Rabeprazole
(KRCQSTCYZUOBHN-UHFFFAOYSA-N)
Structure
- SMILES
- COCCCOc1ccnc(c1C)CS(=O)c1[n-]c2c(n1)cccc2.[Na+]
- Molecular Formula:
- C18H20N3NaO3S
- Molecular Weight:
- 381.424
- Log P:
- 3.4842
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 93.41
- CAS Number(s):
- 117976-90-6
Synonym(s)
1.
Rabeprazole
2.
1H-Benzimidazole, 2-(((4-(3-methoxypropoxy)-3-methyl-2-pyridinyl)methyl)sulfinyl)-, Sodium Salt
3.
2-((4-(3-methoxypropoxy)-3-methylpyridin-2-yl)methylsulfinyl)-1H-benzimidazole
4.
Aciphex
5.
Dexrabeprazole
6.
E 3810
7.
E3810
8.
LY-307640
9.
LY307640
10.
Pariet
11.
Rabeprazole Sodium
12.
LY 307640
13.
Sodium, Rabeprazole
External Link(s)
| MeSH | D064750 |
| PubChem Compound | 14720269 |
| BindingDB | 50247881 |
| ChEBI | 8769 |
| CHEMBL | CHEMBL1200930 |
| KEGG | cpd:C07865 dr:D00724 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 14 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 13 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 9 | US FAERS | |
| 4 | Fatigue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Dizziness | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Erythema Multiforme | FAERS: 7 | US FAERS | |
| 7 | Arthralgia | FAERS: 6 | US FAERS | |
| 8 | Asthenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Dyspepsia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 6 | US FAERS | |
| 11 | Myalgia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Nausea | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Somnolence | FAERS: 6 | US FAERS | |
| 14 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Vomiting | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Abdominal Pain | FAERS: 5 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 17 | Pain | FAERS: 5 | US FAERS | |
| 18 | Product substitution issue | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Chest Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Dysphonia | FAERS: 4 | US FAERS | |
| 21 | Product quality issue | FAERS: 4 | US FAERS | |
| 22 | Suicide attempt | FAERS: 4 | US FAERS | |
| 23 | Tinnitus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Urticaria | FAERS: 4 | US FAERS | |
| 25 | Vertigo | FAERS: 4 | US FAERS | |
| 26 | Agitation | FAERS: 3 | US FAERS | |
| 27 | Amnesia | FAERS: 3 | US FAERS | |
| 28 | Asthma | FAERS: 3 | US FAERS | |
| 29 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 30 | Epistaxis | FAERS: 3 | US FAERS | |
| 31 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 33 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 34 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 35 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 36 | Palpitations | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Pancreatitis | FAERS: 3 | US FAERS | |
| 38 | Pancytopenia | FAERS: 3 | US FAERS | |
| 39 | Pneumonia | FAERS: 3 | US FAERS | |
| 40 | Pregnancy | FAERS: 3 | US FAERS | |
| 41 | Throat irritation | FAERS: 3 | US FAERS | |
| 42 | Upper airway obstruction | FAERS: 3 | US FAERS | |
| 43 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 44 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 45 | Anxiety | FAERS: 2 | US FAERS | |
| 46 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 47 | Burning sensation | FAERS: 2 | US FAERS | |
| 48 | Chills | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Constipation | FAERS: 2 | US FAERS | |
| 50 | Cystitis | FAERS: 2 | US FAERS | |
| 51 | Delirium | FAERS: 2 | US FAERS | |
| 52 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 53 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 54 | Flatulence | FAERS: 2 | US FAERS | |
| 55 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 56 | Memory impairment | FAERS: 2 | US FAERS | |
| 57 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 58 | Pruritus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 60 | Tachycardia | FAERS: 2 | US FAERS | |
| 61 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 62 | Tremor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Weight decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Abdominal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 66 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 67 | Ageusia | FAERS: 1 | US FAERS | |
| 68 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 69 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 70 | Anosmia | FAERS: 1 | US FAERS | |
| 71 | Ataxia | FAERS: 1 | US FAERS | |
| 72 | Bedridden | FAERS: 1 | US FAERS | |
| 73 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 74 | Blood chromogranin A increased | FAERS: 1 | US FAERS | |
