Loratadine and pseudoephedrine sulfate
(KBYGOCNIUHCOLP-MNIONDOCSA-N)
Structure
- SMILES
- OS(=O)(=O)O.CN[C@H]([C@H](c1ccccc1)O)C.CCOC(=O)N1CCC(=C2c3ccc(cc3CCc3c2nccc3)Cl)CC1
- Molecular Formula:
- C32H40ClN3O7S
- Molecular Weight:
- 646.194
- Log P:
- 6.9725
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 157.67
- CAS Number(s):
- 156098-07-6
Synonym(s)
1.
Loratadine and pseudoephedrine sulfate
External Link(s)
| PubChem Compound | 9917507 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 624 | US FAERS | |
| 2 | Product use issue | FAERS: 141 | US FAERS | |
| 3 | Somnolence | FAERS: 129 | US FAERS | |
| 4 | Feeling jittery | FAERS: 80 | US FAERS | |
| 5 | Dizziness | FAERS: 69 | US FAERS | |
| 6 | Feeling abnormal | FAERS: 69 | US FAERS | |
| 7 | Palpitations | FAERS: 68 | US FAERS | |
| 8 | Headache | FAERS: 65 | US FAERS | |
| 9 | Drug effect delayed | FAERS: 63 | US FAERS | |
| 10 | Unevaluable event | FAERS: 56 | US FAERS | |
| 11 | Nausea | FAERS: 39 | US FAERS | |
| 12 | Overdose | FAERS: 39 | US FAERS | |
| 13 | Therapeutic response unexpected | FAERS: 39 | US FAERS | |
| 14 | Drug effect incomplete | FAERS: 37 | US FAERS | |
| 15 | Nervousness | FAERS: 36 | US FAERS | |
| 16 | Poor quality sleep | FAERS: 33 | US FAERS | |
| 17 | Extra dose administered | FAERS: 31 | US FAERS | |
| 18 | Product use in unapproved indication | FAERS: 31 | US FAERS | |
| 19 | Expired product administered | FAERS: 29 | US FAERS | |
| 20 | Fatigue | FAERS: 29 | US FAERS | |
| 21 | Wrong technique in product usage process | FAERS: 26 | US FAERS | |
| 22 | Anxiety | FAERS: 24 | US FAERS | |
| 23 | Malaise | FAERS: 24 | US FAERS | |
| 24 | Accidental overdose | FAERS: 23 | US FAERS | |
| 25 | Dysuria | FAERS: 21 | US FAERS | |
| 26 | Hypersensitivity | FAERS: 21 | US FAERS | |
| 27 | Tremor | FAERS: 21 | US FAERS | |
| 28 | Accidental exposure to product by child | FAERS: 19 | US FAERS | |
| 29 | Inappropriate schedule of drug administration | FAERS: 18 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 31 | Incorrect drug administration duration | FAERS: 16 | US FAERS | |
| 32 | Vomiting | FAERS: 16 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 15 | US FAERS | |
| 34 | Initial insomnia | FAERS: 15 | US FAERS | |
| 35 | Thirst | FAERS: 15 | US FAERS | |
| 36 | Constipation | FAERS: 14 | US FAERS | |
| 37 | Restlessness | FAERS: 14 | US FAERS | |
| 38 | Drug ineffective for unapproved indication | FAERS: 13 | US FAERS | |
| 39 | Circumstance or information capable of leading to medication error | FAERS: 11 | US FAERS | |
| 40 | Pruritus | FAERS: 11 | US FAERS | |
| 41 | Drug screen positive | FAERS: 10 | US FAERS | |
| 42 | Incorrect product administration duration | FAERS: 10 | US FAERS | |
| 43 | Adverse event | FAERS: 9 | US FAERS | |
| 44 | Drug Dependence | FAERS: 9 | US FAERS | |
| 45 | Sneezing | FAERS: 9 | US FAERS | |
| 46 | Urinary Retention | FAERS: 9 | US FAERS | |
| 47 | Back Pain | FAERS: 8 | US FAERS | |
| 48 | Chest Pain | FAERS: 8 | US FAERS | |
| 49 | Chest discomfort | FAERS: 8 | US FAERS | |
| 50 | Discomfort | FAERS: 8 | US FAERS | |
| 51 | Disorientation | FAERS: 8 | US FAERS | |
| 52 | Urticaria | FAERS: 8 | US FAERS | |
| 53 | Agitation | FAERS: 7 | US FAERS | |
| 54 | Asthenia | FAERS: 7 | US FAERS | |
| 55 | Chills | FAERS: 7 | US FAERS | |
| 56 | Dehydration | FAERS: 7 | US FAERS | |
| 57 | Euphoric mood | FAERS: 7 | US FAERS | |
| 58 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 59 | Pain | FAERS: 7 | US FAERS | |
| 60 | Throat irritation | FAERS: 7 | US FAERS | |
| 61 | Dysgeusia | FAERS: 6 | US FAERS | |
| 62 | Head discomfort | FAERS: 6 | US FAERS | |
| 63 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 64 | Lip swelling | FAERS: 5 | US FAERS | |
| 65 | Middle insomnia | FAERS: 5 | US FAERS | |
| 66 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 67 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 68 | Product prescribing issue | FAERS: 5 | US FAERS | |
| 69 | Syncope | FAERS: 5 | US FAERS | |
| 70 | Therapeutic response changed | FAERS: 5 | US FAERS | |
| 71 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 72 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 73 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 74 | Amphetamines positive | FAERS: 4 | US FAERS | |
| 75 | Anger | FAERS: 4 | US FAERS | |
| 76 | Crying | FAERS: 4 | US FAERS | |
| 77 | Depressed mood | FAERS: 4 | US FAERS | |
