hydrochlorothiazide, lisinopril drug combination
(BFNXYSZBURSNHS-UVJOBNTFSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.NCCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N[C@H](C(=O)O)CCc1ccccc1
- Molecular Formula:
- C28H39ClN6O9S2
- Molecular Weight:
- 703.227
- Log P:
- 5.2417
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 7
- TPSA:
- 268.08
- CAS Number(s):
- 151063-30-8
Synonym(s)
1.
hydrochlorothiazide, lisinopril drug combination
2.
Zestoretic
3.
hydrochlorothiazide - lisinopril
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Angioedema | FAERS: 191 | 7860891 | CTD US FAERS |
| 2 | Dizziness | FAERS: 52 | US FAERS | |
| 3 | Drug ineffective | FAERS: 37 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Headache | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Fatigue | FAERS: 25 | US FAERS | |
| 7 | Product substitution issue | FAERS: 23 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 8 | Lip swelling | FAERS: 22 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 20 | US FAERS | |
| 10 | Pharmaceutical product complaint | FAERS: 18 | US FAERS | |
| 11 | Palpitations | FAERS: 16 | US FAERS | |
| 12 | Asthenia | FAERS: 15 | US FAERS | |
| 13 | Pruritus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Chest Pain | FAERS: 14 | US FAERS | |
| 15 | Product quality issue | FAERS: 14 | US FAERS | |
| 16 | Hypersensitivity | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Vomiting | FAERS: 13 | US FAERS | |
| 18 | Syncope | FAERS: 12 | US FAERS | |
| 19 | Burning sensation | FAERS: 11 | US FAERS | |
| 20 | Malaise | FAERS: 11 | US FAERS | |
| 21 | Urticaria | FAERS: 11 | US FAERS | |
| 22 | Wheezing | FAERS: 11 | US FAERS | |
| 23 | Blood pressure inadequately controlled | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Hypotension | FAERS: 10 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 26 | Back Pain | FAERS: 9 | US FAERS | |
| 27 | Musculoskeletal Pain | FAERS: 9 | US FAERS | |
| 28 | Dysphonia | FAERS: 8 | US FAERS | |
| 29 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 30 | Pain | FAERS: 8 | US FAERS | |
| 31 | Swelling | FAERS: 8 | US FAERS | |
| 32 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Dehydration | FAERS: 7 | US FAERS | |
| 34 | Amnesia | FAERS: 6 | US FAERS | |
| 35 | Arthralgia | FAERS: 6 | US FAERS | |
| 36 | Blood creatinine increased | FAERS: 6 | US FAERS | |
| 37 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 38 | Throat irritation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Blood urea increased | FAERS: 5 | US FAERS | |
| 40 | Bronchitis | FAERS: 5 | US FAERS | |
| 41 | Chest discomfort | FAERS: 5 | US FAERS | |
| 42 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 43 | Drug dose omission | FAERS: 5 | US FAERS | |
| 44 | Lethargy | FAERS: 5 | US FAERS | |
| 45 | Retching | FAERS: 5 | US FAERS | |
| 46 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 47 | Alopecia | FAERS: 4 | US FAERS | |
| 48 | Asthma | FAERS: 4 | US FAERS | |
| 49 | Ear discomfort | FAERS: 4 | US FAERS | |
| 50 | Hypoaesthesia facial | FAERS: 4 | US FAERS | |
| 51 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 52 | Joint swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Myalgia | FAERS: 4 | US FAERS | |
| 54 | No adverse event | FAERS: 4 | US FAERS | |
| 55 | Pancreatitis | FAERS: 4 | US FAERS | |
| 56 | Respiratory distress | FAERS: 4 | US FAERS | |
| 57 | Tremor | FAERS: 4 | US FAERS | |
| 58 | Weight decreased | FAERS: 4 | US FAERS | |
| 59 | Abasia | FAERS: 3 | US FAERS | |
| 60 | Adverse event | FAERS: 3 | US FAERS | |
| 61 | Agitation | FAERS: 3 | US FAERS | |
| 62 | Aphasia | FAERS: 3 | US FAERS | |
| 63 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 64 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 65 | Choking | FAERS: 3 | US FAERS | |
| 66 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 67 | Disorientation | FAERS: 3 | US FAERS | |
| 68 | Erythema | FAERS: 3 | US FAERS | |
| 69 | Impaired work ability | FAERS: 3 | US FAERS | |
| 70 | Medication Error | FAERS: 3 | US FAERS | |
| 71 | Multiple allergies | FAERS: 3 | US FAERS | |
| 72 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 73 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 74 | Product physical issue | FAERS: 3 | US FAERS | |
