Ciprodex
(NTRHYMXQWWPZDD-WKSAPEMMSA-N)
Structure
- SMILES
- Fc1cc2c(cc1N1CCNCC1)n(cc(c2=O)C(=O)O)C1CC1.OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F
- Molecular Formula:
- C39H47F2N3O8
- Molecular Weight:
- 723.803
- Log P:
- 3.8728
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 169.4
- CAS Number(s):
- 130244-48-3
Synonym(s)
1.
Ciprodex
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Incorrect route of drug administration | FAERS: 30 | US FAERS | |
| 3 | Ear discomfort | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Tinnitus | FAERS: 16 | US FAERS | |
| 5 | No adverse event | FAERS: 11 | US FAERS | |
| 6 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 7 | Pain | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 8 | Product quality issue | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Tympanic Membrane Perforation | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Dizziness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Medication residue present | FAERS: 6 | US FAERS | |
| 12 | Expired product administered | FAERS: 5 | US FAERS | |
| 13 | Eye irritation | FAERS: 5 | US FAERS | |
| 14 | Headache | FAERS: 5 | US FAERS | |
| 15 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 16 | Deafness | FAERS: 4 | US FAERS | |
| 17 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 18 | Erythema | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Chills | FAERS: 3 | US FAERS | |
| 20 | Crying | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 22 | Eye pain | FAERS: 3 | US FAERS | |
| 23 | Lip swelling | FAERS: 3 | US FAERS | |
| 24 | Malaise | FAERS: 3 | US FAERS | |
| 25 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 26 | Pruritus | FAERS: 3 | US FAERS | |
| 27 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 28 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 29 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 30 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 31 | Anxiety | FAERS: 2 | US FAERS | |
| 32 | Auricular swelling | FAERS: 2 | US FAERS | |
| 33 | Burning sensation | FAERS: 2 | US FAERS | |
| 34 | Drug administration error | FAERS: 2 | US FAERS | |
| 35 | Excessive cerumen production | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Facial paralysis | FAERS: 2 | US FAERS | |
| 37 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 38 | Influenza | FAERS: 2 | US FAERS | |
| 39 | Medication Error | FAERS: 2 | US FAERS | |
| 40 | Nausea | FAERS: 2 | US FAERS | |
| 41 | Product administration error | FAERS: 2 | US FAERS | |
| 42 | Screaming | FAERS: 2 | US FAERS | |
| 43 | Urticaria | FAERS: 2 | US FAERS | |
| 44 | Vertigo | FAERS: 2 | US FAERS | |
| 45 | Visual Impairment | FAERS: 2 | US FAERS | |
| 46 | Adverse event | FAERS: 1 | US FAERS | |
| 47 | Amnesia | FAERS: 1 | US FAERS | |
| 48 | Asthenia | FAERS: 1 | US FAERS | |
| 49 | Asthma | FAERS: 1 | US FAERS | |
| 50 | Blister rupture | FAERS: 1 | US FAERS | |
| 51 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 52 | Cataract | FAERS: 1 | US FAERS | |
| 53 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 54 | Cholesteatoma | FAERS: 1 | US FAERS | |
| 55 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 56 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 57 | Discomfort | FAERS: 1 | US FAERS | |
| 58 | Dysgeusia | FAERS: 1 | US FAERS | |
| 59 | Ear canal abrasion | FAERS: 1 | US FAERS | |
| 60 | Ear canal injury | FAERS: 1 | US FAERS | |
| 61 | Ear congestion | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 63 | External ear cellulitis | FAERS: 1 | US FAERS | |
| 64 | Eye Infection | FAERS: 1 | US FAERS | |
| 65 | Eye allergy | FAERS: 1 | US FAERS | |
| 66 | Fatigue | FAERS: 1 | US FAERS | |
| 67 | Feeling Cold | FAERS: 1 | US FAERS | |
| 68 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 69 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 70 | Glossitis | FAERS: 1 | US FAERS | |
| 71 | Hyperacusis | FAERS: 1 | US FAERS | |
| 72 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 73 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 74 | Infection | FAERS: 1 | US FAERS | |
| 75 | Inflammation | FAERS: 1 | US FAERS | |
| 76 | Instillation site discharge | FAERS: 1 | US FAERS | |
| 77 | Instillation site exfoliation | FAERS: 1 | US FAERS | |
| 78 | Instillation site pain | FAERS: 1 | US FAERS | |
| 79 | Instillation site pruritus | FAERS: 1 | US FAERS | |
| 80 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 81 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 82 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 83 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 84 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 85 | Meningitis | FAERS: 1 | US FAERS | |
| 86 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 87 | Neck Pain | FAERS: 1 | US FAERS | |
| 88 | Nerve injury | FAERS: 1 | US FAERS | |
| 89 | Nervousness | FAERS: 1 | US FAERS | |
| 90 | Oral pain | FAERS: 1 | US FAERS | |
| 91 | Osteoporosis | FAERS: 1 | US FAERS | |
| 92 | Otitis Externa | FAERS: 1 | US FAERS | |
| 93 | Paradoxical pain | FAERS: 1 | US FAERS | |
| 94 | Physical product label issue | FAERS: 1 | US FAERS | |
| 95 | Product container issue | FAERS: 1 | US FAERS | |
| 96 | Product dropper issue | FAERS: 1 | US FAERS | |
| 97 | Product package associated injury | FAERS: 1 | US FAERS | |
| 98 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 99 | Product use complaint | FAERS: 1 | US FAERS | |
| 100 | Product use issue | FAERS: 1 | US FAERS | |
| 101 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 102 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 103 | Scab | FAERS: 1 | US FAERS | |
| 104 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 105 | Secretion discharge | FAERS: 1 | US FAERS | |
| 106 | Skin irritation | FAERS: 1 | US FAERS | |
| 107 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 108 | Stomatitis | FAERS: 1 | US FAERS | |
| 109 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 110 | Swelling | FAERS: 1 | US FAERS | |
| 111 | Tension Headache | FAERS: 1 | US FAERS | |
| 112 | Tongue blistering | FAERS: 1 | US FAERS | |
| 113 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 114 | Urinary Retention | FAERS: 1 | US FAERS | |
| 115 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 116 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 117 | Vomiting | FAERS: 1 | US FAERS | |
| 118 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 119 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 120 | treatment failure | FAERS: 1 | US FAERS | |
| 121 | Drug ineffective for unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 122 | Product use in unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 123 | Somnolence | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.