| 78 | Epistaxis | FAERS: 4 | US FAERS | |
| 79 | Erythema | FAERS: 4 | US FAERS | |
| 80 | Expired drug administered | FAERS: 4 | US FAERS | |
| 81 | Hypervigilance | FAERS: 4 | US FAERS | |
| 82 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 83 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 84 | No adverse event | FAERS: 4 | US FAERS | |
| 85 | Sluggishness | FAERS: 4 | US FAERS | |
| 86 | Anosmia | FAERS: 3 | US FAERS | |
| 87 | Asthma | FAERS: 3 | US FAERS | |
| 88 | Bladder pain | FAERS: 3 | US FAERS | |
| 89 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 90 | Drug administration error | FAERS: 3 | US FAERS | |
| 91 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 92 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 93 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 94 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 3 | US FAERS | |
| 95 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 96 | Medication Error | FAERS: 3 | US FAERS | |
| 97 | Patient dissatisfaction with treatment | FAERS: 3 | US FAERS | |
| 98 | Product label issue | FAERS: 3 | US FAERS | |
| 99 | Product packaging issue | FAERS: 3 | US FAERS | |
| 100 | Product quality issue | FAERS: 3 | US FAERS | |
| 101 | Product substitution issue | FAERS: 3 | US FAERS | |
| 102 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 103 | Retching | FAERS: 3 | US FAERS | |
| 104 | Sinusitis | FAERS: 3 | US FAERS | |
| 105 | Tachycardia | FAERS: 3 | US FAERS | |
| 106 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 107 | Tinnitus | FAERS: 3 | US FAERS | |
| 108 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 109 | Ageusia | FAERS: 2 | US FAERS | |
| 110 | Alopecia | FAERS: 2 | US FAERS | |
| 111 | Anorexia | FAERS: 2 | US FAERS | |
| 112 | Aphasia | FAERS: 2 | US FAERS | |
| 113 | Asthenopia | FAERS: 2 | US FAERS | |
| 114 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 115 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 116 | Burning sensation | FAERS: 2 | US FAERS | |
| 117 | Choking | FAERS: 2 | US FAERS | |
| 118 | Cold sweat | FAERS: 2 | US FAERS | |
| 119 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 120 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 121 | Dry skin | FAERS: 2 | US FAERS | |
| 122 | Dysarthria | FAERS: 2 | US FAERS | |
| 123 | Dyspepsia | FAERS: 2 | US FAERS | |
| 124 | Dysphonia | FAERS: 2 | US FAERS | |
| 125 | Eyelid pain | FAERS: 2 | US FAERS | |
| 126 | Flatulence | FAERS: 2 | US FAERS | |
| 127 | Lethargy | FAERS: 2 | US FAERS | |
| 128 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 129 | Pallor | FAERS: 2 | US FAERS | |
| 130 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 131 | Polydipsia | FAERS: 2 | US FAERS | |
| 132 | Presyncope | FAERS: 2 | US FAERS | |
| 133 | Product physical issue | FAERS: 2 | US FAERS | |
| 134 | Productive Cough | FAERS: 2 | US FAERS | |
| 135 | Renal pain | FAERS: 2 | US FAERS | |
| 136 | Rhinalgia | FAERS: 2 | US FAERS | |
| 137 | Stress | FAERS: 2 | US FAERS | |
| 138 | Suicide attempt | FAERS: 2 | US FAERS | |
| 139 | Tension Headache | FAERS: 2 | US FAERS | |
| 140 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 141 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 142 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 143 | Accidental exposure to product packaging by child | FAERS: 1 | US FAERS | |
| 144 | Acne | FAERS: 1 | US FAERS | |
| 145 | Administration site dryness | FAERS: 1 | US FAERS | |
| 146 | Amnesia | FAERS: 1 | US FAERS | |
| 147 | Anal Fissure | FAERS: 1 | US FAERS | |
| 148 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 149 | Angioedema | FAERS: 1 | US FAERS | |
| 150 | Anuria | FAERS: 1 | US FAERS | |
| 151 | Autopsy | FAERS: 1 | US FAERS | |
| 152 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 153 | Blindness | FAERS: 1 | US FAERS | |
| 154 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 155 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 156 | Blood urea increased | FAERS: 1 | US FAERS | |
| 157 | Boredom | FAERS: 1 | US FAERS | |
| 158 | Breast discomfort | FAERS: 1 | US FAERS | |
| 159 | Bruxism | FAERS: 1 | US FAERS | |
| 160 | Cataract | FAERS: 1 | US FAERS | |
| 161 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 162 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 163 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 164 | Cyanosis | FAERS: 1 | US FAERS | |
