baricitinib
(XUZMWHLSFXCVMG-UHFFFAOYSA-N)
Structure
- SMILES
- N#CCC1(CN(C1)S(=O)(=O)CC)n1ncc(c1)c1ncnc2c1cc[nH]2
- Type(s)
- Approved; Investigational
- ATC code(s)
- L04AA37
- Molecular Formula:
- C16H17N7O2S
- Molecular Weight:
- 371.417
- Log P:
- 2.1144
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 128.94
- CAS Number(s):
- 1187594-09-7
Synonym(s)
1.
baricitinib
2.
INCB028050
3.
LY3009104
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Therapy cessation | FAERS: 29 | US FAERS | |
| 2 | Drug ineffective | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 16 | US FAERS | |
| 4 | Nausea | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Sinusitis | FAERS: 14 | US FAERS | |
| 6 | Dizziness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Infection | FAERS: 12 | US FAERS | |
| 8 | Nasopharyngitis | FAERS: 12 | US FAERS | |
| 9 | Pneumonia | FAERS: 12 | US FAERS | |
| 10 | Pulmonary Embolism | FAERS: 12 | US FAERS | |
| 11 | Malaise | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Peripheral swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Urinary tract infection | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Deep Vein Thrombosis | FAERS: 9 | US FAERS | |
| 15 | Fatigue | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Pain | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 18 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 19 | Arthralgia | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Influenza | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Bronchitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 24 | Pruritus | FAERS: 5 | US FAERS | |
| 25 | Vomiting | FAERS: 5 | US FAERS | |
| 26 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 27 | Alopecia | FAERS: 4 | US FAERS | |
| 28 | Constipation | FAERS: 4 | US FAERS | |
| 29 | Diverticulitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Lip swelling | FAERS: 4 | US FAERS | |
| 31 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 32 | Palpitations | FAERS: 4 | US FAERS | |
| 33 | Anxiety | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 35 | Chest discomfort | FAERS: 3 | US FAERS | |
| 36 | Death of relative | FAERS: 3 | US FAERS | |
| 37 | Economic problem | FAERS: 3 | US FAERS | |
| 38 | Hepatitis E | FAERS: 3 | US FAERS | |
| 39 | Hypotension | FAERS: 3 | US FAERS | |
| 40 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 41 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 42 | Oral pain | FAERS: 3 | US FAERS | |
| 43 | Product dose omission | FAERS: 3 | US FAERS | |
| 44 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 45 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 46 | Sepsis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Stomatitis | FAERS: 3 | US FAERS | |
| 48 | Stress | FAERS: 3 | US FAERS | |
| 49 | Swelling | FAERS: 3 | US FAERS | |
| 50 | Tooth Infection | FAERS: 3 | US FAERS | |
| 51 | Visual Impairment | FAERS: 3 | US FAERS | |
| 52 | Weight decreased | FAERS: 3 | US FAERS | |
| 53 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 54 | Antibiotic therapy | FAERS: 2 | US FAERS | |
| 55 | Arthropathy | FAERS: 2 | US FAERS | |
| 56 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 57 | Asthma | FAERS: 2 | US FAERS | |
| 58 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 59 | Back Pain | FAERS: 2 | US FAERS | |
| 60 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 61 | Cellulitis | FAERS: 2 | US FAERS | |
| 62 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 63 | Chest Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Cyst | FAERS: 2 | US FAERS | |
| 65 | Enterococcal sepsis | FAERS: 2 | US FAERS | |
| 66 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 67 | Gastric infection | FAERS: 2 | US FAERS | |
| 68 | Hordeolum | FAERS: 2 | US FAERS | |
| 69 | Joint swelling | FAERS: 2 | US FAERS | |
| 70 | Limb operation | FAERS: 2 | US FAERS | |
| 71 | Living in residential institution | FAERS: 2 | US FAERS | |
| 72 | Myalgia | FAERS: 2 | US FAERS | |
| 73 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 74 | Productive Cough | FAERS: 2 | US FAERS | |
| 75 | Somnolence | FAERS: 2 | US FAERS | |
| 76 | Sudden death | FAERS: 2 | US FAERS | |
| 77 | Ulcer | FAERS: 2 | US FAERS | |
| 78 | Unevaluable event | FAERS: 2 | US FAERS | |
| 79 | Urinary Retention | FAERS: 2 | US FAERS | |
| 80 | Abscess | FAERS: 1 | US FAERS | |
| 81 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 82 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 83 | Anal abscess | FAERS: 1 | US FAERS | |
| 84 | Anger | FAERS: 1 | US FAERS | |
| 85 | Animal bite | FAERS: 1 | US FAERS | |
| 86 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Asthenia | FAERS: 1 | US FAERS | |
| 88 | Atelectasis | FAERS: 1 | US FAERS | |
| 89 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 90 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 91 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 92 | Blood lactate dehydrogenase | FAERS: 1 | US FAERS | |
| 93 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 94 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 95 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 96 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 97 | Bursitis | FAERS: 1 | US FAERS | |
| 98 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 99 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 100 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 101 | Cholecystitis | FAERS: 1 | US FAERS | |
| 102 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 103 | Colitis | FAERS: 1 | US FAERS | |
| 104 | Compression fracture | FAERS: 1 | US FAERS | |
| 105 | Cystitis | FAERS: 1 | US FAERS | |
| 106 | Dehydration | FAERS: 1 | US FAERS | |
| 107 | Dental caries | FAERS: 1 | US FAERS | |
| 108 | Dermatitis | FAERS: 1 | US FAERS | |
| 109 | Disease recurrence | FAERS: 1 | US FAERS | |
| 110 | Disorientation | FAERS: 1 | US FAERS | |
