Senna Extract
(IPQVTOJGNYVQEO-KGFNBKMBSA-N)
Structure
- SMILES
- OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c([C@@H]3[C@H]3c4cc(cc(c4C(=O)c4c3cccc4O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O)C(=O)O)cc(cc2O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O
- Molecular Formula:
- C42H38O20
- Molecular Weight:
- 862.739
- Log P:
- -1.0956
- Hydrogen Bond Acceptor:
- 20
- Hydrogen Bond Donor:
- 12
- TPSA:
- 347.96
- CAS Number(s):
- 81-27-6; 8013-11-4; 85085-71-8
Synonym(s)
1.
Senna Extract
2.
Extract, Senna
External Link(s)
| MeSH | D012676 |
| PubChem Compound | 73111 |
| BindingDB | 92481 |
| ChEBI | 9112 |
| CHEMBL | CHEMBL2368547 |
| KEGG | cpd:C10404 |
| Therapeutic Target Database | D0Z2LG |
| ZINC | 169296903 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug Dependence | FAERS: 8 | US FAERS | |
| 2 | Constipation | FAERS: 7 Canada Vigilance: 3 | 20699592 | CTD Canada Vigilance US FAERS |
| 3 | Drug ineffective | FAERS: 6 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 5 | US FAERS | |
| 5 | Dehydration | FAERS: 4 | US FAERS | |
| 6 | Flatulence | FAERS: 4 | US FAERS | |
| 7 | Nausea | FAERS: 4 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Asthenia | FAERS: 3 | US FAERS | |
| 10 | Colitis | FAERS: 3 | US FAERS | |
| 11 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 12 | Cholelithiasis obstructive | FAERS: 2 | US FAERS | |
| 13 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 14 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 15 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 16 | Megacolon | FAERS: 2 | US FAERS | |
| 17 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 18 | Product label issue | FAERS: 2 | US FAERS | |
| 19 | Product use issue | FAERS: 2 | US FAERS | |
| 20 | Transmission of an infectious agent via product | FAERS: 2 | US FAERS | |
| 21 | Unevaluable event | FAERS: 2 | US FAERS | |
| 22 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 23 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 24 | Ageusia | FAERS: 1 | US FAERS | |
| 25 | Appendicitis | FAERS: 1 | US FAERS | |
| 26 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 27 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 28 | Burkholderia cepacia complex infection | FAERS: 1 | US FAERS | |
| 29 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 30 | Chromaturia | FAERS: 1 | US FAERS | |
| 31 | Cystitis | FAERS: 1 | US FAERS | |
| 32 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 33 | Discomfort | FAERS: 1 | US FAERS | |
| 34 | Dizziness | FAERS: 1 | US FAERS | |
| 35 | Drug abuse | FAERS: 1 | US FAERS | |
| 36 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 37 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 38 | Dysentery | FAERS: 1 | US FAERS | |
| 39 | Ectopic pregnancy with intrauterine device | FAERS: 1 | US FAERS | |
| 40 | Emotional disorder | FAERS: 1 | US FAERS | |
| 41 | Expired product administered | FAERS: 1 | US FAERS | |
| 42 | Fatigue | FAERS: 1 | US FAERS | |
| 43 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 44 | Food Poisoning | FAERS: 1 | US FAERS | |
| 45 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 46 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 47 | Hepatitis C | FAERS: 1 | US FAERS | |
| 48 | Hypotension | FAERS: 1 | US FAERS | |
| 49 | Implant site infection | FAERS: 1 | US FAERS | |
| 50 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 51 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 52 | Malaise | FAERS: 1 | US FAERS | |
| 53 | Malignant neoplasm progression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 55 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 56 | Overdose | FAERS: 1 | US FAERS | |
| 57 | Pain | FAERS: 1 | US FAERS | |
| 58 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 59 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 60 | Presyncope | FAERS: 1 | US FAERS | |
| 61 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 62 | Product use complaint | FAERS: 1 | US FAERS | |
| 63 | Regurgitation | FAERS: 1 | US FAERS | |
| 64 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 65 | Respiratory distress | FAERS: 1 | US FAERS | |
| 66 | Sciatica | FAERS: 1 | US FAERS | |
| 67 | Shoplifting | FAERS: 1 | US FAERS | |
| 68 | Sinus headache | FAERS: 1 | US FAERS | |
| 69 | Syncope | FAERS: 1 | US FAERS | |
| 70 | Tachycardia | FAERS: 1 | US FAERS | |
| 71 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 72 | Tremor | FAERS: 1 | US FAERS | |
| 73 | Urticaria | FAERS: 1 | US FAERS | |
| 74 | Uterine spasm | FAERS: 1 | US FAERS | |
| 75 | Visual Impairment | FAERS: 1 | US FAERS | |
| 76 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 77 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 78 | Accidental underdose | Canada Vigilance: 1 | Canada Vigilance | |
| 79 | Arthralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 80 | Chest Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 81 | Diarrhea | 20699592 | CTD | |
| 82 | Urine flow decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.