Formoterol Fumarate
(OBRNDARFFFHCGE-PERKLWIXSA-N)
Structure
- SMILES
- OC(=O)/C=C/C(=O)O.O=CNc1cc(ccc1O)[C@@H](CN[C@H](Cc1ccc(cc1)OC)C)O.O=CNc1cc(ccc1O)[C@@H](CN[C@H](Cc1ccc(cc1)OC)C)O
- Molecular Formula:
- C42H52N4O12
- Molecular Weight:
- 804.882
- Log P:
- 6.3580
- Hydrogen Bond Acceptor:
- 16
- Hydrogen Bond Donor:
- 10
- TPSA:
- 256.24
- CAS Number(s):
- 43229-80-7
Synonym(s)
1.
Formoterol Fumarate
2.
3-Formylamino-4-hydroxy-alpha-(N-1-methyl-2-p-methoxyphenethylaminomethyl)benzyl alcohol.hemifumarate
3.
Arformoterol
4.
BD 40A
5.
Eformoterol
6.
Foradil
7.
Formoterol
8.
Formoterol Fumarate, ((R*,R*)-(+-))-isomer
9.
Formoterol, ((R*,R*)-(+-))-isomer
10.
Oxis
External Link(s)
| MeSH | D000068759 |
| PubChem Compound | 9832292 |
| ChEBI | 63109 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthma | FAERS: 35 | CTD US FAERS | |
| 2 | Pneumonia | FAERS: 29 | 20826145 | CTD US FAERS |
| 3 | Malaise | FAERS: 28 | US FAERS | |
| 4 | Fatigue | FAERS: 22 | US FAERS | |
| 5 | Device malfunction | FAERS: 16 | US FAERS | |
| 6 | Bronchitis | FAERS: 12 | US FAERS | |
| 7 | Influenza | FAERS: 11 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 10 | US FAERS | |
| 9 | Respiratory Failure | FAERS: 10 | US FAERS | |
| 10 | Wrong technique in drug usage process | FAERS: 10 | US FAERS | |
| 11 | Infarction | FAERS: 9 | US FAERS | |
| 12 | Syncope | FAERS: 9 | US FAERS | |
| 13 | Tremor | FAERS: 9 | 10516540 | CTD US FAERS |
| 14 | Asthenia | FAERS: 8 | US FAERS | |
| 15 | Chest Pain | FAERS: 8 | US FAERS | |
| 16 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 17 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 18 | Increased bronchial secretion | FAERS: 6 | US FAERS | |
| 19 | Dizziness | FAERS: 5 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 21 | Headache | FAERS: 5 | US FAERS | |
| 22 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 23 | Memory impairment | FAERS: 5 | US FAERS | |
| 24 | Nervousness | FAERS: 5 | US FAERS | |
| 25 | Pain | FAERS: 5 | US FAERS | |
| 26 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 27 | Thrombosis | FAERS: 5 | US FAERS | |
| 28 | Bronchospasm | FAERS: 4 | US FAERS | |
| 29 | Capsule physical issue | FAERS: 4 | US FAERS | |
| 30 | Drug Dependence | FAERS: 4 | US FAERS | |
| 31 | Drug ineffective | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 32 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 33 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 34 | Infection | FAERS: 4 | US FAERS | |
| 35 | Sinusitis | FAERS: 4 | US FAERS | |
| 36 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 37 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 38 | Apparent death | FAERS: 3 | US FAERS | |
| 39 | Candidiasis | FAERS: 3 | US FAERS | |
| 40 | Chest discomfort | FAERS: 3 | US FAERS | |
| 41 | Deafness | FAERS: 3 | US FAERS | |
| 42 | Dysphonia | FAERS: 3 | US FAERS | |
| 43 | Fracture | FAERS: 3 | US FAERS | |
| 44 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 45 | Medication Error | FAERS: 3 | US FAERS | |
| 46 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 47 | Nausea | FAERS: 3 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 49 | Osteoporosis | FAERS: 3 | US FAERS | |
| 50 | Product quality issue | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 51 | Swelling | FAERS: 3 | US FAERS | |
| 52 | Tachycardia | FAERS: 3 | US FAERS | |
| 53 | Throat irritation | FAERS: 3 | US FAERS | |
| 54 | Tuberculosis | FAERS: 3 | US FAERS | |
| 55 | Vomiting | FAERS: 3 | US FAERS | |
| 56 | Wheezing | FAERS: 3 | US FAERS | |
| 57 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 58 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 59 | Aneurysm | FAERS: 2 | US FAERS | |
| 60 | Appendicitis | FAERS: 2 | US FAERS | |
| 61 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 62 | Back Pain | FAERS: 2 | US FAERS | |
| 63 | Bedridden | FAERS: 2 | US FAERS | |
| 64 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 65 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 66 | Blood immunoglobulin E increased | FAERS: 2 | US FAERS | |
| 67 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 68 | Choking | FAERS: 2 | US FAERS | |
| 69 | Depressed mood | FAERS: 2 | US FAERS | |
| 70 | Diverticulitis | FAERS: 2 | US FAERS | |
| 71 | Drug administration error | FAERS: 2 | US FAERS | |
| 72 | Drug dose omission | FAERS: 2 | US FAERS | |
| 73 | Dysgeusia | FAERS: 2 | US FAERS | |
| 74 | Expired drug administered | FAERS: 2 | US FAERS | |
| 75 | Glaucoma | FAERS: 2 | US FAERS | |
| 76 | Hypophagia | FAERS: 2 | US FAERS | |
| 77 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 78 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 79 | Monoplegia | FAERS: 2 | US FAERS | |
| 80 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 81 | No adverse event | FAERS: 2 | US FAERS | |
