AMG-416
(ANIAZGVDEUQPRI-ZJQCGQFWSA-N)
Structure
- SMILES
- NC(=NCCC[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N)CCCN=C(N)N)C)CCCN=C(N)N)NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@H](NC(=O)C)CSSC[C@@H](C(=O)O)N)C)CCCN=C(N)N)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- H05BX04
- Molecular Formula:
- C38H73N21O10S2
- Molecular Weight:
- 1048.250
- Log P:
- 1.6720
- Hydrogen Bond Acceptor:
- 33
- Hydrogen Bond Donor:
- 18
- TPSA:
- 618.31
- CAS Number(s):
- 1262780-97-1
Synonym(s)
1.
AMG-416
2.
AMG 416
3.
KAI-4169
4.
etelcalcetide hydrochloride
5.
etelcalcitide
6.
velcalcetide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood parathyroid hormone increased | FAERS: 89 | US FAERS | |
| 2 | Nausea | FAERS: 78 | US FAERS | |
| 3 | Drug ineffective | FAERS: 41 | US FAERS | |
| 4 | Therapy non-responder | FAERS: 35 | US FAERS | |
| 5 | Vomiting | FAERS: 32 | US FAERS | |
| 6 | Pruritus | FAERS: 28 | US FAERS | |
| 7 | Headache | FAERS: 25 | US FAERS | |
| 8 | Product storage error | FAERS: 24 | US FAERS | |
| 9 | Dizziness | FAERS: 21 | US FAERS | |
| 10 | Abdominal discomfort | FAERS: 19 | US FAERS | |
| 11 | Chest Pain | FAERS: 18 | US FAERS | |
| 12 | Myalgia | FAERS: 18 | US FAERS | |
| 13 | Wrong technique in product usage process | FAERS: 18 | US FAERS | |
| 14 | Arthralgia | FAERS: 17 | US FAERS | |
| 15 | Malaise | FAERS: 16 | US FAERS | |
| 16 | Blood calcium abnormal | FAERS: 15 | US FAERS | |
| 17 | Blood parathyroid hormone abnormal | FAERS: 14 | US FAERS | |
| 18 | Fatigue | FAERS: 14 | US FAERS | |
| 19 | Intestinal Perforation | FAERS: 13 | US FAERS | |
| 20 | Palpitations | FAERS: 13 | US FAERS | |
| 21 | Blood parathyroid hormone decreased | FAERS: 12 | US FAERS | |
| 22 | Blood phosphorus decreased | FAERS: 10 | US FAERS | |
| 23 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 24 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 26 | Adverse event | FAERS: 8 | US FAERS | |
| 27 | Blood phosphorus increased | FAERS: 8 | US FAERS | |
| 28 | Bone pain | FAERS: 8 | US FAERS | |
| 29 | Overdose | FAERS: 8 | US FAERS | |
| 30 | Anxiety | FAERS: 7 | US FAERS | |
| 31 | Asthenia | FAERS: 7 | US FAERS | |
| 32 | Blood phosphorus abnormal | FAERS: 7 | US FAERS | |
| 33 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 34 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 35 | Hypotension | FAERS: 6 | US FAERS | |
| 36 | Lethargy | FAERS: 6 | US FAERS | |
| 37 | Pain | FAERS: 6 | US FAERS | |
| 38 | Prescribed underdose | FAERS: 6 | US FAERS | |
| 39 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 40 | Drug dose omission | FAERS: 5 | US FAERS | |
| 41 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 42 | Parathyroidectomy | FAERS: 5 | US FAERS | |
| 43 | Unevaluable event | FAERS: 5 | US FAERS | |
| 44 | Alopecia | FAERS: 4 | US FAERS | |
| 45 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 46 | Constipation | FAERS: 4 | US FAERS | |
| 47 | Dysgeusia | FAERS: 4 | US FAERS | |
| 48 | Dyspepsia | FAERS: 4 | US FAERS | |
| 49 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 50 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 51 | Peripheral arterial occlusive disease | FAERS: 4 | US FAERS | |
| 52 | Pneumonia | FAERS: 4 | US FAERS | |
| 53 | Sepsis | FAERS: 4 | US FAERS | |
| 54 | Vertigo | FAERS: 4 | US FAERS | |
| 55 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 56 | Back Pain | FAERS: 3 | US FAERS | |
| 57 | Calciphylaxis | FAERS: 3 | US FAERS | |
| 58 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 59 | Chest discomfort | FAERS: 3 | US FAERS | |
| 60 | Disorientation | FAERS: 3 | US FAERS | |
| 61 | Flushing | FAERS: 3 | US FAERS | |
| 62 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 63 | Tachycardia | FAERS: 3 | US FAERS | |
| 64 | Transplant | FAERS: 3 | US FAERS | |
| 65 | Tremor | FAERS: 3 | US FAERS | |
| 66 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 67 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 68 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 69 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 70 | Catheter site cellulitis | FAERS: 2 | US FAERS | |
| 71 | Diplopia | FAERS: 2 | US FAERS | |
| 72 | Epistaxis | FAERS: 2 | US FAERS | |
| 73 | Erythema | FAERS: 2 | US FAERS | |
| 74 | Flatulence | FAERS: 2 | US FAERS | |
| 75 | Fluid overload | FAERS: 2 | US FAERS | |
| 76 | Fracture | FAERS: 2 | US FAERS | |
| 77 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 78 | Pancreatitis | FAERS: 2 | US FAERS | |
| 79 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 80 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 81 | Shunt infection | FAERS: 2 | US FAERS | |
| 82 | Shunt occlusion | FAERS: 2 | US FAERS | |
| 83 | Sleep disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 84 | Somnolence | FAERS: 2 | US FAERS | |
