Piperacillin/tazobactam
(LITBAYYWXZOHAW-XDZRHBBOSA-N)
Structure
- SMILES
- OC(=O)[C@@H]1N2C(=O)C[C@H]2S(=O)(=O)[C@@]1(C)Cn1ccnn1.CCN1CCN(C(=O)C1=O)C(=O)N[C@@H](C(=O)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)c1ccccc1
- Molecular Formula:
- C33H39N9O12S2
- Molecular Weight:
- 817.846
- Log P:
- -0.1493
- Hydrogen Bond Acceptor:
- 22
- Hydrogen Bond Donor:
- 4
- TPSA:
- 312.57
- CAS Number(s):
- N/A
Synonym(s)
1.
Piperacillin/tazobactam
External Link(s)
| PubChem Compound | 9918881 |
| CHEMBL | CHEMBL436129 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypotension | FAERS: 19 | US FAERS | |
| 2 | Drug ineffective | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Acute kidney injury | FAERS: 16 | US FAERS | |
| 4 | Pruritus | FAERS: 16 | US FAERS | |
| 5 | Thrombocytopenia | FAERS: 14 | US FAERS | |
| 6 | Urticaria | FAERS: 13 | US FAERS | |
| 7 | Angioedema | FAERS: 11 | US FAERS | |
| 8 | Nephritis | FAERS: 11 | US FAERS | |
| 9 | Respiratory Depression | FAERS: 9 | US FAERS | |
| 10 | Chills | FAERS: 8 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 12 | Tachycardia | FAERS: 7 | US FAERS | |
| 13 | Eosinophilia | FAERS: 5 | US FAERS | |
| 14 | Hypoxia | FAERS: 5 | US FAERS | |
| 15 | Alanine Aminotransferase Increased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Aspartate Aminotransferase Increased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 18 | Bradycardia | FAERS: 4 | US FAERS | |
| 19 | Erythema | FAERS: 4 | US FAERS | |
| 20 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 21 | Pathogen resistance | FAERS: 4 | US FAERS | |
| 22 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 23 | Sepsis | FAERS: 4 | US FAERS | |
| 24 | Toxic Epidermal Necrolysis | FAERS: 4 | US FAERS | |
| 25 | Wheezing | FAERS: 4 | US FAERS | |
| 26 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 27 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 28 | Blood lactate dehydrogenase increased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Bronchospasm | FAERS: 3 | US FAERS | |
| 30 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 31 | Embolic stroke | FAERS: 3 | US FAERS | |
| 32 | Histiocytosis haematophagic | FAERS: 3 | US FAERS | |
| 33 | Pancytopenia | FAERS: 3 | US FAERS | |
| 34 | Septic Shock | FAERS: 3 | US FAERS | |
| 35 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 36 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 37 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 38 | Blood alkaline phosphatase increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 40 | Blood urea increased | FAERS: 2 | US FAERS | |
| 41 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 42 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 43 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 44 | Eye irritation | FAERS: 2 | US FAERS | |
| 45 | Fatigue | FAERS: 2 | US FAERS | |
| 46 | Heparin-induced thrombocytopenia | FAERS: 2 | US FAERS | |
| 47 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 48 | Klebsiella test positive | FAERS: 2 | US FAERS | |
| 49 | Lethargy | FAERS: 2 | US FAERS | |
| 50 | Mental status changes | FAERS: 2 | US FAERS | |
| 51 | Neutropenia | FAERS: 2 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 52 | Palpitations | FAERS: 2 | US FAERS | |
| 53 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 54 | Reticulocyte count increased | FAERS: 2 | US FAERS | |
| 55 | Stridor | FAERS: 2 | US FAERS | |
| 56 | Swelling | FAERS: 2 | US FAERS | |
| 57 | Tremor | FAERS: 2 | US FAERS | |
| 58 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 59 | Vasculitis | FAERS: 2 | US FAERS | |
| 60 | jaundice | FAERS: 2 | US FAERS | |
| 61 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 62 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 63 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 64 | Ageusia | FAERS: 1 | US FAERS | |
| 65 | Agitation | FAERS: 1 | US FAERS | |
| 66 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 67 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 68 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 69 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 70 | Anuria | FAERS: 1 | US FAERS | |
| 71 | Anxiety | FAERS: 1 | US FAERS | |
| 72 | Arthropod sting | FAERS: 1 | US FAERS | |
| 73 | Asterixis | FAERS: 1 | US FAERS | |
| 74 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 75 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 76 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 77 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 78 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 79 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 80 | Candida test positive | FAERS: 1 | US FAERS | |
