Umeclidinium bromide
(PEJHHXHHNGORMP-UHFFFAOYSA-M)
Structure
- SMILES
- OC(C12CC[N+](CC1)(CC2)CCOCc1ccccc1)(c1ccccc1)c1ccccc1.[Br-]
- Molecular Formula:
- C29H34BrNO2
- Molecular Weight:
- 508.490
- Log P:
- 2.1028
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 29.46
- CAS Number(s):
- 869113-09-7
Synonym(s)
1.
Umeclidinium bromide
External Link(s)
| PubChem Compound | 11519069 |
| ChEBI | 79040 |
| CHEMBL | CHEMBL523299 |
| KEGG | dr:D10181 |
| Therapeutic Target Database | D09ZOQ |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Wrong technique in device usage process | FAERS: 141 | US FAERS | |
| 2 | Drug dose omission | FAERS: 128 | US FAERS | |
| 3 | Device use error | FAERS: 97 | US FAERS | |
| 4 | Drug dispensing error | FAERS: 85 | US FAERS | |
| 5 | Product quality issue | FAERS: 70 | US FAERS | |
| 6 | Drug ineffective | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Wrong technique in product usage process | FAERS: 54 | US FAERS | |
| 8 | Product dose omission | FAERS: 40 | US FAERS | |
| 9 | Product complaint | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Urinary Retention | FAERS: 25 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 11 | Product use in unapproved indication | FAERS: 24 | US FAERS | |
| 12 | Dysgeusia | FAERS: 22 | US FAERS | |
| 13 | Product label confusion | FAERS: 19 | US FAERS | |
| 14 | Product dispensing error | FAERS: 18 | US FAERS | |
| 15 | Dizziness | FAERS: 16 | US FAERS | |
| 16 | Circumstance or information capable of leading to medication error | FAERS: 15 | US FAERS | |
| 17 | Malaise | FAERS: 15 | US FAERS | |
| 18 | Productive Cough | FAERS: 14 | US FAERS | |
| 19 | Extra dose administered | FAERS: 13 | US FAERS | |
| 20 | Pneumonia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Product storage error | FAERS: 12 | US FAERS | |
| 22 | Choking | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Intentional product misuse | FAERS: 11 | US FAERS | |
| 24 | Headache | FAERS: 10 | US FAERS | |
| 25 | Medication Error | FAERS: 10 | US FAERS | |
| 26 | Overdose | FAERS: 10 | US FAERS | |
| 27 | Product packaging confusion | FAERS: 10 | US FAERS | |
| 28 | Chest Pain | FAERS: 9 | US FAERS | |
| 29 | Nausea | FAERS: 9 | US FAERS | |
| 30 | Expired product administered | FAERS: 8 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 32 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 33 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 34 | Wheezing | FAERS: 8 | US FAERS | |
| 35 | Asthma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Chest discomfort | FAERS: 7 | US FAERS | |
| 37 | Dysphonia | FAERS: 7 | US FAERS | |
| 38 | Fatigue | FAERS: 7 | US FAERS | |
| 39 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 40 | Myalgia | FAERS: 7 | US FAERS | |
| 41 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 42 | Palpitations | FAERS: 7 | US FAERS | |
| 43 | Retching | FAERS: 7 | US FAERS | |
| 44 | Throat irritation | FAERS: 7 | US FAERS | |
| 45 | Vomiting | FAERS: 7 | US FAERS | |
| 46 | Choking sensation | FAERS: 6 | US FAERS | |
| 47 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 49 | Pain | FAERS: 6 | US FAERS | |
| 50 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 51 | Pruritus | FAERS: 6 | US FAERS | |
| 52 | Urticaria | FAERS: 6 | US FAERS | |
| 53 | Visual Impairment | FAERS: 6 | US FAERS | |
| 54 | Accidental exposure to product packaging | FAERS: 5 | US FAERS | |
| 55 | Arthralgia | FAERS: 5 | US FAERS | |
| 56 | Asthenia | FAERS: 5 | US FAERS | |
| 57 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 58 | Glaucoma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Inability to afford medication | FAERS: 5 | US FAERS | |
| 60 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 61 | Oral pain | FAERS: 5 | US FAERS | |
| 62 | Peripheral swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Prescribed overdose | FAERS: 5 | US FAERS | |
| 64 | Product use issue | FAERS: 5 | US FAERS | |
| 65 | Tremor | FAERS: 5 | US FAERS | |
| 66 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 67 | Accidental overdose | FAERS: 4 | US FAERS | |
| 68 | Adverse event | FAERS: 4 | US FAERS | |
| 69 | Anxiety | FAERS: 4 | US FAERS | |
