Omacor
(DTMGIJFHGGCSLO-FIAQIACWSA-N)
Structure
- SMILES
- CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC
- Molecular Formula:
- C46H70O4
- Molecular Weight:
- 687.046
- Log P:
- 13.4986
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 52.6
- CAS Number(s):
- 861006-80-6
Synonym(s)
1.
Omacor
2.
Lovaza
3.
P-OM3 adjunct
4.
omega-3 ethyl ester 90
External Link(s)
| MeSH | C405603 |
| PubChem Compound | 9831414 |
| CHEMBL | CHEMBL1200711 |
| Therapeutic Target Database | D0N9TE D0PS6X |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product quality issue | FAERS: 130 | US FAERS | |
| 2 | Eructation | FAERS: 89 | SIDER US FAERS | |
| 3 | Blood triglycerides increased | FAERS: 86 | US FAERS | |
| 4 | Drug ineffective | FAERS: 79 | US FAERS | |
| 5 | Dysgeusia | FAERS: 79 | SIDER US FAERS | |
| 6 | Malaise | FAERS: 64 | SIDER US FAERS | |
| 7 | Abdominal discomfort | FAERS: 59 | US FAERS | |
| 8 | Nausea | FAERS: 54 | US FAERS | |
| 9 | Therapeutic response unexpected | FAERS: 46 | US FAERS | |
| 10 | Drug administration error | FAERS: 39 | US FAERS | |
| 11 | Dyspepsia | FAERS: 32 | SIDER US FAERS | |
| 12 | Flatulence | FAERS: 28 | US FAERS | |
| 13 | Gout | FAERS: 27 | US FAERS | |
| 14 | Low density lipoprotein increased | FAERS: 27 | US FAERS | |
| 15 | Drug dose omission | FAERS: 25 | US FAERS | |
| 16 | Headache | FAERS: 25 | US FAERS | |
| 17 | Blood cholesterol increased | FAERS: 23 | US FAERS | |
| 18 | Chest Pain | FAERS: 23 | SIDER US FAERS | |
| 19 | Vomiting | FAERS: 22 | SIDER US FAERS | |
| 20 | Dizziness | FAERS: 21 | SIDER US FAERS | |
| 21 | Constipation | FAERS: 20 | SIDER US FAERS | |
| 22 | Alanine Aminotransferase Increased | FAERS: 18 | SIDER US FAERS | |
| 23 | Fatigue | FAERS: 18 | US FAERS | |
| 24 | Pruritus | FAERS: 18 | SIDER US FAERS | |
| 25 | Blood glucose increased | FAERS: 17 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 27 | Back Pain | FAERS: 16 | SIDER US FAERS | |
| 28 | Medication residue | FAERS: 16 | US FAERS | |
| 29 | Product taste abnormal | FAERS: 16 | US FAERS | |
| 30 | Urticaria | FAERS: 16 | US FAERS | |
| 31 | Medication residue present | FAERS: 15 | US FAERS | |
| 32 | Asthenia | FAERS: 14 | SIDER US FAERS | |
| 33 | Feeling abnormal | FAERS: 14 | SIDER US FAERS | |
| 34 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 35 | Myalgia | FAERS: 14 | SIDER US FAERS | |
| 36 | Adverse event | FAERS: 13 | US FAERS | |
| 37 | Diabetes Mellitus | FAERS: 13 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 13 | SIDER US FAERS | |
| 39 | Pain | FAERS: 13 | SIDER US FAERS | |
| 40 | Wrong technique in drug usage process | FAERS: 13 | US FAERS | |
| 41 | Epistaxis | FAERS: 12 | SIDER US FAERS | |
| 42 | Overdose | FAERS: 12 | US FAERS | |
| 43 | Product substitution issue | FAERS: 12 | US FAERS | |
| 44 | Alopecia | FAERS: 11 | SIDER US FAERS | |
| 45 | Abdominal Pain | FAERS: 10 | US FAERS | |
| 46 | Arthralgia | FAERS: 10 | SIDER US FAERS | |
| 47 | Aspartate Aminotransferase Increased | FAERS: 10 | SIDER US FAERS | |
| 48 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 49 | Palpitations | FAERS: 10 | US FAERS | |
| 50 | Rhabdomyolysis | FAERS: 10 | US FAERS | |
| 51 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 52 | Retching | FAERS: 9 | US FAERS | |
| 53 | Ageusia | FAERS: 8 | US FAERS | |
| 54 | Chest discomfort | FAERS: 8 | US FAERS | |
| 55 | Disability | FAERS: 8 | US FAERS | |
| 56 | Weight decreased | FAERS: 8 | US FAERS | |
| 57 | Anxiety | FAERS: 7 | US FAERS | |
| 58 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 59 | Choking | FAERS: 7 | US FAERS | |
| 60 | Medication Error | FAERS: 7 | US FAERS | |
| 61 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 62 | Pneumonia | FAERS: 7 | SIDER US FAERS | |
| 63 | Product physical issue | FAERS: 7 | US FAERS | |
| 64 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 65 | Incorrect storage of drug | FAERS: 6 | US FAERS | |
| 66 | Influenza | FAERS: 6 | SIDER US FAERS | |
