nelarabine
(IXOXBSCIXZEQEQ-UHTZMRCNSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1cnc2c1nc(N)nc2OC
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BB07
- Molecular Formula:
- C11H15N5O5
- Molecular Weight:
- 297.267
- Log P:
- -1.3902
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 148.77
- CAS Number(s):
- 7803-88-5; 121032-29-9
Synonym(s)
1.
nelarabine
2.
2-amino-6-methoxypurine arabinoside
3.
2-amino-9-beta-D-arabinofuranosyl-6-methoxy-9H-purine
4.
506U78
5.
Arranon
6.
GW506U78
7.
compound 506U78
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Alanine Aminotransferase Increased | FAERS: 7 | OFFSIDES US FAERS | |
| 2 | Disease Progression | FAERS: 7 | OFFSIDES US FAERS | |
| 3 | Headache | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 4 | Infection | FAERS: 6 | SIDER US FAERS | |
| 5 | nervous system disorder | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 7 | Leukoencephalopathy | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 8 | Vertigo | FAERS: 5 | US FAERS | |
| 9 | Asthenia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 10 | Blood creatine phosphokinase increased | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 11 | Dizziness | FAERS: 4 | SIDER US FAERS | |
| 12 | Guillain-Barre Syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Memory impairment | FAERS: 4 | US FAERS | |
| 14 | Paresis | FAERS: 4 | US FAERS | |
| 15 | Pneumonia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Polyneuropathy | FAERS: 4 | OFFSIDES US FAERS | |
| 17 | Altered state of consciousness | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 18 | Erythema | FAERS: 3 | US FAERS | |
| 19 | Febrile Neutropenia | FAERS: 3 | SIDER US FAERS | |
| 20 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 21 | Hyporeflexia | FAERS: 3 | SIDER US FAERS | |
| 22 | Malaise | FAERS: 3 | US FAERS | |
| 23 | Malignant neoplasm progression | FAERS: 3 | OFFSIDES US FAERS | |
| 24 | Mental status changes | FAERS: 3 | US FAERS | |
| 25 | Neutropenia | FAERS: 3 | SIDER US FAERS | |
| 26 | Pain | FAERS: 3 | 20528871 | CTD SIDER US FAERS |
| 27 | Septic Shock | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Somnolence | FAERS: 3 | SIDER US FAERS | |
| 29 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 30 | Acute polyneuropathy | FAERS: 2 | US FAERS | |
| 31 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 32 | Ataxia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 33 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 34 | Blast cell count increased | FAERS: 2 | OFFSIDES US FAERS | |
| 35 | Chemical eye injury | FAERS: 2 | US FAERS | |
| 36 | Cytopenia | FAERS: 2 | US FAERS | |
| 37 | Dehydration | FAERS: 2 | SIDER US FAERS | |
| 38 | Depressed Level of Consciousness | FAERS: 2 | SIDER US FAERS | |
| 39 | Disease recurrence | FAERS: 2 | US FAERS | |
| 40 | Drug ineffective | FAERS: 2 | US FAERS | |
| 41 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 42 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 43 | Hypoventilation | FAERS: 2 | US FAERS | |
| 44 | Lethargy | FAERS: 2 | SIDER US FAERS | |
| 45 | Leukocytosis | FAERS: 2 | US FAERS | |
| 46 | Monoplegia | FAERS: 2 | US FAERS | |
| 47 | Myalgia | FAERS: 2 | SIDER US FAERS | |
| 48 | Myelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 49 | Nausea | FAERS: 2 | SIDER US FAERS | |
| 50 | Neuralgia | FAERS: 2 | SIDER US FAERS | |
| 51 | Pancytopenia | FAERS: 2 | US FAERS | |
| 52 | Quadriplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 53 | Rhabdomyolysis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 54 | Tremor | FAERS: 2 | SIDER US FAERS | |
| 55 | Vomiting | FAERS: 2 | SIDER US FAERS | |
| 56 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 57 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 58 | Agitation | FAERS: 1 | US FAERS | |
| 59 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 60 | Blood creatinine increased | FAERS: 1 | SIDER US FAERS | |
| 61 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 62 | Blood potassium | FAERS: 1 | US FAERS | |
| 63 | Burning sensation | FAERS: 1 | SIDER US FAERS | |
| 64 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 65 | Cholestasis | FAERS: 1 | US FAERS | |
| 66 | Colitis | FAERS: 1 | US FAERS | |
| 67 | Cystitis | FAERS: 1 | US FAERS | |
| 68 | Deafness | FAERS: 1 | US FAERS | |
| 69 | Decreased vibratory sense | FAERS: 1 | US FAERS | |
| 70 | Delirium | FAERS: 1 | US FAERS | |
| 71 | Dementia | FAERS: 1 | US FAERS | |
| 72 | Demyelination | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 73 | Dysarthria | FAERS: 1 | SIDER US FAERS | |
| 74 | Dysuria | FAERS: 1 | US FAERS | |
