cabazitaxel
(BMQGVNUXMIRLCK-OAGWZNDDSA-N)
Structure
- SMILES
- CO[C@H]1C(=O)[C@]2(C)[C@@H](OC)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@H](c1ccccc1)NC(=O)OC(C)(C)C)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C
- Type(s)
- Approved
- ATC code(s)
- L01CD04
- Molecular Formula:
- C45H57NO14
- Molecular Weight:
- 835.932
- Log P:
- 4.9587
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 3
- TPSA:
- 202.45
- CAS Number(s):
- 183133-96-2
Synonym(s)
1.
cabazitaxel
2.
Jevtana
3.
kabazitaxel
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 27 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 2 | Febrile Neutropenia | FAERS: 26 | SIDER US FAERS | |
| 3 | Fatigue | FAERS: 22 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 4 | Vomiting | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 5 | Disease Progression | FAERS: 15 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 6 | Pain | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Sepsis | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Back Pain | FAERS: 13 | SIDER US FAERS | |
| 9 | Nausea | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 10 | Pneumonia | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Septic Shock | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Asthenia | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 13 | Disseminated Intravascular Coagulation | FAERS: 12 | US FAERS | |
| 14 | Epistaxis | FAERS: 11 | US FAERS | |
| 15 | Extravasation | FAERS: 11 | US FAERS | |
| 16 | Constipation | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Neutrophil count decreased | FAERS: 10 | US FAERS | |
| 18 | Hydronephrosis | FAERS: 9 | SIDER US FAERS | |
| 19 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 20 | Thrombocytopenia | FAERS: 9 | SIDER US FAERS | |
| 21 | Pancytopenia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Urinary tract infection | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Alopecia | FAERS: 7 | SIDER US FAERS | |
| 24 | Dysgeusia | FAERS: 7 | SIDER US FAERS | |
| 25 | General physical health deterioration | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Pneumonitis | FAERS: 7 | US FAERS | |
| 27 | Syncope | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Abdominal Pain | FAERS: 6 | SIDER US FAERS | |
| 29 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 30 | Dizziness | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 31 | Hypotension | FAERS: 6 | SIDER US FAERS | |
| 32 | Ileus | FAERS: 6 | SIDER US FAERS | |
| 33 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 34 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 35 | Stomatitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Weight decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Arthralgia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Ascites | FAERS: 5 | US FAERS | |
| 39 | Cardiac Arrest | FAERS: 5 | SIDER US FAERS | |
| 40 | Dehydration | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 41 | Drug ineffective | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Erythema | FAERS: 5 | SIDER US FAERS | |
| 43 | Unevaluable event | FAERS: 5 | US FAERS | |
| 44 | Bronchitis | FAERS: 4 | US FAERS | |
| 45 | Chest Pain | FAERS: 4 | SIDER US FAERS | |
| 46 | Diverticulitis | FAERS: 4 | US FAERS | |
| 47 | Dysuria | FAERS: 4 | SIDER US FAERS | |
| 48 | Hypersensitivity | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Infection | FAERS: 4 | SIDER US FAERS | |
| 50 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 51 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 52 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 53 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 54 | Bone pain | FAERS: 3 | US FAERS | |
| 55 | Cellulitis | FAERS: 3 | SIDER US FAERS | |
| 56 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 57 | Enteritis | FAERS: 3 | US FAERS | |
| 58 | Febrile bone marrow aplasia | FAERS: 3 | US FAERS | |
| 59 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 60 | Haematotoxicity | FAERS: 3 | US FAERS | |
| 61 | Malaise | FAERS: 3 | SIDER US FAERS | |
| 62 | Metastasis | FAERS: 3 | US FAERS | |
| 63 | Neutropenic infection | FAERS: 3 | US FAERS | |
| 64 | Onycholysis | FAERS: 3 | US FAERS | |
| 65 | Product dose omission | FAERS: 3 | US FAERS | |
| 66 | Prostatic specific antigen decreased | FAERS: 3 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 67 | Tuberculosis | FAERS: 3 | US FAERS | |
| 68 | Abscess | FAERS: 2 | US FAERS | |
| 69 | Ageusia | FAERS: 2 | US FAERS | |
| 70 | Anuria | FAERS: 2 | US FAERS | |
| 71 | Atrial Fibrillation | FAERS: 2 | SIDER US FAERS | |
| 72 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 73 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 74 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 75 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 76 | Cholestasis | FAERS: 2 | US FAERS | |
| 77 | Colitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 78 | Deep Vein Thrombosis | FAERS: 2 | SIDER US FAERS | |
| 79 | Delirium | FAERS: 2 | US FAERS | |
| 80 | Facial paralysis | FAERS: 2 | US FAERS | |
