bupropion hydrochloride, naltrexone hydrochoride drug combination
(KVNBDVQGENTICK-ITLPAZOVSA-N)
Structure
- SMILES
- O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O.Clc1cccc(c1)C(=O)C(NC(C)(C)C)C
- Molecular Formula:
- C33H41ClN2O5
- Molecular Weight:
- 581.142
- Log P:
- 5.1535
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 99.1
- CAS Number(s):
- 1201668-08-7
Synonym(s)
1.
bupropion hydrochloride, naltrexone hydrochoride drug combination
2.
Contrave
3.
Mysimba
4.
bupropion hydrochloride - natrexone hydrochloride
External Link(s)
| MeSH | C000591595 |
| PubChem Compound | 11556075 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 360 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 185 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 150 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 126 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 122 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Constipation | FAERS: 87 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 8 | Urticaria | FAERS: 63 | US FAERS | |
| 9 | Inappropriate schedule of drug administration | FAERS: 61 | US FAERS | |
| 10 | Fatigue | FAERS: 59 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | No adverse event | FAERS: 58 | US FAERS | |
| 12 | Tremor | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Anxiety | FAERS: 52 | US FAERS | |
| 14 | Malaise | FAERS: 46 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 15 | Palpitations | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Somnolence | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Drug prescribing error | FAERS: 28 | US FAERS | |
| 18 | Feeling jittery | FAERS: 27 | US FAERS | |
| 19 | Chest Pain | FAERS: 25 | US FAERS | |
| 20 | Alopecia | FAERS: 22 | US FAERS | |
| 21 | Pruritus | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Abdominal Pain | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Adverse event | FAERS: 18 | US FAERS | |
| 24 | Chest discomfort | FAERS: 17 | US FAERS | |
| 25 | Hypersensitivity | FAERS: 17 | US FAERS | |
| 26 | Agitation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Drug dose omission | FAERS: 16 | US FAERS | |
| 28 | Tinnitus | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Asthenia | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Visual Impairment | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Nervousness | FAERS: 14 | US FAERS | |
| 32 | Depressed mood | FAERS: 13 | US FAERS | |
| 33 | Dysarthria | FAERS: 13 | US FAERS | |
| 34 | Anger | FAERS: 12 | US FAERS | |
| 35 | Eye pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Dyspepsia | FAERS: 11 | US FAERS | |
| 37 | Food craving | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Abdominal discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Flushing | FAERS: 10 | US FAERS | |
| 40 | Hunger | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Impaired work ability | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Lip swelling | FAERS: 10 | US FAERS | |
| 43 | Back Pain | FAERS: 9 | US FAERS | |
| 44 | Cold sweat | FAERS: 9 | US FAERS | |
| 45 | Dysgeusia | FAERS: 9 | US FAERS | |
| 46 | Euphoric mood | FAERS: 9 | US FAERS | |
| 47 | Mood swings | FAERS: 9 | US FAERS | |
| 48 | Product use issue | FAERS: 9 | US FAERS | |
| 49 | Vertigo | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Amnesia | FAERS: 8 | US FAERS | |
| 51 | Dehydration | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Pain | FAERS: 8 | US FAERS | |
| 53 | Angioedema | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Crying | FAERS: 7 | US FAERS | |
| 55 | Disorientation | FAERS: 7 | US FAERS | |
| 56 | Drug titration error | FAERS: 7 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 57 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 58 | Presyncope | FAERS: 7 | US FAERS | |
| 59 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 60 | Chills | FAERS: 6 | US FAERS | |
| 61 | Hypersomnia | FAERS: 6 | US FAERS | |
| 62 | Memory impairment | FAERS: 6 | US FAERS | |
| 63 | Mental impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Motion Sickness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Night sweats | FAERS: 6 | US FAERS | |
| 66 | Swelling | FAERS: 6 | US FAERS | |
| 67 | Syncope | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Aphasia | FAERS: 5 | US FAERS | |
| 69 | Arthralgia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Chromaturia | FAERS: 5 | US FAERS | |
