Ranitidine
(GGWBHVILAJZWKJ-KJEVSKRMSA-N)
Structure
- SMILES
- CN/C(=C\[N+](=O)[O-])/NCCSCc1ccc(o1)CN(C)C.Cl
- Molecular Formula:
- C13H23ClN4O3S
- Molecular Weight:
- 350.865
- Log P:
- 3.5660
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 111.56
- CAS Number(s):
- 66357-59-3; 71130-06-8
Synonym(s)
1.
Ranitidine
2.
AH-19065
3.
Biotidin
4.
N (2-(((5-((Dimethylamino)methyl)-2-furanyl)methyl)thio)ethyl)-N'-methyl-2-nitro-1,1-ethenediamine
5.
Ranisen
6.
Ranitidin
7.
Ranitidine Hydrochloride
8.
Sostril
9.
Zantac
10.
Zantic
11.
AH 19065
12.
AH19065
13.
Hydrochloride, Ranitidine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 147 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Incorrect drug administration duration | FAERS: 91 | US FAERS | |
| 3 | Dyspepsia | FAERS: 45 | US FAERS | |
| 4 | Drug screen positive | FAERS: 44 | US FAERS | |
| 5 | Nausea | FAERS: 41 | US FAERS | |
| 6 | Incorrect dose administered | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 25 | US FAERS | |
| 9 | Constipation | FAERS: 21 | US FAERS | |
| 10 | Medication Error | FAERS: 21 | US FAERS | |
| 11 | Urticaria | FAERS: 21 | US FAERS | |
| 12 | Drug screen false positive | FAERS: 20 | US FAERS | |
| 13 | Abdominal Pain | FAERS: 18 | US FAERS | |
| 14 | Product quality issue | FAERS: 18 | US FAERS | |
| 15 | Malaise | FAERS: 17 | US FAERS | |
| 16 | Headache | FAERS: 16 | US FAERS | |
| 17 | Abdominal discomfort | FAERS: 15 | US FAERS | |
| 18 | Dysgeusia | FAERS: 14 | US FAERS | |
| 19 | Product substitution issue | FAERS: 14 | US FAERS | |
| 20 | Pruritus | FAERS: 14 | US FAERS | |
| 21 | Amphetamines positive | FAERS: 13 | US FAERS | |
| 22 | Chest Pain | FAERS: 13 | US FAERS | |
| 23 | Hypotension | FAERS: 13 | US FAERS | |
| 24 | Flatulence | FAERS: 12 | US FAERS | |
| 25 | Hypersensitivity | FAERS: 12 | US FAERS | |
| 26 | Pain | FAERS: 12 | US FAERS | |
| 27 | Product taste abnormal | FAERS: 12 | US FAERS | |
| 28 | Accidental exposure to product by child | FAERS: 11 | US FAERS | |
| 29 | Overdose | FAERS: 11 | US FAERS | |
| 30 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 31 | Erythema | FAERS: 10 | US FAERS | |
| 32 | Wrong drug administered | FAERS: 10 | US FAERS | |
| 33 | Accidental overdose | FAERS: 9 | US FAERS | |
| 34 | Chest discomfort | FAERS: 9 | US FAERS | |
| 35 | Expired product administered | FAERS: 9 | US FAERS | |
| 36 | Angioedema | FAERS: 8 | US FAERS | |
| 37 | Chromaturia | FAERS: 8 | US FAERS | |
| 38 | Wrong product administered | FAERS: 8 | US FAERS | |
| 39 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 40 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 41 | Back Pain | FAERS: 6 | US FAERS | |
| 42 | Hepatitis | FAERS: 6 | US FAERS | |
| 43 | Incorrect product administration duration | FAERS: 6 | US FAERS | |
| 44 | Product physical issue | FAERS: 6 | US FAERS | |
| 45 | Throat irritation | FAERS: 6 | US FAERS | |
| 46 | Tremor | FAERS: 6 | US FAERS | |
| 47 | Unevaluable event | FAERS: 6 | US FAERS | |
| 48 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 49 | Autoimmune hepatitis | FAERS: 5 | US FAERS | |
| 50 | Burning sensation | FAERS: 5 | US FAERS | |
| 51 | Fatigue | FAERS: 5 | US FAERS | |
| 52 | Flushing | FAERS: 5 | US FAERS | |
| 53 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 54 | Myalgia | FAERS: 5 | US FAERS | |
| 55 | Nystagmus | FAERS: 5 | US FAERS | |
| 56 | Palpitations | FAERS: 5 | US FAERS | |
| 57 | Somnolence | FAERS: 5 | US FAERS | |
| 58 | Wrong technique in product usage process | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | jaundice | FAERS: 5 | US FAERS | |
| 60 | Anaphylactoid Reaction | FAERS: 4 | US FAERS | |
| 61 | Anxiety | FAERS: 4 | US FAERS | |
| 62 | Arthralgia | FAERS: 4 | US FAERS | |
| 63 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 64 | Cholestasis | FAERS: 4 | US FAERS | |
| 65 | Discomfort | FAERS: 4 | US FAERS | |
| 66 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 67 | Lip swelling | FAERS: 4 | US FAERS | |
| 68 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 69 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 70 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 71 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 72 | Retching | FAERS: 4 | US FAERS | |
| 73 | Syncope | FAERS: 4 | US FAERS | |
| 74 | Tachycardia | FAERS: 4 | US FAERS | |
| 75 | Transaminases increased | FAERS: 4 | US FAERS | |
| 76 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 77 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 78 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 79 | Choking | FAERS: 3 | US FAERS | |
