Terbinafine
(BWMISRWJRUSYEX-SZKNIZGXSA-N)
Structure
- SMILES
- CN(Cc1cccc2c1cccc2)C/C=C/C#CC(C)(C)C.Cl
- Molecular Formula:
- C21H26ClN
- Molecular Weight:
- 327.891
- Log P:
- 5.6793
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 1
- TPSA:
- 3.24
- CAS Number(s):
- 78628-80-5
Synonym(s)
1.
Terbinafine
2.
(E)-N-(6,6-Dimethyl-2-heptenynyl)-N-methyl-1-naphthalenementhamin hydrochloride
3.
DA 5505
4.
Lamisil
5.
SF 86-327
6.
SF-86-327
7.
TDT-067
8.
Terbinafine Hydrochloride
9.
Terbinafine, (Z)-
10.
Terbinafine, (Z)-isomer
11.
SF 86 327
12.
SF 86327
13.
SF86327
14.
TDT 067
15.
TDT067
External Link(s)
| MeSH | D000077291 |
| PubChem Compound | 50986900 5282481 11324905 |
| ChEBI | 77614 |
| CHEMBL | CHEMBL1200832 |
| KEGG | dr:D02219 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ageusia | FAERS: 55 | US FAERS | |
| 2 | Dysgeusia | FAERS: 45 | US FAERS | |
| 3 | Nausea | FAERS: 30 | US FAERS | |
| 4 | Dizziness | FAERS: 29 | US FAERS | |
| 5 | Pruritus | FAERS: 23 | US FAERS | |
| 6 | Fatigue | FAERS: 22 | US FAERS | |
| 7 | Headache | FAERS: 20 | US FAERS | |
| 8 | Weight decreased | FAERS: 18 | US FAERS | |
| 9 | Anxiety | FAERS: 17 | US FAERS | |
| 10 | Visual Impairment | FAERS: 16 | US FAERS | |
| 11 | Asthenia | FAERS: 15 | US FAERS | |
| 12 | Tinnitus | FAERS: 15 | US FAERS | |
| 13 | Chromaturia | FAERS: 14 | US FAERS | |
| 14 | Pain | FAERS: 14 | US FAERS | |
| 15 | Urticaria | FAERS: 14 | US FAERS | |
| 16 | Malaise | FAERS: 13 | US FAERS | |
| 17 | Cholestasis | FAERS: 12 | US FAERS | |
| 18 | Erythema Multiforme | FAERS: 11 | US FAERS | |
| 19 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 20 | Vomiting | FAERS: 11 | US FAERS | |
| 21 | Deafness | FAERS: 10 | US FAERS | |
| 22 | Depressed mood | FAERS: 10 | US FAERS | |
| 23 | Myalgia | FAERS: 10 | US FAERS | |
| 24 | Pancreatitis | FAERS: 10 | US FAERS | |
| 25 | Rhabdomyolysis | FAERS: 10 | US FAERS | |
| 26 | Hepatitis | FAERS: 9 | US FAERS | |
| 27 | Leukopenia | FAERS: 9 | US FAERS | |
| 28 | Tachycardia | FAERS: 9 | US FAERS | |
| 29 | jaundice | FAERS: 9 | US FAERS | |
| 30 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 31 | Anorexia | FAERS: 8 | US FAERS | |
| 32 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 33 | Blood pressure fluctuation | FAERS: 8 | US FAERS | |
| 34 | Drug ineffective | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 36 | Pustular psoriasis | FAERS: 8 | US FAERS | |
| 37 | Vasculitis | FAERS: 8 | US FAERS | |
| 38 | Arthritis | FAERS: 7 | US FAERS | |
| 39 | Dyspepsia | FAERS: 7 | US FAERS | |
| 40 | Erythema | FAERS: 7 | US FAERS | |
| 41 | Lethargy | FAERS: 7 | US FAERS | |
| 42 | Rash erythematous | FAERS: 7 | US FAERS | |
| 43 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 44 | Burning sensation | FAERS: 6 | US FAERS | |
| 45 | Chills | FAERS: 6 | US FAERS | |
| 46 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 48 | Hypomania | FAERS: 6 | US FAERS | |
| 49 | Swelling | FAERS: 6 | US FAERS | |
| 50 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 51 | Alcohol interaction | FAERS: 5 | US FAERS | |
| 52 | Arthralgia | FAERS: 5 | US FAERS | |
| 53 | Ascites | FAERS: 5 | US FAERS | |
| 54 | Chest Pain | FAERS: 5 | US FAERS | |
| 55 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 56 | Impaired work ability | FAERS: 5 | US FAERS | |
| 57 | Paranoia | FAERS: 5 | US FAERS | |
| 58 | Autoimmune hepatitis | FAERS: 4 | US FAERS | |
| 59 | Back Pain | FAERS: 4 | US FAERS | |
| 60 | Constipation | FAERS: 4 | US FAERS | |
| 61 | Dermatomyositis | FAERS: 4 | US FAERS | |
| 62 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 63 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 64 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 65 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 66 | Anosmia | FAERS: 3 | US FAERS | |
| 67 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 68 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 69 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 70 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 71 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 72 | Dry skin | FAERS: 3 | US FAERS | |
| 73 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 74 | Hypophagia | FAERS: 3 | US FAERS | |
| 75 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 76 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 77 | Palpitations | FAERS: 3 | US FAERS | |
| 78 | Pancytopenia | FAERS: 3 | US FAERS | |
| 79 | Retching | FAERS: 3 | US FAERS | |