| 67 | Laceration | FAERS: 6 | US FAERS | |
| 68 | Neck Pain | FAERS: 6 | SIDER US FAERS | |
| 69 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 70 | Angina Pectoris | FAERS: 5 | SIDER US FAERS | |
| 71 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 72 | Bronchitis | FAERS: 5 | SIDER US FAERS | |
| 73 | Infection | FAERS: 5 | SIDER US FAERS | |
| 74 | Abasia | FAERS: 4 | US FAERS | |
| 75 | Amnesia | FAERS: 4 | US FAERS | |
| 76 | Arthritis | FAERS: 4 | SIDER US FAERS | |
| 77 | Blood heavy metal increased | FAERS: 4 | US FAERS | |
| 78 | Bone pain | FAERS: 4 | US FAERS | |
| 79 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 80 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 81 | Erythema | FAERS: 4 | US FAERS | |
| 82 | Expired product administered | FAERS: 4 | US FAERS | |
| 83 | Food Allergy | FAERS: 4 | US FAERS | |
| 84 | Fracture | FAERS: 4 | US FAERS | |
| 85 | Gastritis | FAERS: 4 | SIDER US FAERS | |
| 86 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 87 | Laryngitis | FAERS: 4 | SIDER US FAERS | |
| 88 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 89 | Poor quality product administered | FAERS: 4 | US FAERS | |
| 90 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 91 | Product availability issue | FAERS: 4 | US FAERS | |
| 92 | Product storage error | FAERS: 4 | US FAERS | |
| 93 | Psoriasis | FAERS: 4 | US FAERS | |
| 94 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 95 | Rectal discharge | FAERS: 4 | US FAERS | |
| 96 | Sinusitis | FAERS: 4 | SIDER US FAERS | |
| 97 | Skin laceration | FAERS: 4 | US FAERS | |
| 98 | Stomatitis | FAERS: 4 | US FAERS | |
| 99 | Wheezing | FAERS: 4 | US FAERS | |
| 100 | Angioedema | FAERS: 3 | US FAERS | |
| 101 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 102 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 103 | Cataract operation | FAERS: 3 | US FAERS | |
| 104 | Cataract | FAERS: 3 | SIDER US FAERS | |
| 105 | Chills | FAERS: 3 | SIDER US FAERS | |
| 106 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 107 | Crying | FAERS: 3 | US FAERS | |
| 108 | Dehydration | FAERS: 3 | US FAERS | |
| 109 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 110 | Dysuria | FAERS: 3 | US FAERS | |
| 111 | Eczema | FAERS: 3 | SIDER US FAERS | |
| 112 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 113 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 114 | Inflammation | FAERS: 3 | US FAERS | |
| 115 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 116 | Joint swelling | FAERS: 3 | US FAERS | |
| 117 | Lethargy | FAERS: 3 | US FAERS | |
| 118 | Limb injury | FAERS: 3 | US FAERS | |
| 119 | Lip swelling | FAERS: 3 | US FAERS | |
| 120 | Malabsorption | FAERS: 3 | US FAERS | |
| 121 | Multiple allergies | FAERS: 3 | US FAERS | |
| 122 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 123 | No adverse event | FAERS: 3 | US FAERS | |
| 124 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 125 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 126 | Post procedural complication | FAERS: 3 | US FAERS | |
| 127 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 128 | Product use complaint | FAERS: 3 | US FAERS | |
| 129 | Rhinitis | FAERS: 3 | SIDER US FAERS | |
| 130 | Stress | FAERS: 3 | US FAERS | |
| 131 | Suicide attempt | FAERS: 3 | US FAERS | |
| 132 | Tachycardia | FAERS: 3 | SIDER US FAERS | |
| 133 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 134 | Throat irritation | FAERS: 3 | US FAERS | |
| 135 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 136 | Thrombosis | FAERS: 3 | US FAERS | |
| 137 | Angioplasty | FAERS: 2 | US FAERS | |
| 138 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 139 | Arthropod bite | FAERS: 2 | US FAERS | |
| 140 | Aspartate aminotransferase decreased | FAERS: 2 | US FAERS | |
| 141 | Back disorder | FAERS: 2 | US FAERS | |
| 142 | Bedridden | FAERS: 2 | US FAERS | |
| 143 | Blindness | FAERS: 2 | US FAERS | |
