tizanidine
(ZWUKMNZJRDGCTQ-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc2c(c1NC1=NCCN1)nsn2.Cl
- Molecular Formula:
- C9H9Cl2N5S
- Molecular Weight:
- 290.172
- Log P:
- 2.3552
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 90.44
- CAS Number(s):
- 64461-82-1
Synonym(s)
1.
tizanidine
2.
5-chloro-4-(2-imidazolin-2-yl-amino)-2,1,3-benzothiadiazole
3.
DS 103-282
4.
Sirdalud
5.
Zanaflex
6.
tizanidine hydrochloride
7.
tizanidine monohydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 31 | US FAERS | |
| 2 | Dizziness | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Pharmaceutical product complaint | FAERS: 17 | US FAERS | |
| 4 | Somnolence | FAERS: 15 | US FAERS | |
| 5 | Hypotension | FAERS: 12 | US FAERS | |
| 6 | Asthenia | FAERS: 10 | US FAERS | |
| 7 | Overdose | FAERS: 10 | US FAERS | |
| 8 | Nausea | FAERS: 9 | US FAERS | |
| 9 | Headache | FAERS: 8 | US FAERS | |
| 10 | Product quality issue | FAERS: 8 | US FAERS | |
| 11 | Dysarthria | FAERS: 6 | US FAERS | |
| 12 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 13 | Mood swings | FAERS: 6 | US FAERS | |
| 14 | Bradycardia | FAERS: 5 | US FAERS | |
| 15 | Fatigue | FAERS: 5 | US FAERS | |
| 16 | Pain | FAERS: 5 | US FAERS | |
| 17 | Product substitution issue | FAERS: 5 | US FAERS | |
| 18 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 19 | Tachycardia | FAERS: 5 | US FAERS | |
| 20 | Tremor | FAERS: 5 | US FAERS | |
| 21 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 22 | Chills | FAERS: 4 | US FAERS | |
| 23 | Shock | FAERS: 4 | US FAERS | |
| 24 | Vomiting | FAERS: 4 | US FAERS | |
| 25 | Agitation | FAERS: 3 | US FAERS | |
| 26 | Amyotrophic Lateral Sclerosis | FAERS: 3 | US FAERS | |
| 27 | Anxiety | FAERS: 3 | US FAERS | |
| 28 | Delirium | FAERS: 3 | US FAERS | |
| 29 | Malaise | FAERS: 3 | US FAERS | |
| 30 | Proctitis | FAERS: 3 | US FAERS | |
| 31 | Pruritus | FAERS: 3 | US FAERS | |
| 32 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 33 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 34 | Adverse event | FAERS: 2 | US FAERS | |
| 35 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 36 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 37 | Constipation | FAERS: 2 | US FAERS | |
| 38 | Crying | FAERS: 2 | US FAERS | |
| 39 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 40 | Discomfort | FAERS: 2 | US FAERS | |
| 41 | Disease Progression | FAERS: 2 | US FAERS | |
| 42 | Drug abuse | FAERS: 2 | US FAERS | |
| 43 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 44 | Dysuria | FAERS: 2 | US FAERS | |
| 45 | Hepatitis | FAERS: 2 | US FAERS | |
| 46 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 47 | Lethargy | FAERS: 2 | US FAERS | |
| 48 | Medication Error | FAERS: 2 | US FAERS | |
| 49 | Memory impairment | FAERS: 2 | US FAERS | |
| 50 | Middle insomnia | FAERS: 2 | US FAERS | |
| 51 | Myalgia | FAERS: 2 | US FAERS | |
| 52 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 53 | Palpitations | FAERS: 2 | US FAERS | |
| 54 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 55 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 56 | Swelling | FAERS: 2 | US FAERS | |
| 57 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 58 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 59 | Unevaluable event | FAERS: 2 | US FAERS | |
| 60 | Urticaria | FAERS: 2 | US FAERS | |
| 61 | jaundice | FAERS: 2 | US FAERS | |
| 62 | Abasia | FAERS: 1 | US FAERS | |
| 63 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 64 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 65 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 66 | Accidental exposure | FAERS: 1 | US FAERS | |
| 67 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 68 | Akathisia | FAERS: 1 | US FAERS | |
| 69 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 70 | Amnesia | FAERS: 1 | US FAERS | |
| 71 | Angioedema | FAERS: 1 | US FAERS | |
| 72 | Apathy | FAERS: 1 | US FAERS | |
