Simbrinza
(KAKYNGJFPXFCDD-PPHPATTJSA-N)
Structure
- SMILES
- Brc1c(ccc2c1nccn2)NC1=NCCN1.COCCCN1C[C@H](NCC)c2c(S1(=O)=O)sc(c2)S(=O)(=O)N
- Molecular Formula:
- C23H31BrN8O5S3
- Molecular Weight:
- 675.642
- Log P:
- 4.8784
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 4
- TPSA:
- 226
- CAS Number(s):
- N/A
Synonym(s)
1.
Simbrinza
External Link(s)
| PubChem Compound | 9961469 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 139 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Eye allergy | FAERS: 76 | US FAERS | |
| 4 | Eye pain | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Hypersensitivity | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Glaucoma | FAERS: 27 | US FAERS | |
| 8 | Therapy partial responder | FAERS: 25 | US FAERS | |
| 9 | Ocular discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | No adverse event | FAERS: 23 | US FAERS | |
| 11 | Visual Impairment | FAERS: 23 | US FAERS | |
| 12 | Uveitis | FAERS: 19 | US FAERS | |
| 13 | Headache | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Blindness | FAERS: 17 | US FAERS | |
| 15 | Fatigue | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Somnolence | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Hypotension | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Conjunctivitis | FAERS: 14 | US FAERS | |
| 19 | Product quality issue | FAERS: 13 | US FAERS | |
| 20 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 21 | Product dropper issue | FAERS: 12 | US FAERS | |
| 22 | Dysgeusia | FAERS: 10 | US FAERS | |
| 23 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 24 | Cataract | FAERS: 9 | US FAERS | |
| 25 | Intraocular pressure fluctuation | FAERS: 9 | US FAERS | |
| 26 | Medication residue present | FAERS: 9 | US FAERS | |
| 27 | Expired product administered | FAERS: 8 | US FAERS | |
| 28 | Malabsorption from application site | FAERS: 8 | US FAERS | |
| 29 | Malaise | FAERS: 8 | US FAERS | |
| 30 | Asthenia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Feeling abnormal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Foreign body sensation in eyes | FAERS: 7 | US FAERS | |
| 33 | Liquid product physical issue | FAERS: 7 | US FAERS | |
| 34 | Nausea | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Photophobia | FAERS: 7 | US FAERS | |
| 36 | Product physical consistency issue | FAERS: 7 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Asthma | FAERS: 6 | US FAERS | |
| 39 | Drug administration error | FAERS: 6 | US FAERS | |
| 40 | Eye inflammation | FAERS: 6 | US FAERS | |
| 41 | Product container issue | FAERS: 6 | US FAERS | |
| 42 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 43 | Eyelid margin crusting | FAERS: 5 | US FAERS | |
| 44 | Ocular surface disease | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Alopecia | FAERS: 4 | US FAERS | |
| 46 | Bronchitis | FAERS: 4 | US FAERS | |
| 47 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 48 | Chest Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Dementia | FAERS: 4 | US FAERS | |
| 50 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 51 | Pain | FAERS: 4 | US FAERS | |
| 52 | Pruritus | FAERS: 4 | US FAERS | |
| 53 | Amnesia | FAERS: 3 | US FAERS | |
| 54 | Angioedema | FAERS: 3 | US FAERS | |
| 55 | Anxiety | FAERS: 3 | US FAERS | |
| 56 | Cardiac dysfunction | FAERS: 3 | US FAERS | |
| 57 | Chromatopsia | FAERS: 3 | US FAERS | |
| 58 | Concomitant disease aggravated | FAERS: 3 | US FAERS | |
| 59 | Eyelid irritation | FAERS: 3 | US FAERS | |
| 60 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 61 | Inflammation | FAERS: 3 | US FAERS | |
| 62 | Intraocular pressure test abnormal | FAERS: 3 | US FAERS | |
| 63 | Lethargy | FAERS: 3 | US FAERS | |
| 64 | Memory impairment | FAERS: 3 | US FAERS | |
| 65 | Myalgia | FAERS: 3 | US FAERS | |
| 66 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 67 | Palpitations | FAERS: 3 | US FAERS | |
| 68 | Presyncope | FAERS: 3 | US FAERS | |
| 69 | Product administration error | FAERS: 3 | US FAERS | |
| 70 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 71 | Productive Cough | FAERS: 3 | US FAERS | |
| 72 | Punctate keratitis | FAERS: 3 | US FAERS | |
| 73 | Tremor | FAERS: 3 | US FAERS | |
| 74 | Vertigo | FAERS: 3 | US FAERS | |
| 75 | Wheezing | FAERS: 3 | US FAERS | |
| 76 | Apathy | FAERS: 2 | US FAERS | |
| 77 | Arthritis | FAERS: 2 | US FAERS | |
| 78 | Back Pain | FAERS: 2 | US FAERS | |
| 79 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 80 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 81 | Depressed mood | FAERS: 2 | US FAERS | |
| 82 | Diplegia | FAERS: 2 | US FAERS | |
| 83 | Discomfort | FAERS: 2 | US FAERS | |
| 84 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 85 | Dyspepsia | FAERS: 2 | US FAERS | |
| 86 | Epistaxis | FAERS: 2 | US FAERS | |
| 87 | Eructation | FAERS: 2 | US FAERS | |
| 88 | Eye Infection | FAERS: 2 | US FAERS | |
| 89 | Eyelid rash | FAERS: 2 | US FAERS | |
| 90 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 91 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 92 | Iritis | FAERS: 2 | US FAERS | |
| 93 | Keratic precipitates | FAERS: 2 | US FAERS | |
| 94 | Keratitis | FAERS: 2 | US FAERS | |
| 95 | Limb discomfort | FAERS: 2 | US FAERS | |
| 96 | Macular degeneration | FAERS: 2 | US FAERS | |
| 97 | Musculoskeletal Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 99 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 100 | Overdose | FAERS: 2 | US FAERS | |
| 101 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 102 | Product leakage | FAERS: 2 | US FAERS | |
