Austedo
(MKJIEFSOBYUXJB-WEZHFFAMSA-N)
Structure
- SMILES
- CC(C[C@H]1CN2CCc3c([C@@H]2CC1=O)cc(c(c3)OC([2H])([2H])[2H])OC([2H])([2H])[2H])C
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C19H21D6NO3
- Molecular Weight:
- 323.460
- Log P:
- 3.1760
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 38.77
- CAS Number(s):
- 1392826-25-3
Synonym(s)
1.
Austedo
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 42 | US FAERS | |
| 2 | Tremor | FAERS: 24 | US FAERS | |
| 3 | Somnolence | FAERS: 23 | US FAERS | |
| 4 | Feeling abnormal | FAERS: 21 | US FAERS | |
| 5 | Fatigue | FAERS: 20 | US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 17 | US FAERS | |
| 7 | Dizziness | FAERS: 16 | US FAERS | |
| 8 | Asthenia | FAERS: 13 | US FAERS | |
| 9 | Agitation | FAERS: 12 | US FAERS | |
| 10 | Anxiety | FAERS: 12 | US FAERS | |
| 11 | Restlessness | FAERS: 11 | US FAERS | |
| 12 | Gait inability | FAERS: 9 | US FAERS | |
| 13 | Headache | FAERS: 9 | US FAERS | |
| 14 | Nausea | FAERS: 9 | US FAERS | |
| 15 | Loss of personal independence in daily activities | FAERS: 8 | US FAERS | |
| 16 | Product use issue | FAERS: 8 | US FAERS | |
| 17 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 18 | Memory impairment | FAERS: 7 | US FAERS | |
| 19 | Product dose omission | FAERS: 7 | US FAERS | |
| 20 | Amnesia | FAERS: 6 | US FAERS | |
| 21 | Drug dose omission | FAERS: 6 | US FAERS | |
| 22 | Malaise | FAERS: 6 | US FAERS | |
| 23 | Suicide attempt | FAERS: 6 | US FAERS | |
| 24 | Vomiting | FAERS: 6 | US FAERS | |
| 25 | Weight decreased | FAERS: 6 | US FAERS | |
| 26 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 27 | Choking | FAERS: 5 | US FAERS | |
| 28 | Depressed mood | FAERS: 5 | US FAERS | |
| 29 | Pain | FAERS: 5 | US FAERS | |
| 30 | Palpitations | FAERS: 5 | US FAERS | |
| 31 | Adverse event | FAERS: 4 | US FAERS | |
| 32 | Akathisia | FAERS: 4 | US FAERS | |
| 33 | Anger | FAERS: 4 | US FAERS | |
| 34 | Chorea | FAERS: 4 | US FAERS | |
| 35 | Constipation | FAERS: 4 | US FAERS | |
| 36 | Crying | FAERS: 4 | US FAERS | |
| 37 | Dehydration | FAERS: 4 | US FAERS | |
| 38 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 39 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 40 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 41 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 42 | Product substitution issue | FAERS: 4 | US FAERS | |
| 43 | Pruritus | FAERS: 4 | US FAERS | |
| 44 | Therapy change | FAERS: 4 | US FAERS | |
| 45 | Unevaluable event | FAERS: 4 | US FAERS | |
| 46 | Wheelchair user | FAERS: 4 | US FAERS | |
| 47 | Arthralgia | FAERS: 3 | US FAERS | |
| 48 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 49 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 50 | Disease Progression | FAERS: 3 | US FAERS | |
| 51 | Disorientation | FAERS: 3 | US FAERS | |
| 52 | Drooling | FAERS: 3 | US FAERS | |
| 53 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 54 | Drug titration error | FAERS: 3 | US FAERS | |
| 55 | Dystonia | FAERS: 3 | US FAERS | |
| 56 | Hypotension | FAERS: 3 | US FAERS | |
| 57 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 58 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 59 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 60 | Product dispensing error | FAERS: 3 | US FAERS | |
| 61 | Product prescribing error | FAERS: 3 | US FAERS | |
| 62 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 63 | Akinesia | FAERS: 2 | US FAERS | |
| 64 | Alopecia | FAERS: 2 | US FAERS | |
| 65 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 66 | Apathy | FAERS: 2 | US FAERS | |
| 67 | Back Pain | FAERS: 2 | US FAERS | |
| 68 | Bedridden | FAERS: 2 | US FAERS | |
| 69 | Blindness | FAERS: 2 | US FAERS | |
| 70 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 71 | Bronchitis | FAERS: 2 | US FAERS | |