| 75 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 76 | Expired product administered | FAERS: 1 | US FAERS | |
| 77 | Extravasation | FAERS: 1 | US FAERS | |
| 78 | Eye irritation | FAERS: 1 | US FAERS | |
| 79 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 80 | Hypersomnia | FAERS: 1 | US FAERS | |
| 81 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 82 | Inflammation | FAERS: 1 | US FAERS | |
| 83 | Infusion site pain | FAERS: 1 | US FAERS | |
| 84 | Myositis | FAERS: 1 | US FAERS | |
| 85 | Pancreatitis | FAERS: 1 | US FAERS | |
| 86 | Paraparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 87 | Paraplegia | FAERS: 1 | 20658590 | CTD OFFSIDES US FAERS |
| 88 | Peripheral motor neuropathy | FAERS: 1 | SIDER US FAERS | |
| 89 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 90 | Radiculopathy | FAERS: 1 | US FAERS | |
| 91 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 92 | Romberg test positive | FAERS: 1 | US FAERS | |
| 93 | Sepsis | FAERS: 1 | SIDER US FAERS | |
| 94 | Somatosensory evoked potentials abnormal | FAERS: 1 | US FAERS | |
| 95 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 96 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 97 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 98 | Vasculitis | FAERS: 1 | US FAERS | |
| 99 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 100 | Visual Impairment | FAERS: 1 | US FAERS | |
| 101 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 102 | jaundice | FAERS: 1 | US FAERS | |
| 103 | Abdominal Pain | SIDER | ||
| 104 | Abulia | OFFSIDES | ||
| 105 | Adverse event | OFFSIDES | ||
| 106 | Aldolase increased | OFFSIDES | ||
| 107 | Amnesia | SIDER | ||
| 108 | Anal Fissure | OFFSIDES | ||
| 109 | Anorexia | SIDER | ||
| 110 | Aphasia | SIDER | ||
| 111 | Arthralgia | SIDER | ||
| 112 | BK virus infection | OFFSIDES | ||
| 113 | Back Pain | SIDER | ||
| 114 | Blood albumin decreased | SIDER | ||
| 115 | Blood and lymphatic system disorders | SIDER | ||
| 116 | Blood glucose decreased | SIDER | ||
| 117 | Blood magnesium decreased | SIDER | ||
| 118 | Blood potassium decreased | SIDER | ||
| 119 | Blurred vision | OFFSIDES | ||
| 120 | Bulbar palsy | OFFSIDES | ||
| 121 | Chest Pain | SIDER | ||
| 122 | Chills | SIDER | ||
| 123 | Complications of transplant surgery | OFFSIDES | ||
| 124 | Confabulation | OFFSIDES | ||
| 125 | Constipation | SIDER | ||
| 126 | Cyst | SIDER | ||
| 127 | Diastolic dysfunction | OFFSIDES | ||
| 128 | Diplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 129 | Drowsiness | OFFSIDES | ||
| 130 | Dysgeusia | SIDER | ||
| 131 | Dysphonia | OFFSIDES | ||
| 132 | Epistaxis | SIDER | ||
| 133 | Fatigue | SIDER | ||
| 134 | Feeling abnormal | SIDER | ||
| 135 | Formication | OFFSIDES | ||
| 136 | Gastrointestinal Pain | SIDER | ||
| 137 | Gliosis | Canada Vigilance: 1 | Canada Vigilance | |
| 138 | Hemiparesis | SIDER | ||
| 139 | Hydrocephalus | SIDER | ||
| 140 | Hypomania | OFFSIDES | ||
| 141 | Hypotension | SIDER | ||
| 142 | Infestation | SIDER | ||
| 143 | Infusion site mobility decreased | OFFSIDES | ||
| 144 | Intention tremor | OFFSIDES | ||
| 145 | Leukemia, T-Cell | 20528871 | CTD | |
| 146 | Leukopenia neonatal | OFFSIDES | ||
| 147 | Leukopenia | SIDER | ||
| 148 | Loss of proprioception | OFFSIDES | ||
| 149 | Malnutrition | SIDER | ||
| 150 | Meningitis | Canada Vigilance: 1 | Canada Vigilance | |
| 151 | Mental Retardation | SIDER | ||
| 152 | Mononeuritis | OFFSIDES | ||
| 153 | Muscle Weakness | OFFSIDES | ||
| 154 | Musculoskeletal discomfort | SIDER | ||
| 155 | Neck Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 156 | Nerve Degeneration | Canada Vigilance: 1 | Canada Vigilance | |
| 157 | Neuritis | SIDER | ||
| 158 | Neuropathy | SIDER | ||
| 159 | Non-cardiac chest pain | SIDER | ||
| 160 | Nystagmus | SIDER | ||
| 161 | Ocular cancer metastatic | OFFSIDES | ||
| 162 | Oropharyngeal pain | OFFSIDES | ||
| 163 | Peripheral Nervous System Diseases | 24664478 | CTD | |
| 164 | Petechiae | SIDER | ||
| 165 | Pneumothorax | SIDER | ||
| 166 | Precursor T-Cell Lymphoblastic Leukemia-Lymphoma | 16831976 20658590 | CTD | |
| 167 | Productive Cough | OFFSIDES | ||
| 168 | Residual urine | OFFSIDES | ||
| 169 | Respiratory arrest | SIDER | ||
| 170 | Sciatica | SIDER | ||
| 171 | Sinus Tachycardia | SIDER | ||
| 172 | Sinus headache | SIDER | ||
| 173 | Sinusitis | SIDER | ||
| 174 | Status Epilepticus | SIDER | ||
| 175 | Stomatitis | SIDER | ||
| 176 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 177 | Thrombocytopenia | SIDER | ||
| 178 | VIIth nerve paralysis | OFFSIDES | ||
| 179 | Ventricular Fibrillation | OFFSIDES | ||
| 180 | Wheezing | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.