| 103 | Product residue present | FAERS: 2 | US FAERS | |
| 104 | Product storage error | FAERS: 2 | US FAERS | |
| 105 | Product use complaint | FAERS: 2 | US FAERS | |
| 106 | Product use issue | FAERS: 2 | US FAERS | |
| 107 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 108 | Suspected transmission of an infectious agent via product | FAERS: 2 | US FAERS | |
| 109 | Syncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Tachycardia | FAERS: 2 | US FAERS | |
| 111 | Throat irritation | FAERS: 2 | US FAERS | |
| 112 | Tinnitus | FAERS: 2 | US FAERS | |
| 113 | Urticaria | FAERS: 2 | US FAERS | |
| 114 | Vomiting | FAERS: 2 | US FAERS | |
| 115 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 116 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 117 | Administration site discomfort | FAERS: 1 | US FAERS | |
| 118 | Adverse event | FAERS: 1 | US FAERS | |
| 119 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 120 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 121 | Aneurysm | FAERS: 1 | US FAERS | |
| 122 | Anger | FAERS: 1 | US FAERS | |
| 123 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 124 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 125 | Arthralgia | FAERS: 1 | US FAERS | |
| 126 | Asthenopia | FAERS: 1 | US FAERS | |
| 127 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 128 | Aura | FAERS: 1 | US FAERS | |
| 129 | Blepharitis | FAERS: 1 | US FAERS | |
| 130 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 131 | Bradycardia | FAERS: 1 | US FAERS | |
| 132 | Burning sensation | FAERS: 1 | US FAERS | |
| 133 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 134 | Choking sensation | FAERS: 1 | US FAERS | |
| 135 | Choking | FAERS: 1 | US FAERS | |
| 136 | Constipation | FAERS: 1 | US FAERS | |
| 137 | Corneal erosion | FAERS: 1 | US FAERS | |
| 138 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 139 | Corneal lesion | FAERS: 1 | US FAERS | |
| 140 | Corneal thickening | FAERS: 1 | US FAERS | |
| 141 | Deafness | FAERS: 1 | US FAERS | |
| 142 | Dehydration | FAERS: 1 | US FAERS | |
| 143 | Dental caries | FAERS: 1 | US FAERS | |
| 144 | Dermatitis | FAERS: 1 | US FAERS | |
| 145 | Diplopia | FAERS: 1 | US FAERS | |
| 146 | Disorientation | FAERS: 1 | US FAERS | |
| 147 | Ear discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Epilepsy | FAERS: 1 | US FAERS | |
| 149 | Exophthalmos | FAERS: 1 | US FAERS | |
| 150 | Eye Burns | FAERS: 1 | US FAERS | |
| 151 | Eyelash changes | FAERS: 1 | US FAERS | |
| 152 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 153 | Flatulence | FAERS: 1 | US FAERS | |
| 154 | Flushing | FAERS: 1 | US FAERS | |
| 155 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 156 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 157 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 158 | Head discomfort | FAERS: 1 | US FAERS | |
| 159 | Hypersomnia | FAERS: 1 | US FAERS | |
| 160 | Ileus | FAERS: 1 | US FAERS | |
| 161 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 162 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 163 | Infection | FAERS: 1 | US FAERS | |
| 164 | Influenza | FAERS: 1 | US FAERS | |
| 165 | Instillation site pruritus | FAERS: 1 | US FAERS | |
| 166 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 167 | Joint swelling | FAERS: 1 | US FAERS | |
| 168 | Laryngitis | FAERS: 1 | US FAERS | |
| 169 | Limb injury | FAERS: 1 | US FAERS | |
| 170 | Lip swelling | FAERS: 1 | US FAERS | |
| 171 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 172 | Monoplegia | FAERS: 1 | US FAERS | |
| 173 | Mood swings | FAERS: 1 | US FAERS | |
| 174 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 175 | Mydriasis | FAERS: 1 | US FAERS | |
| 176 | Neck Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Nerve injury | FAERS: 1 | US FAERS | |
| 178 | Oral pain | FAERS: 1 | US FAERS | |
| 179 | Overweight | FAERS: 1 | US FAERS | |
| 180 | Pain of skin | FAERS: 1 | US FAERS | |
| 181 | Pemphigus | FAERS: 1 | US FAERS | |
| 182 | Pneumothorax | FAERS: 1 | US FAERS | |
| 183 | Product label issue | FAERS: 1 | US FAERS | |
| 184 | Product packaging issue | FAERS: 1 | US FAERS | |
| 185 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 186 | Product tampering | FAERS: 1 | US FAERS | |
| 187 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 188 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 189 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 190 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 191 | Retinal scar | FAERS: 1 | US FAERS | |
| 192 | Shock | FAERS: 1 | US FAERS | |
| 193 | Sinus pain | FAERS: 1 | US FAERS | |
| 194 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 195 | Stress | FAERS: 1 | US FAERS | |
| 196 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 197 | Suicide attempt | FAERS: 1 | US FAERS | |
| 198 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 199 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 200 | Symblepharon | FAERS: 1 | US FAERS | |
| 201 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 202 | Thirst | FAERS: 1 | US FAERS | |
| 203 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 204 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 205 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 206 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 207 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 208 | Weight decreased | FAERS: 1 | US FAERS | |
| 209 | nervous system disorder | FAERS: 1 | US FAERS | |
| 210 | Intraocular pressure test | Canada Vigilance: 1 | Canada Vigilance | |
| 211 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.