| 80 | Cold sweat | FAERS: 3 | US FAERS | |
| 81 | Crying | FAERS: 3 | US FAERS | |
| 82 | Disorientation | FAERS: 3 | US FAERS | |
| 83 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 84 | Dysuria | FAERS: 3 | US FAERS | |
| 85 | Eructation | FAERS: 3 | US FAERS | |
| 86 | Extra dose administered | FAERS: 3 | US FAERS | |
| 87 | Food Allergy | FAERS: 3 | US FAERS | |
| 88 | No adverse event | FAERS: 3 | US FAERS | |
| 89 | Product coating issue | FAERS: 3 | US FAERS | |
| 90 | Product storage error | FAERS: 3 | US FAERS | |
| 91 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 92 | Restlessness | FAERS: 3 | US FAERS | |
| 93 | Stress | FAERS: 3 | US FAERS | |
| 94 | Suspected product contamination | FAERS: 3 | US FAERS | |
| 95 | Tinnitus | FAERS: 3 | US FAERS | |
| 96 | Urine amphetamine positive | FAERS: 3 | US FAERS | |
| 97 | Weight decreased | FAERS: 3 | US FAERS | |
| 98 | Anger | FAERS: 2 | US FAERS | |
| 99 | Apathy | FAERS: 2 | US FAERS | |
| 100 | Asthenia | FAERS: 2 | US FAERS | |
| 101 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 102 | Cyst | FAERS: 2 | US FAERS | |
| 103 | Dehydration | FAERS: 2 | US FAERS | |
| 104 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 105 | Disease recurrence | FAERS: 2 | US FAERS | |
| 106 | Drug abuse | FAERS: 2 | US FAERS | |
| 107 | Drug administration error | FAERS: 2 | US FAERS | |
| 108 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 109 | Drug level increased | FAERS: 2 | US FAERS | |
| 110 | Drug screen negative | FAERS: 2 | US FAERS | |
| 111 | Dry skin | FAERS: 2 | US FAERS | |
| 112 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 113 | Emotional distress | FAERS: 2 | US FAERS | |
| 114 | Excoriation | FAERS: 2 | US FAERS | |
| 115 | Feeling jittery | FAERS: 2 | US FAERS | |
| 116 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 117 | Gaze palsy | FAERS: 2 | US FAERS | |
| 118 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 119 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 120 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 121 | Mastocytosis | FAERS: 2 | US FAERS | |
| 122 | Nervousness | FAERS: 2 | US FAERS | |
| 123 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 124 | Prescribed overdose | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Product container seal issue | FAERS: 2 | US FAERS | |
| 126 | Product use issue | FAERS: 2 | US FAERS | |
| 127 | Renal mass | FAERS: 2 | US FAERS | |
| 128 | Shock | FAERS: 2 | US FAERS | |
| 129 | Swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 131 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 132 | Vertigo | FAERS: 2 | US FAERS | |
| 133 | Visual Impairment | FAERS: 2 | US FAERS | |
| 134 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 135 | Achlorhydria | FAERS: 1 | US FAERS | |
| 136 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 137 | Adverse event | FAERS: 1 | US FAERS | |
| 138 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 139 | Alopecia | FAERS: 1 | US FAERS | |
| 140 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 141 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 142 | Amnesia | FAERS: 1 | US FAERS | |
| 143 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 144 | Anorgasmia | FAERS: 1 | US FAERS | |
| 145 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 146 | Arthritis | FAERS: 1 | US FAERS | |
| 147 | Blepharospasm | FAERS: 1 | US FAERS | |
| 148 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 149 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 150 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 151 | Bradycardia | FAERS: 1 | US FAERS | |
| 152 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 153 | Bronchospasm | FAERS: 1 | US FAERS | |
| 154 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 155 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 156 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 157 | Chills | FAERS: 1 | US FAERS | |
| 158 | Chorea | FAERS: 1 | US FAERS | |
| 159 | Dental caries | FAERS: 1 | US FAERS | |
| 160 | Depressed mood | FAERS: 1 | US FAERS | |
| 161 | Dermatitis | FAERS: 1 | US FAERS | |
| 162 | Diplopia | FAERS: 1 | US FAERS | |
| 163 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 164 | Drug dose omission | FAERS: 1 | US FAERS | |
| 165 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 166 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 167 | Dysphonia | FAERS: 1 | US FAERS | |
| 168 | Dystonia | FAERS: 1 | US FAERS | |
| 169 | Eczema | FAERS: 1 | US FAERS | |
| 170 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 171 | Eosinophilia | FAERS: 1 | US FAERS | |
