Olopatadine Hydrochloride
(HVRLZEKDTUEKQH-NOILCQHBSA-N)
Structure
- SMILES
- CN(CC/C=C/1\c2cc(ccc2OCc2c1cccc2)CC(=O)O)C.Cl
- Molecular Formula:
- C21H24ClNO3
- Molecular Weight:
- 373.873
- Log P:
- 4.3915
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 49.77
- CAS Number(s):
- 140462-76-6
Synonym(s)
1.
Olopatadine Hydrochloride
2.
11-(3-(dimethylamino)propylidene)-6,11-dihydrodibenz(b,e)oxepin-2-acetic acid
3.
KW 4679
4.
KW-4679
5.
KW-4943A
6.
Olopatadine
7.
Patanol
8.
4679, KW
9.
Hydrochloride, Olopatadine
10.
KW 4943A
11.
KW4943A
External Link(s)
| MeSH | D000069605 |
| PubChem Compound | 67108011 5282402 |
| ChEBI | 31933 |
| CHEMBL | CHEMBL1719 |
| KEGG | dr:D01192 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 305 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 2 | Eye irritation | FAERS: 89 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Hypersensitivity | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Headache | FAERS: 25 | US FAERS | |
| 6 | Product quality issue | FAERS: 23 | US FAERS | |
| 7 | Dysgeusia | FAERS: 19 | US FAERS | |
| 8 | Visual Impairment | FAERS: 14 | US FAERS | |
| 9 | Eyelid margin crusting | FAERS: 13 | US FAERS | |
| 10 | Incorrect dose administered | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Oropharyngeal pain | FAERS: 12 | US FAERS | |
| 12 | Dizziness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Expired product administered | FAERS: 10 | US FAERS | |
| 14 | Malaise | FAERS: 9 | US FAERS | |
| 15 | Nausea | FAERS: 8 | US FAERS | |
| 16 | Ocular discomfort | FAERS: 8 | US FAERS | |
| 17 | Epistaxis | FAERS: 7 | US FAERS | |
| 18 | Eye allergy | FAERS: 7 | US FAERS | |
| 19 | Foreign body sensation in eyes | FAERS: 7 | US FAERS | |
| 20 | Overdose | FAERS: 6 | US FAERS | |
| 21 | Product use issue | FAERS: 6 | US FAERS | |
| 22 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 23 | Adverse event | FAERS: 5 | US FAERS | |
| 24 | Liquid product physical issue | FAERS: 5 | US FAERS | |
| 25 | No adverse event | FAERS: 5 | US FAERS | |
| 26 | Pain | FAERS: 5 | US FAERS | |
| 27 | Photophobia | FAERS: 5 | US FAERS | |
| 28 | Somnolence | FAERS: 5 | US FAERS | |
| 29 | Tremor | FAERS: 5 | US FAERS | |
| 30 | Arthritis | FAERS: 4 | US FAERS | |
| 31 | Back Pain | FAERS: 4 | US FAERS | |
| 32 | Blepharospasm | FAERS: 4 | US FAERS | |
| 33 | Chest discomfort | FAERS: 4 | US FAERS | |
| 34 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 35 | Erythema | FAERS: 4 | US FAERS | |
| 36 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 37 | Incorrect dose administered by device | FAERS: 4 | US FAERS | |
| 38 | Medication residue present | FAERS: 4 | US FAERS | |
| 39 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 40 | Urticaria | FAERS: 4 | US FAERS | |
| 41 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 42 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 43 | Blepharitis | FAERS: 3 | US FAERS | |
| 44 | Blindness | FAERS: 3 | US FAERS | |
| 45 | Drug administration error | FAERS: 3 | US FAERS | |
| 46 | Eye inflammation | FAERS: 3 | US FAERS | |
| 47 | Eyelid irritation | FAERS: 3 | US FAERS | |
| 48 | Fatigue | FAERS: 3 | US FAERS | |
| 49 | Head discomfort | FAERS: 3 | US FAERS | |
| 50 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 51 | Product dropper issue | FAERS: 3 | US FAERS | |
| 52 | Product packaging issue | FAERS: 3 | US FAERS | |
| 53 | Product substitution issue | FAERS: 3 | US FAERS | |
| 54 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 55 | Sinusitis | FAERS: 3 | US FAERS | |
| 56 | Superficial injury of eye | FAERS: 3 | US FAERS | |
| 57 | Angioedema | FAERS: 2 | US FAERS | |
| 58 | Anxiety | FAERS: 2 | US FAERS | |
| 59 | Asthenia | FAERS: 2 | US FAERS | |
| 60 | Asthenopia | FAERS: 2 | US FAERS | |
| 61 | Asthma | FAERS: 2 | US FAERS | |
| 62 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 64 | Chest Pain | FAERS: 2 | US FAERS | |
| 65 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 66 | Crying | FAERS: 2 | US FAERS | |
| 67 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 68 | Dysphonia | FAERS: 2 | US FAERS | |
| 69 | Eye Infection | FAERS: 2 | US FAERS | |
| 70 | Eyelids pruritus | FAERS: 2 | US FAERS | |
| 71 | Impaired work ability | FAERS: 2 | US FAERS | |
| 72 | Laryngitis | FAERS: 2 | US FAERS | |
| 73 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 74 | Mydriasis | FAERS: 2 | US FAERS | |
| 75 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 76 | Nasal pruritus | FAERS: 2 | US FAERS | |
| 77 | Nervousness | FAERS: 2 | US FAERS | |
| 78 | Pharyngitis | FAERS: 2 | US FAERS | |