| 144 | Burning sensation | FAERS: 2 | US FAERS | |
| 145 | Chemotherapy | FAERS: 2 | US FAERS | |
| 146 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 147 | Dysphonia | FAERS: 2 | US FAERS | |
| 148 | Emergency Care | FAERS: 2 | US FAERS | |
| 149 | Erection increased | FAERS: 2 | US FAERS | |
| 150 | Eye irritation | FAERS: 2 | US FAERS | |
| 151 | Flushing | FAERS: 2 | US FAERS | |
| 152 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 153 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 154 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 155 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 156 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 157 | Impaired work ability | FAERS: 2 | US FAERS | |
| 158 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 159 | Intestinal Obstruction | FAERS: 2 | SIDER US FAERS | |
| 160 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 161 | Live Birth | FAERS: 2 | US FAERS | |
| 162 | Memory impairment | FAERS: 2 | US FAERS | |
| 163 | Menorrhagia | FAERS: 2 | US FAERS | |
| 164 | Muscle tightness | FAERS: 2 | US FAERS | |
| 165 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 166 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 167 | Nervousness | FAERS: 2 | US FAERS | |
| 168 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 169 | Product complaint | FAERS: 2 | US FAERS | |
| 170 | Product use issue | FAERS: 2 | US FAERS | |
| 171 | Productive Cough | FAERS: 2 | US FAERS | |
| 172 | Rash erythematous | FAERS: 2 | US FAERS | |
| 173 | Regurgitation | FAERS: 2 | US FAERS | |
| 174 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 175 | Rheumatoid Arthritis | FAERS: 2 | SIDER US FAERS | |
| 176 | Tremor | FAERS: 2 | US FAERS | |
| 177 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 178 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 179 | Visual Impairment | FAERS: 2 | US FAERS | |
| 180 | cancer surgery | FAERS: 2 | US FAERS | |
| 181 | jaundice | FAERS: 2 | US FAERS | |
| 182 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 183 | Accidental exposure | FAERS: 1 | US FAERS | |
| 184 | Accidental underdose | FAERS: 1 | US FAERS | |
| 185 | Acne | FAERS: 1 | US FAERS | |
| 186 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 187 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 188 | Alcohol rehabilitation | FAERS: 1 | US FAERS | |
| 189 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 190 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 191 | Anal Fistula | FAERS: 1 | US FAERS | |
| 192 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 193 | Anorectal discomfort | FAERS: 1 | SIDER US FAERS | |
| 194 | Anosmia | FAERS: 1 | US FAERS | |
| 195 | Aphasia | FAERS: 1 | US FAERS | |
| 196 | Arthropathy | FAERS: 1 | US FAERS | |
| 197 | Asthma | FAERS: 1 | SIDER US FAERS | |
| 198 | Biopsy | FAERS: 1 | US FAERS | |
| 199 | Blepharospasm | FAERS: 1 | US FAERS | |
| 200 | Blood arsenic increased | FAERS: 1 | US FAERS | |
| 201 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 202 | Blood immunoglobulin E abnormal | FAERS: 1 | US FAERS | |
| 203 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 204 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 205 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 206 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 207 | Blood selenium increased | FAERS: 1 | US FAERS | |
| 208 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 209 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 210 | Blood urine present | FAERS: 1 | US FAERS | |
| 211 | Bone density decreased | FAERS: 1 | US FAERS | |
| 212 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 213 | Breast engorgement | FAERS: 1 | US FAERS | |
| 214 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 215 | Cardiac Arrest | FAERS: 1 | SIDER US FAERS | |
| 216 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 217 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 218 | Catheter placement | FAERS: 1 | US FAERS | |