| 172 | Epistaxis | FAERS: 1 | US FAERS | |
| 173 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 174 | Eye pain | FAERS: 1 | US FAERS | |
| 175 | False positive investigation result | FAERS: 1 | US FAERS | |
| 176 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 177 | Feeling Cold | FAERS: 1 | US FAERS | |
| 178 | Fibrosis | FAERS: 1 | US FAERS | |
| 179 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 180 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 181 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 182 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 183 | Gastritis | FAERS: 1 | US FAERS | |
| 184 | Giardiasis | FAERS: 1 | US FAERS | |
| 185 | Glossitis | FAERS: 1 | US FAERS | |
| 186 | Hair metal test | FAERS: 1 | US FAERS | |
| 187 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 188 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 189 | Hernia | FAERS: 1 | US FAERS | |
| 190 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 191 | Hypersomnia | FAERS: 1 | US FAERS | |
| 192 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 193 | Hypoxia | FAERS: 1 | US FAERS | |
| 194 | Impaired work ability | FAERS: 1 | US FAERS | |
| 195 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 196 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 197 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 198 | Injection site pain | FAERS: 1 | US FAERS | |
| 199 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 200 | Intubation | FAERS: 1 | US FAERS | |
| 201 | Joint swelling | FAERS: 1 | US FAERS | |
| 202 | Lethargy | FAERS: 1 | US FAERS | |
| 203 | Leukopenia | FAERS: 1 | US FAERS | |
| 204 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 205 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 206 | Medical device site pain | FAERS: 1 | US FAERS | |
| 207 | Memory impairment | FAERS: 1 | US FAERS | |
| 208 | Mouth swelling | FAERS: 1 | US FAERS | |
| 209 | Multiple allergies | FAERS: 1 | US FAERS | |
| 210 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 211 | Myositis | FAERS: 1 | US FAERS | |
| 212 | Night sweats | FAERS: 1 | US FAERS | |
| 213 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 214 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 215 | Ocular icterus | FAERS: 1 | US FAERS | |
| 216 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 217 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 218 | Overweight | FAERS: 1 | US FAERS | |
| 219 | Pallor | FAERS: 1 | US FAERS | |
| 220 | Pancreatitis | FAERS: 1 | US FAERS | |
| 221 | Piloerection | FAERS: 1 | US FAERS | |
| 222 | Pneumothorax | FAERS: 1 | US FAERS | |
| 223 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 224 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 225 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 226 | Product administration error | FAERS: 1 | US FAERS | |
| 227 | Product availability issue | FAERS: 1 | US FAERS | |
| 228 | Product contamination physical | FAERS: 1 | US FAERS | |
| 229 | Product dose omission | FAERS: 1 | US FAERS | |
| 230 | Product packaging issue | FAERS: 1 | US FAERS | |
| 231 | Product residue present | FAERS: 1 | US FAERS | |
| 232 | Product size issue | FAERS: 1 | US FAERS | |
| 233 | Product substitution | FAERS: 1 | US FAERS | |
| 234 | Product use complaint | FAERS: 1 | US FAERS | |
| 235 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 236 | Rash erythematous | FAERS: 1 | US FAERS | |
| 237 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 238 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 239 | Rhinitis | FAERS: 1 | US FAERS | |
| 240 | Rhonchi | FAERS: 1 | US FAERS | |
| 241 | Saliva altered | FAERS: 1 | US FAERS | |
| 242 | Septic rash | FAERS: 1 | US FAERS | |
| 243 | Sickle Cell Trait | FAERS: 1 | US FAERS | |
| 244 | Skin test positive | FAERS: 1 | US FAERS | |
| 245 | Stillbirth | FAERS: 1 | US FAERS | |
| 246 | Superinfection | FAERS: 1 | US FAERS | |
| 247 | Supportive care | FAERS: 1 | US FAERS | |
| 248 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 249 | Tetany | FAERS: 1 | US FAERS | |
| 250 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 251 | Ulcer | FAERS: 1 | US FAERS | |
| 252 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 253 | Urine output increased | FAERS: 1 | US FAERS | |
| 254 | Visual disturbance | FAERS: 1 | US FAERS | |
| 255 | Wheezing | FAERS: 1 | US FAERS | |
| 256 | Wrong dose | FAERS: 1 | US FAERS | |
| 257 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 258 | Reflux gastritis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.