| 81 | Flatulence | FAERS: 2 | US FAERS | |
| 82 | Fluid overload | FAERS: 2 | US FAERS | |
| 83 | Flushing | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 84 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 85 | Hemiplegia | FAERS: 2 | US FAERS | |
| 86 | Hypoxia | FAERS: 2 | US FAERS | |
| 87 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 88 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 89 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 90 | Leukocytosis | FAERS: 2 | US FAERS | |
| 91 | Malignant neoplasm progression | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 92 | Meningitis | FAERS: 2 | US FAERS | |
| 93 | Myalgia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 94 | Overdose | FAERS: 2 | US FAERS | |
| 95 | Paraplegia | FAERS: 2 | US FAERS | |
| 96 | Performance status decreased | FAERS: 2 | US FAERS | |
| 97 | Polyuria | FAERS: 2 | US FAERS | |
| 98 | Proctitis | FAERS: 2 | US FAERS | |
| 99 | Productive Cough | FAERS: 2 | US FAERS | |
| 100 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 101 | Renal Colic | FAERS: 2 | SIDER US FAERS | |
| 102 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 103 | Skin irritation | FAERS: 2 | US FAERS | |
| 104 | Somnolence | FAERS: 2 | US FAERS | |
| 105 | Sudden death | FAERS: 2 | US FAERS | |
| 106 | Thrombosis | FAERS: 2 | US FAERS | |
| 107 | Urinary Retention | FAERS: 2 | SIDER US FAERS | |
| 108 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 109 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 110 | jaundice | FAERS: 2 | US FAERS | |
| 111 | Abasia | FAERS: 1 | US FAERS | |
| 112 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 113 | Accidental overdose | FAERS: 1 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 114 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 115 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 116 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 117 | Adverse event | FAERS: 1 | US FAERS | |
| 118 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 119 | Alveolitis | FAERS: 1 | US FAERS | |
| 120 | Amylase increased | FAERS: 1 | US FAERS | |
| 121 | Anal Fistula | FAERS: 1 | US FAERS | |
| 122 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 123 | Application site extravasation | FAERS: 1 | US FAERS | |
| 124 | Asphyxia | FAERS: 1 | US FAERS | |
| 125 | Ataxia | FAERS: 1 | US FAERS | |
| 126 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 127 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 128 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 129 | Bladder Neoplasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 131 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 132 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 133 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 134 | Blood urine present | FAERS: 1 | US FAERS | |
| 135 | Bone lesion | FAERS: 1 | US FAERS | |
| 136 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 137 | Burning sensation | FAERS: 1 | US FAERS | |
| 138 | Cachexia | FAERS: 1 | US FAERS | |
| 139 | Candida sepsis | FAERS: 1 | US FAERS | |
| 140 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 141 | Cell marker increased | FAERS: 1 | US FAERS | |
| 142 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 143 | Chest discomfort | FAERS: 1 | US FAERS | |
| 144 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 145 | Cholangitis | FAERS: 1 | US FAERS | |
| 146 | Cholecystitis | FAERS: 1 | US FAERS | |
| 147 | Chromaturia | FAERS: 1 | US FAERS | |
| 148 | Colonic fistula | FAERS: 1 | US FAERS | |
| 149 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 150 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 151 | Device malfunction | FAERS: 1 | US FAERS | |
| 152 | Device related infection | FAERS: 1 | US FAERS | |
| 153 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 154 | Diplopia | FAERS: 1 | US FAERS | |
| 155 | Disability | FAERS: 1 | US FAERS | |
| 156 | Disease complication | FAERS: 1 | US FAERS | |
| 157 | Disorientation | FAERS: 1 | US FAERS | |
| 158 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 159 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 160 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 161 | Duodenitis | FAERS: 1 | US FAERS | |
| 162 | Electrolyte imbalance | FAERS: 1 | SIDER US FAERS | |
| 163 | Embolism | FAERS: 1 | US FAERS | |
| 164 | Enterocolitis | FAERS: 1 | SIDER US FAERS | |
| 165 | Eye Burns | FAERS: 1 | US FAERS | |
| 166 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 167 | Feeling abnormal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 168 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 169 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 170 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 171 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 172 | Gingivitis | FAERS: 1 | US FAERS | |
| 173 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 174 | Headache | FAERS: 1 | SIDER US FAERS | |
| 175 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 176 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 177 | Hepatitis | FAERS: 1 | US FAERS | |
