Odefsey
(GHWBYIZAYFIRPA-PPEAAZTNSA-N)
Structure
- SMILES
- Nc1nc(=O)n(cc1F)[C@@H]1CS[C@@H](O1)CO.C[C@H](Cn1cnc2c1ncnc2N)OC[P@@](=O)(N[C@H](C(=O)OC(C)C)C)Oc1ccccc1.N#C/C=C/c1cc(C)c(c(c1)C)Nc1ccnc(n1)Nc1ccc(cc1)C#N
- Molecular Formula:
- C51H57FN15O8PS
- Molecular Weight:
- 1090.130
- Log P:
- 9.2063
- Hydrogen Bond Acceptor:
- 22
- Hydrogen Bond Donor:
- 6
- TPSA:
- 366.38
- CAS Number(s):
- N/A
Synonym(s)
1.
Odefsey
External Link(s)
| PubChem Compound | 91810705 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 15 | US FAERS | |
| 2 | Nausea | FAERS: 13 | US FAERS | |
| 3 | Drug dose omission | FAERS: 9 | US FAERS | |
| 4 | Drug ineffective | FAERS: 8 | US FAERS | |
| 5 | Myalgia | FAERS: 8 | US FAERS | |
| 6 | Viral load increased | FAERS: 8 | US FAERS | |
| 7 | Dizziness | FAERS: 7 | US FAERS | |
| 8 | Fatigue | FAERS: 7 | US FAERS | |
| 9 | Pruritus | FAERS: 7 | US FAERS | |
| 10 | Therapy cessation | FAERS: 7 | US FAERS | |
| 11 | Alopecia | FAERS: 6 | US FAERS | |
| 12 | Product storage error | FAERS: 6 | US FAERS | |
| 13 | Blood HIV RNA increased | FAERS: 5 | US FAERS | |
| 14 | Gastrostomy | FAERS: 5 | US FAERS | |
| 15 | Intentional dose omission | FAERS: 5 | US FAERS | |
| 16 | Dyspepsia | FAERS: 4 | US FAERS | |
| 17 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 18 | Memory impairment | FAERS: 4 | US FAERS | |
| 19 | Pain | FAERS: 4 | US FAERS | |
| 20 | Pneumonia | FAERS: 4 | US FAERS | |
| 21 | Product dose omission | FAERS: 4 | US FAERS | |
| 22 | Product use issue | FAERS: 4 | US FAERS | |
| 23 | Therapy change | FAERS: 4 | US FAERS | |
| 24 | Vertigo | FAERS: 4 | US FAERS | |
| 25 | Vomiting | FAERS: 4 | US FAERS | |
| 26 | Anxiety | FAERS: 3 | US FAERS | |
| 27 | Arthralgia | FAERS: 3 | US FAERS | |
| 28 | Asthenia | FAERS: 3 | US FAERS | |
| 29 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 30 | Flatulence | FAERS: 3 | US FAERS | |
| 31 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 32 | Insurance issue | FAERS: 3 | US FAERS | |
| 33 | Malaise | FAERS: 3 | US FAERS | |
| 34 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 35 | Product use complaint | FAERS: 3 | US FAERS | |
| 36 | Somnolence | FAERS: 3 | US FAERS | |
| 37 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 38 | Urticaria | FAERS: 3 | US FAERS | |
| 39 | Weight decreased | FAERS: 3 | US FAERS | |
| 40 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 41 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 42 | Accidental overdose | FAERS: 2 | US FAERS | |
| 43 | Amnesia | FAERS: 2 | US FAERS | |
| 44 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 45 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 46 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 47 | Chest Pain | FAERS: 2 | US FAERS | |
| 48 | Constipation | FAERS: 2 | US FAERS | |
| 49 | Discomfort | FAERS: 2 | US FAERS | |
| 50 | Economic problem | FAERS: 2 | US FAERS | |
| 51 | Emotional disorder | FAERS: 2 | US FAERS | |
| 52 | Hepatitis | FAERS: 2 | US FAERS | |
| 53 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 54 | Joint swelling | FAERS: 2 | US FAERS | |
| 55 | Lip swelling | FAERS: 2 | US FAERS | |
| 56 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 57 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 58 | Neuralgia | FAERS: 2 | US FAERS | |
| 59 | Pancreatitis | FAERS: 2 | US FAERS | |
| 60 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 61 | Sepsis | FAERS: 2 | US FAERS | |
| 62 | Syphilis | FAERS: 2 | US FAERS | |
| 63 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 64 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 65 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 66 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 67 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 68 | Angioedema | FAERS: 1 | US FAERS | |
| 69 | Appendicitis | FAERS: 1 | US FAERS | |
| 70 | Arthropathy | FAERS: 1 | US FAERS | |
| 71 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 72 | Back Pain | FAERS: 1 | US FAERS | |
| 73 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 74 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 75 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 76 | Cell Death | FAERS: 1 | US FAERS | |
| 77 | Chills | FAERS: 1 | US FAERS | |
| 78 | Cholestasis | FAERS: 1 | US FAERS | |