| 75 | Renal pain | FAERS: 3 | US FAERS | |
| 76 | Restlessness | FAERS: 3 | US FAERS | |
| 77 | Thirst | FAERS: 3 | US FAERS | |
| 78 | Tinnitus | FAERS: 3 | US FAERS | |
| 79 | Urinary Retention | FAERS: 3 | US FAERS | |
| 80 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 81 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 82 | Aphonia | FAERS: 2 | US FAERS | |
| 83 | Arthropathy | FAERS: 2 | US FAERS | |
| 84 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 85 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 86 | Chills | FAERS: 2 | US FAERS | |
| 87 | Completed Suicide | FAERS: 2 | US FAERS | |
| 88 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 89 | Dysarthria | FAERS: 2 | US FAERS | |
| 90 | Dysgeusia | FAERS: 2 | US FAERS | |
| 91 | Dyspepsia | FAERS: 2 | US FAERS | |
| 92 | Eczema | FAERS: 2 | US FAERS | |
| 93 | Eye pain | FAERS: 2 | US FAERS | |
| 94 | Flushing | FAERS: 2 | US FAERS | |
| 95 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 96 | Gout | FAERS: 2 | US FAERS | |
| 97 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 98 | Hypoxia | FAERS: 2 | US FAERS | |
| 99 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 100 | Incontinence | FAERS: 2 | US FAERS | |
| 101 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 102 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 103 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 104 | Middle insomnia | FAERS: 2 | US FAERS | |
| 105 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 106 | Neck Pain | FAERS: 2 | US FAERS | |
| 107 | Nervousness | FAERS: 2 | US FAERS | |
| 108 | Pneumonia | FAERS: 2 | US FAERS | |
| 109 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 110 | Productive Cough | FAERS: 2 | US FAERS | |
| 111 | Pseudolymphoma | FAERS: 2 | US FAERS | |
| 112 | Purpura | FAERS: 2 | US FAERS | |
| 113 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 114 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 115 | Somnolence | FAERS: 2 | US FAERS | |
| 116 | Tachycardia | FAERS: 2 | US FAERS | |
| 117 | Unevaluable event | FAERS: 2 | US FAERS | |
| 118 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 119 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 120 | Visual Impairment | FAERS: 2 | US FAERS | |
| 121 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 122 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 123 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 124 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 125 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 126 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 127 | Anorgasmia | FAERS: 1 | US FAERS | |
| 128 | Anosmia | FAERS: 1 | US FAERS | |
| 129 | Anuria | FAERS: 1 | US FAERS | |
| 130 | Anxiety | FAERS: 1 | US FAERS | |
| 131 | Arthritis | FAERS: 1 | US FAERS | |
| 132 | Arthropod bite | FAERS: 1 | US FAERS | |
| 133 | Bladder pain | FAERS: 1 | US FAERS | |
| 134 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 135 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 136 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 137 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 138 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 139 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 140 | Bradycardia | FAERS: 1 | US FAERS | |
| 141 | Bronchospasm | FAERS: 1 | US FAERS | |
| 142 | Bruxism | FAERS: 1 | US FAERS | |
| 143 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 144 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 145 | Cellulitis | FAERS: 1 | US FAERS | |
| 146 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 147 | Chromaturia | FAERS: 1 | US FAERS | |
| 148 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 149 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 150 | Constipation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 152 | Crying | FAERS: 1 | US FAERS | |
| 153 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 154 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 155 | Disability | FAERS: 1 | US FAERS | |
| 156 | Discomfort | FAERS: 1 | US FAERS | |
| 157 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 158 | Drooling | FAERS: 1 | US FAERS | |
| 159 | Drug abuse | FAERS: 1 | US FAERS | |