| 73 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 74 | Asthenopia | FAERS: 1 | US FAERS | |
| 75 | Back Pain | FAERS: 1 | US FAERS | |
| 76 | Bedridden | FAERS: 1 | US FAERS | |
| 77 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 78 | Bronchitis | FAERS: 1 | US FAERS | |
| 79 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 80 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 81 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 82 | Completed Suicide | FAERS: 1 | US FAERS | |
| 83 | Cyanosis | FAERS: 1 | US FAERS | |
| 84 | Deformity | FAERS: 1 | US FAERS | |
| 85 | Diplopia | FAERS: 1 | US FAERS | |
| 86 | Disease recurrence | FAERS: 1 | US FAERS | |
| 87 | Disorientation | FAERS: 1 | US FAERS | |
| 88 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 89 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 90 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 91 | Drug level increased | FAERS: 1 | US FAERS | |
| 92 | Dyspepsia | FAERS: 1 | US FAERS | |
| 93 | Eczema | FAERS: 1 | US FAERS | |
| 94 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 95 | Emotional distress | FAERS: 1 | US FAERS | |
| 96 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 97 | Erythema | FAERS: 1 | US FAERS | |
| 98 | Formication | FAERS: 1 | US FAERS | |
| 99 | Frustration | FAERS: 1 | US FAERS | |
| 100 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 101 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 102 | Hypersomnia | FAERS: 1 | US FAERS | |
| 103 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 104 | Impaired work ability | FAERS: 1 | US FAERS | |
| 105 | Infection | FAERS: 1 | US FAERS | |
| 106 | Influenza | FAERS: 1 | US FAERS | |
| 107 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 108 | Joint swelling | FAERS: 1 | US FAERS | |
| 109 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 110 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 111 | Muscle tightness | FAERS: 1 | US FAERS | |
| 112 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 113 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 114 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 115 | Nervousness | FAERS: 1 | US FAERS | |
| 116 | Neuralgia | FAERS: 1 | US FAERS | |
| 117 | No adverse effect | FAERS: 1 | US FAERS | |
| 118 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 119 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 120 | Pallor | FAERS: 1 | US FAERS | |
| 121 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 122 | Pneumonia | FAERS: 1 | US FAERS | |
| 123 | Poisoning | FAERS: 1 | US FAERS | |
| 124 | Presyncope | FAERS: 1 | US FAERS | |
| 125 | Product counterfeit | FAERS: 1 | US FAERS | |
| 126 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 127 | Rebound effect | FAERS: 1 | US FAERS | |
| 128 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 129 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 130 | Restlessness | FAERS: 1 | US FAERS | |
| 131 | Retching | FAERS: 1 | US FAERS | |
| 132 | Screaming | FAERS: 1 | US FAERS | |
| 133 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 134 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 135 | Skin laceration | FAERS: 1 | US FAERS | |
| 136 | Stomatitis | FAERS: 1 | US FAERS | |
| 137 | Suicide attempt | FAERS: 1 | US FAERS | |
| 138 | Syncope | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Therapy change | FAERS: 1 | US FAERS | |
| 140 | Thrombosis | FAERS: 1 | US FAERS | |
| 141 | Tinnitus | FAERS: 1 | US FAERS | |
| 142 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 143 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 144 | Visual disturbance | FAERS: 1 | US FAERS | |
| 145 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 146 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 147 | treatment failure | FAERS: 1 | US FAERS | |
| 148 | Acute left ventricular failure | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 150 | Urinary Retention | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.