| 72 | Bruxism | FAERS: 2 | US FAERS | |
| 73 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 74 | Dementia | FAERS: 2 | US FAERS | |
| 75 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 76 | Disability | FAERS: 2 | US FAERS | |
| 77 | Dysphonia | FAERS: 2 | US FAERS | |
| 78 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 79 | Hunger | FAERS: 2 | US FAERS | |
| 80 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 81 | Incontinence | FAERS: 2 | US FAERS | |
| 82 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 83 | Influenza | FAERS: 2 | US FAERS | |
| 84 | Lethargy | FAERS: 2 | US FAERS | |
| 85 | Morbid thoughts | FAERS: 2 | US FAERS | |
| 86 | Muscle tightness | FAERS: 2 | US FAERS | |
| 87 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 88 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 89 | Paranoia | FAERS: 2 | US FAERS | |
| 90 | Product administration error | FAERS: 2 | US FAERS | |
| 91 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 92 | Product storage error | FAERS: 2 | US FAERS | |
| 93 | Sinusitis | FAERS: 2 | US FAERS | |
| 94 | Sluggishness | FAERS: 2 | US FAERS | |
| 95 | Stress | FAERS: 2 | US FAERS | |
| 96 | Swelling | FAERS: 2 | US FAERS | |
| 97 | Symptom recurrence | FAERS: 2 | US FAERS | |
| 98 | Tachycardia | FAERS: 2 | US FAERS | |
| 99 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 100 | Therapy cessation | FAERS: 2 | US FAERS | |
| 101 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 102 | Vertigo | FAERS: 2 | US FAERS | |
| 103 | Visual Impairment | FAERS: 2 | US FAERS | |
| 104 | Walking aid user | FAERS: 2 | US FAERS | |
| 105 | Wrong dose | FAERS: 2 | US FAERS | |
| 106 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 107 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 108 | Accidental overdose | FAERS: 1 | US FAERS | |
| 109 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 110 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 111 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 112 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 113 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 114 | Bone contusion | FAERS: 1 | US FAERS | |
| 115 | Bradycardia | FAERS: 1 | US FAERS | |
| 116 | Catatonia | FAERS: 1 | US FAERS | |
| 117 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 118 | Cerebrospinal fluid retention | FAERS: 1 | US FAERS | |
| 119 | Chest Pain | FAERS: 1 | US FAERS | |
| 120 | Chest discomfort | FAERS: 1 | US FAERS | |
| 121 | Chromaturia | FAERS: 1 | US FAERS | |
| 122 | Claustrophobia | FAERS: 1 | US FAERS | |
| 123 | Clumsiness | FAERS: 1 | US FAERS | |
| 124 | Completed Suicide | FAERS: 1 | US FAERS | |
| 125 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 126 | Cystitis | FAERS: 1 | US FAERS | |
| 127 | Delirium | FAERS: 1 | US FAERS | |
| 128 | Dependence | FAERS: 1 | US FAERS | |
| 129 | Disease recurrence | FAERS: 1 | US FAERS | |
| 130 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 131 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 132 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 133 | Dysarthria | FAERS: 1 | US FAERS | |
| 134 | Dysgeusia | FAERS: 1 | US FAERS | |
| 135 | Dysphemia | FAERS: 1 | US FAERS | |
| 136 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 137 | Eructation | FAERS: 1 | US FAERS | |
| 138 | Erythema | FAERS: 1 | US FAERS | |
| 139 | Ex-tobacco user | FAERS: 1 | US FAERS | |
| 140 | Exophthalmos | FAERS: 1 | US FAERS | |
| 141 | Feeling Cold | FAERS: 1 | US FAERS | |
| 142 | Flank Pain | FAERS: 1 | US FAERS | |
| 143 | Flat affect | FAERS: 1 | US FAERS | |
| 144 | Food aversion | FAERS: 1 | US FAERS | |
| 145 | Gastrostomy | FAERS: 1 | US FAERS | |
| 146 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 147 | Hyperphagia | FAERS: 1 | US FAERS | |