| 219 | Cellulitis | FAERS: 1 | US FAERS | |
| 220 | Cerebral Amyloid Angiopathy | FAERS: 1 | US FAERS | |
| 221 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 222 | Cheilitis | FAERS: 1 | US FAERS | |
| 223 | Chromaturia | FAERS: 1 | US FAERS | |
| 224 | Clumsiness | FAERS: 1 | US FAERS | |
| 225 | Colitis | FAERS: 1 | SIDER US FAERS | |
| 226 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 227 | Corneal Scar | FAERS: 1 | US FAERS | |
| 228 | Deafness | FAERS: 1 | US FAERS | |
| 229 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 230 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 231 | Denture wearer | FAERS: 1 | US FAERS | |
| 232 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 233 | Device breakage | FAERS: 1 | US FAERS | |
| 234 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 235 | Diabetic blindness | FAERS: 1 | US FAERS | |
| 236 | Diphyllobothriasis | FAERS: 1 | US FAERS | |
| 237 | Diplopia | FAERS: 1 | US FAERS | |
| 238 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 239 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 240 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 241 | Ear congestion | FAERS: 1 | US FAERS | |
| 242 | Ear discomfort | FAERS: 1 | US FAERS | |
| 243 | Ecchymosis | FAERS: 1 | US FAERS | |
| 244 | Economic problem | FAERS: 1 | US FAERS | |
| 245 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 246 | Emotional disorder | FAERS: 1 | US FAERS | |
| 247 | Emotional distress | FAERS: 1 | US FAERS | |
| 248 | Eosinophilia | FAERS: 1 | US FAERS | |
| 249 | Epididymitis | FAERS: 1 | SIDER US FAERS | |
| 250 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 251 | Epiglottitis | FAERS: 1 | US FAERS | |
| 252 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 253 | Expired drug administered | FAERS: 1 | US FAERS | |
| 254 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 255 | Eye pain | FAERS: 1 | US FAERS | |
| 256 | Feeling jittery | FAERS: 1 | US FAERS | |
| 257 | Food Poisoning | FAERS: 1 | US FAERS | |
| 258 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 259 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 260 | Glaucoma | FAERS: 1 | US FAERS | |
| 261 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 262 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 263 | Hemiparesis | FAERS: 1 | US FAERS | |
| 264 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 265 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 266 | Hip surgery | FAERS: 1 | US FAERS | |
| 267 | Hospice Care | FAERS: 1 | US FAERS | |
| 268 | Hunger | FAERS: 1 | US FAERS | |
| 269 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 270 | Hypogeusia | FAERS: 1 | US FAERS | |
| 271 | Hypophagia | FAERS: 1 | US FAERS | |
| 272 | Hypotension | FAERS: 1 | US FAERS | |
| 273 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 274 | Incoherent | FAERS: 1 | US FAERS | |
| 275 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 276 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 277 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 278 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 279 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 280 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 281 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 282 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 283 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 284 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 285 | Lactescent serum | FAERS: 1 | US FAERS | |
| 286 | Ligament rupture | FAERS: 1 | US FAERS | |
| 287 | Lipase increased | FAERS: 1 | US FAERS | |
| 288 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 289 | Macular degeneration | FAERS: 1 | US FAERS | |
| 290 | Marasmus | FAERS: 1 | US FAERS | |
| 291 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 292 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 293 | Medical device implantation | FAERS: 1 | US FAERS | |
