Acarbose
(XUFXOAAUWZOOIT-SXARVLRPSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@H]1O[C@H](C)[C@H]([C@@H]([C@H]1O)O)N[C@H]1C=C(CO)[C@H]([C@@H]([C@H]1O)O)O)O)O
- Molecular Formula:
- C25H43NO18
- Molecular Weight:
- 645.605
- Log P:
- -8.1736
- Hydrogen Bond Acceptor:
- 19
- Hydrogen Bond Donor:
- 14
- TPSA:
- 321.17
- CAS Number(s):
- 56180-94-0
Synonym(s)
1.
Acarbose
2.
Bay g 5421
3.
Glucobay
4.
Glucor
5.
Glumida
6.
Prandase
7.
Precose
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetes mellitus inadequate control | FAERS: 39 | US FAERS | |
| 2 | Blood glucose increased | FAERS: 19 | US FAERS | |
| 3 | Drug ineffective | FAERS: 14 | US FAERS | |
| 4 | Flatulence | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Weight decreased | FAERS: 11 | US FAERS | |
| 6 | Suspected counterfeit product | FAERS: 10 | US FAERS | |
| 7 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 8 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 9 | Vomiting | FAERS: 7 | US FAERS | |
| 10 | Malaise | FAERS: 6 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 12 | Constipation | FAERS: 5 | US FAERS | |
| 13 | Dizziness | FAERS: 5 | US FAERS | |
| 14 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 15 | Ileus | FAERS: 5 | US FAERS | |
| 16 | Pneumatosis intestinalis | FAERS: 5 | US FAERS | |
| 17 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 18 | Nausea | FAERS: 4 | US FAERS | |
| 19 | Pneumatosis Cystoides Intestinalis | FAERS: 4 | US FAERS | |
| 20 | Pruritus | FAERS: 4 | US FAERS | |
| 21 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 22 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 23 | Chest discomfort | FAERS: 3 | US FAERS | |
| 24 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 25 | Erythema | FAERS: 3 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 27 | No adverse event | FAERS: 3 | US FAERS | |
| 28 | Somnolence | FAERS: 3 | US FAERS | |
| 29 | Swelling | FAERS: 3 | US FAERS | |
| 30 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 31 | Unevaluable event | FAERS: 3 | US FAERS | |
| 32 | Urticaria | FAERS: 3 | US FAERS | |
| 33 | Anorexia | FAERS: 2 | US FAERS | |
| 34 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 35 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 36 | Chills | FAERS: 2 | US FAERS | |
| 37 | Discomfort | FAERS: 2 | US FAERS | |
| 38 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 39 | Fatigue | FAERS: 2 | US FAERS | |
| 40 | Gastritis | FAERS: 2 | US FAERS | |
| 41 | Oliguria | FAERS: 2 | US FAERS | |
| 42 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 43 | Product use issue | FAERS: 2 | US FAERS | |
| 44 | Suicide attempt | FAERS: 2 | US FAERS | |
| 45 | Transaminases increased | FAERS: 2 | US FAERS | |
| 46 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 47 | Abasia | FAERS: 1 | US FAERS | |
| 48 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 49 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 50 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 51 | Angioedema | FAERS: 1 | US FAERS | |
| 52 | Asphyxia | FAERS: 1 | US FAERS | |
| 53 | Asthma | FAERS: 1 | US FAERS | |
| 54 | Azoospermia | FAERS: 1 | US FAERS | |
| 55 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 56 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 57 | Burning sensation | FAERS: 1 | US FAERS | |
| 58 | Cachexia | FAERS: 1 | US FAERS | |
| 59 | Cataract | FAERS: 1 | US FAERS | |
| 60 | Cholestasis | FAERS: 1 | US FAERS | |
| 61 | Colon adenoma | FAERS: 1 | US FAERS | |
| 62 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 63 | Crystal urine present | FAERS: 1 | US FAERS | |
| 64 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 65 | Drug dose omission | FAERS: 1 | US FAERS | |
| 66 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 67 | Dyspepsia | FAERS: 1 | US FAERS | |
| 68 | Ecchymosis | FAERS: 1 | US FAERS | |
| 69 | Eosinophilia | FAERS: 1 | US FAERS | |
| 70 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 71 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 72 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 73 | Head discomfort | FAERS: 1 | US FAERS | |
| 74 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 75 | Hepatitis B | FAERS: 1 | US FAERS | |
| 76 | Hepatitis C | FAERS: 1 | US FAERS | |
| 77 | Hypersomnia | FAERS: 1 | US FAERS | |
| 78 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 79 | Infection | FAERS: 1 | US FAERS | |
| 80 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 81 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 82 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 83 | Lethargy | FAERS: 1 | US FAERS | |
| 84 | Leukocytosis | FAERS: 1 | US FAERS | |
| 85 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 86 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 87 | Macular degeneration | FAERS: 1 | US FAERS | |
| 88 | Medication Error | FAERS: 1 | US FAERS | |
| 89 | Myalgia | FAERS: 1 | US FAERS | |
| 90 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 91 | Ocular icterus | FAERS: 1 | US FAERS | |
| 92 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 93 | Palpitations | FAERS: 1 | US FAERS | |
| 94 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 96 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 97 | Portal venous gas | FAERS: 1 | US FAERS | |
| 98 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 99 | Product quality issue | FAERS: 1 | US FAERS | |
| 100 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 101 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 102 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 103 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 104 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 105 | Shock | FAERS: 1 | US FAERS | |
| 106 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 107 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 108 | Thrombosis | FAERS: 1 | US FAERS | |
| 109 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 110 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 111 | Wound Infection | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.