| 111 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 112 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 113 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 114 | Dysgeusia | FAERS: 1 | US FAERS | |
| 115 | Dyspepsia | FAERS: 1 | US FAERS | |
| 116 | Dysphonia | FAERS: 1 | US FAERS | |
| 117 | Dysuria | FAERS: 1 | US FAERS | |
| 118 | Embolic stroke | FAERS: 1 | US FAERS | |
| 119 | Embolism | FAERS: 1 | US FAERS | |
| 120 | Emergency care examination | FAERS: 1 | US FAERS | |
| 121 | Emotional disorder | FAERS: 1 | US FAERS | |
| 122 | Encephalitis | FAERS: 1 | US FAERS | |
| 123 | Enteritis | FAERS: 1 | US FAERS | |
| 124 | Epidural empyema | FAERS: 1 | US FAERS | |
| 125 | Epistaxis | FAERS: 1 | US FAERS | |
| 126 | Erysipelas | FAERS: 1 | US FAERS | |
| 127 | Eye Infection | FAERS: 1 | US FAERS | |
| 128 | Fibrosis | FAERS: 1 | US FAERS | |
| 129 | Flatulence | FAERS: 1 | US FAERS | |
| 130 | Food Allergy | FAERS: 1 | US FAERS | |
| 131 | Fracture | FAERS: 1 | US FAERS | |
| 132 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 133 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 134 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 135 | Genital herpes zoster | FAERS: 1 | US FAERS | |
| 136 | Head discomfort | FAERS: 1 | US FAERS | |
| 137 | Hepatic Infarction | FAERS: 1 | US FAERS | |
| 138 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 139 | Immunosuppression | FAERS: 1 | US FAERS | |
| 140 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 141 | Inflammation | FAERS: 1 | US FAERS | |
| 142 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 143 | Injection site erythema | FAERS: 1 | US FAERS | |
| 144 | Injection site pain | FAERS: 1 | US FAERS | |
| 145 | Insurance issue | FAERS: 1 | US FAERS | |
| 146 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 147 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 148 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 149 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 150 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 151 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 152 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 153 | Joint injury | FAERS: 1 | US FAERS | |
| 154 | Leukopenia | FAERS: 1 | US FAERS | |
| 155 | Limb mass | FAERS: 1 | US FAERS | |
| 156 | Liver Abscess | FAERS: 1 | US FAERS | |
| 157 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 158 | Lymphoma | FAERS: 1 | US FAERS | |
| 159 | Lymphopenia | FAERS: 1 | US FAERS | |
| 160 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 161 | Memory impairment | FAERS: 1 | US FAERS | |
| 162 | Mesothelioma | FAERS: 1 | US FAERS | |
| 163 | Mole excision | FAERS: 1 | US FAERS | |
| 164 | Motion Sickness | FAERS: 1 | US FAERS | |
| 165 | Multiple allergies | FAERS: 1 | US FAERS | |
| 166 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 167 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 168 | Nervousness | FAERS: 1 | US FAERS | |
| 169 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 170 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 171 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 172 | Pancytopenia | FAERS: 1 | US FAERS | |
| 173 | Peritonitis | FAERS: 1 | US FAERS | |
| 174 | Post procedural contusion | FAERS: 1 | US FAERS | |
| 175 | Post procedural infection | FAERS: 1 | US FAERS | |
| 176 | Product distribution issue | FAERS: 1 | US FAERS | |
| 177 | Product supply issue | FAERS: 1 | US FAERS | |
| 178 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 179 | Psoriasis | FAERS: 1 | US FAERS | |
| 180 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 181 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 182 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 183 | Quadriparesis | FAERS: 1 | US FAERS | |
| 184 | Radial nerve compression | FAERS: 1 | US FAERS | |
| 185 | Rash erythematous | FAERS: 1 | US FAERS | |
| 186 | Renal Colic | FAERS: 1 | US FAERS | |
| 187 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 188 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 189 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 190 | Rheumatoid Vasculitis | FAERS: 1 | US FAERS | |
| 191 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 192 | Sciatica | FAERS: 1 | US FAERS | |
| 193 | Septic Shock | FAERS: 1 | US FAERS | |
| 194 | Septic embolus | FAERS: 1 | US FAERS | |
| 195 | Skin laceration | FAERS: 1 | US FAERS | |
| 196 | Skin lesion | FAERS: 1 | US FAERS | |
| 197 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 198 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 199 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 200 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 201 | Syncope | FAERS: 1 | US FAERS | |
| 202 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 203 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 204 | Tachycardia | FAERS: 1 | US FAERS | |
| 205 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 206 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 207 | Thrombosis | FAERS: 1 | US FAERS | |
| 208 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 209 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 210 | Transcription medication error | FAERS: 1 | US FAERS | |
| 211 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 212 | Urticaria | FAERS: 1 | US FAERS | |
| 213 | Vascular fragility | FAERS: 1 | US FAERS | |
| 214 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 215 | colonoscopy | FAERS: 1 | US FAERS | |
| 216 | treatment failure | FAERS: 1 | US FAERS | |
| 217 | Central nervous system lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 218 | Dermatitis acneiform | Canada Vigilance: 1 | Canada Vigilance | |
| 219 | Extra dose administered | Canada Vigilance: 1 | Canada Vigilance | |
| 220 | Musculoskeletal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 221 | Urethritis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.