Diphenhydramine
(PCHPORCSPXIHLZ-UHFFFAOYSA-N)
Structure
- SMILES
- CN(CCOC(c1ccccc1)c1ccccc1)C.Cl
- Molecular Formula:
- C17H22ClNO
- Molecular Weight:
- 291.816
- Log P:
- 4.1562
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 12.47
- CAS Number(s):
- 147-24-0; 8052-21-9
Synonym(s)
1.
Diphenhydramine
2.
Benhydramin
3.
Diphenylhydramin
4.
2-Diphenylmethoxy-N,N-dimethylethylamine
5.
Allerdryl
6.
Benadryl
7.
Benylin
8.
Benzhydramine
9.
Dimedrol
10.
Diphenhydramine Citrate
11.
Diphenhydramine Citrate (1:1)
12.
Diphenhydramine Hydrochloride
13.
Diphenylhydramine
14.
Dormin
15.
Citrate, Diphenhydramine
16.
Hydrochloride, Diphenhydramine
External Link(s)
| MeSH | D004155 |
| PubChem Compound | 8980 657365 43833360 |
| ChEBI | 4637 |
| CHEMBL | CHEMBL1620 |
| KEGG | cpd:C07784 dr:D00669 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Completed Suicide | FAERS: 99 | US FAERS | |
| 2 | Overdose | FAERS: 79 | US FAERS | |
| 3 | Toxicity to various agents | FAERS: 72 | US FAERS | |
| 4 | Drug toxicity | FAERS: 39 | US FAERS | |
| 5 | Suicide attempt | FAERS: 37 | US FAERS | |
| 6 | Cardiac Arrest | FAERS: 36 | US FAERS | |
| 7 | Accidental overdose | FAERS: 29 | US FAERS | |
| 8 | Tachycardia | FAERS: 28 | US FAERS | |
| 9 | Sinus Tachycardia | FAERS: 24 | US FAERS | |
| 10 | Agitation | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Incorrect dose administered | FAERS: 21 | US FAERS | |
| 12 | Hypotension | FAERS: 20 | US FAERS | |
| 13 | Respiratory arrest | FAERS: 20 | US FAERS | |
| 14 | Somnolence | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Mental status changes | FAERS: 17 | US FAERS | |
| 16 | Status Epilepticus | FAERS: 16 | US FAERS | |
| 17 | Vomiting | FAERS: 16 | US FAERS | |
| 18 | Drug abuse | FAERS: 15 | US FAERS | |
| 19 | Mydriasis | FAERS: 15 | US FAERS | |
| 20 | Drug ineffective | FAERS: 14 | US FAERS | |
| 21 | Urinary Retention | FAERS: 14 | US FAERS | |
| 22 | Delirium | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Depressed Level of Consciousness | FAERS: 13 | US FAERS | |
| 24 | Anxiety | FAERS: 12 | US FAERS | |
| 25 | Unresponsive to stimuli | FAERS: 12 | US FAERS | |
| 26 | Dry skin | FAERS: 11 | US FAERS | |
| 27 | Flushing | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Metabolic acidosis | FAERS: 11 | US FAERS | |
| 29 | Rhabdomyolysis | FAERS: 11 | US FAERS | |
| 30 | Anticholinergic Syndrome | FAERS: 10 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 32 | Bradycardia | FAERS: 9 | US FAERS | |
| 33 | Drug Dependence | FAERS: 9 | US FAERS | |
| 34 | Nystagmus | FAERS: 9 | US FAERS | |
| 35 | Visceral congestion | FAERS: 9 | US FAERS | |
| 36 | Accidental exposure | FAERS: 8 | US FAERS | |
| 37 | Dizziness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Intentional drug misuse | FAERS: 8 | US FAERS | |
| 39 | Tremor | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Accidental drug intake by child | FAERS: 7 | US FAERS | |
| 41 | Erythema | FAERS: 7 | US FAERS | |
| 42 | Lethargy | FAERS: 7 | US FAERS | |
| 43 | Muscle Rigidity | FAERS: 7 | US FAERS | |
| 44 | Nausea | FAERS: 7 | US FAERS | |
| 45 | Palpitations | FAERS: 7 | US FAERS | |
| 46 | Urticaria | FAERS: 7 | US FAERS | |
| 47 | Dysarthria | FAERS: 6 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 49 | Headache | FAERS: 6 | US FAERS | |
| 50 | Intentional misuse | FAERS: 6 | US FAERS | |
| 51 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 52 | Pulmonary congestion | FAERS: 6 | US FAERS | |
| 53 | Shock | FAERS: 6 | US FAERS | |
| 54 | Accidental exposure to product by child | FAERS: 5 | US FAERS | |
| 55 | Amnesia | FAERS: 5 | US FAERS | |
| 56 | Drug level increased | FAERS: 5 | US FAERS | |
| 57 | Fatigue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Hyperreflexia | FAERS: 5 | US FAERS | |
| 59 | No adverse event | FAERS: 5 | US FAERS | |
| 60 | Product quality issue | FAERS: 5 | US FAERS | |
| 61 | Restlessness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 63 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 64 | Burning sensation | FAERS: 4 | US FAERS | |