| 82 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 83 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 84 | Respiratory distress | FAERS: 2 | US FAERS | |
| 85 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 86 | Somnolence | FAERS: 2 | US FAERS | |
| 87 | Weight decreased | FAERS: 2 | US FAERS | |
| 88 | Wheelchair user | FAERS: 2 | US FAERS | |
| 89 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 90 | Abasia | FAERS: 1 | US FAERS | |
| 91 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 92 | Allergic bronchitis | FAERS: 1 | US FAERS | |
| 93 | Angioedema | FAERS: 1 | US FAERS | |
| 94 | Anxiety | FAERS: 1 | US FAERS | |
| 95 | Aphonia | FAERS: 1 | US FAERS | |
| 96 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 97 | Arthropathy | FAERS: 1 | US FAERS | |
| 98 | Aspergillosis | FAERS: 1 | US FAERS | |
| 99 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 100 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 101 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 102 | Blood urine present | FAERS: 1 | US FAERS | |
| 103 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 104 | Bone erosion | FAERS: 1 | US FAERS | |
| 105 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 106 | Burning sensation | FAERS: 1 | US FAERS | |
| 107 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 108 | Cataract | FAERS: 1 | US FAERS | |
| 109 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 110 | Cyanosis | FAERS: 1 | US FAERS | |
| 111 | Cyst | FAERS: 1 | US FAERS | |
| 112 | Delayed delivery | FAERS: 1 | US FAERS | |
| 113 | Dependence | FAERS: 1 | US FAERS | |
| 114 | Dermatitis | FAERS: 1 | US FAERS | |
| 115 | Discomfort | FAERS: 1 | US FAERS | |
| 116 | Drug abuse | FAERS: 1 | US FAERS | |
| 117 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 118 | Dyspepsia | FAERS: 1 | US FAERS | |
| 119 | Epistaxis | FAERS: 1 | US FAERS | |
| 120 | Erysipelas | FAERS: 1 | US FAERS | |
| 121 | Erythema | FAERS: 1 | US FAERS | |
| 122 | Fibrosis | FAERS: 1 | US FAERS | |
| 123 | Flatulence | FAERS: 1 | US FAERS | |
| 124 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 125 | Gangrene | FAERS: 1 | US FAERS | |
| 126 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 127 | Gastritis | FAERS: 1 | US FAERS | |
| 128 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 129 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 130 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 131 | Hunger | FAERS: 1 | US FAERS | |
| 132 | Hypotension | FAERS: 1 | US FAERS | |
| 133 | Hypoxia | FAERS: 1 | US FAERS | |
| 134 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 135 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 136 | Inflammation | FAERS: 1 | US FAERS | |
| 137 | Inspiratory capacity decreased | FAERS: 1 | US FAERS | |
| 138 | Joint injury | FAERS: 1 | US FAERS | |
| 139 | Joint swelling | FAERS: 1 | US FAERS | |
| 140 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 141 | Laryngospasm | FAERS: 1 | US FAERS | |
| 142 | Leukocytosis | FAERS: 1 | US FAERS | |
| 143 | Ligament injury | FAERS: 1 | US FAERS | |
| 144 | Limb discomfort | FAERS: 1 | US FAERS | |
| 145 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 146 | Medication residue | FAERS: 1 | US FAERS | |
| 147 | Metastasis | FAERS: 1 | US FAERS | |
| 148 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 149 | Myalgia | FAERS: 1 | US FAERS | |
| 150 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 151 | Nerve injury | FAERS: 1 | US FAERS | |
| 152 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 153 | Osteopenia | FAERS: 1 | US FAERS | |
| 154 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 155 | Product physical issue | FAERS: 1 | US FAERS | |
| 156 | Pruritus | FAERS: 1 | US FAERS | |
| 157 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 158 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 159 | Secretion discharge | FAERS: 1 | US FAERS | |
| 160 | Septic Shock | FAERS: 1 | US FAERS | |
| 161 | Shock | FAERS: 1 | US FAERS | |
| 162 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 163 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 164 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 165 | Tinnitus | FAERS: 1 | US FAERS | |
| 166 | Toothache | FAERS: 1 | US FAERS | |
| 167 | Ulcer | FAERS: 1 | US FAERS | |
| 168 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 169 | Visual Impairment | FAERS: 1 | US FAERS | |
| 170 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 171 | nervous system disorder | FAERS: 1 | US FAERS | |
| 172 | Bronchial Hyperreactivity | 17336541 | CTD | |
| 173 | Dyspnea | 22069361 | CTD | |
| 174 | Lung Injury | 25313925 | CTD | |
| 175 | Myocarditis | 16908771 | CTD | |
| 176 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 177 | Pulmonary Edema | 17336541 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.