| 294 | Medical device removal | FAERS: 1 | US FAERS | |
| 295 | Meniscus injury | FAERS: 1 | US FAERS | |
| 296 | Mental impairment | FAERS: 1 | US FAERS | |
| 297 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 298 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 299 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 300 | Night sweats | FAERS: 1 | US FAERS | |
| 301 | Oral administration complication | FAERS: 1 | US FAERS | |
| 302 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 303 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 304 | Oral pain | FAERS: 1 | US FAERS | |
| 305 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 306 | Pancreatic steatosis | FAERS: 1 | US FAERS | |
| 307 | Paraparesis | FAERS: 1 | US FAERS | |
| 308 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 309 | Peritonitis | FAERS: 1 | US FAERS | |
| 310 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 311 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 312 | Photophobia | FAERS: 1 | US FAERS | |
| 313 | Plantar erythema | FAERS: 1 | US FAERS | |
| 314 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 315 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 316 | Product coating issue | FAERS: 1 | US FAERS | |
| 317 | Product container issue | FAERS: 1 | US FAERS | |
| 318 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 319 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 320 | Product label confusion | FAERS: 1 | US FAERS | |
| 321 | Product label issue | FAERS: 1 | US FAERS | |
| 322 | Product leakage | FAERS: 1 | US FAERS | |
| 323 | Product size issue | FAERS: 1 | US FAERS | |
| 324 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 325 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 326 | Purpura | FAERS: 1 | US FAERS | |
| 327 | Pyometra | FAERS: 1 | US FAERS | |
| 328 | Radiculopathy | FAERS: 1 | US FAERS | |
| 329 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 330 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 331 | Rosacea | FAERS: 1 | US FAERS | |
| 332 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 333 | Sciatica | FAERS: 1 | US FAERS | |
| 334 | Sepsis | FAERS: 1 | US FAERS | |
| 335 | Skin irritation | FAERS: 1 | US FAERS | |
| 336 | Sluggishness | FAERS: 1 | US FAERS | |
| 337 | Somnolence | FAERS: 1 | US FAERS | |
| 338 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 339 | Swelling | FAERS: 1 | US FAERS | |
| 340 | Syncope | FAERS: 1 | SIDER US FAERS | |
| 341 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 342 | Therapy cessation | FAERS: 1 | US FAERS | |
| 343 | Throat cancer | FAERS: 1 | US FAERS | |
| 344 | Tinnitus | FAERS: 1 | US FAERS | |
| 345 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 346 | Tooth Loss | FAERS: 1 | US FAERS | |
| 347 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 348 | Unevaluable event | FAERS: 1 | US FAERS | |
| 349 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 350 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 351 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 352 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 353 | furuncle | FAERS: 1 | US FAERS | |
| 354 | nervous system disorder | FAERS: 1 | US FAERS | |
| 355 | Acute Coronary Syndrome | SIDER | ||
| 356 | Body odor | SIDER | ||
| 357 | Completed Suicide | SIDER | ||
| 358 | Cyst | SIDER | ||
| 359 | Dermatitis | SIDER | ||
| 360 | Enlargement abdomen | SIDER | ||
| 361 | Facial paralysis | SIDER | ||
| 362 | Gastroenteritis | SIDER | ||
| 363 | Infestation | SIDER | ||
| 364 | Lymphadenopathy | SIDER | ||
| 365 | Malnutrition | SIDER | ||
| 366 | Mood swings | SIDER | ||
| 367 | Pharyngitis | SIDER | ||
| 368 | Rectal tenesmus | SIDER | ||
| 369 | Renal cyst | SIDER | ||
| 370 | Shock | SIDER | ||
| 371 | Sudden death | SIDER | ||
| 372 | Suicide | SIDER | ||
| 373 | Sweating | SIDER | ||
| 374 | VIIth nerve paralysis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.