| 65 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 66 | Myoclonus | FAERS: 4 | US FAERS | |
| 67 | Pain | FAERS: 4 | US FAERS | |
| 68 | Phlebitis | FAERS: 4 | US FAERS | |
| 69 | Product substitution issue | FAERS: 4 | US FAERS | |
| 70 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 71 | Restless Legs Syndrome | FAERS: 4 | US FAERS | |
| 72 | Sudden onset of sleep | FAERS: 4 | US FAERS | |
| 73 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 74 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 75 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 76 | Brain Death | FAERS: 3 | US FAERS | |
| 77 | Crying | FAERS: 3 | US FAERS | |
| 78 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 79 | Dehydration | FAERS: 3 | US FAERS | |
| 80 | Discomfort | FAERS: 3 | US FAERS | |
| 81 | Disorientation | FAERS: 3 | US FAERS | |
| 82 | Drug screen positive | FAERS: 3 | US FAERS | |
| 83 | Expired drug administered | FAERS: 3 | US FAERS | |
| 84 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 85 | Glaucoma | FAERS: 3 | US FAERS | |
| 86 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 87 | Incoherent | FAERS: 3 | US FAERS | |
| 88 | Malaise | FAERS: 3 | US FAERS | |
| 89 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 90 | Medication Error | FAERS: 3 | US FAERS | |
| 91 | Middle insomnia | FAERS: 3 | US FAERS | |
| 92 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 93 | Polydipsia | FAERS: 3 | US FAERS | |
| 94 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 95 | Pruritus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 97 | Thirst | FAERS: 3 | US FAERS | |
| 98 | Weight decreased | FAERS: 3 | US FAERS | |
| 99 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 100 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 101 | Anuria | FAERS: 2 | US FAERS | |
| 102 | Aphasia | FAERS: 2 | US FAERS | |
| 103 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 104 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 105 | Chest discomfort | FAERS: 2 | US FAERS | |
| 106 | Chromaturia | FAERS: 2 | US FAERS | |
| 107 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 108 | Cold sweat | FAERS: 2 | US FAERS | |
| 109 | Cyanosis | FAERS: 2 | US FAERS | |
| 110 | Dependence | FAERS: 2 | US FAERS | |
| 111 | Depressed mood | FAERS: 2 | US FAERS | |
| 112 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 113 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 114 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 115 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 116 | Dysphonia | FAERS: 2 | US FAERS | |
| 117 | Dystonia | FAERS: 2 | US FAERS | |
| 118 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 119 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 120 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 121 | Euphoric mood | FAERS: 2 | US FAERS | |
| 122 | Expired product administered | FAERS: 2 | US FAERS | |
| 123 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 2 | US FAERS | |
| 124 | Formication | FAERS: 2 | US FAERS | |
| 125 | Homicide | FAERS: 2 | US FAERS | |
| 126 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 127 | Hypersomnia | FAERS: 2 | US FAERS | |
| 128 | Infusion site pain | FAERS: 2 | US FAERS | |
| 129 | Joint swelling | FAERS: 2 | US FAERS | |
| 130 | Laceration | FAERS: 2 | US FAERS | |
| 131 | Lip swelling | FAERS: 2 | US FAERS | |
| 132 | Memory impairment | FAERS: 2 | US FAERS | |
| 133 | Mental impairment | FAERS: 2 | US FAERS | |
| 134 | Pain of skin | FAERS: 2 | US FAERS | |
| 135 | Paranoia | FAERS: 2 | US FAERS | |
| 136 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 137 | Product label issue | FAERS: 2 | US FAERS | |
| 138 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 139 | Skeletal injury | FAERS: 2 | US FAERS | |
| 140 | Staring | FAERS: 2 | US FAERS | |
| 141 | Stupor | FAERS: 2 | US FAERS | |
| 142 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 143 | Tinnitus | FAERS: 2 | US FAERS | |
| 144 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 145 | Vertigo | FAERS: 2 | US FAERS | |