| 165 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 166 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 167 | Diplopia | FAERS: 1 | US FAERS | |
| 168 | Drug abuse | FAERS: 1 | US FAERS | |
| 169 | Drug chemical incompatibility | FAERS: 1 | US FAERS | |
| 170 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 171 | Drug resistance | FAERS: 1 | US FAERS | |
| 172 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 173 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 174 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 175 | Eczema | FAERS: 1 | US FAERS | |
| 176 | Facial Pain | FAERS: 1 | US FAERS | |
| 177 | Feeling Cold | FAERS: 1 | US FAERS | |
| 178 | Flank Pain | FAERS: 1 | US FAERS | |
| 179 | Flushing | FAERS: 1 | US FAERS | |
| 180 | Formication | FAERS: 1 | US FAERS | |
| 181 | Genital erythema | FAERS: 1 | US FAERS | |
| 182 | Hemiplegia | FAERS: 1 | US FAERS | |
| 183 | Hunger | FAERS: 1 | US FAERS | |
| 184 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 185 | Incoherent | FAERS: 1 | US FAERS | |
| 186 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 187 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 188 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 189 | Joint stiffness | FAERS: 1 | US FAERS | |
| 190 | Laceration | FAERS: 1 | US FAERS | |
| 191 | Limb discomfort | FAERS: 1 | US FAERS | |
| 192 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 193 | Medication residue present | FAERS: 1 | US FAERS | |
| 194 | Memory impairment | FAERS: 1 | US FAERS | |
| 195 | Mental impairment | FAERS: 1 | US FAERS | |
| 196 | Monoplegia | FAERS: 1 | US FAERS | |
| 197 | Mood swings | FAERS: 1 | US FAERS | |
| 198 | Muscle tightness | FAERS: 1 | US FAERS | |
| 199 | Myalgia | FAERS: 1 | US FAERS | |
| 200 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 201 | Negativism | FAERS: 1 | US FAERS | |
| 202 | Nocturia | FAERS: 1 | US FAERS | |
| 203 | Oliguria | FAERS: 1 | US FAERS | |
| 204 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 205 | Oral pruritus | FAERS: 1 | US FAERS | |
| 206 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 207 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 208 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 209 | Poisoning | FAERS: 1 | US FAERS | |
| 210 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 211 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 212 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 213 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 214 | Product counterfeit | FAERS: 1 | US FAERS | |
| 215 | Product package associated injury | FAERS: 1 | US FAERS | |
| 216 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 217 | Product preparation issue | FAERS: 1 | US FAERS | |
| 218 | Product shape issue | FAERS: 1 | US FAERS | |
| 219 | Product size issue | FAERS: 1 | US FAERS | |
| 220 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 221 | Product use complaint | FAERS: 1 | US FAERS | |
| 222 | Prostatism | FAERS: 1 | US FAERS | |
| 223 | Rebound effect | FAERS: 1 | US FAERS | |
| 224 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 225 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 226 | Sinus headache | FAERS: 1 | US FAERS | |
| 227 | Skin irritation | FAERS: 1 | US FAERS | |
| 228 | Sunburn | FAERS: 1 | US FAERS | |
| 229 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 230 | Swelling | FAERS: 1 | US FAERS | |
| 231 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 232 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 233 | Tension | FAERS: 1 | US FAERS | |
| 234 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 235 | Therapy cessation | FAERS: 1 | US FAERS | |
| 236 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 237 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 238 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 239 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 240 | Vasculitis | FAERS: 1 | US FAERS | |
| 241 | Vertigo | FAERS: 1 | US FAERS | |
| 242 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 243 | Visual Impairment | FAERS: 1 | US FAERS | |
| 244 | Weight decreased | FAERS: 1 | US FAERS | |
| 245 | Wheezing | FAERS: 1 | US FAERS | |
| 246 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 247 | Wrong dose | FAERS: 1 | US FAERS | |
| 248 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.