Dapagliflozin and metformin hydrochloride
(IPQABJMJAWNGON-RFSZPCNPSA-N)
Structure
- SMILES
- CN(C(=N)N=C(N)N)C.CCOc1ccc(cc1)Cc1cc(ccc1Cl)C1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O.Cl
- Molecular Formula:
- C25H37Cl2N5O6
- Molecular Weight:
- 574.497
- Log P:
- 2.9029
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 8
- TPSA:
- 190.87
- CAS Number(s):
- N/A
Synonym(s)
1.
Dapagliflozin and metformin hydrochloride
External Link(s)
| PubChem Compound | 85470863 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetic Ketoacidosis | FAERS: 30 | US FAERS | |
| 2 | Blood glucose increased | FAERS: 18 | US FAERS | |
| 3 | Ketoacidosis | FAERS: 14 | US FAERS | |
| 4 | Nausea | FAERS: 14 | US FAERS | |
| 5 | Vomiting | FAERS: 12 | US FAERS | |
| 6 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 7 | Urinary tract infection | FAERS: 11 | US FAERS | |
| 8 | Weight decreased | FAERS: 11 | US FAERS | |
| 9 | Dizziness | FAERS: 8 | US FAERS | |
| 10 | Drug dose omission | FAERS: 7 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 12 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 13 | Pancreatitis | FAERS: 7 | US FAERS | |
| 14 | Back Pain | FAERS: 6 | US FAERS | |
| 15 | Fatigue | FAERS: 6 | US FAERS | |
| 16 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 17 | Headache | FAERS: 5 | US FAERS | |
| 18 | Medication residue present | FAERS: 5 | US FAERS | |
| 19 | Pain | FAERS: 5 | US FAERS | |
| 20 | Visual Impairment | FAERS: 5 | US FAERS | |
| 21 | Dehydration | FAERS: 4 | US FAERS | |
| 22 | Drug ineffective | FAERS: 4 | US FAERS | |
| 23 | Erythema | FAERS: 4 | US FAERS | |
| 24 | Product use issue | FAERS: 4 | US FAERS | |
| 25 | Pruritus | FAERS: 4 | US FAERS | |
| 26 | Urticaria | FAERS: 4 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 28 | Acidosis | FAERS: 3 | US FAERS | |
| 29 | Arthralgia | FAERS: 3 | US FAERS | |
| 30 | Asthenia | FAERS: 3 | US FAERS | |
| 31 | Balanoposthitis | FAERS: 3 | US FAERS | |
| 32 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 33 | Euglycaemic diabetic ketoacidosis | FAERS: 3 | US FAERS | |
| 34 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 36 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 37 | Phimosis | FAERS: 3 | US FAERS | |
| 38 | Syncope | FAERS: 3 | US FAERS | |
| 39 | Adverse event | FAERS: 2 | US FAERS | |
| 40 | Alopecia | FAERS: 2 | US FAERS | |
| 41 | Anxiety | FAERS: 2 | US FAERS | |
| 42 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 43 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 44 | Chest Pain | FAERS: 2 | US FAERS | |
| 45 | Constipation | FAERS: 2 | US FAERS | |
| 46 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 47 | Dysuria | FAERS: 2 | US FAERS | |
| 48 | Escherichia infection | FAERS: 2 | US FAERS | |
| 49 | Flushing | FAERS: 2 | US FAERS | |
| 50 | Genital infection fungal | FAERS: 2 | US FAERS | |
| 51 | Hepatitis | FAERS: 2 | US FAERS | |
| 52 | Infection | FAERS: 2 | US FAERS | |
| 53 | Ketonuria | FAERS: 2 | US FAERS | |
| 54 | Muscle tightness | FAERS: 2 | US FAERS | |
| 55 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 56 | Myalgia | FAERS: 2 | US FAERS | |
| 57 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 58 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 59 | Palpitations | FAERS: 2 | US FAERS | |
| 60 | Pneumonia | FAERS: 2 | US FAERS | |
| 61 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 62 | Sepsis | FAERS: 2 | US FAERS | |
| 63 | Somnolence | FAERS: 2 | US FAERS | |
| 64 | Thrombosis | FAERS: 2 | US FAERS | |
| 65 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 66 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 67 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 68 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 69 | Amputation | FAERS: 1 | US FAERS | |
| 70 | Anal abscess | FAERS: 1 | US FAERS | |
| 71 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 72 | Back disorder | FAERS: 1 | US FAERS | |
| 73 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 74 | Blindness | FAERS: 1 | US FAERS | |
