ezogabine
(PCOBBVZJEWWZFR-UHFFFAOYSA-N)
Structure
- SMILES
- CCOC(=O)Nc1ccc(cc1N)NCc1ccc(cc1)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- N03AX21
- Molecular Formula:
- C16H18FN3O2
- Molecular Weight:
- 303.331
- Log P:
- 4.3156
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 76.38
- CAS Number(s):
- 150812-12-7
Synonym(s)
1.
ezogabine
2.
D 20443
3.
D 23129
4.
D-20443
5.
D-23129
6.
N-(2-amino-4-(4-fluorobenzylamino)phenyl)carbamic acid ethyl ester
7.
Potiga
8.
ethyl N-(2-amino-4-(4-fluorobenzylamino)phenyl)carbamate hydrochloride
9.
retigabine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urinary Retention | FAERS: 30 | SIDER US FAERS | |
| 2 | Retinal pigmentation | FAERS: 28 | US FAERS | |
| 3 | Epilepsy | FAERS: 16 | US FAERS | |
| 4 | Drug ineffective | FAERS: 15 | US FAERS | |
| 5 | Aphasia | FAERS: 8 | SIDER US FAERS | |
| 6 | Chromaturia | FAERS: 8 | SIDER US FAERS | |
| 7 | Catheter placement | FAERS: 6 | US FAERS | |
| 8 | Dizziness | FAERS: 6 | SIDER US FAERS | |
| 9 | Dysuria | FAERS: 6 | SIDER US FAERS | |
| 10 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 11 | Neutropenia | FAERS: 5 | SIDER US FAERS | |
| 12 | Retinal Degeneration | FAERS: 5 | US FAERS | |
| 13 | Urinary hesitation | FAERS: 5 | SIDER US FAERS | |
| 14 | Ataxia | FAERS: 4 | US FAERS | |
| 15 | Retinal depigmentation | FAERS: 4 | US FAERS | |
| 16 | Somnolence | FAERS: 4 | SIDER US FAERS | |
| 17 | Anxiety | FAERS: 3 | SIDER US FAERS | |
| 18 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 19 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 20 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 21 | Adverse event | FAERS: 2 | US FAERS | |
| 22 | Back Pain | FAERS: 2 | US FAERS | |
| 23 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 24 | Disorientation | FAERS: 2 | SIDER US FAERS | |
| 25 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 26 | Euphoric mood | FAERS: 2 | SIDER US FAERS | |
| 27 | Fatigue | FAERS: 2 | SIDER US FAERS | |
| 28 | Hypotension | FAERS: 2 | US FAERS | |
| 29 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 30 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 31 | Macular pigmentation | FAERS: 2 | US FAERS | |
| 32 | Palpitations | FAERS: 2 | US FAERS | |
| 33 | Personality Change | FAERS: 2 | US FAERS | |
| 34 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 35 | Product use issue | FAERS: 2 | US FAERS | |
| 36 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 37 | Visual Impairment | FAERS: 2 | SIDER US FAERS | |
| 38 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 39 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 40 | Agitation | FAERS: 1 | US FAERS | |
| 41 | Angioedema | FAERS: 1 | US FAERS | |
| 42 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 43 | Blepharospasm | FAERS: 1 | US FAERS | |
| 44 | Blindness | FAERS: 1 | US FAERS | |
| 45 | Cataract | FAERS: 1 | US FAERS | |
| 46 | Cellulitis | FAERS: 1 | US FAERS | |
| 47 | Chest Pain | FAERS: 1 | US FAERS | |
| 48 | Chills | FAERS: 1 | US FAERS | |
| 49 | Completed Suicide | FAERS: 1 | US FAERS | |
| 50 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 51 | Conjunctival pigmentation | FAERS: 1 | US FAERS | |
| 52 | Delirium | FAERS: 1 | US FAERS | |
| 53 | Diphtheria | FAERS: 1 | US FAERS | |
| 54 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 55 | Drug administration error | FAERS: 1 | US FAERS | |
| 56 | Drug withdrawal convulsions | FAERS: 1 | SIDER US FAERS | |
| 57 | Dysarthria | FAERS: 1 | SIDER US FAERS | |
| 58 | Epileptic psychosis | FAERS: 1 | US FAERS | |
| 59 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 60 | Extra dose administered | FAERS: 1 | US FAERS | |
| 61 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 62 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 63 | Headache | FAERS: 1 | US FAERS | |
| 64 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 65 | Mental impairment | FAERS: 1 | US FAERS | |
| 66 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 67 | Myoclonus | FAERS: 1 | SIDER US FAERS | |
| 68 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 69 | Nausea | FAERS: 1 | SIDER US FAERS | |
| 70 | Nephrolithiasis | FAERS: 1 | SIDER US FAERS | |
| 71 | Overdose | FAERS: 1 | US FAERS | |
| 72 | Pallor | FAERS: 1 | US FAERS | |
| 73 | Pancreatitis | FAERS: 1 | US FAERS | |
| 74 | Pneumonia | FAERS: 1 | US FAERS | |
| 75 | Product preparation error | FAERS: 1 | US FAERS | |
| 76 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 77 | Psychiatric symptom | FAERS: 1 | SIDER US FAERS | |
| 78 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 79 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 80 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 81 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 82 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 83 | Sluggishness | FAERS: 1 | US FAERS | |
| 84 | Somnambulism | FAERS: 1 | US FAERS | |
| 85 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 86 | Syncope | FAERS: 1 | SIDER US FAERS | |
| 87 | Therapy cessation | FAERS: 1 | US FAERS | |
| 88 | Urticaria | FAERS: 1 | US FAERS | |
| 89 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 90 | Weight decreased | FAERS: 1 | US FAERS | |
| 91 | intensive care | FAERS: 1 | US FAERS | |
| 92 | Alopecia | SIDER | ||
| 93 | Amnesia | SIDER | ||
| 94 | Asthenia | SIDER | ||
| 95 | Constipation | SIDER | ||
| 96 | Dermatitis | SIDER | ||
| 97 | Developmental Disabilities | 27602407 | CTD | |
| 98 | Diplopia | SIDER | ||
| 99 | Dyspepsia | SIDER | ||
| 100 | Dysphasia | SIDER | ||
| 101 | Feeling abnormal | SIDER | ||
| 102 | Hyperalgesia | 26227020 | CTD | |
| 103 | Hypokinesia | SIDER | ||
| 104 | Infection | SIDER | ||
| 105 | Infestation | SIDER | ||
| 106 | Influenza | SIDER | ||
| 107 | Leukopenia | SIDER | ||
| 108 | Long QT Syndrome | 28641963 | CTD | |
| 109 | Malaise | SIDER | ||
| 110 | Malnutrition | SIDER | ||
| 111 | Memory impairment | SIDER | ||
| 112 | Mobility Limitation | 29803855 | CTD | |
| 113 | Nystagmus | SIDER | ||
| 114 | Pain | 12559370 | CTD | |
| 115 | Renal Colic | SIDER | ||
| 116 | Retinal Diseases | 26909536 | CTD | |
| 117 | Seizures | CTD | ||
| 118 | Shock | SIDER | ||
| 119 | Thrombocytopenia | SIDER | ||
| 120 | Tremor | SIDER | ||
| 121 | Urination Disorders | 15540788 | CTD | |
| 122 | Vertigo | SIDER | ||
| 123 | Withdrawal seizures | SIDER | ||
| 124 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.