| 75 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 76 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 77 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 78 | Blood urea increased | FAERS: 1 | US FAERS | |
| 79 | Bone density decreased | FAERS: 1 | US FAERS | |
| 80 | Breast tenderness | FAERS: 1 | US FAERS | |
| 81 | Bronchitis | FAERS: 1 | US FAERS | |
| 82 | Bronchospasm | FAERS: 1 | US FAERS | |
| 83 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 84 | Cataract | FAERS: 1 | US FAERS | |
| 85 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 86 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 87 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 88 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 89 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 90 | Disease recurrence | FAERS: 1 | US FAERS | |
| 91 | Drug abuser | FAERS: 1 | US FAERS | |
| 92 | Drug diversion | FAERS: 1 | US FAERS | |
| 93 | Drug screen positive | FAERS: 1 | US FAERS | |
| 94 | Dysgeusia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Dysuria | FAERS: 1 | US FAERS | |
| 96 | Eczema | FAERS: 1 | US FAERS | |
| 97 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 98 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 99 | Eructation | FAERS: 1 | US FAERS | |
| 100 | Erythema | FAERS: 1 | US FAERS | |
| 101 | Erythropenia | FAERS: 1 | US FAERS | |
| 102 | Expired drug administered | FAERS: 1 | US FAERS | |
| 103 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 104 | Food aversion | FAERS: 1 | US FAERS | |
| 105 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 106 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 107 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 108 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 109 | Hepatitis A | FAERS: 1 | US FAERS | |
| 110 | Hypereosinophilic syndrome | FAERS: 1 | US FAERS | |
| 111 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 112 | Hypoxia | FAERS: 1 | US FAERS | |
| 113 | Impaired gastric emptying | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 115 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 116 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 117 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 118 | Leukopenia | FAERS: 1 | US FAERS | |
| 119 | Ligament rupture | FAERS: 1 | US FAERS | |
| 120 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 121 | Meniscus injury | FAERS: 1 | US FAERS | |
| 122 | Mood swings | FAERS: 1 | US FAERS | |
| 123 | Multiple allergies | FAERS: 1 | US FAERS | |
| 124 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 125 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 126 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 127 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 128 | Neuritis | FAERS: 1 | US FAERS | |
| 129 | Neutropenia | FAERS: 1 | US FAERS | |
| 130 | Osteoporosis | FAERS: 1 | US FAERS | |
| 131 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 132 | Paranoia | FAERS: 1 | US FAERS | |
| 133 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 134 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 135 | Pharyngitis | FAERS: 1 | US FAERS | |
| 136 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 137 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 138 | Productive Cough | FAERS: 1 | US FAERS | |
| 139 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 140 | Restlessness | FAERS: 1 | US FAERS | |
| 141 | Retinal Detachment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 143 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 144 | Schizophrenia | FAERS: 1 | US FAERS | |
| 145 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 146 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 147 | Sopor | FAERS: 1 | US FAERS | |
| 148 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 149 | Swelling | FAERS: 1 | US FAERS | |
| 150 | Syncope | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Unemployment | FAERS: 1 | US FAERS | |
| 152 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 153 | Vitreous floaters | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Aspartate Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 155 | Back Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 156 | Clostridium difficile colitis | Canada Vigilance: 2 | Canada Vigilance | |
| 157 | Enteritis | Canada Vigilance: 1 | Canada Vigilance | |
| 158 | Feeling Cold | Canada Vigilance: 1 | Canada Vigilance | |
| 159 | Hepatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 160 | Vitreous Detachment | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.