| 75 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 76 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 77 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 78 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 79 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 80 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 81 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 82 | Blood urine present | FAERS: 1 | US FAERS | |
| 83 | Burning sensation | FAERS: 1 | US FAERS | |
| 84 | Calcinosis | FAERS: 1 | US FAERS | |
| 85 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 86 | Chest discomfort | FAERS: 1 | US FAERS | |
| 87 | Choking | FAERS: 1 | US FAERS | |
| 88 | Culture urine positive | FAERS: 1 | US FAERS | |
| 89 | Cystitis | FAERS: 1 | US FAERS | |
| 90 | Dengue Fever | FAERS: 1 | US FAERS | |
| 91 | Dermatitis | FAERS: 1 | US FAERS | |
| 92 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 93 | Disorientation | FAERS: 1 | US FAERS | |
| 94 | Drug administration error | FAERS: 1 | US FAERS | |
| 95 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 96 | Dysgraphia | FAERS: 1 | US FAERS | |
| 97 | Dyspepsia | FAERS: 1 | US FAERS | |
| 98 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 99 | Enterovesical Fistula | FAERS: 1 | US FAERS | |
| 100 | Epididymitis | FAERS: 1 | US FAERS | |
| 101 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 102 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 103 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 104 | Eye irritation | FAERS: 1 | US FAERS | |
| 105 | Facial Pain | FAERS: 1 | US FAERS | |
| 106 | Feeling Cold | FAERS: 1 | US FAERS | |
| 107 | Fixed bowel loop | FAERS: 1 | US FAERS | |
| 108 | Flank Pain | FAERS: 1 | US FAERS | |
| 109 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 110 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 111 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 112 | Genital erythema | FAERS: 1 | US FAERS | |
| 113 | Genital pain | FAERS: 1 | US FAERS | |
| 114 | Glossitis | FAERS: 1 | US FAERS | |
| 115 | Glycosuria | FAERS: 1 | US FAERS | |
| 116 | Gout | FAERS: 1 | US FAERS | |
| 117 | Heat illness | FAERS: 1 | US FAERS | |
| 118 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 119 | Hunger | FAERS: 1 | US FAERS | |
| 120 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 121 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 122 | Impaired work ability | FAERS: 1 | US FAERS | |
| 123 | Infarction | FAERS: 1 | US FAERS | |
| 124 | Inflammation | FAERS: 1 | US FAERS | |
| 125 | Influenza | FAERS: 1 | US FAERS | |
| 126 | Lethargy | FAERS: 1 | US FAERS | |
| 127 | Lip swelling | FAERS: 1 | US FAERS | |
| 128 | Malaise | FAERS: 1 | US FAERS | |
| 129 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 130 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 131 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 132 | Oral pain | FAERS: 1 | US FAERS | |
| 133 | Pain of skin | FAERS: 1 | US FAERS | |
| 134 | Parotitis | FAERS: 1 | US FAERS | |
| 135 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 136 | Penile swelling | FAERS: 1 | US FAERS | |
| 137 | Performance status decreased | FAERS: 1 | US FAERS | |
| 138 | Peritonsillitis | FAERS: 1 | US FAERS | |
| 139 | Polyuria | FAERS: 1 | US FAERS | |
| 140 | Prerenal failure | FAERS: 1 | US FAERS | |
| 141 | Product quality issue | FAERS: 1 | US FAERS | |
| 142 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 143 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 144 | Renal pain | FAERS: 1 | US FAERS | |
| 145 | Semen analysis abnormal | FAERS: 1 | US FAERS | |
| 146 | Septic Shock | FAERS: 1 | US FAERS | |
| 147 | Skin necrosis | FAERS: 1 | US FAERS | |
| 148 | Splenomegaly | FAERS: 1 | US FAERS | |
| 149 | Stress | FAERS: 1 | US FAERS | |
| 150 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 151 | Tension | FAERS: 1 | US FAERS | |
| 152 | Therapy cessation | FAERS: 1 | US FAERS | |
| 153 | Throat irritation | FAERS: 1 | US FAERS | |
| 154 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 155 | Transaminases increased | FAERS: 1 | US FAERS | |
| 156 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 157 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 158 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.