Bupivacaine
(SIEYLFHKZGLBNX-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C.Cl
- Molecular Formula:
- C18H29ClN2O
- Molecular Weight:
- 324.889
- Log P:
- 4.7094
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 14252-80-3; 15233-43-9; 18010-40-7
Synonym(s)
1.
Bupivacaine
2.
1-Butyl-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide
3.
Bupivacain Janapharm
4.
Bupivacain-RPR
5.
Bupivacaina Braun
6.
Bupivacaine Anhydrous
7.
Bupivacaine Carbonate
8.
Bupivacaine Hydrochloride
9.
Bupivacaine Monohydrochloride, Monohydrate
10.
Buvacaina
11.
Carbostesin
12.
Dolanaest
13.
Marcain
14.
Marcaine
15.
Sensorcaine
16.
Svedocain Sin Vasoconstr
17.
Bupivacain RPR
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 884 Canada Vigilance: 76 | Canada Vigilance US FAERS | |
| 2 | Activities of daily living impaired | FAERS: 71 | US FAERS | |
| 3 | Joint injury | FAERS: 69 | US FAERS | |
| 4 | Drug effect incomplete | FAERS: 56 | US FAERS | |
| 5 | Musculoskeletal Pain | FAERS: 32 | US FAERS | |
| 6 | Arthropathy | FAERS: 29 | US FAERS | |
| 7 | Cardiotoxicity | FAERS: 29 | US FAERS | |
| 8 | Pain | FAERS: 28 | US FAERS | |
| 9 | Musculoskeletal discomfort | FAERS: 26 | US FAERS | |
| 10 | Product quality issue | FAERS: 25 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 11 | Drug effect delayed | FAERS: 23 | US FAERS | |
| 12 | Product use in unapproved indication | FAERS: 23 | US FAERS | |
| 13 | Hypotension | FAERS: 21 | US FAERS | |
| 14 | Catheter site related reaction | FAERS: 15 | US FAERS | |
| 15 | Cardiac Arrest | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Toxicity to various agents | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Incorrect product storage | FAERS: 12 | US FAERS | |
| 18 | Joint Range of Motion Decreased | FAERS: 11 | US FAERS | |
| 19 | Arthralgia | FAERS: 9 | US FAERS | |
| 20 | Bradycardia | FAERS: 9 | US FAERS | |
| 21 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 22 | Emotional distress | FAERS: 7 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 24 | Product formulation issue | FAERS: 7 | US FAERS | |
| 25 | Erythema | FAERS: 6 | US FAERS | |
| 26 | No adverse event | FAERS: 6 | US FAERS | |
| 27 | Product closure issue | FAERS: 5 | US FAERS | |
| 28 | Product measured potency issue | FAERS: 5 | US FAERS | |
| 29 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 30 | Abasia | FAERS: 4 | US FAERS | |
| 31 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 32 | Discomfort | FAERS: 4 | US FAERS | |
| 33 | Drug toxicity | FAERS: 4 | US FAERS | |
| 34 | Electrocardiogram T wave peaked | FAERS: 4 | US FAERS | |
| 35 | Headache | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 37 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 38 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 39 | Nerve injury | FAERS: 4 | US FAERS | |
| 40 | Paraplegia | FAERS: 4 | US FAERS | |
| 41 | Procedural complication | FAERS: 4 | US FAERS | |
| 42 | Pruritus | FAERS: 4 | US FAERS | |
| 43 | Skin necrosis | FAERS: 4 | US FAERS | |
| 44 | Tachycardia | FAERS: 4 | US FAERS | |
| 45 | Anxiety | FAERS: 3 | US FAERS | |
| 46 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 47 | Laceration | FAERS: 3 | US FAERS | |
| 48 | Muscle tightness | FAERS: 3 | US FAERS | |
| 49 | Overdose | FAERS: 3 | US FAERS | |
| 50 | Product label issue | FAERS: 3 | US FAERS | |
| 51 | Product use issue | FAERS: 3 | US FAERS | |
| 52 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 53 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 54 | Shock | FAERS: 3 | US FAERS | |
| 55 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 56 | Vomiting | FAERS: 3 | US FAERS | |
| 57 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 58 | treatment failure | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 60 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 61 | Aphasia | FAERS: 2 | US FAERS | |
| 62 | Asthenia | FAERS: 2 | US FAERS | |
| 63 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 64 | Blindness | FAERS: 2 | US FAERS | |
| 65 | Catheter related complication | FAERS: 2 | US FAERS | |
| 66 | Cauda Equina Syndrome | FAERS: 2 | US FAERS | |
| 67 | Chest Pain | FAERS: 2 | US FAERS | |
| 68 | Dysgeusia | FAERS: 2 | US FAERS | |
| 69 | Flushing | FAERS: 2 | US FAERS | |
| 70 | Hypokinesia | FAERS: 2 | US FAERS | |
| 71 | Incision site pain | FAERS: 2 | US FAERS | |
| 72 | Injection site erythema | FAERS: 2 | US FAERS | |
| 73 | Lethargy | FAERS: 2 | US FAERS | |
| 74 | Medical device complication | FAERS: 2 | US FAERS | |
| 75 | Medication Error | FAERS: 2 | US FAERS | |
| 76 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 77 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 78 | Nausea | FAERS: 2 | US FAERS | |
| 79 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 80 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 81 | Product deposit | FAERS: 2 | US FAERS | |
| 82 | Restlessness | FAERS: 2 | US FAERS | |
| 83 | Skin irritation | FAERS: 2 | US FAERS | |
| 84 | Skin laceration | FAERS: 2 | US FAERS | |
| 85 | Somnolence | FAERS: 2 | US FAERS | |
| 86 | Strabismus | FAERS: 2 | US FAERS | |
| 87 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 88 | Urticaria | FAERS: 2 | US FAERS | |
| 89 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 90 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 91 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 92 | Accidental exposure | FAERS: 1 | US FAERS | |
| 93 | Administration site reaction | FAERS: 1 | US FAERS | |
