Ganfort
(ISZJXIYRLAGBMH-IQMDKZJJSA-N)
Structure
- SMILES
- O[C@H](COc1nsnc1N1CCOCC1)CNC(C)(C)C.CCNC(=O)CCC/C=C\CC1C(O)CC([C@@H]1/C=C/C(CCc1ccccc1)O)O
- Molecular Formula:
- C38H61N5O7S
- Molecular Weight:
- 731.985
- Log P:
- 4.4962
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 6
- TPSA:
- 197.77
- CAS Number(s):
- 946163-60-6
Synonym(s)
1.
Ganfort
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Amnesia | FAERS: 7 | US FAERS | |
| 2 | Eye pain | FAERS: 6 | US FAERS | |
| 3 | Vertigo | FAERS: 6 | US FAERS | |
| 4 | Dizziness | FAERS: 5 | US FAERS | |
| 5 | Eye irritation | FAERS: 5 | US FAERS | |
| 6 | Headache | FAERS: 5 | US FAERS | |
| 7 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 8 | Asthma | FAERS: 3 | US FAERS | |
| 9 | Cataract | FAERS: 3 | US FAERS | |
| 10 | Diplopia | FAERS: 3 | US FAERS | |
| 11 | Uveitis | FAERS: 3 | US FAERS | |
| 12 | Aphasia | FAERS: 2 | US FAERS | |
| 13 | Blindness | FAERS: 2 | US FAERS | |
| 14 | Bradycardia | FAERS: 2 | US FAERS | |
| 15 | Choroidal Detachment | FAERS: 2 | US FAERS | |
| 16 | Fatigue | FAERS: 2 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 18 | Glaucoma | FAERS: 2 | US FAERS | |
| 19 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 20 | Lymphoma | FAERS: 2 | US FAERS | |
| 21 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 22 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 23 | Skin necrosis | FAERS: 2 | US FAERS | |
| 24 | Stomatitis | FAERS: 2 | US FAERS | |
| 25 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 26 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 27 | Asthenia | FAERS: 1 | US FAERS | |
| 28 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 29 | Bronchospasm | FAERS: 1 | US FAERS | |
| 30 | Burning sensation | FAERS: 1 | US FAERS | |
| 31 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 32 | Chest Pain | FAERS: 1 | US FAERS | |
| 33 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 34 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 35 | Dementia | FAERS: 1 | US FAERS | |
| 36 | Discomfort | FAERS: 1 | US FAERS | |
| 37 | Dissociation | FAERS: 1 | US FAERS | |
| 38 | Epistaxis | FAERS: 1 | US FAERS | |
| 39 | Exophthalmos | FAERS: 1 | US FAERS | |
| 40 | Eye allergy | FAERS: 1 | US FAERS | |
| 41 | Eyelid dermatochalasis | FAERS: 1 | US FAERS | |
| 42 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 43 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 44 | Growth of eyelashes | FAERS: 1 | US FAERS | |
| 45 | Head discomfort | FAERS: 1 | US FAERS | |
| 46 | Hepatitis | FAERS: 1 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 48 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 49 | Infection | FAERS: 1 | US FAERS | |
| 50 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 51 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 52 | Iris hyperpigmentation | FAERS: 1 | US FAERS | |
| 53 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 54 | Macular degeneration | FAERS: 1 | US FAERS | |
| 55 | Memory impairment | FAERS: 1 | US FAERS | |
| 56 | Myalgia | FAERS: 1 | US FAERS | |
| 57 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 58 | Periorbital fat atrophy | FAERS: 1 | US FAERS | |
| 59 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 60 | Presbyopia | FAERS: 1 | US FAERS | |
| 61 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 62 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 63 | Retinal scar | FAERS: 1 | US FAERS | |
| 64 | Rhinitis | FAERS: 1 | US FAERS | |
| 65 | Schizophrenia | FAERS: 1 | US FAERS | |
| 66 | Somnolence | FAERS: 1 | US FAERS | |
| 67 | Symptom masked | FAERS: 1 | US FAERS | |
| 68 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 69 | Tinnitus | FAERS: 1 | US FAERS | |
| 70 | Trabeculectomy | FAERS: 1 | US FAERS | |
| 71 | Visual Impairment | FAERS: 1 | US FAERS | |
| 72 | Vitreous opacities | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.