| 70 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 71 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 72 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 73 | Dysuria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Memory impairment | FAERS: 4 | US FAERS | |
| 75 | Product availability issue | FAERS: 4 | US FAERS | |
| 76 | Toothache | FAERS: 4 | US FAERS | |
| 77 | Alopecia | FAERS: 3 | US FAERS | |
| 78 | Back Pain | FAERS: 3 | US FAERS | |
| 79 | Eye pain | FAERS: 3 | US FAERS | |
| 80 | Foreign body aspiration | FAERS: 3 | US FAERS | |
| 81 | Intercepted drug prescribing error | FAERS: 3 | US FAERS | |
| 82 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 83 | Joint swelling | FAERS: 3 | US FAERS | |
| 84 | Tachycardia | FAERS: 3 | US FAERS | |
| 85 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 86 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 87 | Amnesia | FAERS: 2 | US FAERS | |
| 88 | Anuria | FAERS: 2 | US FAERS | |
| 89 | Aphonia | FAERS: 2 | US FAERS | |
| 90 | Blindness | FAERS: 2 | US FAERS | |
| 91 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 92 | Bronchitis | FAERS: 2 | US FAERS | |
| 93 | Burning sensation | FAERS: 2 | US FAERS | |
| 94 | Cataract | FAERS: 2 | US FAERS | |
| 95 | Constipation | FAERS: 2 | US FAERS | |
| 96 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 97 | Dental caries | FAERS: 2 | US FAERS | |
| 98 | Disorientation | FAERS: 2 | US FAERS | |
| 99 | Emotional distress | FAERS: 2 | US FAERS | |
| 100 | Erythema | FAERS: 2 | US FAERS | |
| 101 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 102 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 103 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 104 | Intercepted drug administration error | FAERS: 2 | US FAERS | |
| 105 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 106 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 107 | Lower respiratory tract congestion | FAERS: 2 | US FAERS | |
| 108 | Medication residue present | FAERS: 2 | US FAERS | |
| 109 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 110 | Nervousness | FAERS: 2 | US FAERS | |
| 111 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 112 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 113 | Product contamination physical | FAERS: 2 | US FAERS | |
| 114 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 115 | Therapeutic product effect incomplete | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Therapy cessation | FAERS: 2 | US FAERS | |
| 117 | Throat clearing | FAERS: 2 | US FAERS | |
| 118 | Thrombosis | FAERS: 2 | US FAERS | |
| 119 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 120 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 121 | Accidental underdose | FAERS: 1 | US FAERS | |
| 122 | Aneurysm | FAERS: 1 | US FAERS | |
| 123 | Anger | FAERS: 1 | US FAERS | |
| 124 | Angioedema | FAERS: 1 | US FAERS | |
| 125 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 126 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 127 | Ascites | FAERS: 1 | US FAERS | |
| 128 | Asphyxia | FAERS: 1 | US FAERS | |
| 129 | Atrial Flutter | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Bedridden | FAERS: 1 | US FAERS | |
| 131 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 132 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 133 | Breast tenderness | FAERS: 1 | US FAERS | |
| 134 | Bronchospasm | FAERS: 1 | US FAERS | |
| 135 | Cheilitis | FAERS: 1 | US FAERS | |
| 136 | Chills | FAERS: 1 | US FAERS | |
| 137 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 138 | Coating in mouth | FAERS: 1 | US FAERS | |
| 139 | Colitis | FAERS: 1 | US FAERS | |
| 140 | Dehydration | FAERS: 1 | US FAERS | |
| 141 | Dental Plaque | FAERS: 1 | US FAERS | |
| 142 | Device malfunction | FAERS: 1 | US FAERS | |
| 143 | Diplopia | FAERS: 1 | US FAERS | |
| 144 | Discomfort | FAERS: 1 | US FAERS | |
| 145 | Disease complication | FAERS: 1 | US FAERS | |
| 146 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 147 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 148 | Dry skin | FAERS: 1 | US FAERS | |
| 149 | Dyspepsia | FAERS: 1 | US FAERS | |
| 150 | Enteritis | FAERS: 1 | US FAERS | |