| 94 | Agitation | FAERS: 1 | US FAERS | |
| 95 | Allergy test positive | FAERS: 1 | US FAERS | |
| 96 | Anhedonia | FAERS: 1 | US FAERS | |
| 97 | Aphonia | FAERS: 1 | US FAERS | |
| 98 | Arthritis | FAERS: 1 | US FAERS | |
| 99 | Atelectasis | FAERS: 1 | US FAERS | |
| 100 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 101 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 102 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 103 | Back Pain | FAERS: 1 | US FAERS | |
| 104 | Bedridden | FAERS: 1 | US FAERS | |
| 105 | Bladder pain | FAERS: 1 | US FAERS | |
| 106 | Bone pain | FAERS: 1 | US FAERS | |
| 107 | Burning sensation | FAERS: 1 | US FAERS | |
| 108 | Cardiac sarcoidosis | FAERS: 1 | US FAERS | |
| 109 | Cartilage injury | FAERS: 1 | US FAERS | |
| 110 | Cataract | FAERS: 1 | US FAERS | |
| 111 | Chondromalacia | FAERS: 1 | US FAERS | |
| 112 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 113 | Deafness | FAERS: 1 | US FAERS | |
| 114 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 115 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 116 | Device malfunction | FAERS: 1 | US FAERS | |
| 117 | Disorientation | FAERS: 1 | US FAERS | |
| 118 | Dizziness | FAERS: 1 | US FAERS | |
| 119 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 120 | Dry skin | FAERS: 1 | US FAERS | |
| 121 | Dysphonia | FAERS: 1 | US FAERS | |
| 122 | Economic problem | FAERS: 1 | US FAERS | |
| 123 | Expired product administered | FAERS: 1 | US FAERS | |
| 124 | Eye irritation | FAERS: 1 | US FAERS | |
| 125 | Eye pain | FAERS: 1 | US FAERS | |
| 126 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 127 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 128 | Fracture | FAERS: 1 | US FAERS | |
| 129 | Gaze palsy | FAERS: 1 | US FAERS | |
| 130 | Harlequin syndrome | FAERS: 1 | US FAERS | |
| 131 | Hyperacusis | FAERS: 1 | US FAERS | |
| 132 | Hypercapnia | FAERS: 1 | US FAERS | |
| 133 | Hypoxia | FAERS: 1 | US FAERS | |
| 134 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 135 | Infection | FAERS: 1 | US FAERS | |
| 136 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 137 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 138 | Injection site irritation | FAERS: 1 | US FAERS | |
| 139 | Injection site joint movement impairment | FAERS: 1 | US FAERS | |
| 140 | Injection site pain | FAERS: 1 | US FAERS | |
| 141 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 142 | Intra-abdominal pressure increased | FAERS: 1 | US FAERS | |
| 143 | Ligament rupture | FAERS: 1 | US FAERS | |
| 144 | Malaise | FAERS: 1 | US FAERS | |
| 145 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 146 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 147 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 148 | Meningitis | FAERS: 1 | US FAERS | |
| 149 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 150 | Mydriasis | FAERS: 1 | US FAERS | |
| 151 | Nerve Block | FAERS: 1 | US FAERS | |
| 152 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 153 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 154 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 155 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 156 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 157 | Procedural headache | FAERS: 1 | US FAERS | |
| 158 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 159 | Product container issue | FAERS: 1 | US FAERS | |
| 160 | Product contamination | FAERS: 1 | US FAERS | |
| 161 | Product label confusion | FAERS: 1 | US FAERS | |
| 162 | Product package associated injury | FAERS: 1 | US FAERS | |
| 163 | Product packaging issue | FAERS: 1 | US FAERS | |
| 164 | Product substitution issue | FAERS: 1 | US FAERS | |
| 165 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 166 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 167 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 168 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 169 | Sepsis | FAERS: 1 | US FAERS | |
| 170 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 171 | Spinal cord paralysis | FAERS: 1 | US FAERS | |
| 172 | Spinal haemangioma | FAERS: 1 | US FAERS | |
| 173 | Spinal shock | FAERS: 1 | US FAERS | |
| 174 | Spondylitis | FAERS: 1 | US FAERS | |
| 175 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 176 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 177 | Swelling | FAERS: 1 | US FAERS | |
| 178 | Synovitis | FAERS: 1 | US FAERS | |
| 179 | Systemic toxicity | FAERS: 1 | US FAERS | |
| 180 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 181 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 182 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 183 | Unevaluable event | FAERS: 1 | US FAERS | |
| 184 | Urinary Retention | FAERS: 1 | US FAERS | |
| 185 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 186 | Visual Impairment | FAERS: 1 | US FAERS | |
| 187 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 188 | Weight decreased | FAERS: 1 | US FAERS | |
| 189 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 190 | Pallor | Canada Vigilance: 1 | Canada Vigilance | |
| 191 | Palpitations | Canada Vigilance: 1 | Canada Vigilance | |
| 192 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 193 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 194 | Therapeutic product effect delayed | Canada Vigilance: 1 | Canada Vigilance | |
| 195 | Therapeutic product effect incomplete | Canada Vigilance: 9 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.