Miconazole
(MCCACAIVAXEFAL-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(c(c1)Cl)COC(c1ccc(cc1Cl)Cl)Cn1cncc1.[O-][N+](=O)O
- Molecular Formula:
- C18H15Cl4N3O4
- Molecular Weight:
- 479.141
- Log P:
- 6.6303
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 93.1
- CAS Number(s):
- 22832-37-7; 22832-87-7; 75319-48-1
Synonym(s)
1.
Miconazole
2.
Brentan
3.
Dactarin
4.
Miconasil Nitrate
5.
Miconazole Nitrate
6.
Monistat
7.
R-14,889
8.
Nitrate, Miconasil
9.
Nitrate, Miconazole
10.
R 14,889
11.
R14,889
External Link(s)
| MeSH | D008825 |
| PubChem Compound | 68553 |
| CHEMBL | CHEMBL1559 |
| KEGG | cpd:C08070 dr:D00882 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vulvovaginal burning sensation | FAERS: 330 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 282 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Vulvovaginal pain | FAERS: 129 | US FAERS | |
| 4 | Vulvovaginal pruritus | FAERS: 121 | US FAERS | |
| 5 | Vulvovaginal discomfort | FAERS: 96 | US FAERS | |
| 6 | Vulvovaginal swelling | FAERS: 64 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 51 | US FAERS | |
| 8 | Pruritus | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Vaginal Discharge | FAERS: 31 | US FAERS | |
| 10 | Burning sensation | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Incorrect route of drug administration | FAERS: 30 | US FAERS | |
| 12 | Drug exposure during pregnancy | FAERS: 28 | US FAERS | |
| 13 | Pain | FAERS: 27 | US FAERS | |
| 14 | Application site pain | FAERS: 25 | US FAERS | |
| 15 | Vulvovaginal erythema | FAERS: 25 | US FAERS | |
| 16 | Expired product administered | FAERS: 23 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 18 | Nausea | FAERS: 17 | US FAERS | |
| 19 | Choking | FAERS: 16 | US FAERS | |
| 20 | Medication Error | FAERS: 16 | US FAERS | |
| 21 | No adverse event | FAERS: 15 | US FAERS | |
| 22 | Swelling | FAERS: 13 | US FAERS | |
| 23 | Dizziness | FAERS: 12 | US FAERS | |
| 24 | Erythema | FAERS: 12 | US FAERS | |
| 25 | Urticaria | FAERS: 12 | US FAERS | |
| 26 | Application site pruritus | FAERS: 11 | US FAERS | |
| 27 | Drug dose omission | FAERS: 11 | US FAERS | |
| 28 | Dysuria | FAERS: 11 | US FAERS | |
| 29 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 30 | Vomiting | FAERS: 11 | US FAERS | |
| 31 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 32 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 33 | Asphyxia | FAERS: 10 | US FAERS | |
| 34 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 35 | Inappropriate schedule of drug administration | FAERS: 10 | US FAERS | |
| 36 | Incorrect drug administration duration | FAERS: 9 | US FAERS | |
| 37 | Intentional drug misuse | FAERS: 9 | US FAERS | |
| 38 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 39 | Vulvovaginal rash | FAERS: 9 | US FAERS | |
| 40 | Discomfort | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Chemical injury | FAERS: 7 | US FAERS | |
| 42 | Cyanosis | FAERS: 7 | US FAERS | |
| 43 | Anaphylactoid Reaction | FAERS: 6 | US FAERS | |
| 44 | Application site reaction | FAERS: 6 | US FAERS | |
| 45 | Application site swelling | FAERS: 6 | US FAERS | |
| 46 | Crying | FAERS: 6 | US FAERS | |
| 47 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 48 | Headache | FAERS: 6 | US FAERS | |
| 49 | Product quality issue | FAERS: 6 | US FAERS | |
| 50 | Somnolence | FAERS: 6 | US FAERS | |
| 51 | Thermal burn | FAERS: 6 | US FAERS | |
| 52 | Abasia | FAERS: 5 | US FAERS | |
| 53 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 54 | Vaginal erosion | FAERS: 5 | US FAERS | |
| 55 | Vulvovaginal injury | FAERS: 5 | US FAERS | |
| 56 | Accidental exposure | FAERS: 4 | US FAERS | |
| 57 | Application site irritation | FAERS: 4 | US FAERS | |
| 58 | Asthma | FAERS: 4 | US FAERS | |
| 59 | Back Pain | FAERS: 4 | US FAERS | |
| 60 | Blood urine present | FAERS: 4 | US FAERS | |
| 61 | Cervical polyp | FAERS: 4 | US FAERS | |
| 62 | Chills | FAERS: 4 | US FAERS | |
| 63 | Expired drug administered | FAERS: 4 | US FAERS | |
| 64 | Infection | FAERS: 4 | US FAERS | |
| 65 | Injury asphyxiation | FAERS: 4 | US FAERS | |
| 66 | Malaise | FAERS: 4 | US FAERS | |
| 67 | Neonatal disorder | FAERS: 4 | US FAERS | |
| 68 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 69 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 70 | Skin irritation | FAERS: 4 | US FAERS | |
| 71 | Tremor | FAERS: 4 | US FAERS | |
| 72 | Vaginal mucosal blistering | FAERS: 4 | US FAERS | |