| 71 | Head discomfort | FAERS: 5 | US FAERS | |
| 72 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 73 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 74 | Joint swelling | FAERS: 5 | US FAERS | |
| 75 | Restlessness | FAERS: 5 | US FAERS | |
| 76 | Retching | FAERS: 5 | US FAERS | |
| 77 | Tachycardia | FAERS: 5 | US FAERS | |
| 78 | Wrong technique in product usage process | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 80 | Angina Pectoris | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Breast engorgement | FAERS: 4 | US FAERS | |
| 82 | Drug screen positive | FAERS: 4 | US FAERS | |
| 83 | Incoherent | FAERS: 4 | US FAERS | |
| 84 | Lethargy | FAERS: 4 | US FAERS | |
| 85 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 86 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 87 | Rash erythematous | FAERS: 4 | US FAERS | |
| 88 | Restless Legs Syndrome | FAERS: 4 | US FAERS | |
| 89 | Therapy cessation | FAERS: 4 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 90 | Thirst | FAERS: 4 | US FAERS | |
| 91 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 92 | Asthenopia | FAERS: 3 | US FAERS | |
| 93 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 94 | Bedridden | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 95 | Blood creatinine increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 97 | Dysuria | FAERS: 3 | US FAERS | |
| 98 | Emotional disorder | FAERS: 3 | US FAERS | |
| 99 | Eructation | FAERS: 3 | US FAERS | |
| 100 | Extra dose administered | FAERS: 3 | US FAERS | |
| 101 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 102 | Initial insomnia | FAERS: 3 | US FAERS | |
| 103 | Lack of satiety | FAERS: 3 | US FAERS | |
| 104 | Muscle tightness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Musculoskeletal discomfort | FAERS: 3 | US FAERS | |
| 106 | Myalgia | FAERS: 3 | US FAERS | |
| 107 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 108 | Neck Pain | FAERS: 3 | US FAERS | |
| 109 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 110 | Pancreatitis | FAERS: 3 | US FAERS | |
| 111 | Photophobia | FAERS: 3 | US FAERS | |
| 112 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 113 | Pregnancy | FAERS: 3 | US FAERS | |
| 114 | Sinusitis | FAERS: 3 | US FAERS | |
| 115 | Stomatitis | FAERS: 3 | US FAERS | |
| 116 | Therapy change | FAERS: 3 | US FAERS | |
| 117 | Toothache | FAERS: 3 | US FAERS | |
| 118 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 119 | Asthma | FAERS: 2 | US FAERS | |
| 120 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 121 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 122 | Burning sensation | FAERS: 2 | US FAERS | |
| 123 | Cerebrovascular accident | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 125 | Cystitis | FAERS: 2 | US FAERS | |
| 126 | Dysphemia | FAERS: 2 | US FAERS | |
| 127 | Dysphonia | FAERS: 2 | US FAERS | |
| 128 | Dystonia | FAERS: 2 | US FAERS | |
| 129 | Electrocardiogram abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Erythema | FAERS: 2 | US FAERS | |
| 131 | Eye irritation | FAERS: 2 | US FAERS | |
| 132 | Facial paralysis | FAERS: 2 | US FAERS | |
| 133 | Feeling Cold | FAERS: 2 | US FAERS | |
| 134 | Flatulence | FAERS: 2 | US FAERS | |
| 135 | Gastritis | FAERS: 2 | US FAERS | |
| 136 | Glaucoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Hyperphagia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Hypophagia | FAERS: 2 | US FAERS | |
| 139 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 140 | Inflammation | FAERS: 2 | US FAERS | |
| 141 | Influenza | FAERS: 2 | US FAERS | |
| 142 | Intentional product use issue | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 143 | Loss of personal independence in daily activities | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Meniscus injury | FAERS: 2 | US FAERS | |
| 145 | Menorrhagia | FAERS: 2 | US FAERS | |
| 146 | Middle insomnia | FAERS: 2 | US FAERS | |
| 147 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 148 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 149 | Panic Disorder | FAERS: 2 | US FAERS | |
| 150 | Serotonin Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 152 | Suicide attempt | FAERS: 2 | US FAERS | |
| 153 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 154 | Tooth Infection | FAERS: 2 | US FAERS | |
| 155 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 156 | Abasia | FAERS: 1 | US FAERS | |
