US FAERS | |
| 25 | Erythema | FAERS: 4 | US FAERS | |
| 26 | Headache | FAERS: 4 | US FAERS | |
| 27 | Palpitations | FAERS: 4 | US FAERS | |
| 28 | Ventricular arrhythmia | FAERS: 4 | US FAERS | |
| 29 | Agitation | FAERS: 3 | US FAERS | |
| 30 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 31 | Chest discomfort | FAERS: 3 | US FAERS | |
| 32 | Dehydration | FAERS: 3 | US FAERS | |
| 33 | Dysgeusia | FAERS: 3 | US FAERS | |
| 34 | Dystonia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Malaise | FAERS: 3 | US FAERS | |
| 36 | Mydriasis | FAERS: 3 | US FAERS | |
| 37 | Pain | FAERS: 3 | US FAERS | |
| 38 | Posterior reversible encephalopathy syndrome | FAERS: 3 | US FAERS | |
| 39 | Serotonin Syndrome | FAERS: 3 | US FAERS | |
| 40 | Stridor | FAERS: 3 | US FAERS | |
| 41 | Urticaria | FAERS: 3 | US FAERS | |
| 42 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 43 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 44 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 45 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 46 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 47 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 48 | Ataxia | FAERS: 2 | US FAERS | |
| 49 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 50 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 51 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 52 | Emotional distress | FAERS: 2 | US FAERS | |
| 53 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 54 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 55 | Live Birth | FAERS: 2 | US FAERS | |
| 56 | Long QT Syndrome | FAERS: 2 | US FAERS | |
| 57 | Mental status changes | FAERS: 2 | US FAERS | |
| 58 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 59 | Product quality issue | FAERS: 2 | US FAERS | |
| 60 | Product substitution issue | FAERS: 2 | US FAERS | |
| 61 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 62 | Product use in unapproved indication | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 63 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 64 | Single functional kidney | FAERS: 2 | US FAERS | |
| 65 | Vertigo | FAERS: 2 | US FAERS | |
| 66 | Wheezing | FAERS: 2 | US FAERS | |
| 67 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 68 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 69 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 70 | Anhedonia | FAERS: 1 | US FAERS | |
| 71 | Asthenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Atelectasis | FAERS: 1 | US FAERS | |
| 73 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 74 | Blindness | FAERS: 1 | US FAERS | |
| 75 | Bradycardia | FAERS: 1 | US FAERS | |
| 76 | Bronchospasm | FAERS: 1 | US FAERS | |
| 77 | Burning sensation | FAERS: 1 | US FAERS | |
| 78 | Cleft Palate | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 80 | Cyanosis | FAERS: 1 | US FAERS | |
| 81 | Drug administration error | FAERS: 1 | US FAERS | |
| 82 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 83 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 84 | Drug level increased | FAERS: 1 | US FAERS | |
| 85 | Drug screen positive | FAERS: 1 | US FAERS | |
| 86 | Drug toxicity | FAERS: 1 | US FAERS | |
| 87 | Dysphonia | FAERS: 1 | US FAERS | |
| 88 | Emotional disorder | FAERS: 1 | US FAERS | |
| 89 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 90 | Fatigue | FAERS: 1 | US FAERS | |
| 91 | Frustration | FAERS: 1 | US FAERS | |
| 92 | Gaze palsy | FAERS: 1 | US FAERS | |
| 93 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 94 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 95 | Hypoxia | FAERS: 1 | US FAERS | |
| 96 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 97 | Impaired work ability | FAERS: 1 | US FAERS | |
| 98 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 99 | Injection site mass | FAERS: 1 | US FAERS | |
| 100 | Injection site pain | FAERS: 1 | US FAERS | |
| 101 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 102 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 103 | Lip swelling | FAERS: 1 | US FAERS | |
| 104 | Medication Error | FAERS: 1 | US FAERS | |
| 105 | Memory impairment | FAERS: 1 | US FAERS | |
| 106 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 107 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 108 | Myocarditis | FAERS: 1 | US FAERS | |
| 109 | Neuralgia | FAERS: 1 | US FAERS | |
| 110 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 111 | Patent ductus arteriosus | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 112 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 113 | Perineal infection | FAERS: 1 | US FAERS | |
| 114 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 115 | Pneumothorax | FAERS: 1 | US FAERS | |
| 116 | Priapism | FAERS: 1 | US FAERS | |
| 117 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 118 | Product contamination | FAERS: 1 | US FAERS | |
| 119 | Product label issue | FAERS: 1 | US FAERS | |
| 120 | Rash erythematous | FAERS: 1 | US FAERS | |
| 121 | Retching | FAERS: 1 | US FAERS | |
| 122 | Right ventricular hypertension | FAERS: 1 | US FAERS | |
| 123 | Shock | FAERS: 1 | US FAERS | |
| 124 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 125 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 126 | Swelling | FAERS: 1 | US FAERS | |
| 127 | Syncope | FAERS: 1 | US FAERS | |
| 128 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 129 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 130 | Throat irritation | FAERS: 1 | US FAERS | |
| 131 | Tinnitus | FAERS: 1 | US FAERS | |
| 132 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 133 | Visceral Pain | FAERS: 1 | US FAERS | |
| 134 | Visual Impairment | FAERS: 1 | US FAERS | |
| 135 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 136 | Body height below normal | Canada Vigilance: 1 | Canada Vigilance | |
| 137 | Chorea | Canada Vigilance: 1 | Canada Vigilance | |
| 138 | Dysmorphism | Canada Vigilance: 1 | Canada Vigilance | |
| 139 | Failure to Thrive | Canada Vigilance: 1 | Canada Vigilance | |
| 140 | Growth retardation | Canada Vigilance: 1 | Canada Vigilance | |
| 141 | Laryngeal cleft | Canada Vigilance: 1 | Canada Vigilance | |
| 142 | Low set ears | Canada Vigilance: 1 | Canada Vigilance | |
| 143 | Post procedural complication | Canada Vigilance: 1 | Canada Vigilance | |
| 144 | Post procedural infection | Canada Vigilance: 1 | Canada Vigilance | |
| 145 | Postoperative thrombosis | Canada Vigilance: 1 | Canada Vigilance | |
| 146 | Pulmonary Valve Stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 147 | Pyelocaliectasis | Canada Vigilance: 1 | Canada Vigilance | |
| 148 | Selective eating disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Tetany | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.