Primaquine
(INDBQLZJXZLFIT-UHFFFAOYSA-N)
Structure
- SMILES
- NCCCC(Nc1cc(OC)cc2c1nccc2)C
- Type(s)
- Approved
- ATC code(s)
- P01BA03
- Molecular Formula:
- C15H21N3O
- Molecular Weight:
- 259.347
- Log P:
- 3.5560
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 60.17
- CAS Number(s):
- 90-34-6
Synonym(s)
1.
Primaquine
2.
Primacin
3.
Primaquine Diphosphate
4.
Primaquine Phosphate
5.
Diphosphate, Primaquine
6.
Phosphate, Primaquine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Acute kidney injury | FAERS: 1 | 7325735 | CTD US FAERS |
| 2 | Drug resistance | FAERS: 1 | US FAERS | |
| 3 | Headache | FAERS: 1 | 5467364 15916292 | CTD US FAERS |
| 4 | Nausea | FAERS: 1 | SIDER US FAERS | |
| 5 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 6 | Vomiting | FAERS: 1 | SIDER US FAERS | |
| 7 | treatment failure | FAERS: 1 | US FAERS | |
| 8 | Abdominal Cramps | SIDER | ||
| 9 | Abdominal Pain | SIDER | ||
| 10 | Alcohol interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 11 | Anemia, Hemolytic | CTD | ||
| 12 | Anemia | 20194698 | CTD | |
| 13 | Angioedema | 5467364 | CTD | |
| 14 | Back Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 15 | Chromaturia | Canada Vigilance: 1 | Canada Vigilance | |
| 16 | Confusion | 7356244 | CTD | |
| 17 | Depressive disorder | 7356244 | CTD | |
| 18 | Drug Eruptions | 5467364 | CTD | |
| 19 | Dyspepsia | SIDER | ||
| 20 | Epigastric distress | SIDER | ||
| 21 | Fatigue | Canada Vigilance: 1 | Canada Vigilance | |
| 22 | Leukopenia | SIDER | ||
| 23 | Long QT Syndrome | 20512476 | CTD | |
| 24 | Malaria, Vivax | 12041544 15916292 | CTD | |
| 25 | Malaria | CTD | ||
| 26 | Methemoglobinemia | 3537620 8757424 11303037 | CTD | |
| 27 | Pruritus | 5467364 | CTD | |
| 28 | Urination Disorders | 15916292 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.