| 157 | Accidental overdose | FAERS: 1 | US FAERS | |
| 158 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 159 | Acute psychosis | FAERS: 1 | US FAERS | |
| 160 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 161 | Allergic cough | FAERS: 1 | US FAERS | |
| 162 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 163 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 164 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 165 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 166 | Apathy | FAERS: 1 | US FAERS | |
| 167 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Asphyxia | FAERS: 1 | US FAERS | |
| 169 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 170 | Blepharospasm | FAERS: 1 | US FAERS | |
| 171 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 172 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 173 | Blood potassium decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 175 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 176 | Bradycardia | FAERS: 1 | US FAERS | |
| 177 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 178 | Breast discomfort | FAERS: 1 | US FAERS | |
| 179 | Bronchitis | FAERS: 1 | US FAERS | |
| 180 | Bronchospasm | FAERS: 1 | US FAERS | |
| 181 | Bruxism | FAERS: 1 | US FAERS | |
| 182 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 183 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 184 | Catatonia | FAERS: 1 | US FAERS | |
| 185 | Cholecystitis | FAERS: 1 | US FAERS | |
| 186 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 187 | Colitis | FAERS: 1 | US FAERS | |
| 188 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 189 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 190 | Dermatitis | FAERS: 1 | US FAERS | |
| 191 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 192 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 193 | Discomfort | FAERS: 1 | US FAERS | |
| 194 | Disease complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Diverticulitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Drooling | FAERS: 1 | US FAERS | |
| 197 | Drug Dependence | FAERS: 1 | US FAERS | |
| 198 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 199 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 200 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 201 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 202 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 203 | Dysacusis | FAERS: 1 | US FAERS | |
| 204 | Dysmorphism | FAERS: 1 | US FAERS | |
| 205 | Ear discomfort | FAERS: 1 | US FAERS | |
| 206 | Eczema | FAERS: 1 | US FAERS | |
| 207 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 208 | Emotional distress | FAERS: 1 | US FAERS | |
| 209 | Epistaxis | FAERS: 1 | US FAERS | |
| 210 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 211 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 212 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 213 | Essential Tremor | FAERS: 1 | US FAERS | |
| 214 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 215 | Fat intolerance | FAERS: 1 | US FAERS | |
| 216 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 217 | Fibromyalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Food Allergy | FAERS: 1 | US FAERS | |
| 219 | Food aversion | FAERS: 1 | US FAERS | |
| 220 | Formication | FAERS: 1 | US FAERS | |
| 221 | Gait inability | FAERS: 1 | US FAERS | |
| 222 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 223 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 224 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 225 | Gingivitis | FAERS: 1 | US FAERS | |
| 226 | Gout | FAERS: 1 | US FAERS | |
| 227 | Head titubation | FAERS: 1 | US FAERS | |
| 228 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 229 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 230 | Hostility | FAERS: 1 | US FAERS | |
| 231 | Hyperventilation | FAERS: 1 | US FAERS | |
| 232 | Hypokinesia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Hypotension | FAERS: 1 | US FAERS | |
| 234 | Hysterectomy | FAERS: 1 | US FAERS | |
| 235 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 236 | Impatience | FAERS: 1 | US FAERS | |
| 237 | Inability to afford medication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 239 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 240 | Insurance issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 242 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 243 | Irritable Bowel Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Joint injury | FAERS: 1 | US FAERS | |
