Midodrine
(MGCQZNBCJBRZDT-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc(cc1C(CNC(=O)CN)O)OC.Cl
- Molecular Formula:
- C12H19ClN2O4
- Molecular Weight:
- 290.743
- Log P:
- 1.7053
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 93.81
- CAS Number(s):
- 3092-17-9; 43218-56-0
Synonym(s)
1.
Midodrine
2.
Amatine
3.
Gutron
4.
Midodrin
5.
Midodrine Hydrochloride
6.
Midodrine Monohydrochloride
7.
Midon
8.
ProAmatine
9.
ST-1085
10.
Monohydrochloride, Midodrine
11.
ST 1085
12.
ST1085
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 18 | US FAERS | |
| 2 | Headache | FAERS: 13 | US FAERS | |
| 3 | Nausea | FAERS: 9 | US FAERS | |
| 4 | Dizziness | FAERS: 7 | US FAERS | |
| 5 | Dry gangrene | FAERS: 5 | US FAERS | |
| 6 | Hypotension | FAERS: 5 | US FAERS | |
| 7 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 8 | Vomiting | FAERS: 5 | US FAERS | |
| 9 | Chest Pain | FAERS: 4 | US FAERS | |
| 10 | Erythema | FAERS: 4 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 12 | Bradycardia | FAERS: 3 | US FAERS | |
| 13 | Dysuria | FAERS: 3 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 15 | Infection | FAERS: 3 | US FAERS | |
| 16 | Pain | FAERS: 3 | US FAERS | |
| 17 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 18 | Pruritus | FAERS: 3 | US FAERS | |
| 19 | Somnolence | FAERS: 3 | US FAERS | |
| 20 | Syncope | FAERS: 3 | US FAERS | |
| 21 | Therapeutic response unexpected with drug substitution | FAERS: 3 | US FAERS | |
| 22 | Urticaria | FAERS: 3 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 24 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 25 | Asthenia | FAERS: 2 | US FAERS | |
| 26 | Disorientation | FAERS: 2 | US FAERS | |
| 27 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 28 | Dysarthria | FAERS: 2 | US FAERS | |
| 29 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 30 | Malaise | FAERS: 2 | US FAERS | |
| 31 | Palpitations | FAERS: 2 | US FAERS | |
| 32 | Piloerection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Snoring | FAERS: 2 | US FAERS | |
| 34 | Sperm count decreased | FAERS: 2 | US FAERS | |
| 35 | Swelling | FAERS: 2 | US FAERS | |
| 36 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 37 | Agitation | FAERS: 1 | US FAERS | |
| 38 | Alopecia | FAERS: 1 | US FAERS | |
| 39 | Anger | FAERS: 1 | US FAERS | |
| 40 | Angioedema | FAERS: 1 | US FAERS | |
| 41 | Anxiety | FAERS: 1 | US FAERS | |
| 42 | Arterial insufficiency | FAERS: 1 | US FAERS | |
| 43 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 44 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 45 | Chest discomfort | FAERS: 1 | US FAERS | |
| 46 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 48 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 49 | Dysgeusia | FAERS: 1 | US FAERS | |
| 50 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 51 | Epistaxis | FAERS: 1 | US FAERS | |
| 52 | Eye Infection | FAERS: 1 | US FAERS | |
| 53 | Eye pain | FAERS: 1 | US FAERS | |
| 54 | Fatigue | FAERS: 1 | US FAERS | |
| 55 | Fluid overload | FAERS: 1 | US FAERS | |
| 56 | Flushing | FAERS: 1 | US FAERS | |
| 57 | Formication | FAERS: 1 | US FAERS | |
| 58 | Head discomfort | FAERS: 1 | US FAERS | |
| 59 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 60 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 61 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 62 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 63 | Induration | FAERS: 1 | US FAERS | |
| 64 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 65 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 66 | Joint swelling | FAERS: 1 | US FAERS | |
| 67 | Leukopenia | FAERS: 1 | US FAERS | |
| 68 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 69 | Medication Error | FAERS: 1 | US FAERS | |
| 70 | Middle insomnia | FAERS: 1 | US FAERS | |
| 71 | Mouth swelling | FAERS: 1 | US FAERS | |
| 72 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 73 | Necrosis | FAERS: 1 | US FAERS | |
| 74 | Night sweats | FAERS: 1 | US FAERS | |
| 75 | Nipple pain | FAERS: 1 | US FAERS | |
| 76 | Overdose | FAERS: 1 | US FAERS | |
| 77 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 78 | Pneumonia | FAERS: 1 | US FAERS | |
| 79 | Pneumothorax | FAERS: 1 | US FAERS | |
| 80 | Pregnancy | FAERS: 1 | US FAERS | |
| 81 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 82 | Pressure of speech | FAERS: 1 | US FAERS | |
| 83 | Product label issue | FAERS: 1 | US FAERS | |
| 84 | Product quality issue | FAERS: 1 | US FAERS | |
| 85 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 86 | Product substitution issue | FAERS: 1 | US FAERS | |
| 87 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 88 | Prostatic pain | FAERS: 1 | US FAERS | |
| 89 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 90 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 91 | Restlessness | FAERS: 1 | US FAERS | |
| 92 | Rosacea | FAERS: 1 | US FAERS | |
| 93 | Shock | FAERS: 1 | US FAERS | |
| 94 | Skin necrosis | FAERS: 1 | US FAERS | |
| 95 | Suicide attempt | FAERS: 1 | US FAERS | |
| 96 | Tachycardia | FAERS: 1 | US FAERS | |
| 97 | Tremor | FAERS: 1 | US FAERS | |
| 98 | Unevaluable event | FAERS: 1 | US FAERS | |
| 99 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 100 | Vascular calcification | FAERS: 1 | US FAERS | |
| 101 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 102 | Visual Impairment | FAERS: 1 | US FAERS | |
| 103 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.