| 81 | Chest discomfort | FAERS: 1 | US FAERS | |
| 82 | Cholestasis | FAERS: 1 | US FAERS | |
| 83 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 84 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 85 | Cold sweat | FAERS: 1 | US FAERS | |
| 86 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 87 | Cyanosis | FAERS: 1 | US FAERS | |
| 88 | Dehydration | FAERS: 1 | US FAERS | |
| 89 | Delirium | FAERS: 1 | US FAERS | |
| 90 | Device occlusion | FAERS: 1 | US FAERS | |
| 91 | Device related infection | FAERS: 1 | US FAERS | |
| 92 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 93 | Drug cross-reactivity | FAERS: 1 | US FAERS | |
| 94 | Drug dose omission | FAERS: 1 | US FAERS | |
| 95 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 96 | Dysarthria | FAERS: 1 | US FAERS | |
| 97 | Dysentery | FAERS: 1 | US FAERS | |
| 98 | Ecchymosis | FAERS: 1 | US FAERS | |
| 99 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 100 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 101 | Eosinophil percentage increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 103 | Eosinophils urine present | FAERS: 1 | US FAERS | |
| 104 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 105 | Escherichia infection | FAERS: 1 | US FAERS | |
| 106 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 107 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 108 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 109 | Factor V inhibition | FAERS: 1 | US FAERS | |
| 110 | Factor VIII inhibition | FAERS: 1 | US FAERS | |
| 111 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 112 | Fluid overload | FAERS: 1 | US FAERS | |
| 113 | Flushing | FAERS: 1 | US FAERS | |
| 114 | Fungal test positive | FAERS: 1 | US FAERS | |
| 115 | Gamma-Glutamyltransferase Increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 116 | Heparin-induced thrombocytopenia test | FAERS: 1 | US FAERS | |
| 117 | Hypercapnia | FAERS: 1 | US FAERS | |
| 118 | Ileus | FAERS: 1 | US FAERS | |
| 119 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 120 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 121 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 122 | Leukocytosis | FAERS: 1 | US FAERS | |
| 123 | Leukopenia | FAERS: 1 | US FAERS | |
| 124 | Lip swelling | FAERS: 1 | US FAERS | |
| 125 | Liver Abscess | FAERS: 1 | US FAERS | |
| 126 | Lymphadenopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Malnutrition | FAERS: 1 | US FAERS | |
| 128 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 129 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 130 | Myoclonus | FAERS: 1 | US FAERS | |
| 131 | Nausea | FAERS: 1 | US FAERS | |
| 132 | Necrosis | FAERS: 1 | US FAERS | |
| 133 | Nervousness | FAERS: 1 | US FAERS | |
| 134 | Night sweats | FAERS: 1 | US FAERS | |
| 135 | No adverse event | FAERS: 1 | US FAERS | |
| 136 | Obesity | FAERS: 1 | US FAERS | |
| 137 | Pain | FAERS: 1 | US FAERS | |
| 138 | Peritonitis | FAERS: 1 | US FAERS | |
| 139 | Pneumonia | FAERS: 1 | US FAERS | |
| 140 | Product contamination physical | FAERS: 1 | US FAERS | |
| 141 | Product deposit | FAERS: 1 | US FAERS | |
| 142 | Product physical issue | FAERS: 1 | US FAERS | |
| 143 | Product quality issue | FAERS: 1 | US FAERS | |
| 144 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 145 | Productive Cough | FAERS: 1 | US FAERS | |
| 146 | Protein total decreased | FAERS: 1 | US FAERS | |
| 147 | Pyoderma | FAERS: 1 | US FAERS | |
| 148 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 149 | Respiratory distress | FAERS: 1 | US FAERS | |
| 150 | Retching | FAERS: 1 | US FAERS | |
| 151 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 152 | Serum Sickness | FAERS: 1 | US FAERS | |
| 153 | Shock | FAERS: 1 | US FAERS | |
| 154 | Splenomegaly | FAERS: 1 | US FAERS | |
| 155 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 156 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 157 | Therapy cessation | FAERS: 1 | US FAERS | |
| 158 | Therapy change | FAERS: 1 | US FAERS | |
| 159 | Throat irritation | FAERS: 1 | US FAERS | |
| 160 | Thrombosis | FAERS: 1 | US FAERS | |
| 161 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 162 | Troponin increased | FAERS: 1 | US FAERS | |
| 163 | Urinary Retention | FAERS: 1 | US FAERS | |
| 164 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 165 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 166 | Vomiting | FAERS: 1 | US FAERS | |
| 167 | Wound Infection | FAERS: 1 | US FAERS | |
| 168 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 169 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.