peramivir
(XRQDFNLINLXZLB-CKIKVBCHSA-N)
Structure
- SMILES
- CCC([C@@H]([C@H]1[C@H](N=C(N)N)C[C@@H]([C@H]1O)C(=O)O)NC(=O)C)CC
- Type(s)
- Approved; Investigational
- ATC code(s)
- J05AH03
- Molecular Formula:
- C15H28N4O4
- Molecular Weight:
- 328.407
- Log P:
- 1.4424
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 151.03
- CAS Number(s):
- 229614-55-5; 229614-56-6; 330600-85-6
Synonym(s)
1.
peramivir
2.
3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid
3.
BCX 1812
4.
BCX-1812
5.
BCX1812
6.
RWJ 270201
7.
RWJ-270201
8.
RWJ270201
9.
Rapivab
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Shock | FAERS: 10 | US FAERS | |
| 2 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 3 | Pneumonia | FAERS: 8 | US FAERS | |
| 4 | Thrombocytopenia | FAERS: 5 | US FAERS | |
| 5 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 6 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 7 | Influenza | FAERS: 3 | US FAERS | |
| 8 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 9 | Anuria | FAERS: 2 | US FAERS | |
| 10 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 11 | Cyanosis | FAERS: 2 | US FAERS | |
| 12 | Dehydration | FAERS: 2 | US FAERS | |
| 13 | Hyperventilation | FAERS: 2 | US FAERS | |
| 14 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 15 | Injection site ulcer | FAERS: 2 | US FAERS | |
| 16 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 17 | Leukopenia | FAERS: 2 | US FAERS | |
| 18 | Nausea | FAERS: 2 | US FAERS | |
| 19 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 20 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 21 | Amnesia | FAERS: 1 | US FAERS | |
| 22 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 23 | Anxiety | FAERS: 1 | US FAERS | |
| 24 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 25 | Asthenia | FAERS: 1 | US FAERS | |
| 26 | Bradycardia | FAERS: 1 | US FAERS | |
| 27 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 28 | Cold sweat | FAERS: 1 | US FAERS | |
| 29 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 30 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 31 | Dizziness | FAERS: 1 | US FAERS | |
| 32 | Drug ineffective | FAERS: 1 | US FAERS | |
| 33 | Encephalitis | FAERS: 1 | US FAERS | |
| 34 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 35 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 36 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 37 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 38 | Hypercapnia | FAERS: 1 | US FAERS | |
| 39 | Mental impairment | FAERS: 1 | US FAERS | |
| 40 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 41 | Myalgia | FAERS: 1 | US FAERS | |
| 42 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 43 | Neuralgia | FAERS: 1 | US FAERS | |
| 44 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 45 | Oliguria | FAERS: 1 | US FAERS | |
| 46 | Pancytopenia | FAERS: 1 | US FAERS | |
| 47 | Pneumonitis | FAERS: 1 | US FAERS | |
| 48 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 49 | Rash erythematous | FAERS: 1 | US FAERS | |
| 50 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 51 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 52 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 53 | Sepsis | FAERS: 1 | US FAERS | |
| 54 | Septic Shock | FAERS: 1 | US FAERS | |
| 55 | Shock symptom | FAERS: 1 | US FAERS | |
| 56 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 57 | Syncope | FAERS: 1 | US FAERS | |
| 58 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 59 | Urticaria | FAERS: 1 | US FAERS | |
| 60 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 61 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.