Topotecan
(DGHHQBMTXTWTJV-BQAIUKQQSA-N)
Structure
- SMILES
- CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccc(c(c4cc3Cn1c2=O)CN(C)C)O.Cl
- Molecular Formula:
- C23H24ClN3O5
- Molecular Weight:
- 457.907
- Log P:
- 2.6488
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 104.89
- CAS Number(s):
- 119413-54-6
Synonym(s)
1.
Topotecan
2.
9-Dimethylaminomethyl-10-hydroxycamptothecin
3.
Hycamtamine
4.
Hycamtin
5.
NSC-609699
6.
Nogitecan Hydrochloride
7.
SK&F-104864-A
8.
SKF-104864-A
9.
Topotecan Hydrochloride
10.
Topotecan Monohydrochloride, (S)-Isomer
11.
9 Dimethylaminomethyl 10 hydroxycamptothecin
12.
Hydrochloride, Nogitecan
13.
Hydrochloride, Topotecan
14.
NSC 609699
15.
NSC609699
16.
SK&F 104864 A
17.
SK&F104864A
18.
SKF 104864 A
19.
SKF104864A
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 73 | US FAERS | |
| 2 | White blood cell count decreased | FAERS: 58 | US FAERS | |
| 3 | Neutrophil count decreased | FAERS: 48 | US FAERS | |
| 4 | Fatigue | FAERS: 40 | US FAERS | |
| 5 | Thrombocytopenia | FAERS: 34 | US FAERS | |
| 6 | Disease Progression | FAERS: 32 | US FAERS | |
| 7 | Vomiting | FAERS: 30 | US FAERS | |
| 8 | Neutropenia | FAERS: 29 | US FAERS | |
| 9 | Drug ineffective | FAERS: 23 | US FAERS | |
| 10 | Pancytopenia | FAERS: 23 | US FAERS | |
| 11 | Alopecia | FAERS: 16 | US FAERS | |
| 12 | Asthenia | FAERS: 15 | US FAERS | |
| 13 | Aspartate Aminotransferase Increased | FAERS: 14 | US FAERS | |
| 14 | Constipation | FAERS: 14 | US FAERS | |
| 15 | Febrile Neutropenia | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 17 | Weight decreased | FAERS: 13 | US FAERS | |
| 18 | Haematotoxicity | FAERS: 12 | US FAERS | |
| 19 | Pneumonia | FAERS: 12 | US FAERS | |
| 20 | Headache | FAERS: 11 | US FAERS | |
| 21 | Leukopenia | FAERS: 11 | US FAERS | |
| 22 | Malaise | FAERS: 9 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 24 | Drug toxicity | FAERS: 8 | US FAERS | |
| 25 | Malignant neoplasm progression | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Sepsis | FAERS: 8 | US FAERS | |
| 27 | Syncope | FAERS: 8 | US FAERS | |
| 28 | Adverse event | FAERS: 7 | US FAERS | |
| 29 | Anorexia | FAERS: 7 | US FAERS | |
| 30 | Dizziness | FAERS: 7 | US FAERS | |
| 31 | Hospice Care | FAERS: 7 | US FAERS | |
| 32 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 33 | Ileus | FAERS: 6 | US FAERS | |
| 34 | Neutropenic sepsis | FAERS: 6 | US FAERS | |
| 35 | Ocular Toxicity | FAERS: 6 | US FAERS | |
| 36 | Pruritus | FAERS: 6 | US FAERS | |
| 37 | Agranulocytosis | FAERS: 5 | US FAERS | |
| 38 | Blood urea increased | FAERS: 5 | US FAERS | |
| 39 | Dysgeusia | FAERS: 5 | US FAERS | |
| 40 | Epistaxis | FAERS: 5 | US FAERS | |
| 41 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 42 | Hypoxia | FAERS: 5 | US FAERS | |
| 43 | Pain | FAERS: 5 | US FAERS | |
| 44 | Product use in unapproved indication | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 45 | Septic Shock | FAERS: 5 | US FAERS | |
| 46 | treatment failure | FAERS: 5 | US FAERS | |
| 47 | Ascites | FAERS: 4 | US FAERS | |
| 48 | Blood phosphorus increased | FAERS: 4 | US FAERS | |
| 49 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 50 | Chest Pain | FAERS: 4 | US FAERS | |
| 51 | Chills | FAERS: 4 | US FAERS | |
| 52 | Deafness | FAERS: 4 | US FAERS | |
| 53 | Drug administration error | FAERS: 4 | US FAERS | |
| 54 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 55 | Hypersensitivity | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Hypotension | FAERS: 4 | US FAERS | |
| 57 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 58 | Medication Error | FAERS: 4 | US FAERS | |
| 59 | Monocyte count decreased | FAERS: 4 | US FAERS | |
| 60 | Product use issue | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Urticaria | FAERS: 4 | US FAERS | |
| 62 | Vasculitis | FAERS: 4 | US FAERS | |
| 63 | Amaurosis Fugax | FAERS: 3 | US FAERS | |
| 64 | Amaurosis | FAERS: 3 | US FAERS | |
| 65 | Back Pain | FAERS: 3 | US FAERS | |
| 66 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 67 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 68 | Blood lactate dehydrogenase decreased | FAERS: 3 | US FAERS | |
| 69 | Blood magnesium decreased | FAERS: 3 | US FAERS | |
| 70 | Blood magnesium increased | FAERS: 3 | US FAERS | |