| 80 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 81 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 82 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 83 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 84 | Alopecia | FAERS: 2 | US FAERS | |
| 85 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 86 | Angioedema | FAERS: 2 | US FAERS | |
| 87 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 88 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 89 | Blood urea increased | FAERS: 2 | US FAERS | |
| 90 | Blood urine present | FAERS: 2 | US FAERS | |
| 91 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 92 | Choking sensation | FAERS: 2 | US FAERS | |
| 93 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 94 | Dehydration | FAERS: 2 | US FAERS | |
| 95 | Dermatitis | FAERS: 2 | US FAERS | |
| 96 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 97 | Emotional distress | FAERS: 2 | US FAERS | |
| 98 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 99 | Expired drug administered | FAERS: 2 | US FAERS | |
| 100 | Flatulence | FAERS: 2 | US FAERS | |
| 101 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 102 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 103 | Inflammation | FAERS: 2 | US FAERS | |
| 104 | Leukocytosis | FAERS: 2 | US FAERS | |
| 105 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 106 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 107 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 108 | Necrosis | FAERS: 2 | US FAERS | |
| 109 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 110 | Neutropenia | FAERS: 2 | US FAERS | |
| 111 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 112 | Pneumonia | FAERS: 2 | US FAERS | |
| 113 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 114 | Product substitution issue | FAERS: 2 | US FAERS | |
| 115 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 116 | Sepsis | FAERS: 2 | US FAERS | |
| 117 | Skin lesion | FAERS: 2 | US FAERS | |
| 118 | Skin necrosis | FAERS: 2 | US FAERS | |
| 119 | Syncope | FAERS: 2 | US FAERS | |
| 120 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 121 | Tremor | FAERS: 2 | US FAERS | |
| 122 | Urinary Retention | FAERS: 2 | US FAERS | |
| 123 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 124 | Abasia | FAERS: 1 | US FAERS | |
| 125 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 126 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 127 | Aldolase increased | FAERS: 1 | US FAERS | |
| 128 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 129 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 130 | Aphagia | FAERS: 1 | US FAERS | |
| 131 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 132 | Application site erythema | FAERS: 1 | US FAERS | |
| 133 | Application site reaction | FAERS: 1 | US FAERS | |
| 134 | Application site swelling | FAERS: 1 | US FAERS | |
| 135 | Application site vesicles | FAERS: 1 | US FAERS | |
| 136 | Arthropathy | FAERS: 1 | US FAERS | |
| 137 | Aura | FAERS: 1 | US FAERS | |
| 138 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 139 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 140 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 141 | Blindness | FAERS: 1 | US FAERS | |
| 142 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 143 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 144 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 145 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 146 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 147 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 148 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 149 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 150 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 151 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 152 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 153 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 154 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 155 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 156 | Candidiasis | FAERS: 1 | US FAERS | |
| 157 | Cellulitis | FAERS: 1 | US FAERS | |
| 158 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 159 | Cheilitis | FAERS: 1 | US FAERS | |
| 160 | Chest discomfort | FAERS: 1 | US FAERS | |
| 161 | Colitis | FAERS: 1 | US FAERS | |
| 162 | Dementia | FAERS: 1 | US FAERS | |
| 163 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 164 | Discomfort | FAERS: 1 | US FAERS | |
| 165 | Disease Progression | FAERS: 1 | US FAERS | |
| 166 | Diverticulitis | FAERS: 1 | US FAERS | |
| 167 | Drug dose omission | FAERS: 1 | US FAERS | |
| 168 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 169 | Drug resistance | FAERS: 1 | US FAERS | |