| 245 | Keratomileusis | FAERS: 1 | US FAERS | |
| 246 | Leukocytosis | FAERS: 1 | US FAERS | |
| 247 | Ligament injury | FAERS: 1 | US FAERS | |
| 248 | Limb discomfort | FAERS: 1 | US FAERS | |
| 249 | Limb injury | FAERS: 1 | US FAERS | |
| 250 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 251 | Medication residue present | FAERS: 1 | US FAERS | |
| 252 | Miliaria | FAERS: 1 | US FAERS | |
| 253 | Mouth swelling | FAERS: 1 | US FAERS | |
| 254 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 255 | Nephrectomy | FAERS: 1 | US FAERS | |
| 256 | Nodule | FAERS: 1 | US FAERS | |
| 257 | Obesity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Oral pain | FAERS: 1 | US FAERS | |
| 259 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 260 | Overdose | FAERS: 1 | US FAERS | |
| 261 | Pallor | FAERS: 1 | US FAERS | |
| 262 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 263 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 264 | Paranoia | FAERS: 1 | US FAERS | |
| 265 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 266 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 267 | Petechiae | FAERS: 1 | US FAERS | |
| 268 | Physical assault | FAERS: 1 | US FAERS | |
| 269 | Piloerection | FAERS: 1 | US FAERS | |
| 270 | Pneumonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Post procedural complication | FAERS: 1 | US FAERS | |
| 272 | Post procedural pulmonary embolism | FAERS: 1 | US FAERS | |
| 273 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 274 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 275 | Procedural complication | FAERS: 1 | US FAERS | |
| 276 | Product communication issue | FAERS: 1 | US FAERS | |
| 277 | Product prescribing error | FAERS: 1 | US FAERS | |
| 278 | Product quality issue | FAERS: 1 | US FAERS | |
| 279 | Product size issue | FAERS: 1 | US FAERS | |
| 280 | Pseudostroke | FAERS: 1 | US FAERS | |
| 281 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 282 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 283 | Screaming | FAERS: 1 | US FAERS | |
| 284 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 285 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 286 | Shoplifting | FAERS: 1 | US FAERS | |
| 287 | Sinus headache | FAERS: 1 | US FAERS | |
| 288 | Skin reaction | FAERS: 1 | US FAERS | |
| 289 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 290 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 291 | Slow speech | FAERS: 1 | US FAERS | |
| 292 | Strabismus | FAERS: 1 | US FAERS | |
| 293 | Stress | FAERS: 1 | US FAERS | |
| 294 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 295 | Tension | FAERS: 1 | US FAERS | |
| 296 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 297 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 298 | Throat irritation | FAERS: 1 | US FAERS | |
| 299 | Thrombosis | FAERS: 1 | US FAERS | |
| 300 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 301 | Tongue blistering | FAERS: 1 | US FAERS | |
| 302 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 303 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 304 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 305 | Unevaluable event | FAERS: 1 | US FAERS | |
| 306 | Urinary Incontinence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Urinary Retention | FAERS: 1 | US FAERS | |
| 308 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 309 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 310 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 311 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 312 | Weight decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 314 | nervous system disorder | FAERS: 1 | US FAERS | |
| 315 | Anaphylactic shock | Canada Vigilance: 1 | Canada Vigilance | |
| 316 | Arthropathy | Canada Vigilance: 1 | Canada Vigilance | |
| 317 | Dissociation | Canada Vigilance: 1 | Canada Vigilance | |
| 318 | Drug dose titration not performed | Canada Vigilance: 1 | Canada Vigilance | |
| 319 | Intentional dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 320 | Poisoning | Canada Vigilance: 1 | Canada Vigilance | |
| 321 | Product residue present | Canada Vigilance: 1 | Canada Vigilance | |
| 322 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 323 | Vitreous floaters | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.