| 71 | Blood phosphorus | FAERS: 3 | US FAERS | |
| 72 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 73 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 74 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 75 | Cholestasis | FAERS: 3 | US FAERS | |
| 76 | Epilepsy | FAERS: 3 | US FAERS | |
| 77 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 78 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 79 | Otitis Media | FAERS: 3 | US FAERS | |
| 80 | Overdose | FAERS: 3 | US FAERS | |
| 81 | Pancreatitis | FAERS: 3 | US FAERS | |
| 82 | Performance status decreased | FAERS: 3 | US FAERS | |
| 83 | Protein total decreased | FAERS: 3 | US FAERS | |
| 84 | Protein urine present | FAERS: 3 | US FAERS | |
| 85 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 86 | Respiratory depth decreased | FAERS: 3 | US FAERS | |
| 87 | Stomatitis | FAERS: 3 | US FAERS | |
| 88 | Tremor | FAERS: 3 | US FAERS | |
| 89 | Urinary Retention | FAERS: 3 | US FAERS | |
| 90 | Urinary sediment present | FAERS: 3 | US FAERS | |
| 91 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 92 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 93 | Blindness | FAERS: 2 | US FAERS | |
| 94 | Blood chloride decreased | FAERS: 2 | US FAERS | |
| 95 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 96 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 97 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 98 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 99 | Bone pain | FAERS: 2 | US FAERS | |
| 100 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 101 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 102 | Colitis | FAERS: 2 | US FAERS | |
| 103 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 104 | Delirium | FAERS: 2 | US FAERS | |
| 105 | Dermatitis | FAERS: 2 | US FAERS | |
| 106 | Diplopia | FAERS: 2 | US FAERS | |
| 107 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 108 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 109 | Erythema | FAERS: 2 | US FAERS | |
| 110 | Escherichia infection | FAERS: 2 | US FAERS | |
| 111 | Eye irritation | FAERS: 2 | US FAERS | |
| 112 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 113 | Flatulence | FAERS: 2 | US FAERS | |
| 114 | Flushing | FAERS: 2 | US FAERS | |
| 115 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 116 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 117 | Injection site pain | FAERS: 2 | US FAERS | |
| 118 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 119 | Lipase increased | FAERS: 2 | US FAERS | |
| 120 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 121 | Myalgia | FAERS: 2 | US FAERS | |
| 122 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 123 | Polyuria | FAERS: 2 | US FAERS | |
| 124 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 125 | Product quality issue | FAERS: 2 | US FAERS | |
| 126 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 127 | Rash erythematous | FAERS: 2 | US FAERS | |
| 128 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 129 | Scab | FAERS: 2 | US FAERS | |
| 130 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 131 | Skin lesion | FAERS: 2 | US FAERS | |
| 132 | Subileus | FAERS: 2 | US FAERS | |
| 133 | Therapy cessation | FAERS: 2 | US FAERS | |
| 134 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 135 | Accidental overdose | FAERS: 1 | US FAERS | |
| 136 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 137 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 138 | Amnesia | FAERS: 1 | US FAERS | |
| 139 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 140 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 141 | Angioedema | FAERS: 1 | US FAERS | |
| 142 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 143 | Aphonia | FAERS: 1 | US FAERS | |
| 144 | Arthralgia | FAERS: 1 | US FAERS | |
| 145 | Arthritis | FAERS: 1 | US FAERS | |
| 146 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 147 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 148 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 149 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 150 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 151 | Cancer Pain | FAERS: 1 | US FAERS | |
| 152 | Cataract | FAERS: 1 | US FAERS | |
