GS-7340
(LDEKQSIMHVQZJK-CAQYMETFSA-N)
Structure
- SMILES
- C[C@H](Cn1cnc2c1ncnc2N)OC[P@@](=O)(N[C@H](C(=O)OC(C)C)C)Oc1ccccc1
- Type(s)
- Approved
- ATC code(s)
- J05AF13; J05AR17; J05AR18; J05AR19; J05AR20; J05AR22
- Molecular Formula:
- C21H29N6O5P
- Molecular Weight:
- 476.466
- Log P:
- 3.9450
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 2
- TPSA:
- 153.29
- CAS Number(s):
- 379270-37-8; 383365-04-6
Synonym(s)
1.
GS-7340
2.
tenofovir alafenamide
3.
vemlidy
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 22 | US FAERS | |
| 2 | Headache | FAERS: 18 | US FAERS | |
| 3 | Arthralgia | FAERS: 16 | US FAERS | |
| 4 | Intentional dose omission | FAERS: 16 | US FAERS | |
| 5 | Product dose omission | FAERS: 16 | US FAERS | |
| 6 | Nausea | FAERS: 13 | US FAERS | |
| 7 | Back Pain | FAERS: 11 | US FAERS | |
| 8 | Dizziness | FAERS: 10 | US FAERS | |
| 9 | Pruritus | FAERS: 10 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 11 | Drug dose omission | FAERS: 8 | US FAERS | |
| 12 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 13 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 14 | Asthenia | FAERS: 5 | US FAERS | |
| 15 | Chest discomfort | FAERS: 5 | US FAERS | |
| 16 | Drug ineffective | FAERS: 5 | US FAERS | |
| 17 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 18 | Pain | FAERS: 5 | US FAERS | |
| 19 | Product storage error | FAERS: 5 | US FAERS | |
| 20 | Therapy cessation | FAERS: 5 | US FAERS | |
| 21 | Viral load increased | FAERS: 5 | US FAERS | |
| 22 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 23 | Bone pain | FAERS: 4 | US FAERS | |
| 24 | Myalgia | FAERS: 4 | US FAERS | |
| 25 | Product dispensing error | FAERS: 4 | US FAERS | |
| 26 | Arthropathy | FAERS: 3 | US FAERS | |
| 27 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 28 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 30 | Chromaturia | FAERS: 3 | US FAERS | |
| 31 | Dysgeusia | FAERS: 3 | US FAERS | |
| 32 | Flushing | FAERS: 3 | US FAERS | |
| 33 | Hepatitis B DNA increased | FAERS: 3 | US FAERS | |
| 34 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 35 | Malaise | FAERS: 3 | US FAERS | |
| 36 | Memory impairment | FAERS: 3 | US FAERS | |
| 37 | No adverse event | FAERS: 3 | US FAERS | |
| 38 | Product use complaint | FAERS: 3 | US FAERS | |
| 39 | Product use issue | FAERS: 3 | US FAERS | |
| 40 | Somnolence | FAERS: 3 | US FAERS | |
| 41 | Vomiting | FAERS: 3 | US FAERS | |
| 42 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 43 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 44 | Alopecia | FAERS: 2 | US FAERS | |
| 45 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 46 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 47 | Chemotherapy | FAERS: 2 | US FAERS | |
| 48 | Chills | FAERS: 2 | US FAERS | |
| 49 | Completed Suicide | FAERS: 2 | US FAERS | |
| 50 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 51 | Depressed mood | FAERS: 2 | US FAERS | |
| 52 | Dry skin | FAERS: 2 | US FAERS | |
| 53 | Emergency Care | FAERS: 2 | US FAERS | |
| 54 | Exposure via body fluid | FAERS: 2 | US FAERS | |
| 55 | Extra dose administered | FAERS: 2 | US FAERS | |
| 56 | Hepatitis B DNA assay positive | FAERS: 2 | US FAERS | |
| 57 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 58 | Infection | FAERS: 2 | US FAERS | |
| 59 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 60 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 61 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 62 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 63 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 64 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 65 | Pneumonia | FAERS: 2 | US FAERS | |
| 66 | Product counterfeit | FAERS: 2 | US FAERS | |
| 67 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 68 | Transaminases increased | FAERS: 2 | US FAERS | |
| 69 | Tremor | FAERS: 2 | US FAERS | |
| 70 | Unevaluable event | FAERS: 2 | US FAERS | |
| 71 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 72 | Acne | FAERS: 1 | US FAERS | |
| 73 | Ammonia increased | FAERS: 1 | US FAERS | |
| 74 | Amnesia | FAERS: 1 | US FAERS | |
| 75 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 76 | Apathy | FAERS: 1 | US FAERS | |
| 77 | Arterial graft | FAERS: 1 | US FAERS | |
| 78 | Arthritis | FAERS: 1 | US FAERS | |
| 79 | Asthma | FAERS: 1 | US FAERS | |