| 146 | Victim of homicide | FAERS: 2 | US FAERS | |
| 147 | Abasia | FAERS: 1 | US FAERS | |
| 148 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 149 | Abdominal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Abdominal mass | FAERS: 1 | US FAERS | |
| 151 | Acidosis | FAERS: 1 | US FAERS | |
| 152 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 153 | Agonal rhythm | FAERS: 1 | US FAERS | |
| 154 | Akathisia | FAERS: 1 | US FAERS | |
| 155 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 156 | Anion Gap | FAERS: 1 | US FAERS | |
| 157 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 158 | Application site pain | FAERS: 1 | US FAERS | |
| 159 | Application site scab | FAERS: 1 | US FAERS | |
| 160 | Arthropod sting | FAERS: 1 | US FAERS | |
| 161 | Ataxia | FAERS: 1 | US FAERS | |
| 162 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 163 | Back Pain | FAERS: 1 | US FAERS | |
| 164 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 165 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 166 | Blood Pressure | FAERS: 1 | US FAERS | |
| 167 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 168 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 169 | Blood creatine phosphokinase | FAERS: 1 | US FAERS | |
| 170 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 171 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 172 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 173 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 174 | Bronchitis | FAERS: 1 | US FAERS | |
| 175 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 176 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 177 | Cataplexy | FAERS: 1 | US FAERS | |
| 178 | Catheter site inflammation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Chest Pain | FAERS: 1 | US FAERS | |
| 180 | Cholestasis | FAERS: 1 | US FAERS | |
| 181 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 182 | Device computer issue | FAERS: 1 | US FAERS | |
| 183 | Drooling | FAERS: 1 | US FAERS | |
| 184 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 185 | Drug administration error | FAERS: 1 | US FAERS | |
| 186 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 187 | Dysgeusia | FAERS: 1 | US FAERS | |
| 188 | Dysuria | FAERS: 1 | US FAERS | |
| 189 | Ear discomfort | FAERS: 1 | US FAERS | |
| 190 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 191 | Epilepsy | FAERS: 1 | US FAERS | |
| 192 | Excoriation | FAERS: 1 | US FAERS | |
| 193 | Eye pain | FAERS: 1 | US FAERS | |
| 194 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 195 | Feeling Cold | FAERS: 1 | US FAERS | |
| 196 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 197 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 198 | Gaze palsy | FAERS: 1 | US FAERS | |
| 199 | Glossitis | FAERS: 1 | US FAERS | |
| 200 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 201 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 202 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 203 | Hepatitis | FAERS: 1 | US FAERS | |
| 204 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 205 | Hypophagia | FAERS: 1 | US FAERS | |
| 206 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 207 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 208 | Ileus | FAERS: 1 | US FAERS | |
| 209 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 210 | Impaired work ability | FAERS: 1 | US FAERS | |
| 211 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 212 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 213 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 214 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 215 | Inflammation | FAERS: 1 | US FAERS | |
| 216 | Initial insomnia | FAERS: 1 | US FAERS | |
| 217 | Injection site pain | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 218 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 219 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 220 | Intentional self-injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 222 | Leukocytosis | FAERS: 1 | US FAERS | |