| 85 | Therapy partial responder | FAERS: 2 | US FAERS | |
| 86 | Throat irritation | FAERS: 2 | US FAERS | |
| 87 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 88 | Weight decreased | FAERS: 2 | US FAERS | |
| 89 | Accidental overdose | FAERS: 1 | US FAERS | |
| 90 | Accidental underdose | FAERS: 1 | US FAERS | |
| 91 | Acne | FAERS: 1 | US FAERS | |
| 92 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 93 | Adjusted calcium decreased | FAERS: 1 | US FAERS | |
| 94 | Ageusia | FAERS: 1 | US FAERS | |
| 95 | Amputation | FAERS: 1 | US FAERS | |
| 96 | Anger | FAERS: 1 | US FAERS | |
| 97 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 98 | Arteriovenous fistula site complication | FAERS: 1 | US FAERS | |
| 99 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 100 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 101 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 102 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 103 | Blood urea increased | FAERS: 1 | US FAERS | |
| 104 | Bradycardia | FAERS: 1 | US FAERS | |
| 105 | Breast necrosis | FAERS: 1 | US FAERS | |
| 106 | Bronchitis | FAERS: 1 | US FAERS | |
| 107 | Burning sensation | FAERS: 1 | US FAERS | |
| 108 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 109 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 110 | Chills | FAERS: 1 | US FAERS | |
| 111 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 112 | Colitis | FAERS: 1 | US FAERS | |
| 113 | Compression fracture | FAERS: 1 | US FAERS | |
| 114 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 115 | Dementia | FAERS: 1 | US FAERS | |
| 116 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 117 | Discomfort | FAERS: 1 | US FAERS | |
| 118 | Disease Progression | FAERS: 1 | US FAERS | |
| 119 | Disease complication | FAERS: 1 | US FAERS | |
| 120 | Drug administration error | FAERS: 1 | US FAERS | |
| 121 | Dry gangrene | FAERS: 1 | US FAERS | |
| 122 | Eczema | FAERS: 1 | US FAERS | |
| 123 | Emotional distress | FAERS: 1 | US FAERS | |
| 124 | Endocarditis | FAERS: 1 | US FAERS | |
| 125 | Epilepsy | FAERS: 1 | US FAERS | |
| 126 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 127 | Gait inability | FAERS: 1 | US FAERS | |
| 128 | Gastroduodenitis haemorrhagic | FAERS: 1 | US FAERS | |
| 129 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 130 | Hemiparesis | FAERS: 1 | US FAERS | |
| 131 | Hypoxia | FAERS: 1 | US FAERS | |
| 132 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 133 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 134 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 135 | Infection | FAERS: 1 | US FAERS | |
| 136 | Influenza | FAERS: 1 | US FAERS | |
| 137 | Injection site pain | FAERS: 1 | US FAERS | |
| 138 | Joint swelling | FAERS: 1 | US FAERS | |
| 139 | Lip swelling | FAERS: 1 | US FAERS | |
| 140 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 141 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 142 | Mood swings | FAERS: 1 | US FAERS | |
| 143 | Myopathy | FAERS: 1 | US FAERS | |
| 144 | Neck Pain | FAERS: 1 | US FAERS | |
| 145 | Nervousness | FAERS: 1 | US FAERS | |
| 146 | Neuralgia | FAERS: 1 | US FAERS | |
| 147 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 148 | Presyncope | FAERS: 1 | US FAERS | |
| 149 | Procedural complication | FAERS: 1 | US FAERS | |
| 150 | Product administration error | FAERS: 1 | US FAERS | |
| 151 | Product dispensing error | FAERS: 1 | US FAERS | |
| 152 | Renal pain | FAERS: 1 | US FAERS | |
| 153 | Restlessness | FAERS: 1 | US FAERS | |
| 154 | Retching | FAERS: 1 | US FAERS | |
| 155 | Sensitive skin | FAERS: 1 | US FAERS | |
| 156 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 157 | Shunt aneurysm | FAERS: 1 | US FAERS | |
| 158 | Skin irritation | FAERS: 1 | US FAERS | |
| 159 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 160 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 161 | Syncope | FAERS: 1 | US FAERS | |
| 162 | Tension Headache | FAERS: 1 | US FAERS | |
| 163 | Tetany | FAERS: 1 | US FAERS | |
| 164 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 165 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 166 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 167 | Thrombosis | FAERS: 1 | US FAERS | |
| 168 | Tongue biting | FAERS: 1 | US FAERS | |
| 169 | Tooth Loss | FAERS: 1 | US FAERS | |
| 170 | Transferrin decreased | FAERS: 1 | US FAERS | |
| 171 | Ulcer | FAERS: 1 | US FAERS | |
| 172 | Urticaria | FAERS: 1 | US FAERS | |
| 173 | Vascular access site rupture | FAERS: 1 | US FAERS | |
| 174 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 175 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 176 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.