| 73 | Vulvovaginal dryness | FAERS: 4 | US FAERS | |
| 74 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 75 | Accidental underdose | FAERS: 3 | US FAERS | |
| 76 | Adverse event | FAERS: 3 | US FAERS | |
| 77 | Asthenia | FAERS: 3 | US FAERS | |
| 78 | Constipation | FAERS: 3 | US FAERS | |
| 79 | Drug Dependence | FAERS: 3 | US FAERS | |
| 80 | Drug administered at inappropriate site | FAERS: 3 | US FAERS | |
| 81 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 82 | Fatigue | FAERS: 3 | US FAERS | |
| 83 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 84 | Genital pain | FAERS: 3 | US FAERS | |
| 85 | Medical device complication | FAERS: 3 | US FAERS | |
| 86 | Pallor | FAERS: 3 | US FAERS | |
| 87 | Product counterfeit | FAERS: 3 | US FAERS | |
| 88 | Product use issue | FAERS: 3 | US FAERS | |
| 89 | Skin Erosion | FAERS: 3 | US FAERS | |
| 90 | Unevaluable event | FAERS: 3 | US FAERS | |
| 91 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 92 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 93 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 94 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 95 | Angioedema | FAERS: 2 | US FAERS | |
| 96 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 97 | Anxiety | FAERS: 2 | US FAERS | |
| 98 | Aphasia | FAERS: 2 | US FAERS | |
| 99 | Application site burn | FAERS: 2 | US FAERS | |
| 100 | Application site discomfort | FAERS: 2 | US FAERS | |
| 101 | Application site ulcer | FAERS: 2 | US FAERS | |
| 102 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 103 | Cellulitis | FAERS: 2 | US FAERS | |
| 104 | Chemical burn of skin | FAERS: 2 | US FAERS | |
| 105 | Chromaturia | FAERS: 2 | US FAERS | |
| 106 | Drug administration error | FAERS: 2 | US FAERS | |
| 107 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 108 | Expulsion of medication | FAERS: 2 | US FAERS | |
| 109 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 110 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 111 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 112 | Hepatitis | FAERS: 2 | US FAERS | |
| 113 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 114 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 115 | Mucosal erosion | FAERS: 2 | US FAERS | |
| 116 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 117 | Perineal pain | FAERS: 2 | US FAERS | |
| 118 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 119 | Pneumonia | FAERS: 2 | US FAERS | |
| 120 | Presyncope | FAERS: 2 | US FAERS | |
| 121 | Priapism | FAERS: 2 | US FAERS | |
| 122 | Product substitution issue | FAERS: 2 | US FAERS | |
| 123 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 124 | Rash erythematous | FAERS: 2 | US FAERS | |
| 125 | Screaming | FAERS: 2 | US FAERS | |
| 126 | Tachycardia | FAERS: 2 | US FAERS | |
| 127 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 128 | Urinary Retention | FAERS: 2 | US FAERS | |
| 129 | Vaginal lesion | FAERS: 2 | US FAERS | |
| 130 | Vaginal pain | FAERS: 2 | US FAERS | |
| 131 | effusion | FAERS: 2 | US FAERS | |
| 132 | furuncle | FAERS: 2 | US FAERS | |
| 133 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 134 | Acne | FAERS: 1 | US FAERS | |
| 135 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 136 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 137 | Anuria | FAERS: 1 | US FAERS | |
| 138 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 139 | Application site erythema | FAERS: 1 | US FAERS | |
| 140 | Application site pustules | FAERS: 1 | US FAERS | |
| 141 | Application site urticaria | FAERS: 1 | US FAERS | |
| 142 | Application site warmth | FAERS: 1 | US FAERS | |
| 143 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 144 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 145 | Biopsy vulva abnormal | FAERS: 1 | US FAERS | |
| 146 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 147 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 148 | Bradycardia | FAERS: 1 | US FAERS | |
| 149 | Bronchospasm | FAERS: 1 | US FAERS | |
| 150 | Caustic injury | FAERS: 1 | US FAERS | |
| 151 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 152 | Chest discomfort | FAERS: 1 | US FAERS | |
| 153 | Complication associated with device | FAERS: 1 | US FAERS | |
| 154 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 155 | Conversion disorder | FAERS: 1 | US FAERS | |
| 156 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 157 | Deformity | FAERS: 1 | US FAERS | |