| 160 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 161 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 162 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 163 | Dry skin | FAERS: 1 | US FAERS | |
| 164 | Dysuria | FAERS: 1 | US FAERS | |
| 165 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 166 | Emotional disorder | FAERS: 1 | US FAERS | |
| 167 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 168 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 169 | Facial Pain | FAERS: 1 | US FAERS | |
| 170 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 171 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 172 | Flatulence | FAERS: 1 | US FAERS | |
| 173 | Frustration | FAERS: 1 | US FAERS | |
| 174 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 175 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 176 | Gingival erythema | FAERS: 1 | US FAERS | |
| 177 | Hemiparesis | FAERS: 1 | US FAERS | |
| 178 | Hypersomnia | FAERS: 1 | US FAERS | |
| 179 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 180 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 181 | Ileitis | FAERS: 1 | US FAERS | |
| 182 | Influenza | FAERS: 1 | US FAERS | |
| 183 | Joint Instability | FAERS: 1 | US FAERS | |
| 184 | Joint stiffness | FAERS: 1 | US FAERS | |
| 185 | Laceration | FAERS: 1 | US FAERS | |
| 186 | Laryngitis | FAERS: 1 | US FAERS | |
| 187 | Lipase increased | FAERS: 1 | US FAERS | |
| 188 | Memory impairment | FAERS: 1 | US FAERS | |
| 189 | Mental status changes | FAERS: 1 | US FAERS | |
| 190 | Mouth swelling | FAERS: 1 | US FAERS | |
| 191 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 192 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 193 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 194 | Oral pain | FAERS: 1 | US FAERS | |
| 195 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 196 | Pain of skin | FAERS: 1 | US FAERS | |
| 197 | Pallor | FAERS: 1 | US FAERS | |
| 198 | Paranoia | FAERS: 1 | US FAERS | |
| 199 | Periodontal destruction | FAERS: 1 | US FAERS | |
| 200 | Personality Change | FAERS: 1 | US FAERS | |
| 201 | Pharyngitis | FAERS: 1 | US FAERS | |
| 202 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 203 | Polyuria | FAERS: 1 | US FAERS | |
| 204 | Pregnancy | FAERS: 1 | US FAERS | |
| 205 | Presyncope | FAERS: 1 | US FAERS | |
| 206 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 207 | Product dispensing error | FAERS: 1 | US FAERS | |
| 208 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 209 | Product formulation issue | FAERS: 1 | US FAERS | |
| 210 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 211 | Product lot number issue | FAERS: 1 | US FAERS | |
| 212 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 213 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 214 | Rash erythematous | FAERS: 1 | US FAERS | |
| 215 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 216 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 217 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 218 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 219 | Retinal phototoxicity | FAERS: 1 | US FAERS | |
| 220 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 221 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 222 | Secretion discharge | FAERS: 1 | US FAERS | |
| 223 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 224 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 225 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 226 | Skin irritation | FAERS: 1 | US FAERS | |
| 227 | Sluggishness | FAERS: 1 | US FAERS | |
| 228 | Staring | FAERS: 1 | US FAERS | |
| 229 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 230 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 231 | Tension Headache | FAERS: 1 | US FAERS | |
| 232 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 233 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 234 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 235 | Vasculitis | FAERS: 1 | US FAERS | |
| 236 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 237 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 238 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 239 | nervous system disorder | FAERS: 1 | US FAERS | |
| 240 | Glossitis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.