| 223 | Lipase increased | FAERS: 1 | US FAERS | |
| 224 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 225 | Liver palpable | FAERS: 1 | US FAERS | |
| 226 | Lividity | FAERS: 1 | US FAERS | |
| 227 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 228 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 229 | Mood swings | FAERS: 1 | US FAERS | |
| 230 | Mouth plaque | FAERS: 1 | US FAERS | |
| 231 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 232 | Myalgia | FAERS: 1 | US FAERS | |
| 233 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 234 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 235 | Nervousness | FAERS: 1 | US FAERS | |
| 236 | Neuralgia | FAERS: 1 | US FAERS | |
| 237 | Neutropenia | FAERS: 1 | US FAERS | |
| 238 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 239 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 240 | Ocular icterus | FAERS: 1 | US FAERS | |
| 241 | Opiates positive | FAERS: 1 | US FAERS | |
| 242 | Oral pain | FAERS: 1 | US FAERS | |
| 243 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 244 | PO2 increased | FAERS: 1 | US FAERS | |
| 245 | Pallor | FAERS: 1 | US FAERS | |
| 246 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 247 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 248 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 249 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 250 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 251 | Postmortem blood drug level increased | FAERS: 1 | US FAERS | |
| 252 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 253 | Product container seal issue | FAERS: 1 | US FAERS | |
| 254 | Product contamination | FAERS: 1 | US FAERS | |
| 255 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 256 | Product contamination physical | FAERS: 1 | US FAERS | |
| 257 | Product formulation issue | FAERS: 1 | US FAERS | |
| 258 | Product lot number issue | FAERS: 1 | US FAERS | |
| 259 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 260 | Product packaging issue | FAERS: 1 | US FAERS | |
| 261 | Product tampering | FAERS: 1 | US FAERS | |
| 262 | Product use issue | FAERS: 1 | US FAERS | |
| 263 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 264 | Rash erythematous | FAERS: 1 | US FAERS | |
| 265 | Rebound effect | FAERS: 1 | US FAERS | |
| 266 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 267 | Respiratory distress | FAERS: 1 | US FAERS | |
| 268 | Rhinalgia | FAERS: 1 | US FAERS | |
| 269 | Skin laceration | FAERS: 1 | US FAERS | |
| 270 | Sluggishness | FAERS: 1 | US FAERS | |
| 271 | Stillbirth | FAERS: 1 | US FAERS | |
| 272 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 273 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 274 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 275 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 276 | Transcription medication error | FAERS: 1 | US FAERS | |
| 277 | Troponin increased | FAERS: 1 | US FAERS | |
| 278 | Unevaluable event | FAERS: 1 | US FAERS | |
| 279 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 280 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 281 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 282 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 283 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 284 | Victim of chemical submission | FAERS: 1 | US FAERS | |
| 285 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 286 | Visual Impairment | FAERS: 1 | US FAERS | |
| 287 | jaundice | FAERS: 1 | US FAERS | |
| 288 | muscle injury | FAERS: 1 | US FAERS | |
| 289 | pH urine decreased | FAERS: 1 | US FAERS | |
| 290 | skin abrasion | FAERS: 1 | US FAERS | |
| 291 | Catheter site irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 292 | Injection site erythema | Canada Vigilance: 4 | Canada Vigilance | |
| 293 | Injection site warmth | Canada Vigilance: 1 | Canada Vigilance | |
| 294 | Instillation site warmth | Canada Vigilance: 1 | Canada Vigilance | |
| 295 | Swelling | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.