| 158 | Dehydration | FAERS: 1 | US FAERS | |
| 159 | Disease recurrence | FAERS: 1 | US FAERS | |
| 160 | Disorientation | FAERS: 1 | US FAERS | |
| 161 | Drug toxicity | FAERS: 1 | US FAERS | |
| 162 | Dysgeusia | FAERS: 1 | US FAERS | |
| 163 | Dyspareunia | FAERS: 1 | US FAERS | |
| 164 | Dyspepsia | FAERS: 1 | US FAERS | |
| 165 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 166 | Eczema | FAERS: 1 | US FAERS | |
| 167 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 168 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 169 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 170 | Eye Redness | FAERS: 1 | US FAERS | |
| 171 | Eye pain | FAERS: 1 | US FAERS | |
| 172 | Flank Pain | FAERS: 1 | US FAERS | |
| 173 | Flatulence | FAERS: 1 | US FAERS | |
| 174 | Fluid overload | FAERS: 1 | US FAERS | |
| 175 | Gastroschisis | FAERS: 1 | US FAERS | |
| 176 | General symptom | FAERS: 1 | US FAERS | |
| 177 | Genital erythema | FAERS: 1 | US FAERS | |
| 178 | Genital swelling | FAERS: 1 | US FAERS | |
| 179 | Hypersomnia | FAERS: 1 | US FAERS | |
| 180 | Hypospadias | FAERS: 1 | US FAERS | |
| 181 | Hysterectomy | FAERS: 1 | US FAERS | |
| 182 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 183 | Impaired work ability | FAERS: 1 | US FAERS | |
| 184 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 185 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 186 | Influenza | FAERS: 1 | US FAERS | |
| 187 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 188 | Injury associated with device | FAERS: 1 | US FAERS | |
| 189 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 190 | Intra-abdominal pressure increased | FAERS: 1 | US FAERS | |
| 191 | Laceration | FAERS: 1 | US FAERS | |
| 192 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 193 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 194 | Limb discomfort | FAERS: 1 | US FAERS | |
| 195 | Localised skin reaction | FAERS: 1 | US FAERS | |
| 196 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 197 | Middle insomnia | FAERS: 1 | US FAERS | |
| 198 | Muscle strain | FAERS: 1 | US FAERS | |
| 199 | Muscle tightness | FAERS: 1 | US FAERS | |
| 200 | Myocarditis | FAERS: 1 | US FAERS | |
| 201 | Neck Pain | FAERS: 1 | US FAERS | |
| 202 | Nerve injury | FAERS: 1 | US FAERS | |
| 203 | Nervousness | FAERS: 1 | US FAERS | |
| 204 | Obstruction | FAERS: 1 | US FAERS | |
| 205 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 206 | Overdose | FAERS: 1 | US FAERS | |
| 207 | Pain of skin | FAERS: 1 | US FAERS | |
| 208 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 209 | Perineal erythema | FAERS: 1 | US FAERS | |
| 210 | Petechiae | FAERS: 1 | US FAERS | |
| 211 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 212 | Product container issue | FAERS: 1 | US FAERS | |
| 213 | Product container seal issue | FAERS: 1 | US FAERS | |
| 214 | Product dispensing error | FAERS: 1 | US FAERS | |
| 215 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 216 | Product dose omission | FAERS: 1 | US FAERS | |
| 217 | Product label confusion | FAERS: 1 | US FAERS | |
| 218 | Product leakage | FAERS: 1 | US FAERS | |
| 219 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 220 | Product packaging issue | FAERS: 1 | US FAERS | |
| 221 | Product physical issue | FAERS: 1 | US FAERS | |
| 222 | Product prescribing error | FAERS: 1 | US FAERS | |
| 223 | Product tampering | FAERS: 1 | US FAERS | |
| 224 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 225 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 226 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 227 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 228 | Restlessness | FAERS: 1 | US FAERS | |
| 229 | Scab | FAERS: 1 | US FAERS | |
| 230 | Secretion discharge | FAERS: 1 | US FAERS | |
| 231 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 232 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 233 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 234 | Sluggishness | FAERS: 1 | US FAERS | |
| 235 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 236 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 237 | Throat irritation | FAERS: 1 | US FAERS | |
| 238 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 239 | Uterine spasm | FAERS: 1 | US FAERS | |
| 240 | Vaginal burning sensation | FAERS: 1 | US FAERS | |
| 241 | Vasculitis | FAERS: 1 | US FAERS | |
| 242 | Vulvitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.