| 79 | Product container seal issue | FAERS: 2 | US FAERS | |
| 80 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 81 | Product use complaint | FAERS: 2 | US FAERS | |
| 82 | Rhinalgia | FAERS: 2 | US FAERS | |
| 83 | Throat irritation | FAERS: 2 | US FAERS | |
| 84 | Vertigo | FAERS: 2 | US FAERS | |
| 85 | treatment failure | FAERS: 2 | US FAERS | |
| 86 | Ageusia | FAERS: 1 | US FAERS | |
| 87 | Agitation | FAERS: 1 | US FAERS | |
| 88 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 89 | Arthropathy | FAERS: 1 | US FAERS | |
| 90 | Astigmatism | FAERS: 1 | US FAERS | |
| 91 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 92 | Bronchitis | FAERS: 1 | US FAERS | |
| 93 | Cataract | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Chills | FAERS: 1 | US FAERS | |
| 95 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 96 | Coating in mouth | FAERS: 1 | US FAERS | |
| 97 | Complication associated with device | FAERS: 1 | US FAERS | |
| 98 | Constipation | FAERS: 1 | US FAERS | |
| 99 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 100 | Deafness | FAERS: 1 | US FAERS | |
| 101 | Depressed mood | FAERS: 1 | US FAERS | |
| 102 | Device damage | FAERS: 1 | US FAERS | |
| 103 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 104 | Diplopia | FAERS: 1 | US FAERS | |
| 105 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 106 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 107 | Ear discomfort | FAERS: 1 | US FAERS | |
| 108 | Economic problem | FAERS: 1 | US FAERS | |
| 109 | Emotional disorder | FAERS: 1 | US FAERS | |
| 110 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 111 | Eyelid pain | FAERS: 1 | US FAERS | |
| 112 | Eyelid rash | FAERS: 1 | US FAERS | |
| 113 | Food aversion | FAERS: 1 | US FAERS | |
| 114 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 115 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 116 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 117 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 118 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 119 | Influenza | FAERS: 1 | US FAERS | |
| 120 | Injury associated with device | FAERS: 1 | US FAERS | |
| 121 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 122 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 123 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 124 | Keratoconus | FAERS: 1 | US FAERS | |
| 125 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 126 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 127 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 128 | Middle insomnia | FAERS: 1 | US FAERS | |
| 129 | Motion Sickness | FAERS: 1 | US FAERS | |
| 130 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 131 | Nodule | FAERS: 1 | US FAERS | |
| 132 | Palpitations | FAERS: 1 | US FAERS | |
| 133 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 134 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 135 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 136 | Product administration error | FAERS: 1 | US FAERS | |
| 137 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 138 | Product container issue | FAERS: 1 | US FAERS | |
| 139 | Product dispensing error | FAERS: 1 | US FAERS | |
| 140 | Product label issue | FAERS: 1 | US FAERS | |
| 141 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 142 | Product physical issue | FAERS: 1 | US FAERS | |
| 143 | Productive Cough | FAERS: 1 | US FAERS | |
| 144 | Pruritus | FAERS: 1 | US FAERS | |
| 145 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 146 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 147 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 148 | Secretion discharge | FAERS: 1 | US FAERS | |
| 149 | Sinonasal obstruction | FAERS: 1 | US FAERS | |
| 150 | Sinus headache | FAERS: 1 | US FAERS | |
| 151 | Sinus pain | FAERS: 1 | US FAERS | |
| 152 | Skin laceration | FAERS: 1 | US FAERS | |
| 153 | Stress | FAERS: 1 | US FAERS | |
| 154 | Swelling | FAERS: 1 | US FAERS | |
| 155 | Syncope | FAERS: 1 | US FAERS | |
| 156 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 157 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 158 | Thermal burn | FAERS: 1 | US FAERS | |
| 159 | Toothache | FAERS: 1 | US FAERS | |
| 160 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 161 | Uveitis | FAERS: 1 | US FAERS | |
| 162 | Victim of homicide | FAERS: 1 | US FAERS | |
| 163 | Vomiting | FAERS: 1 | US FAERS | |
| 164 | Concomitant disease aggravated | Canada Vigilance: 1 | Canada Vigilance | |
| 165 | Sneezing | 19075512 | CTD | |
| 166 | anaphylaxis | 8951675 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.