Dexmedetomidine
(VPNGEIHDPSLNMU-MERQFXBCSA-N)
Structure
- SMILES
- Cc1cccc(c1C)[C@@H](c1cnc[nH]1)C.Cl
- Molecular Formula:
- C13H17ClN2
- Molecular Weight:
- 236.740
- Log P:
- 3.9803
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 2
- TPSA:
- 28.68
- CAS Number(s):
- 145108-58-3
Synonym(s)
1.
Dexmedetomidine
2.
Dexmedetomidine Hydrochloride
3.
MPV-1440
4.
Precedex
5.
Hydrochloride, Dexmedetomidine
6.
MPV 1440
7.
MPV1440
External Link(s)
| MeSH | D020927 |
| PubChem Compound | 6918081 |
| ChEBI | 31472 |
| CHEMBL | CHEMBL2106195 |
| KEGG | dr:D01205 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug withdrawal convulsions | FAERS: 28 | US FAERS | |
| 2 | Hypotension | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Drug administered to patient of inappropriate age | FAERS: 23 | US FAERS | |
| 4 | Bradycardia | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Cardiac Arrest | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Product use issue | FAERS: 12 | US FAERS | |
| 7 | Product closure removal difficult | FAERS: 11 | US FAERS | |
| 8 | Laceration | FAERS: 10 | US FAERS | |
| 9 | Tachycardia | FAERS: 8 | US FAERS | |
| 10 | Agitation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 12 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 13 | Sedation complication | FAERS: 6 | US FAERS | |
| 14 | Cardiac Tamponade | FAERS: 5 | US FAERS | |
| 15 | Drug ineffective | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 17 | Hypoxia | FAERS: 5 | US FAERS | |
| 18 | Neonatal hypotension | FAERS: 5 | US FAERS | |
| 19 | Pneumonia | FAERS: 5 | US FAERS | |
| 20 | Syncope | FAERS: 5 | US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 22 | Infusion Site Extravasation | FAERS: 4 | US FAERS | |
| 23 | Respiratory distress | FAERS: 4 | US FAERS | |
| 24 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 25 | Upper airway obstruction | FAERS: 4 | US FAERS | |
| 26 | Vomiting | FAERS: 4 | US FAERS | |
| 27 | Accidental overdose | FAERS: 3 | US FAERS | |
| 28 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 29 | Asthenia | FAERS: 3 | US FAERS | |
| 30 | Extravasation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 32 | Glossoptosis | FAERS: 3 | US FAERS | |
| 33 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 34 | No adverse event | FAERS: 3 | US FAERS | |
| 35 | Product closure issue | FAERS: 3 | US FAERS | |
| 36 | Product package associated injury | FAERS: 3 | US FAERS | |
| 37 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 38 | Sepsis | FAERS: 3 | US FAERS | |
| 39 | Somnolence | FAERS: 3 | US FAERS | |
| 40 | Therapy cessation | FAERS: 3 | US FAERS | |
| 41 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 42 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 43 | Cerebrovascular Insufficiency | FAERS: 2 | US FAERS | |
| 44 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 45 | Chest Pain | FAERS: 2 | US FAERS | |
| 46 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 47 | Eczema | FAERS: 2 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 49 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 50 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 51 | Malabsorption | FAERS: 2 | US FAERS | |
| 52 | Nasogastric output high | FAERS: 2 | US FAERS | |
| 53 | Peritonitis | FAERS: 2 | US FAERS | |
| 54 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 55 | Procedural complication | FAERS: 2 | US FAERS | |
| 56 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 57 | Product container issue | FAERS: 2 | US FAERS | |
| 58 | Product container seal issue | FAERS: 2 | US FAERS | |
| 59 | Restlessness | FAERS: 2 | US FAERS | |
| 60 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 61 | Swelling | FAERS: 2 | US FAERS | |
| 62 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 63 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 64 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 65 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 66 | Acidosis | FAERS: 1 | US FAERS | |
| 67 | Angioedema | FAERS: 1 | US FAERS | |
| 68 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 69 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 70 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 71 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 72 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 73 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 74 | Catheter site necrosis | FAERS: 1 | US FAERS | |
| 75 | Cellulitis | FAERS: 1 | US FAERS | |
| 76 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 77 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 78 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 79 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 80 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 81 | Cyanosis | FAERS: 1 | US FAERS | |
| 82 | Dermatitis | FAERS: 1 | US FAERS | |
| 83 | Device computer issue | FAERS: 1 | US FAERS | |
| 84 | Device related infection | FAERS: 1 | US FAERS | |
| 85 | Dizziness | FAERS: 1 | US FAERS | |
| 86 | Dose calculation error | FAERS: 1 | US FAERS | |
| 87 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 88 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 89 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 90 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 91 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 92 | Erythema | FAERS: 1 | US FAERS | |
| 93 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 94 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 95 | Hemiparesis | FAERS: 1 | US FAERS | |
| 96 | Hypersomnia | FAERS: 1 | US FAERS | |
| 97 | Hyperventilation | FAERS: 1 | US FAERS | |
| 98 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 99 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 100 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 101 | Implant site effusion | FAERS: 1 | US FAERS | |
| 102 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 103 | Infection | FAERS: 1 | US FAERS | |
| 104 | Infusion site discomfort | FAERS: 1 | US FAERS | |
| 105 | Infusion site irritation | FAERS: 1 | US FAERS | |
| 106 | Infusion site ulcer | FAERS: 1 | US FAERS | |
| 107 | Infusion site vesicles | FAERS: 1 | US FAERS | |
| 108 | Intestinal Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 109 | Laryngospasm | FAERS: 1 | US FAERS | |
| 110 | Lip swelling | FAERS: 1 | US FAERS | |
| 111 | Medication Error | FAERS: 1 | US FAERS | |
| 112 | Mental status changes | FAERS: 1 | US FAERS | |
| 113 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 114 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 115 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 116 | Mydriasis | FAERS: 1 | US FAERS | |
| 117 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 118 | Nausea | FAERS: 1 | US FAERS | |
| 119 | Nervousness | FAERS: 1 | US FAERS | |
| 120 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 121 | Overdose | FAERS: 1 | US FAERS | |
| 122 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 123 | Post procedural complication | FAERS: 1 | US FAERS | |
| 124 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 125 | Product packaging issue | FAERS: 1 | US FAERS | |
| 126 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 127 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 128 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 129 | Septic Shock | FAERS: 1 | US FAERS | |
| 130 | Shock | FAERS: 1 | US FAERS | |
| 131 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 132 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 133 | Staring | FAERS: 1 | US FAERS | |
| 134 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 135 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 136 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 137 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 138 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 139 | Tremor | FAERS: 1 | US FAERS | |
| 140 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 141 | Urinary Retention | FAERS: 1 | US FAERS | |
| 142 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 143 | Urticaria | FAERS: 1 | US FAERS | |
| 144 | Vascular graft complication | FAERS: 1 | US FAERS | |
| 145 | Vasculitis | FAERS: 1 | US FAERS | |
| 146 | Visual Impairment | FAERS: 1 | US FAERS | |
| 147 | jaundice | FAERS: 1 | US FAERS | |
| 148 | Drug ineffective for unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Infusion site swelling | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.