| 80 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 81 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 82 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 83 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 84 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 85 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 86 | Bone density decreased | FAERS: 1 | US FAERS | |
| 87 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 88 | Brain Contusion | FAERS: 1 | US FAERS | |
| 89 | Burning sensation | FAERS: 1 | US FAERS | |
| 90 | Compression fracture | FAERS: 1 | US FAERS | |
| 91 | Constipation | FAERS: 1 | US FAERS | |
| 92 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 93 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 94 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 95 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 96 | Drug resistance | FAERS: 1 | US FAERS | |
| 97 | Dysuria | FAERS: 1 | US FAERS | |
| 98 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 99 | Epistaxis | FAERS: 1 | US FAERS | |
| 100 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 101 | Erythema | FAERS: 1 | US FAERS | |
| 102 | Evans syndrome | FAERS: 1 | US FAERS | |
| 103 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 104 | Feeling jittery | FAERS: 1 | US FAERS | |
| 105 | Flatulence | FAERS: 1 | US FAERS | |
| 106 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 107 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 108 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 109 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 110 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 111 | Hepatic cancer stage III | FAERS: 1 | US FAERS | |
| 112 | Hepatitis B e antigen positive | FAERS: 1 | US FAERS | |
| 113 | Hepatitis B | FAERS: 1 | US FAERS | |
| 114 | Hepatitis C | FAERS: 1 | US FAERS | |
| 115 | Hepatitis | FAERS: 1 | US FAERS | |
| 116 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 117 | Hypophagia | FAERS: 1 | US FAERS | |
| 118 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 119 | Influenza | FAERS: 1 | US FAERS | |
| 120 | Joint swelling | FAERS: 1 | US FAERS | |
| 121 | Laziness | FAERS: 1 | US FAERS | |
| 122 | Limb discomfort | FAERS: 1 | US FAERS | |
| 123 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 124 | Lymphoma | FAERS: 1 | US FAERS | |
| 125 | Marasmus | FAERS: 1 | US FAERS | |
| 126 | Mastectomy | FAERS: 1 | US FAERS | |
| 127 | Muscle tightness | FAERS: 1 | US FAERS | |
| 128 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 129 | Oral pain | FAERS: 1 | US FAERS | |
| 130 | Palpitations | FAERS: 1 | US FAERS | |
| 131 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 132 | Pancreatitis | FAERS: 1 | US FAERS | |
| 133 | Paternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 134 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 135 | Poisoning | FAERS: 1 | US FAERS | |
| 136 | Premature Menopause | FAERS: 1 | US FAERS | |
| 137 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 138 | Product container issue | FAERS: 1 | US FAERS | |
| 139 | Product container seal issue | FAERS: 1 | US FAERS | |
| 140 | Product physical issue | FAERS: 1 | US FAERS | |
| 141 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 142 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 143 | Renal pain | FAERS: 1 | US FAERS | |
| 144 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 145 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 146 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 147 | Sneezing | FAERS: 1 | US FAERS | |
| 148 | Stomatitis | FAERS: 1 | US FAERS | |
| 149 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 150 | Syncope | FAERS: 1 | US FAERS | |
| 151 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 152 | Therapy change | FAERS: 1 | US FAERS | |
| 153 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 154 | Thrombosis | FAERS: 1 | US FAERS | |
| 155 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 156 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 157 | Urticaria | FAERS: 1 | US FAERS | |
| 158 | Weight decreased | FAERS: 1 | US FAERS | |
| 159 | Wrong product administered | FAERS: 1 | US FAERS | |
| 160 | jaundice | FAERS: 1 | US FAERS | |
| 161 | treatment failure | FAERS: 1 | US FAERS | |
| 162 | Product substitution issue | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.