| 151 | Epistaxis | FAERS: 1 | US FAERS | |
| 152 | Eructation | FAERS: 1 | US FAERS | |
| 153 | Feeling jittery | FAERS: 1 | US FAERS | |
| 154 | Flatulence | FAERS: 1 | US FAERS | |
| 155 | Flushing | FAERS: 1 | US FAERS | |
| 156 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 157 | Gingival erythema | FAERS: 1 | US FAERS | |
| 158 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 159 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 160 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 161 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 162 | Hyperventilation | FAERS: 1 | US FAERS | |
| 163 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 164 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 165 | Impaired work ability | FAERS: 1 | US FAERS | |
| 166 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 167 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 168 | Infection | FAERS: 1 | US FAERS | |
| 169 | Inflammation | FAERS: 1 | US FAERS | |
| 170 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 171 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 172 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 173 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 174 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 175 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 176 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 177 | Laryngitis | FAERS: 1 | US FAERS | |
| 178 | Lip swelling | FAERS: 1 | US FAERS | |
| 179 | Lung neoplasm surgery | FAERS: 1 | US FAERS | |
| 180 | Lung volume reduction surgery | FAERS: 1 | US FAERS | |
| 181 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 182 | Mechanical ileus | FAERS: 1 | US FAERS | |
| 183 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 184 | Mouth swelling | FAERS: 1 | US FAERS | |
| 185 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 186 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 187 | Nocturia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 189 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 190 | Oliguria | FAERS: 1 | US FAERS | |
| 191 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 192 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 193 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 194 | Pharyngitis | FAERS: 1 | US FAERS | |
| 195 | Physical assault | FAERS: 1 | US FAERS | |
| 196 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 197 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 198 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 199 | Presyncope | FAERS: 1 | US FAERS | |
| 200 | Product design confusion | FAERS: 1 | US FAERS | |
| 201 | Product name confusion | FAERS: 1 | US FAERS | |
| 202 | Product residue present | FAERS: 1 | US FAERS | |
| 203 | Product tampering | FAERS: 1 | US FAERS | |
| 204 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 205 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 206 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 207 | Rash erythematous | FAERS: 1 | US FAERS | |
| 208 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 209 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 210 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 211 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 212 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 213 | Rhinitis | FAERS: 1 | US FAERS | |
| 214 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 215 | Shock | FAERS: 1 | US FAERS | |
| 216 | Skin Induration | FAERS: 1 | US FAERS | |
| 217 | Sneezing | FAERS: 1 | US FAERS | |
| 218 | Stomatitis | FAERS: 1 | US FAERS | |
| 219 | Swelling | FAERS: 1 | US FAERS | |
| 220 | Syncope | FAERS: 1 | US FAERS | |
| 221 | Thermal burn | FAERS: 1 | US FAERS | |
| 222 | Throat cancer | FAERS: 1 | US FAERS | |
| 223 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 224 | Transient lingual papillitis | FAERS: 1 | US FAERS | |
| 225 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 226 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 227 | colonoscopy | FAERS: 1 | US FAERS | |
| 228 | muscle injury | FAERS: 1 | US FAERS | |
| 229 | prostatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.