| 148 | Hypersomnia | FAERS: 1 | US FAERS | |
| 149 | Hypokinesia | FAERS: 1 | US FAERS | |
| 150 | Impaired work ability | FAERS: 1 | US FAERS | |
| 151 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 152 | Incoherent | FAERS: 1 | US FAERS | |
| 153 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 154 | Infection | FAERS: 1 | US FAERS | |
| 155 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 156 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 157 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 158 | Limb discomfort | FAERS: 1 | US FAERS | |
| 159 | Limb injury | FAERS: 1 | US FAERS | |
| 160 | Lip swelling | FAERS: 1 | US FAERS | |
| 161 | Living in residential institution | FAERS: 1 | US FAERS | |
| 162 | Mental impairment | FAERS: 1 | US FAERS | |
| 163 | Mental status changes | FAERS: 1 | US FAERS | |
| 164 | Middle insomnia | FAERS: 1 | US FAERS | |
| 165 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 166 | Monoparesis | FAERS: 1 | US FAERS | |
| 167 | Mouth swelling | FAERS: 1 | US FAERS | |
| 168 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 169 | Neck Pain | FAERS: 1 | US FAERS | |
| 170 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 171 | Nervousness | FAERS: 1 | US FAERS | |
| 172 | Night sweats | FAERS: 1 | US FAERS | |
| 173 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 174 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 175 | Panic Disorder | FAERS: 1 | US FAERS | |
| 176 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 177 | Photophobia | FAERS: 1 | US FAERS | |
| 178 | Physical disability | FAERS: 1 | US FAERS | |
| 179 | Pneumonia | FAERS: 1 | US FAERS | |
| 180 | Pneumothorax | FAERS: 1 | US FAERS | |
| 181 | Polydipsia | FAERS: 1 | US FAERS | |
| 182 | Polyuria | FAERS: 1 | US FAERS | |
| 183 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 184 | Pregnancy | FAERS: 1 | US FAERS | |
| 185 | Presyncope | FAERS: 1 | US FAERS | |
| 186 | Product distribution issue | FAERS: 1 | US FAERS | |
| 187 | Product label issue | FAERS: 1 | US FAERS | |
| 188 | Product supply issue | FAERS: 1 | US FAERS | |
| 189 | Product use complaint | FAERS: 1 | US FAERS | |
| 190 | Productive Cough | FAERS: 1 | US FAERS | |
| 191 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 192 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 193 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 194 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 195 | Schizophrenia | FAERS: 1 | US FAERS | |
| 196 | Screaming | FAERS: 1 | US FAERS | |
| 197 | Sepsis | FAERS: 1 | US FAERS | |
| 198 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 199 | Skin lesion | FAERS: 1 | US FAERS | |
| 200 | Slow speech | FAERS: 1 | US FAERS | |
| 201 | Soliloquy | FAERS: 1 | US FAERS | |
| 202 | Strabismus | FAERS: 1 | US FAERS | |
| 203 | Sudden death | FAERS: 1 | US FAERS | |
| 204 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 205 | Suicide threat | FAERS: 1 | US FAERS | |
| 206 | Suspected suicide attempt | FAERS: 1 | US FAERS | |
| 207 | Syncope | FAERS: 1 | US FAERS | |
| 208 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 209 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 210 | Thrombosis | FAERS: 1 | US FAERS | |
| 211 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 212 | Transcription medication error | FAERS: 1 | US FAERS | |
| 213 | Trismus | FAERS: 1 | US FAERS | |
| 214 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 215 | Urinary Retention | FAERS: 1 | US FAERS | |
| 216 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 217 | Urticaria | FAERS: 1 | US FAERS | |
| 218 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 219 | Wheezing | FAERS: 1 | US FAERS | |
| 220 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.