Fluticasone/salmeterol
(YYAZJTUGSQOFHG-RZFXJYHSSA-N)
Structure
- SMILES
- OCc1cc(ccc1O)C(CNCCCCCCOCCCCc1ccccc1)O.FCSC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Molecular Formula:
- C50H68F3NO9S
- Molecular Weight:
- 916.136
- Log P:
- 8.9283
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 187.92
- CAS Number(s):
- N/A
Synonym(s)
1.
Fluticasone/salmeterol
External Link(s)
| PubChem Compound | 9811567 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthma | FAERS: 6 | US FAERS | |
| 2 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 3 | Asthenia | FAERS: 4 | US FAERS | |
| 4 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 5 | Drug Dependence | FAERS: 3 | US FAERS | |
| 6 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 7 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 8 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 9 | Disability | FAERS: 2 | US FAERS | |
| 10 | Dysphonia | FAERS: 2 | SIDER US FAERS | |
| 11 | Enamel anomaly | FAERS: 2 | US FAERS | |
| 12 | Infection | FAERS: 2 | SIDER US FAERS | |
| 13 | Lip swelling | FAERS: 2 | US FAERS | |
| 14 | Myalgia | FAERS: 2 | US FAERS | |
| 15 | Pathological fracture | FAERS: 2 | US FAERS | |
| 16 | Product quality issue | FAERS: 2 | US FAERS | |
| 17 | Respiratory distress | FAERS: 2 | US FAERS | |
| 18 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 19 | Tuberculosis | FAERS: 2 | US FAERS | |
| 20 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 21 | Accidental overdose | FAERS: 1 | US FAERS | |
| 22 | Adverse event | FAERS: 1 | US FAERS | |
| 23 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 24 | Anxiety | FAERS: 1 | SIDER US FAERS | |
| 25 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 26 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 27 | Cataract | FAERS: 1 | SIDER US FAERS | |
| 28 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 29 | Chest discomfort | FAERS: 1 | US FAERS | |
| 30 | Choking sensation | FAERS: 1 | US FAERS | |
| 31 | Dizziness | FAERS: 1 | US FAERS | |
| 32 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 33 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 34 | Drug ineffective | FAERS: 1 | US FAERS | |
| 35 | Epiglottitis | FAERS: 1 | US FAERS | |
| 36 | Epilepsy | FAERS: 1 | US FAERS | |
| 37 | Expired drug administered | FAERS: 1 | US FAERS | |
| 38 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 39 | Headache | FAERS: 1 | SIDER US FAERS | |
| 40 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 41 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 42 | Hypertrophy | FAERS: 1 | US FAERS | |
| 43 | Macular degeneration | FAERS: 1 | US FAERS | |
| 44 | Malaise | FAERS: 1 | US FAERS | |
| 45 | Mouth swelling | FAERS: 1 | US FAERS | |
| 46 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 47 | Paresis | FAERS: 1 | US FAERS | |
| 48 | Product substitution issue | FAERS: 1 | US FAERS | |
| 49 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 50 | Product use issue | FAERS: 1 | US FAERS | |
| 51 | Pruritus | FAERS: 1 | US FAERS | |
| 52 | Sense of oppression | FAERS: 1 | US FAERS | |
| 53 | Suicide attempt | FAERS: 1 | US FAERS | |
| 54 | Syncope | FAERS: 1 | US FAERS | |
| 55 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 56 | Tremor | FAERS: 1 | SIDER US FAERS | |
| 57 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 58 | Visual disturbance | FAERS: 1 | US FAERS | |
| 59 | Weight decreased | FAERS: 1 | US FAERS | |
| 60 | Anaphylactic shock | SIDER | ||
| 61 | Atrial Fibrillation | SIDER | ||
| 62 | Bronchial Hyperreactivity | SIDER | ||
| 63 | Cutaneous hypersensitivity | SIDER | ||
| 64 | Glaucoma | SIDER | ||
| 65 | Growth retardation | SIDER | ||
| 66 | Hoarseness | SIDER | ||
| 67 | Hyperkinesia | SIDER | ||
| 68 | Infestation | SIDER | ||
| 69 | Malnutrition | SIDER | ||
| 70 | Musculoskeletal discomfort | SIDER | ||
| 71 | Oral candidiasis | SIDER | ||
| 72 | Oropharyngeal swelling | SIDER | ||
| 73 | Palpitations | SIDER | ||
| 74 | Supraventricular tachycardia | SIDER | ||
| 75 | Throat irritation | SIDER | ||
| 76 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.