| 153 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 154 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 155 | Chest discomfort | FAERS: 1 | US FAERS | |
| 156 | Cyanosis | FAERS: 1 | US FAERS | |
| 157 | Cystitis | FAERS: 1 | US FAERS | |
| 158 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 159 | Dehydration | FAERS: 1 | US FAERS | |
| 160 | Dementia | FAERS: 1 | US FAERS | |
| 161 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 162 | Device related infection | FAERS: 1 | US FAERS | |
| 163 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 164 | Disease complication | FAERS: 1 | US FAERS | |
| 165 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 166 | Drug dose omission | FAERS: 1 | US FAERS | |
| 167 | Dyspepsia | FAERS: 1 | US FAERS | |
| 168 | Dysuria | FAERS: 1 | US FAERS | |
| 169 | Eczema | FAERS: 1 | US FAERS | |
| 170 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 171 | Encephalitis | FAERS: 1 | US FAERS | |
| 172 | Expired drug administered | FAERS: 1 | US FAERS | |
| 173 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 174 | Eyelid rash | FAERS: 1 | US FAERS | |
| 175 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 176 | Gangrene | FAERS: 1 | US FAERS | |
| 177 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 178 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 179 | Hypersomnia | FAERS: 1 | US FAERS | |
| 180 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 181 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 182 | Joint swelling | FAERS: 1 | US FAERS | |
| 183 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 184 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 185 | Lymphopenia | FAERS: 1 | US FAERS | |
| 186 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 187 | Medulloblastoma | FAERS: 1 | US FAERS | |
| 188 | Memory impairment | FAERS: 1 | US FAERS | |
| 189 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 190 | Neck Pain | FAERS: 1 | US FAERS | |
| 191 | Neurological infection | FAERS: 1 | US FAERS | |
| 192 | Neuropathy | FAERS: 1 | US FAERS | |
| 193 | No adverse event | FAERS: 1 | US FAERS | |
| 194 | Nodule | FAERS: 1 | US FAERS | |
| 195 | PO2 decreased | FAERS: 1 | US FAERS | |
| 196 | Papule | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 197 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 198 | Peritonitis | FAERS: 1 | US FAERS | |
| 199 | Petechiae | FAERS: 1 | US FAERS | |
| 200 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 201 | Pneumonitis | FAERS: 1 | US FAERS | |
| 202 | Pneumothorax | FAERS: 1 | US FAERS | |
| 203 | Product dispensing error | FAERS: 1 | US FAERS | |
| 204 | Product storage error | FAERS: 1 | US FAERS | |
| 205 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 206 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 207 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 208 | Purpura | FAERS: 1 | US FAERS | |
| 209 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 210 | Rash maculovesicular | FAERS: 1 | US FAERS | |
| 211 | Scleroderma | FAERS: 1 | US FAERS | |
| 212 | Shock | FAERS: 1 | US FAERS | |
| 213 | Skin necrosis | FAERS: 1 | US FAERS | |
| 214 | Skin reaction | FAERS: 1 | US FAERS | |
| 215 | Sluggishness | FAERS: 1 | US FAERS | |
| 216 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 217 | Somatoform disorder cardiovascular | FAERS: 1 | US FAERS | |
| 218 | Somnolence | FAERS: 1 | US FAERS | |
| 219 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 220 | Swelling | FAERS: 1 | US FAERS | |
| 221 | Tachycardia | FAERS: 1 | US FAERS | |
| 222 | Therapy change | FAERS: 1 | US FAERS | |
| 223 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 224 | Thrombocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Thrombosis | FAERS: 1 | US FAERS | |
| 226 | Transcription medication error | FAERS: 1 | US FAERS | |
| 227 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 228 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 229 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 230 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 231 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 232 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 233 | jaundice | FAERS: 1 | US FAERS | |
| 234 | nervous system disorder | FAERS: 1 | US FAERS | |
| 235 | Retinoblastoma | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.