| 79 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 80 | Completed Suicide | FAERS: 1 | US FAERS | |
| 81 | Crying | FAERS: 1 | US FAERS | |
| 82 | Cystitis | FAERS: 1 | US FAERS | |
| 83 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 84 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 85 | Drug administration error | FAERS: 1 | US FAERS | |
| 86 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 87 | Dry skin | FAERS: 1 | US FAERS | |
| 88 | Early satiety | FAERS: 1 | US FAERS | |
| 89 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 90 | Epistaxis | FAERS: 1 | US FAERS | |
| 91 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 92 | Escherichia infection | FAERS: 1 | US FAERS | |
| 93 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 94 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 95 | Eyelid rash | FAERS: 1 | US FAERS | |
| 96 | Facial paralysis | FAERS: 1 | US FAERS | |
| 97 | Feeling Cold | FAERS: 1 | US FAERS | |
| 98 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 99 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 100 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 101 | Hepatitis C | FAERS: 1 | US FAERS | |
| 102 | Hunger | FAERS: 1 | US FAERS | |
| 103 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 104 | Hypotension | FAERS: 1 | US FAERS | |
| 105 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 106 | Impaired work ability | FAERS: 1 | US FAERS | |
| 107 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 108 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 109 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 110 | Infection | FAERS: 1 | US FAERS | |
| 111 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 112 | Joint injury | FAERS: 1 | US FAERS | |
| 113 | Joint stiffness | FAERS: 1 | US FAERS | |
| 114 | Limb discomfort | FAERS: 1 | US FAERS | |
| 115 | Limb injury | FAERS: 1 | US FAERS | |
| 116 | Lipase increased | FAERS: 1 | US FAERS | |
| 117 | Lymphopenia | FAERS: 1 | US FAERS | |
| 118 | Malignant anorectal neoplasm | FAERS: 1 | US FAERS | |
| 119 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 120 | Mental status changes | FAERS: 1 | US FAERS | |
| 121 | Muscle strain | FAERS: 1 | US FAERS | |
| 122 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 123 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 124 | Myopathy | FAERS: 1 | US FAERS | |
| 125 | Natural killer T cell count decreased | FAERS: 1 | US FAERS | |
| 126 | Neutropenia | FAERS: 1 | US FAERS | |
| 127 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 128 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 129 | Overdose | FAERS: 1 | US FAERS | |
| 130 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 131 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 132 | Product complaint | FAERS: 1 | US FAERS | |
| 133 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 134 | Product dispensing error | FAERS: 1 | US FAERS | |
| 135 | Product distribution issue | FAERS: 1 | US FAERS | |
| 136 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 137 | Purulence | FAERS: 1 | US FAERS | |
| 138 | Rash erythematous | FAERS: 1 | US FAERS | |
| 139 | Renal mass | FAERS: 1 | US FAERS | |
| 140 | Renal pain | FAERS: 1 | US FAERS | |
| 141 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 142 | Respiratory distress | FAERS: 1 | US FAERS | |
| 143 | Roux loop conversion | FAERS: 1 | US FAERS | |
| 144 | Septic Shock | FAERS: 1 | US FAERS | |
| 145 | Sluggishness | FAERS: 1 | US FAERS | |
| 146 | Stomatitis | FAERS: 1 | US FAERS | |
| 147 | Stress | FAERS: 1 | US FAERS | |
| 148 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 149 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 150 | Tachycardia | FAERS: 1 | US FAERS | |
| 151 | Throat irritation | FAERS: 1 | US FAERS | |
| 152 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 153 | Tremor | FAERS: 1 | US FAERS | |
| 154 | Unevaluable event | FAERS: 1 | US FAERS | |
| 155 | Uveitis | FAERS: 1 | US FAERS | |
| 156 | Viral load undetectable | FAERS: 1 | US FAERS | |
| 157 | Visual Impairment | FAERS: 1 | US FAERS | |
| 158 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 159 | Wrong patient received product | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.