| 170 | Dystonia | FAERS: 1 | US FAERS | |
| 171 | Eczema | FAERS: 1 | US FAERS | |
| 172 | Erysipelas | FAERS: 1 | US FAERS | |
| 173 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 174 | Extravasation | FAERS: 1 | US FAERS | |
| 175 | Familial Mediterranean Fever | FAERS: 1 | US FAERS | |
| 176 | Feeling jittery | FAERS: 1 | US FAERS | |
| 177 | Gastric pH increased | FAERS: 1 | US FAERS | |
| 178 | General symptom | FAERS: 1 | US FAERS | |
| 179 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 180 | Hepatitis B DNA assay positive | FAERS: 1 | US FAERS | |
| 181 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 182 | Hunger | FAERS: 1 | US FAERS | |
| 183 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 184 | Hypogeusia | FAERS: 1 | US FAERS | |
| 185 | Hypokinesia | FAERS: 1 | US FAERS | |
| 186 | Ileectomy | FAERS: 1 | US FAERS | |
| 187 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 188 | Incontinence | FAERS: 1 | US FAERS | |
| 189 | Infection | FAERS: 1 | US FAERS | |
| 190 | Initial insomnia | FAERS: 1 | US FAERS | |
| 191 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 192 | Joint swelling | FAERS: 1 | US FAERS | |
| 193 | Ketonuria | FAERS: 1 | US FAERS | |
| 194 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 195 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 196 | Lymphangitis | FAERS: 1 | US FAERS | |
| 197 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 198 | Medication Error | FAERS: 1 | US FAERS | |
| 199 | Memory impairment | FAERS: 1 | US FAERS | |
| 200 | Middle insomnia | FAERS: 1 | US FAERS | |
| 201 | Mood swings | FAERS: 1 | US FAERS | |
| 202 | Muscle tightness | FAERS: 1 | US FAERS | |
| 203 | Neck Pain | FAERS: 1 | US FAERS | |
| 204 | Nerve injury | FAERS: 1 | US FAERS | |
| 205 | Nervousness | FAERS: 1 | US FAERS | |
| 206 | Neuralgia | FAERS: 1 | US FAERS | |
| 207 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 208 | Night sweats | FAERS: 1 | US FAERS | |
| 209 | No adverse event | FAERS: 1 | US FAERS | |
| 210 | Occult blood positive | FAERS: 1 | US FAERS | |
| 211 | Oligodipsia | FAERS: 1 | US FAERS | |
| 212 | Onychomycosis | FAERS: 1 | US FAERS | |
| 213 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 214 | Oral pain | FAERS: 1 | US FAERS | |
| 215 | Pain of skin | FAERS: 1 | US FAERS | |
| 216 | Papule | FAERS: 1 | US FAERS | |
| 217 | Pemphigus | FAERS: 1 | US FAERS | |
| 218 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 219 | Pericarditis | FAERS: 1 | US FAERS | |
| 220 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 221 | Peritonitis viral | FAERS: 1 | US FAERS | |
| 222 | Peritonitis | FAERS: 1 | US FAERS | |
| 223 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 224 | Photosensitivity allergic reaction | FAERS: 1 | US FAERS | |
| 225 | Pleurisy | FAERS: 1 | US FAERS | |
| 226 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 227 | Porphyrins urine increased | FAERS: 1 | US FAERS | |
| 228 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 229 | Protein urine present | FAERS: 1 | US FAERS | |
| 230 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 231 | Purpura | FAERS: 1 | US FAERS | |
| 232 | Rash scaly | FAERS: 1 | US FAERS | |
| 233 | Restlessness | FAERS: 1 | US FAERS | |
| 234 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 235 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 236 | Roseolovirus test positive | FAERS: 1 | US FAERS | |
| 237 | Septic Shock | FAERS: 1 | US FAERS | |
| 238 | Seroconversion test positive | FAERS: 1 | US FAERS | |
| 239 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 240 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 241 | Sinus headache | FAERS: 1 | US FAERS | |
| 242 | Sinus operation | FAERS: 1 | US FAERS | |
| 243 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 244 | Stress | FAERS: 1 | US FAERS | |
| 245 | Sunburn | FAERS: 1 | US FAERS | |
| 246 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 247 | Tongue eruption | FAERS: 1 | US FAERS | |
| 248 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 249 | Transferrin saturation increased | FAERS: 1 | US FAERS | |
| 250 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 251 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 252 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 253 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 254 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 255 | colonoscopy | FAERS: 1 | US FAERS | |
| 256 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120330
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.