Ellagic Acid
(AFSDNFLWKVMVRB-UHFFFAOYSA-N)
Structure
- SMILES
- Oc1cc2c(=O)oc3c4c2c(c1O)oc(=O)c4cc(c3O)O
- Type(s)
- Investigational
- Molecular Formula:
- C14H6O8
- Molecular Weight:
- 302.193
- Log P:
- 1.3128
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 141.34
- CAS Number(s):
- 476-66-4
Synonym(s)
1.
Ellagic Acid
2.
Benzoaric Acid
3.
Acid, Benzoaric
4.
Acid, Ellagic
External Link(s)
| MeSH | D004610 |
| PubChem Compound | 5281855 |
| BindingDB | 4078 |
| ChEBI | 4775 |
| CHEMBL | CHEMBL6246 |
| DrugBank | DB08846 |
| KEGG | cpd:C10788 |
| Therapeutic Target Database | D0A1CM |
| ZINC | 3872446 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abnormalities, Drug-Induced | 9650642 | CTD | |
| 2 | Brain Injuries | 29455002 | CTD | |
| 3 | Cerebral Hemorrhage | 28815802 | CTD | |
| 4 | Chemical and Drug Induced Liver Injury | 29935397 | CTD | |
| 5 | Encephalomalacia | 28815802 | CTD | |
| 6 | Fatty Liver, Alcoholic | 24498295 | CTD | |
| 7 | Heart Diseases | 28474970 | CTD | |
| 8 | Hyperglycemia | 24877639 | CTD | |
| 9 | Hyperplasia | 19329757 20103723 | CTD | |
| 10 | Kidney Diseases | 24877639 29935397 | CTD | |
| 11 | Myocardial Infarction | 21762681 | CTD | |
| 12 | Neurobehavioral Manifestations | 24877639 | CTD | |
| 13 | Neurotoxicity Syndromes | 28815802 | CTD | |
| 14 | Proteinuria | 24877639 | CTD | |
| 15 | Reperfusion Injury | 9650642 | CTD | |
| 16 | Skin Neoplasms | 19329757 | CTD | |
| 17 | Sunburn | 22386815 | CTD | |
| 18 | Testicular Diseases | 20074268 30503583 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.