| 178 | Hepatobiliary neoplasm | FAERS: 1 | US FAERS | |
| 179 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 180 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 181 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 182 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 183 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 184 | Infectious colitis | FAERS: 1 | US FAERS | |
| 185 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 186 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 187 | Inflammation | FAERS: 1 | US FAERS | |
| 188 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 189 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 190 | Intestinal Obstruction | FAERS: 1 | SIDER US FAERS | |
| 191 | Lethargy | FAERS: 1 | SIDER US FAERS | |
| 192 | Limb discomfort | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 193 | Lip swelling | FAERS: 1 | US FAERS | |
| 194 | Listeriosis | FAERS: 1 | US FAERS | |
| 195 | Medication Error | FAERS: 1 | US FAERS | |
| 196 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 197 | Musculoskeletal chest pain | FAERS: 1 | SIDER US FAERS | |
| 198 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 199 | Myocarditis | FAERS: 1 | US FAERS | |
| 200 | Nail toxicity | FAERS: 1 | US FAERS | |
| 201 | Nasopharyngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Neck Pain | FAERS: 1 | US FAERS | |
| 203 | No adverse event | FAERS: 1 | US FAERS | |
| 204 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 205 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 206 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 207 | Pancreatitis | FAERS: 1 | US FAERS | |
| 208 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 209 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 210 | Perineal cellulitis | FAERS: 1 | US FAERS | |
| 211 | Peripheral swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 213 | Pleurisy | FAERS: 1 | US FAERS | |
| 214 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 215 | Presyncope | FAERS: 1 | US FAERS | |
| 216 | Product container issue | FAERS: 1 | US FAERS | |
| 217 | Product quality issue | FAERS: 1 | US FAERS | |
| 218 | Product use complaint | FAERS: 1 | US FAERS | |
| 219 | Prostatic pain | FAERS: 1 | US FAERS | |
| 220 | Pubic pain | FAERS: 1 | US FAERS | |
| 221 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 222 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 223 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 224 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 225 | Renal pain | FAERS: 1 | US FAERS | |
| 226 | Respiratory distress | FAERS: 1 | US FAERS | |
| 227 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 228 | Shock | FAERS: 1 | US FAERS | |
| 229 | Skin lesion | FAERS: 1 | US FAERS | |
| 230 | Skin necrosis | FAERS: 1 | US FAERS | |
| 231 | Staring | FAERS: 1 | US FAERS | |
| 232 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 233 | Swelling | FAERS: 1 | US FAERS | |
| 234 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 235 | Therapy cessation | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 236 | Therapy responder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Thirst | FAERS: 1 | US FAERS | |
| 238 | Throat irritation | FAERS: 1 | US FAERS | |
| 239 | Tooth Loss | FAERS: 1 | US FAERS | |
| 240 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 241 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 242 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 243 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 244 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 245 | Wound Complication | FAERS: 1 | US FAERS | |
| 246 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 247 | Alanine Aminotransferase Increased | SIDER | ||
| 248 | Anorexia | SIDER | ||
| 249 | Anxiety | SIDER | ||
| 250 | Aspartate Aminotransferase Increased | SIDER | ||
| 251 | Blood and lymphatic system disorders | SIDER | ||
| 252 | Blood creatinine increased | Canada Vigilance: 1 | Canada Vigilance | |
| 253 | Conjunctivitis | SIDER | ||
| 254 | Cystitis | SIDER | ||
| 255 | Dry skin | SIDER | ||
| 256 | Dyspepsia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 257 | Ear and labyrinth disorders | SIDER | ||
| 258 | Flank Pain | SIDER | ||
| 259 | Infestation | SIDER | ||
| 260 | Malnutrition | SIDER | ||
| 261 | Musculoskeletal discomfort | SIDER | ||
| 262 | Neutropenic colitis | SIDER | ||
| 263 | Neutropenic sepsis | SIDER | ||
| 264 | Oropharyngeal pain | SIDER | ||
| 265 | Pelvic Pain | SIDER | ||
| 266 | Product preparation issue | Canada Vigilance: 10 | Canada Vigilance | |
| 267 | Prostatic Neoplasms | 22666205 24418724 | CTD | |
| 268 | Pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 269 | Sciatica | SIDER | ||
| 270 | Tinnitus | SIDER | ||
| 271 | Tongue erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 272 | Urinary Incontinence | SIDER | ||
| 273 | Ventricular Fibrillation | SIDER | ||
| 274 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.